diff options
Diffstat (limited to 'tools')
152 files changed, 6050 insertions, 1446 deletions
diff --git a/tools/arch/arm64/include/asm/cputype.h b/tools/arch/arm64/include/asm/cputype.h index 52f076afeb96..7b32b99023a2 100644 --- a/tools/arch/arm64/include/asm/cputype.h +++ b/tools/arch/arm64/include/asm/cputype.h @@ -86,6 +86,9 @@ #define ARM_CPU_PART_CORTEX_X2 0xD48 #define ARM_CPU_PART_NEOVERSE_N2 0xD49 #define ARM_CPU_PART_CORTEX_A78C 0xD4B +#define ARM_CPU_PART_NEOVERSE_V2 0xD4F +#define ARM_CPU_PART_CORTEX_X4 0xD82 +#define ARM_CPU_PART_NEOVERSE_V3 0xD84 #define APM_CPU_PART_XGENE 0x000 #define APM_CPU_VAR_POTENZA 0x00 @@ -159,6 +162,9 @@ #define MIDR_CORTEX_X2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X2) #define MIDR_NEOVERSE_N2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_N2) #define MIDR_CORTEX_A78C MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A78C) +#define MIDR_NEOVERSE_V2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V2) +#define MIDR_CORTEX_X4 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X4) +#define MIDR_NEOVERSE_V3 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V3) #define MIDR_THUNDERX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX) #define MIDR_THUNDERX_81XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_81XX) #define MIDR_THUNDERX_83XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_83XX) diff --git a/tools/arch/arm64/include/uapi/asm/unistd.h b/tools/arch/arm64/include/uapi/asm/unistd.h index ce2ee8f1e361..9306726337fe 100644 --- a/tools/arch/arm64/include/uapi/asm/unistd.h +++ b/tools/arch/arm64/include/uapi/asm/unistd.h @@ -19,7 +19,6 @@ #define __ARCH_WANT_NEW_STAT #define __ARCH_WANT_SET_GET_RLIMIT #define __ARCH_WANT_TIME32_SYSCALLS -#define __ARCH_WANT_SYS_CLONE3 #define __ARCH_WANT_MEMFD_SECRET #include <asm-generic/unistd.h> diff --git a/tools/arch/loongarch/include/uapi/asm/unistd.h b/tools/arch/loongarch/include/uapi/asm/unistd.h index 0c743344e92d..8eeaac0087c3 100644 --- a/tools/arch/loongarch/include/uapi/asm/unistd.h +++ b/tools/arch/loongarch/include/uapi/asm/unistd.h @@ -4,6 +4,5 @@ */ #define __ARCH_WANT_SYS_CLONE -#define __ARCH_WANT_SYS_CLONE3 #include <asm-generic/unistd.h> diff --git a/tools/arch/x86/include/asm/msr-index.h b/tools/arch/x86/include/asm/msr-index.h index e72c2b872957..e022e6eb766c 100644 --- a/tools/arch/x86/include/asm/msr-index.h +++ b/tools/arch/x86/include/asm/msr-index.h @@ -170,6 +170,10 @@ * CPU is not affected by Branch * History Injection. */ +#define ARCH_CAP_XAPIC_DISABLE BIT(21) /* + * IA32_XAPIC_DISABLE_STATUS MSR + * supported + */ #define ARCH_CAP_PBRSB_NO BIT(24) /* * Not susceptible to Post-Barrier * Return Stack Buffer Predictions. @@ -192,11 +196,6 @@ * File. */ -#define ARCH_CAP_XAPIC_DISABLE BIT(21) /* - * IA32_XAPIC_DISABLE_STATUS MSR - * supported - */ - #define MSR_IA32_FLUSH_CMD 0x0000010b #define L1D_FLUSH BIT(0) /* * Writeback and invalidate the diff --git a/tools/arch/x86/include/uapi/asm/kvm.h b/tools/arch/x86/include/uapi/asm/kvm.h index ef11aa4cab42..9fae1b73b529 100644 --- a/tools/arch/x86/include/uapi/asm/kvm.h +++ b/tools/arch/x86/include/uapi/asm/kvm.h @@ -457,8 +457,13 @@ struct kvm_sync_regs { #define KVM_STATE_VMX_PREEMPTION_TIMER_DEADLINE 0x00000001 -/* attributes for system fd (group 0) */ -#define KVM_X86_XCOMP_GUEST_SUPP 0 +/* vendor-independent attributes for system fd (group 0) */ +#define KVM_X86_GRP_SYSTEM 0 +# define KVM_X86_XCOMP_GUEST_SUPP 0 + +/* vendor-specific groups and attributes for system fd */ +#define KVM_X86_GRP_SEV 1 +# define KVM_X86_SEV_VMSA_FEATURES 0 struct kvm_vmx_nested_state_data { __u8 vmcs12[KVM_STATE_NESTED_VMX_VMCS_SIZE]; @@ -689,6 +694,9 @@ enum sev_cmd_id { /* Guest Migration Extension */ KVM_SEV_SEND_CANCEL, + /* Second time is the charm; improved versions of the above ioctls. */ + KVM_SEV_INIT2, + KVM_SEV_NR_MAX, }; @@ -700,6 +708,14 @@ struct kvm_sev_cmd { __u32 sev_fd; }; +struct kvm_sev_init { + __u64 vmsa_features; + __u32 flags; + __u16 ghcb_version; + __u16 pad1; + __u32 pad2[8]; +}; + struct kvm_sev_launch_start { __u32 handle; __u32 policy; @@ -856,5 +872,7 @@ struct kvm_hyperv_eventfd { #define KVM_X86_DEFAULT_VM 0 #define KVM_X86_SW_PROTECTED_VM 1 +#define KVM_X86_SEV_VM 2 +#define KVM_X86_SEV_ES_VM 3 #endif /* _ASM_X86_KVM_H */ diff --git a/tools/arch/x86/kcpuid/Makefile b/tools/arch/x86/kcpuid/Makefile index 87b554fab14b..d0b4b0ed10ff 100644 --- a/tools/arch/x86/kcpuid/Makefile +++ b/tools/arch/x86/kcpuid/Makefile @@ -19,6 +19,6 @@ clean : @rm -f kcpuid install : kcpuid - install -d $(DESTDIR)$(BINDIR) + install -d $(DESTDIR)$(BINDIR) $(DESTDIR)$(HWDATADIR) install -m 755 -p kcpuid $(DESTDIR)$(BINDIR)/kcpuid - install -m 444 -p cpuid.csv $(HWDATADIR)/cpuid.csv + install -m 444 -p cpuid.csv $(DESTDIR)$(HWDATADIR)/cpuid.csv diff --git a/tools/bpf/resolve_btfids/main.c b/tools/bpf/resolve_btfids/main.c index d9520cb826b3..af393c7dee1f 100644 --- a/tools/bpf/resolve_btfids/main.c +++ b/tools/bpf/resolve_btfids/main.c @@ -728,7 +728,7 @@ static int sets_patch(struct object *obj) static int symbols_patch(struct object *obj) { - int err; + off_t err; if (__symbols_patch(obj, &obj->structs) || __symbols_patch(obj, &obj->unions) || diff --git a/tools/gpio/gpio-sloppy-logic-analyzer.sh b/tools/gpio/gpio-sloppy-logic-analyzer.sh new file mode 100755 index 000000000000..ed21a110df5e --- /dev/null +++ b/tools/gpio/gpio-sloppy-logic-analyzer.sh @@ -0,0 +1,246 @@ +#!/bin/sh -eu +# SPDX-License-Identifier: GPL-2.0 +# +# Helper script for the Linux Kernel GPIO sloppy logic analyzer +# +# Copyright (C) Wolfram Sang <wsa@sang-engineering.com> +# Copyright (C) Renesas Electronics Corporation + +samplefreq=1000000 +numsamples=250000 +cpusetdefaultdir='/sys/fs/cgroup' +cpusetprefix='cpuset.' +debugdir='/sys/kernel/debug' +ladirname='gpio-sloppy-logic-analyzer' +outputdir="$PWD" +neededcmds='taskset zip' +max_chans=8 +duration= +initcpu= +listinstances=0 +lainstance= +lasysfsdir= +triggerdat= +trigger_bindat= +progname="${0##*/}" +print_help() +{ + cat << EOF +$progname - helper script for the Linux Kernel Sloppy GPIO Logic Analyzer +Available options: + -c|--cpu <n>: which CPU to isolate for sampling. Only needed once. Default <1>. + Remember that a more powerful CPU gives you higher sampling speeds. + Also CPU0 is not recommended as it usually does extra bookkeeping. + -d|--duration-us <SI-n>: number of microseconds to sample. Overrides -n, no default value. + -h|--help: print this help + -i|--instance <str>: name of the logic analyzer in case you have multiple instances. Default + to first instance found + -k|--kernel-debug-dir <str>: path to the kernel debugfs mountpoint. Default: <$debugdir> + -l|--list-instances: list all available instances + -n|--num_samples <SI-n>: number of samples to acquire. Default <$numsamples> + -o|--output-dir <str>: directory to put the result files. Default: current dir + -s|--sample_freq <SI-n>: desired sampling frequency. Might be capped if too large. + Default: <1000000> + -t|--trigger <str>: pattern to use as trigger. <str> consists of two-char pairs. First + char is channel number starting at "1". Second char is trigger level: + "L" - low; "H" - high; "R" - rising; "F" - falling + These pairs can be combined with "+", so "1H+2F" triggers when probe 1 + is high while probe 2 has a falling edge. You can have multiple triggers + combined with ",". So, "1H+2F,1H+2R" is like the example before but it + waits for a rising edge on probe 2 while probe 1 is still high after the + first trigger has been met. + Trigger data will only be used for the next capture and then be erased. + +<SI-n> is an integer value where SI units "T", "G", "M", "K" are recognized, e.g. '1M500K' is 1500000. + +Examples: +Samples $numsamples values at 1MHz with an already prepared CPU or automatically prepares CPU1 if needed, +use the first logic analyzer instance found: + '$progname' +Samples 50us at 2MHz waiting for a falling edge on channel 2. CPU and instance as above: + '$progname -d 50 -s 2M -t "2F"' + +Note that the process exits after checking all parameters but a sub-process still works in +the background. The result is only available once the sub-process finishes. + +Result is a .sr file to be consumed with PulseView from the free Sigrok project. It is +a zip file which also contains the binary sample data which may be consumed by others. +The filename is the logic analyzer instance name plus a since-epoch timestamp. +EOF +} + +fail() +{ + echo "$1" + exit 1 +} + +parse_si() +{ + conv_si="$(printf $1 | sed 's/[tT]+\?/*1000G+/g; s/[gG]+\?/*1000M+/g; s/[mM]+\?/*1000K+/g; s/[kK]+\?/*1000+/g; s/+$//')" + si_val="$((conv_si))" +} +set_newmask() +{ + for f in $(find "$1" -iname "$2"); do echo "$newmask" > "$f" 2>/dev/null || true; done +} + +init_cpu() +{ + isol_cpu="$1" + + [ -d "$lacpusetdir" ] || mkdir "$lacpusetdir" + + cur_cpu=$(cat "${lacpusetfile}cpus") + [ "$cur_cpu" = "$isol_cpu" ] && return + [ -z "$cur_cpu" ] || fail "CPU$isol_cpu requested but CPU$cur_cpu already isolated" + + echo "$isol_cpu" > "${lacpusetfile}cpus" || fail "Could not isolate CPU$isol_cpu. Does it exist?" + echo 1 > "${lacpusetfile}cpu_exclusive" + echo 0 > "${lacpusetfile}mems" + + oldmask=$(cat /proc/irq/default_smp_affinity) + newmask=$(printf "%x" $((0x$oldmask & ~(1 << isol_cpu)))) + + set_newmask '/proc/irq' '*smp_affinity' + set_newmask '/sys/devices/virtual/workqueue/' 'cpumask' + + # Move tasks away from isolated CPU + for p in $(ps -o pid | tail -n +2); do + mask=$(taskset -p "$p") || continue + # Ignore tasks with a custom mask, i.e. not equal $oldmask + [ "${mask##*: }" = "$oldmask" ] || continue + taskset -p "$newmask" "$p" || continue + done 2>/dev/null >/dev/null + + # Big hammer! Working with 'rcu_momentary_dyntick_idle()' for a more fine-grained solution + # still printed warnings. Same for re-enabling the stall detector after sampling. + echo 1 > /sys/module/rcupdate/parameters/rcu_cpu_stall_suppress + + cpufreqgov="/sys/devices/system/cpu/cpu$isol_cpu/cpufreq/scaling_governor" + [ -w "$cpufreqgov" ] && echo 'performance' > "$cpufreqgov" || true +} + +parse_triggerdat() +{ + oldifs="$IFS" + IFS=','; for trig in $1; do + mask=0; val1=0; val2=0 + IFS='+'; for elem in $trig; do + chan=${elem%[lhfrLHFR]} + mode=${elem#$chan} + # Check if we could parse something and the channel number fits + [ "$chan" != "$elem" ] && [ "$chan" -le $max_chans ] || fail "Trigger syntax error: $elem" + bit=$((1 << (chan - 1))) + mask=$((mask | bit)) + case $mode in + [hH]) val1=$((val1 | bit)); val2=$((val2 | bit));; + [fF]) val1=$((val1 | bit));; + [rR]) val2=$((val2 | bit));; + esac + done + trigger_bindat="$trigger_bindat$(printf '\\%o\\%o' $mask $val1)" + [ $val1 -ne $val2 ] && trigger_bindat="$trigger_bindat$(printf '\\%o\\%o' $mask $val2)" + done + IFS="$oldifs" +} + +do_capture() +{ + taskset "$1" echo 1 > "$lasysfsdir"/capture || fail "Capture error! Check kernel log" + + srtmp=$(mktemp -d) + echo 1 > "$srtmp"/version + cp "$lasysfsdir"/sample_data "$srtmp"/logic-1-1 + cat > "$srtmp"/metadata << EOF +[global] +sigrok version=0.2.0 + +[device 1] +capturefile=logic-1 +total probes=$(wc -l < "$lasysfsdir"/meta_data) +samplerate=${samplefreq}Hz +unitsize=1 +EOF + cat "$lasysfsdir"/meta_data >> "$srtmp"/metadata + + zipname="$outputdir/${lasysfsdir##*/}-$(date +%s).sr" + zip -jq "$zipname" "$srtmp"/* + rm -rf "$srtmp" + delay_ack=$(cat "$lasysfsdir"/delay_ns_acquisition) + [ "$delay_ack" -eq 0 ] && delay_ack=1 + echo "Logic analyzer done. Saved '$zipname'" + echo "Max sample frequency this time: $((1000000000 / delay_ack))Hz." +} + +rep=$(getopt -a -l cpu:,duration-us:,help,instance:,list-instances,kernel-debug-dir:,num_samples:,output-dir:,sample_freq:,trigger: -o c:d:hi:k:ln:o:s:t: -- "$@") || exit 1 +eval set -- "$rep" +while true; do + case "$1" in + -c|--cpu) initcpu="$2"; shift;; + -d|--duration-us) parse_si $2; duration=$si_val; shift;; + -h|--help) print_help; exit 0;; + -i|--instance) lainstance="$2"; shift;; + -k|--kernel-debug-dir) debugdir="$2"; shift;; + -l|--list-instances) listinstances=1;; + -n|--num_samples) parse_si $2; numsamples=$si_val; shift;; + -o|--output-dir) outputdir="$2"; shift;; + -s|--sample_freq) parse_si $2; samplefreq=$si_val; shift;; + -t|--trigger) triggerdat="$2"; shift;; + --) break;; + *) fail "error parsing command line: $*";; + esac + shift +done + +for f in $neededcmds; do + command -v "$f" >/dev/null || fail "Command '$f' not found" +done + +# print cpuset mountpoint if any, errorcode > 0 if noprefix option was found +cpusetdir=$(awk '$3 == "cgroup" && $4 ~ /cpuset/ { print $2; exit (match($4, /noprefix/) > 0) }' /proc/self/mounts) || cpusetprefix='' +if [ -z "$cpusetdir" ]; then + cpusetdir="$cpusetdefaultdir" + [ -d $cpusetdir ] || mkdir $cpusetdir + mount -t cgroup -o cpuset none $cpusetdir || fail "Couldn't mount cpusets. Not in kernel or already in use?" +fi + +lacpusetdir="$cpusetdir/$ladirname" +lacpusetfile="$lacpusetdir/$cpusetprefix" +sysfsdir="$debugdir/$ladirname" + +[ "$samplefreq" -ne 0 ] || fail "Invalid sample frequency" + +[ -d "$sysfsdir" ] || fail "Could not find logic analyzer root dir '$sysfsdir'. Module loaded?" +[ -x "$sysfsdir" ] || fail "Could not access logic analyzer root dir '$sysfsdir'. Need root?" + +[ $listinstances -gt 0 ] && find "$sysfsdir" -mindepth 1 -type d | sed 's|.*/||' && exit 0 + +if [ -n "$lainstance" ]; then + lasysfsdir="$sysfsdir/$lainstance" +else + lasysfsdir=$(find "$sysfsdir" -mindepth 1 -type d -print -quit) +fi +[ -d "$lasysfsdir" ] || fail "Logic analyzer directory '$lasysfsdir' not found!" +[ -d "$outputdir" ] || fail "Output directory '$outputdir' not found!" + +[ -n "$initcpu" ] && init_cpu "$initcpu" +[ -d "$lacpusetdir" ] || { echo "Auto-Isolating CPU1"; init_cpu 1; } + +ndelay=$((1000000000 / samplefreq)) +echo "$ndelay" > "$lasysfsdir"/delay_ns + +[ -n "$duration" ] && numsamples=$((samplefreq * duration / 1000000)) +echo $numsamples > "$lasysfsdir"/buf_size + +if [ -n "$triggerdat" ]; then + parse_triggerdat "$triggerdat" + printf "$trigger_bindat" > "$lasysfsdir"/trigger 2>/dev/null || fail "Trigger data '$triggerdat' rejected" +fi + +workcpu=$(cat "${lacpusetfile}effective_cpus") +[ -n "$workcpu" ] || fail "No isolated CPU found" +cpumask=$(printf '%x' $((1 << workcpu))) +instance=${lasysfsdir##*/} +echo "Setting up '$instance': $numsamples samples at ${samplefreq}Hz with ${triggerdat:-no} trigger using CPU$workcpu" +do_capture "$cpumask" & diff --git a/tools/hv/Makefile b/tools/hv/Makefile index bb52871da341..2e60e2c212cd 100644 --- a/tools/hv/Makefile +++ b/tools/hv/Makefile @@ -17,6 +17,7 @@ endif MAKEFLAGS += -r override CFLAGS += -O2 -Wall -g -D_GNU_SOURCE -I$(OUTPUT)include +override CFLAGS += -Wno-address-of-packed-member ALL_TARGETS := hv_kvp_daemon hv_vss_daemon ifneq ($(ARCH), aarch64) diff --git a/tools/include/nolibc/stdint.h b/tools/include/nolibc/stdint.h index 6665e272e213..cd79ddd6170e 100644 --- a/tools/include/nolibc/stdint.h +++ b/tools/include/nolibc/stdint.h @@ -96,6 +96,10 @@ typedef uint64_t uintmax_t; #define UINT_FAST32_MAX SIZE_MAX #define UINT_FAST64_MAX UINT64_MAX +#define INTMAX_MIN INT64_MIN +#define INTMAX_MAX INT64_MAX +#define UINTMAX_MAX UINT64_MAX + #ifndef INT_MIN #define INT_MIN (-__INT_MAX__ - 1) #endif @@ -110,4 +114,19 @@ typedef uint64_t uintmax_t; #define LONG_MAX __LONG_MAX__ #endif +#ifndef ULONG_MAX +#define ULONG_MAX ((unsigned long)(__LONG_MAX__) * 2 + 1) +#endif + +#ifndef LLONG_MIN +#define LLONG_MIN (-__LONG_LONG_MAX__ - 1) +#endif +#ifndef LLONG_MAX +#define LLONG_MAX __LONG_LONG_MAX__ +#endif + +#ifndef ULLONG_MAX +#define ULLONG_MAX ((unsigned long long)(__LONG_LONG_MAX__) * 2 + 1) +#endif + #endif /* _NOLIBC_STDINT_H */ diff --git a/tools/include/nolibc/stdio.h b/tools/include/nolibc/stdio.h index 16cd4d807251..c968dbbc4ef8 100644 --- a/tools/include/nolibc/stdio.h +++ b/tools/include/nolibc/stdio.h @@ -376,6 +376,16 @@ int setvbuf(FILE *stream __attribute__((unused)), return 0; } +static __attribute__((unused)) +const char *strerror(int errno) +{ + static char buf[18] = "errno="; + + i64toa_r(errno, &buf[6]); + + return buf; +} + /* make sure to include all global symbols */ #include "nolibc.h" diff --git a/tools/include/nolibc/stdlib.h b/tools/include/nolibc/stdlib.h index 5be9d3c7435a..75aa273c23a6 100644 --- a/tools/include/nolibc/stdlib.h +++ b/tools/include/nolibc/stdlib.h @@ -438,6 +438,115 @@ char *u64toa(uint64_t in) return itoa_buffer; } +static __attribute__((unused)) +uintmax_t __strtox(const char *nptr, char **endptr, int base, intmax_t lower_limit, uintmax_t upper_limit) +{ + const char signed_ = lower_limit != 0; + unsigned char neg = 0, overflow = 0; + uintmax_t val = 0, limit, old_val; + char c; + + if (base < 0 || base > 36) { + SET_ERRNO(EINVAL); + goto out; + } + + while (isspace(*nptr)) + nptr++; + + if (*nptr == '+') { + nptr++; + } else if (*nptr == '-') { + neg = 1; + nptr++; + } + + if (signed_ && neg) + limit = -(uintmax_t)lower_limit; + else + limit = upper_limit; + + if ((base == 0 || base == 16) && + (strncmp(nptr, "0x", 2) == 0 || strncmp(nptr, "0X", 2) == 0)) { + base = 16; + nptr += 2; + } else if (base == 0 && strncmp(nptr, "0", 1) == 0) { + base = 8; + nptr += 1; + } else if (base == 0) { + base = 10; + } + + while (*nptr) { + c = *nptr; + + if (c >= '0' && c <= '9') + c -= '0'; + else if (c >= 'a' && c <= 'z') + c = c - 'a' + 10; + else if (c >= 'A' && c <= 'Z') + c = c - 'A' + 10; + else + goto out; + + if (c >= base) + goto out; + + nptr++; + old_val = val; + val *= base; + val += c; + + if (val > limit || val < old_val) + overflow = 1; + } + +out: + if (overflow) { + SET_ERRNO(ERANGE); + val = limit; + } + if (endptr) + *endptr = (char *)nptr; + return neg ? -val : val; +} + +static __attribute__((unused)) +long strtol(const char *nptr, char **endptr, int base) +{ + return __strtox(nptr, endptr, base, LONG_MIN, LONG_MAX); +} + +static __attribute__((unused)) +unsigned long strtoul(const char *nptr, char **endptr, int base) +{ + return __strtox(nptr, endptr, base, 0, ULONG_MAX); +} + +static __attribute__((unused)) +long long strtoll(const char *nptr, char **endptr, int base) +{ + return __strtox(nptr, endptr, base, LLONG_MIN, LLONG_MAX); +} + +static __attribute__((unused)) +unsigned long long strtoull(const char *nptr, char **endptr, int base) +{ + return __strtox(nptr, endptr, base, 0, ULLONG_MAX); +} + +static __attribute__((unused)) +intmax_t strtoimax(const char *nptr, char **endptr, int base) +{ + return __strtox(nptr, endptr, base, INTMAX_MIN, INTMAX_MAX); +} + +static __attribute__((unused)) +uintmax_t strtoumax(const char *nptr, char **endptr, int base) +{ + return __strtox(nptr, endptr, base, 0, UINTMAX_MAX); +} + /* make sure to include all global symbols */ #include "nolibc.h" diff --git a/tools/include/uapi/asm-generic/unistd.h b/tools/include/uapi/asm-generic/unistd.h index 75f00965ab15..a00d53d02723 100644 --- a/tools/include/uapi/asm-generic/unistd.h +++ b/tools/include/uapi/asm-generic/unistd.h @@ -776,12 +776,8 @@ __SYSCALL(__NR_fsmount, sys_fsmount) __SYSCALL(__NR_fspick, sys_fspick) #define __NR_pidfd_open 434 __SYSCALL(__NR_pidfd_open, sys_pidfd_open) - -#ifdef __ARCH_WANT_SYS_CLONE3 #define __NR_clone3 435 __SYSCALL(__NR_clone3, sys_clone3) -#endif - #define __NR_close_range 436 __SYSCALL(__NR_close_range, sys_close_range) #define __NR_openat2 437 @@ -842,8 +838,11 @@ __SYSCALL(__NR_lsm_set_self_attr, sys_lsm_set_self_attr) #define __NR_lsm_list_modules 461 __SYSCALL(__NR_lsm_list_modules, sys_lsm_list_modules) +#define __NR_mseal 462 +__SYSCALL(__NR_mseal, sys_mseal) + #undef __NR_syscalls -#define __NR_syscalls 462 +#define __NR_syscalls 463 /* * 32 bit systems traditionally used different diff --git a/tools/include/uapi/drm/i915_drm.h b/tools/include/uapi/drm/i915_drm.h index 2ee338860b7e..d4d86e566e07 100644 --- a/tools/include/uapi/drm/i915_drm.h +++ b/tools/include/uapi/drm/i915_drm.h @@ -806,6 +806,12 @@ typedef struct drm_i915_irq_wait { */ #define I915_PARAM_PXP_STATUS 58 +/* + * Query if kernel allows marking a context to send a Freq hint to SLPC. This + * will enable use of the strategies allowed by the SLPC algorithm. + */ +#define I915_PARAM_HAS_CONTEXT_FREQ_HINT 59 + /* Must be kept compact -- no holes and well documented */ /** @@ -2148,6 +2154,15 @@ struct drm_i915_gem_context_param { * -EIO: The firmware did not succeed in creating the protected context. */ #define I915_CONTEXT_PARAM_PROTECTED_CONTENT 0xd + +/* + * I915_CONTEXT_PARAM_LOW_LATENCY: + * + * Mark this context as a low latency workload which requires aggressive GT + * frequency scaling. Use I915_PARAM_HAS_CONTEXT_FREQ_HINT to check if the kernel + * supports this per context flag. + */ +#define I915_CONTEXT_PARAM_LOW_LATENCY 0xe /* Must be kept compact -- no holes and well documented */ /** @value: Context parameter value to be set or queried */ @@ -2623,19 +2638,29 @@ struct drm_i915_reg_read { * */ +/* + * struct drm_i915_reset_stats - Return global reset and other context stats + * + * Driver keeps few stats for each contexts and also global reset count. + * This struct can be used to query those stats. + */ struct drm_i915_reset_stats { + /** @ctx_id: ID of the requested context */ __u32 ctx_id; + + /** @flags: MBZ */ __u32 flags; - /* All resets since boot/module reload, for all contexts */ + /** @reset_count: All resets since boot/module reload, for all contexts */ __u32 reset_count; - /* Number of batches lost when active in GPU, for this context */ + /** @batch_active: Number of batches lost when active in GPU, for this context */ __u32 batch_active; - /* Number of batches lost pending for execution, for this context */ + /** @batch_pending: Number of batches lost pending for execution, for this context */ __u32 batch_pending; + /** @pad: MBZ */ __u32 pad; }; diff --git a/tools/include/uapi/linux/kvm.h b/tools/include/uapi/linux/kvm.h index ea32b101b999..d03842abae57 100644 --- a/tools/include/uapi/linux/kvm.h +++ b/tools/include/uapi/linux/kvm.h @@ -1221,9 +1221,9 @@ struct kvm_vfio_spapr_tce { /* Available with KVM_CAP_SPAPR_RESIZE_HPT */ #define KVM_PPC_RESIZE_HPT_PREPARE _IOR(KVMIO, 0xad, struct kvm_ppc_resize_hpt) #define KVM_PPC_RESIZE_HPT_COMMIT _IOR(KVMIO, 0xae, struct kvm_ppc_resize_hpt) -/* Available with KVM_CAP_PPC_RADIX_MMU or KVM_CAP_PPC_MMU_HASH_V3 */ +/* Available with KVM_CAP_PPC_MMU_RADIX or KVM_CAP_PPC_MMU_HASH_V3 */ #define KVM_PPC_CONFIGURE_V3_MMU _IOW(KVMIO, 0xaf, struct kvm_ppc_mmuv3_cfg) -/* Available with KVM_CAP_PPC_RADIX_MMU */ +/* Available with KVM_CAP_PPC_MMU_RADIX */ #define KVM_PPC_GET_RMMU_INFO _IOW(KVMIO, 0xb0, struct kvm_ppc_rmmu_info) /* Available with KVM_CAP_PPC_GET_CPU_CHAR */ #define KVM_PPC_GET_CPU_CHAR _IOR(KVMIO, 0xb1, struct kvm_ppc_cpu_char) diff --git a/tools/include/uapi/linux/netdev.h b/tools/include/uapi/linux/netdev.h index a8188202413e..43742ac5b00d 100644 --- a/tools/include/uapi/linux/netdev.h +++ b/tools/include/uapi/linux/netdev.h @@ -148,6 +148,7 @@ enum { NETDEV_A_QSTATS_RX_ALLOC_FAIL, NETDEV_A_QSTATS_RX_HW_DROPS, NETDEV_A_QSTATS_RX_HW_DROP_OVERRUNS, + NETDEV_A_QSTATS_RX_CSUM_COMPLETE, NETDEV_A_QSTATS_RX_CSUM_UNNECESSARY, NETDEV_A_QSTATS_RX_CSUM_NONE, NETDEV_A_QSTATS_RX_CSUM_BAD, diff --git a/tools/include/uapi/linux/stat.h b/tools/include/uapi/linux/stat.h index 2f2ee82d5517..67626d535316 100644 --- a/tools/include/uapi/linux/stat.h +++ b/tools/include/uapi/linux/stat.h @@ -126,8 +126,9 @@ struct statx { __u64 stx_mnt_id; __u32 stx_dio_mem_align; /* Memory buffer alignment for direct I/O */ __u32 stx_dio_offset_align; /* File offset alignment for direct I/O */ + __u64 stx_subvol; /* Subvolume identifier */ /* 0xa0 */ - __u64 __spare3[12]; /* Spare space for future expansion */ + __u64 __spare3[11]; /* Spare space for future expansion */ /* 0x100 */ }; @@ -155,6 +156,7 @@ struct statx { #define STATX_MNT_ID 0x00001000U /* Got stx_mnt_id */ #define STATX_DIOALIGN 0x00002000U /* Want/got direct I/O alignment info */ #define STATX_MNT_ID_UNIQUE 0x00004000U /* Want/got extended stx_mount_id */ +#define STATX_SUBVOL 0x00008000U /* Want/got stx_subvol */ #define STATX__RESERVED 0x80000000U /* Reserved for future struct statx expansion */ diff --git a/tools/lib/bpf/features.c b/tools/lib/bpf/features.c index a336786a22a3..50befe125ddc 100644 --- a/tools/lib/bpf/features.c +++ b/tools/lib/bpf/features.c @@ -392,11 +392,41 @@ static int probe_uprobe_multi_link(int token_fd) link_fd = bpf_link_create(prog_fd, -1, BPF_TRACE_UPROBE_MULTI, &link_opts); err = -errno; /* close() can clobber errno */ + if (link_fd >= 0 || err != -EBADF) { + if (link_fd >= 0) + close(link_fd); + close(prog_fd); + return 0; + } + + /* Initial multi-uprobe support in kernel didn't handle PID filtering + * correctly (it was doing thread filtering, not process filtering). + * So now we'll detect if PID filtering logic was fixed, and, if not, + * we'll pretend multi-uprobes are not supported, if not. + * Multi-uprobes are used in USDT attachment logic, and we need to be + * conservative here, because multi-uprobe selection happens early at + * load time, while the use of PID filtering is known late at + * attachment time, at which point it's too late to undo multi-uprobe + * selection. + * + * Creating uprobe with pid == -1 for (invalid) '/' binary will fail + * early with -EINVAL on kernels with fixed PID filtering logic; + * otherwise -ESRCH would be returned if passed correct binary path + * (but we'll just get -BADF, of course). + */ + link_opts.uprobe_multi.pid = -1; /* invalid PID */ + link_opts.uprobe_multi.path = "/"; /* invalid path */ + link_opts.uprobe_multi.offsets = &offset; + link_opts.uprobe_multi.cnt = 1; + + link_fd = bpf_link_create(prog_fd, -1, BPF_TRACE_UPROBE_MULTI, &link_opts); + err = -errno; /* close() can clobber errno */ + if (link_fd >= 0) close(link_fd); close(prog_fd); - return link_fd < 0 && err == -EBADF; + return link_fd < 0 && err == -EINVAL; } static int probe_kern_bpf_cookie(int token_fd) diff --git a/tools/memory-model/Documentation/README b/tools/memory-model/Documentation/README index db90a26dbdf4..304162743a5b 100644 --- a/tools/memory-model/Documentation/README +++ b/tools/memory-model/Documentation/README @@ -47,6 +47,10 @@ DESCRIPTION OF FILES README This file. +access-marking.txt + Guidelines for marking intentionally concurrent accesses to + shared memory. + cheatsheet.txt Quick-reference guide to the Linux-kernel memory model. diff --git a/tools/memory-model/Documentation/access-marking.txt b/tools/memory-model/Documentation/access-marking.txt index 65778222183e..3fbe77fd564a 100644 --- a/tools/memory-model/Documentation/access-marking.txt +++ b/tools/memory-model/Documentation/access-marking.txt @@ -6,7 +6,8 @@ normal accesses to shared memory, that is "normal" as in accesses that do not use read-modify-write atomic operations. It also describes how to document these accesses, both with comments and with special assertions processed by the Kernel Concurrency Sanitizer (KCSAN). This discussion -builds on an earlier LWN article [1]. +builds on an earlier LWN article [1] and Linux Foundation mentorship +session [2]. ACCESS-MARKING OPTIONS @@ -24,6 +25,11 @@ The Linux kernel provides the following access-marking options: 4. WRITE_ONCE(), for example, "WRITE_ONCE(a, b);" The various forms of atomic_set() also fit in here. +5. __data_racy, for example "int __data_racy a;" + +6. KCSAN's negative-marking assertions, ASSERT_EXCLUSIVE_ACCESS() + and ASSERT_EXCLUSIVE_WRITER(), are described in the + "ACCESS-DOCUMENTATION OPTIONS" section below. These may be used in combination, as shown in this admittedly improbable example: @@ -31,7 +37,7 @@ example: WRITE_ONCE(a, b + data_race(c + d) + READ_ONCE(e)); Neither plain C-language accesses nor data_race() (#1 and #2 above) place -any sort of constraint on the compiler's choice of optimizations [2]. +any sort of constraint on the compiler's choice of optimizations [3]. In contrast, READ_ONCE() and WRITE_ONCE() (#3 and #4 above) restrict the compiler's use of code-motion and common-subexpression optimizations. Therefore, if a given access is involved in an intentional data race, @@ -205,6 +211,23 @@ because doing otherwise prevents KCSAN from detecting violations of your code's synchronization rules. +Use of __data_racy +------------------ + +Adding the __data_racy type qualifier to the declaration of a variable +causes KCSAN to treat all accesses to that variable as if they were +enclosed by data_race(). However, __data_racy does not affect the +compiler, though one could imagine hardened kernel builds treating the +__data_racy type qualifier as if it was the volatile keyword. + +Note well that __data_racy is subject to the same pointer-declaration +rules as are other type qualifiers such as const and volatile. +For example: + + int __data_racy *p; // Pointer to data-racy data. + int *__data_racy p; // Data-racy pointer to non-data-racy data. + + ACCESS-DOCUMENTATION OPTIONS ============================ @@ -342,7 +365,7 @@ as follows: Because foo is read locklessly, all accesses are marked. The purpose of the ASSERT_EXCLUSIVE_WRITER() is to allow KCSAN to check for a buggy -concurrent lockless write. +concurrent write, whether marked or not. Lock-Protected Writes With Heuristic Lockless Reads @@ -594,5 +617,8 @@ REFERENCES [1] "Concurrency bugs should fear the big bad data-race detector (part 2)" https://lwn.net/Articles/816854/ -[2] "Who's afraid of a big bad optimizing compiler?" +[2] "The Kernel Concurrency Sanitizer" + https://www.linuxfoundation.org/webinars/the-kernel-concurrency-sanitizer + +[3] "Who's afraid of a big bad optimizing compiler?" https://lwn.net/Articles/793253/ diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat index 53b5a492739d..03c12efed66a 100644 --- a/tools/memory-model/lock.cat +++ b/tools/memory-model/lock.cat @@ -54,6 +54,12 @@ flag ~empty LKR \ domain(lk-rmw) as unpaired-LKR *) empty ([LKW] ; po-loc ; [LKR]) \ (po-loc ; [UL] ; po-loc) as lock-nest +(* + * In the same way, spin_is_locked() inside a critical section must always + * return True (no RU events can be in a critical section for the same lock). + *) +empty ([LKW] ; po-loc ; [RU]) \ (po-loc ; [UL] ; po-loc) as nested-is-locked + (* The final value of a spinlock should not be tested *) flag ~empty [FW] ; loc ; [ALL-LOCKS] as lock-final @@ -79,42 +85,50 @@ empty ([UNMATCHED-LKW] ; loc ; [UNMATCHED-LKW]) \ id as unmatched-locks (* rfi for LF events: link each LKW to the LF events in its critical section *) let rfi-lf = ([LKW] ; po-loc ; [LF]) \ ([LKW] ; po-loc ; [UL] ; po-loc) -(* rfe for LF events *) +(* Utility macro to convert a single pair to a single-edge relation *) +let pair-to-relation p = p ++ 0 + +(* + * If a given LF event e is outside a critical section, it cannot read + * internally but it may read from an LKW event in another thread. + * Compute the relation containing these possible edges. + *) +let possible-rfe-noncrit-lf e = (LKW * {e}) & loc & ext + +(* Compute set of sets of possible rfe edges for LF events *) let all-possible-rfe-lf = (* - * Given an LF event r, compute the possible rfe edges for that event - * (all those starting from LKW events in other threads), - * and then convert that relation to a set of single-edge relations. + * Convert the possible-rfe-noncrit-lf relation for e + * to a set of single edges *) - let possible-rfe-lf r = - let pair-to-relation p = p ++ 0 - in map pair-to-relation ((LKW * {r}) & loc & ext) - (* Do this for each LF event r that isn't in rfi-lf *) - in map possible-rfe-lf (LF \ range(rfi-lf)) + let set-of-singleton-rfe-lf e = + map pair-to-relation (possible-rfe-noncrit-lf e) + (* Do this for each LF event e that isn't in rfi-lf *) + in map set-of-singleton-rfe-lf (LF \ range(rfi-lf)) (* Generate all rf relations for LF events *) with rfe-lf from cross(all-possible-rfe-lf) let rf-lf = rfe-lf | rfi-lf (* - * RU, i.e., spin_is_locked() returning False, is slightly different. - * We rely on the memory model to rule out cases where spin_is_locked() - * within one of the lock's critical sections returns False. + * A given RU event e may read internally from the last po-previous UL, + * or it may read from a UL event in another thread or the initial write. + * Compute the relation containing these possible edges. *) - -(* rfi for RU events: an RU may read from the last po-previous UL *) -let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc) - -(* rfe for RU events: an RU may read from an external UL or the initial write *) -let all-possible-rfe-ru = - let possible-rfe-ru r = - let pair-to-relation p = p ++ 0 - in map pair-to-relation (((UL | IW) * {r}) & loc & ext) - in map possible-rfe-ru RU +let possible-rf-ru e = (((UL * {e}) & po-loc) \ + ([UL] ; po-loc ; [UL] ; po-loc)) | + (((UL | IW) * {e}) & loc & ext) + +(* Compute set of sets of possible rf edges for RU events *) +let all-possible-rf-ru = + (* Convert the possible-rf-ru relation for e to a set of single edges *) + let set-of-singleton-rf-ru e = + map pair-to-relation (possible-rf-ru e) + (* Do this for each RU event e *) + in map set-of-singleton-rf-ru RU (* Generate all rf relations for RU events *) -with rfe-ru from cross(all-possible-rfe-ru) -let rf-ru = rfe-ru | rfi-ru +with rf-ru from cross(all-possible-rf-ru) (* Final rf relation *) let rf = rf | rf-lf | rf-ru diff --git a/tools/objtool/Documentation/objtool.txt b/tools/objtool/Documentation/objtool.txt index fe39c2a8ef0d..7c3ee959b63c 100644 --- a/tools/objtool/Documentation/objtool.txt +++ b/tools/objtool/Documentation/objtool.txt @@ -284,6 +284,25 @@ the objtool maintainers. Otherwise the stack frame may not get created before the call. + objtool can help with pinpointing the exact function where it happens: + + $ OBJTOOL_ARGS="--verbose" make arch/x86/kvm/ + + arch/x86/kvm/kvm.o: warning: objtool: .altinstr_replacement+0xc5: call without frame pointer save/setup + arch/x86/kvm/kvm.o: warning: objtool: em_loop.part.0+0x29: (alt) + arch/x86/kvm/kvm.o: warning: objtool: em_loop.part.0+0x0: <=== (sym) + LD [M] arch/x86/kvm/kvm-intel.o + 0000 0000000000028220 <em_loop.part.0>: + 0000 28220: 0f b6 47 61 movzbl 0x61(%rdi),%eax + 0004 28224: 3c e2 cmp $0xe2,%al + 0006 28226: 74 2c je 28254 <em_loop.part.0+0x34> + 0008 28228: 48 8b 57 10 mov 0x10(%rdi),%rdx + 000c 2822c: 83 f0 05 xor $0x5,%eax + 000f 2822f: 48 c1 e0 04 shl $0x4,%rax + 0013 28233: 25 f0 00 00 00 and $0xf0,%eax + 0018 28238: 81 e2 d5 08 00 00 and $0x8d5,%edx + 001e 2823e: 80 ce 02 or $0x2,%dh + ... 2. file.o: warning: objtool: .text+0x53: unreachable instruction diff --git a/tools/objtool/arch/x86/special.c b/tools/objtool/arch/x86/special.c index 4134d27c696b..4ea0f9815fda 100644 --- a/tools/objtool/arch/x86/special.c +++ b/tools/objtool/arch/x86/special.c @@ -9,6 +9,29 @@ void arch_handle_alternative(unsigned short feature, struct special_alt *alt) { + static struct special_alt *group, *prev; + + /* + * Recompute orig_len for nested ALTERNATIVE()s. + */ + if (group && group->orig_sec == alt->orig_sec && + group->orig_off == alt->orig_off) { + + struct special_alt *iter = group; + for (;;) { + unsigned int len = max(iter->orig_len, alt->orig_len); + iter->orig_len = alt->orig_len = len; + + if (iter == prev) + break; + + iter = list_next_entry(iter, list); + } + + } else group = alt; + + prev = alt; + switch (feature) { case X86_FEATURE_SMAP: /* diff --git a/tools/objtool/noreturns.h b/tools/objtool/noreturns.h index 7ebf29c91184..1e8141ef1b15 100644 --- a/tools/objtool/noreturns.h +++ b/tools/objtool/noreturns.h @@ -7,12 +7,16 @@ * Yes, this is unfortunate. A better solution is in the works. */ NORETURN(__fortify_panic) +NORETURN(__ia32_sys_exit) +NORETURN(__ia32_sys_exit_group) NORETURN(__kunit_abort) NORETURN(__module_put_and_kthread_exit) NORETURN(__reiserfs_panic) NORETURN(__stack_chk_fail) NORETURN(__tdx_hypercall_failed) NORETURN(__ubsan_handle_builtin_unreachable) +NORETURN(__x64_sys_exit) +NORETURN(__x64_sys_exit_group) NORETURN(arch_cpu_idle_dead) NORETURN(bch2_trans_in_restart_error) NORETURN(bch2_trans_restart_error) diff --git a/tools/objtool/special.c b/tools/objtool/special.c index 91b1950f5bd8..097a69db82a0 100644 --- a/tools/objtool/special.c +++ b/tools/objtool/special.c @@ -84,6 +84,14 @@ static int get_alt_entry(struct elf *elf, const struct special_entry *entry, entry->new_len); } + orig_reloc = find_reloc_by_dest(elf, sec, offset + entry->orig); + if (!orig_reloc) { + WARN_FUNC("can't find orig reloc", sec, offset + entry->orig); + return -1; + } + + reloc_to_sec_off(orig_reloc, &alt->orig_sec, &alt->orig_off); + if (entry->feature) { unsigned short feature; @@ -94,14 +102,6 @@ static int get_alt_entry(struct elf *elf, const struct special_entry *entry, arch_handle_alternative(feature, alt); } - orig_reloc = find_reloc_by_dest(elf, sec, offset + entry->orig); - if (!orig_reloc) { - WARN_FUNC("can't find orig reloc", sec, offset + entry->orig); - return -1; - } - - reloc_to_sec_off(orig_reloc, &alt->orig_sec, &alt->orig_off); - if (!entry->group || alt->new_len) { new_reloc = find_reloc_by_dest(elf, sec, offset + entry->new); if (!new_reloc) { diff --git a/tools/perf/Makefile.perf b/tools/perf/Makefile.perf index 5c35c0d89306..e6d56b555369 100644 --- a/tools/perf/Makefile.perf +++ b/tools/perf/Makefile.perf @@ -214,6 +214,7 @@ NON_CONFIG_TARGETS := clean python-clean TAGS tags cscope help ifdef MAKECMDGOALS ifeq ($(filter-out $(NON_CONFIG_TARGETS),$(MAKECMDGOALS)),) + VMLINUX_H=$(src-perf)/util/bpf_skel/vmlinux/vmlinux.h config := 0 endif endif diff --git a/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl b/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl index 532b855df589..1464c6be6eb3 100644 --- a/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl +++ b/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl @@ -376,3 +376,4 @@ 459 n64 lsm_get_self_attr sys_lsm_get_self_attr 460 n64 lsm_set_self_attr sys_lsm_set_self_attr 461 n64 lsm_list_modules sys_lsm_list_modules +462 n64 mseal sys_mseal diff --git a/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl b/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl index 17173b82ca21..3656f1ca7a21 100644 --- a/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl +++ b/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl @@ -548,3 +548,4 @@ 459 common lsm_get_self_attr sys_lsm_get_self_attr 460 common lsm_set_self_attr sys_lsm_set_self_attr 461 common lsm_list_modules sys_lsm_list_modules +462 common mseal sys_mseal diff --git a/tools/perf/arch/s390/entry/syscalls/syscall.tbl b/tools/perf/arch/s390/entry/syscalls/syscall.tbl index 095bb86339a7..bd0fee24ad10 100644 --- a/tools/perf/arch/s390/entry/syscalls/syscall.tbl +++ b/tools/perf/arch/s390/entry/syscalls/syscall.tbl @@ -464,3 +464,4 @@ 459 common lsm_get_self_attr sys_lsm_get_self_attr sys_lsm_get_self_attr 460 common lsm_set_self_attr sys_lsm_set_self_attr sys_lsm_set_self_attr 461 common lsm_list_modules sys_lsm_list_modules sys_lsm_list_modules +462 common mseal sys_mseal sys_mseal diff --git a/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl b/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl index 7e8d46f4147f..a396f6e6ab5b 100644 --- a/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl +++ b/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl @@ -374,7 +374,7 @@ 450 common set_mempolicy_home_node sys_set_mempolicy_home_node 451 common cachestat sys_cachestat 452 common fchmodat2 sys_fchmodat2 -453 64 map_shadow_stack sys_map_shadow_stack +453 common map_shadow_stack sys_map_shadow_stack 454 common futex_wake sys_futex_wake 455 common futex_wait sys_futex_wait 456 common futex_requeue sys_futex_requeue @@ -383,6 +383,7 @@ 459 common lsm_get_self_attr sys_lsm_get_self_attr 460 common lsm_set_self_attr sys_lsm_set_self_attr 461 common lsm_list_modules sys_lsm_list_modules +462 common mseal sys_mseal # # Due to a historical design error, certain syscalls are numbered differently diff --git a/tools/perf/builtin-record.c b/tools/perf/builtin-record.c index 66a3de8ac661..0a8ba1323d64 100644 --- a/tools/perf/builtin-record.c +++ b/tools/perf/builtin-record.c @@ -1956,8 +1956,7 @@ static void record__read_lost_samples(struct record *rec) if (count.lost) { if (!lost) { - lost = zalloc(sizeof(*lost) + - session->machines.host.id_hdr_size); + lost = zalloc(PERF_SAMPLE_MAX_SIZE); if (!lost) { pr_debug("Memory allocation failed\n"); return; @@ -1973,8 +1972,7 @@ static void record__read_lost_samples(struct record *rec) lost_count = perf_bpf_filter__lost_count(evsel); if (lost_count) { if (!lost) { - lost = zalloc(sizeof(*lost) + - session->machines.host.id_hdr_size); + lost = zalloc(PERF_SAMPLE_MAX_SIZE); if (!lost) { pr_debug("Memory allocation failed\n"); return; diff --git a/tools/perf/builtin-trace.c b/tools/perf/builtin-trace.c index 51eca671c797..08a3a6effac1 100644 --- a/tools/perf/builtin-trace.c +++ b/tools/perf/builtin-trace.c @@ -765,7 +765,7 @@ static const char *fcntl_cmds[] = { static DEFINE_STRARRAY(fcntl_cmds, "F_"); static const char *fcntl_linux_specific_cmds[] = { - "SETLEASE", "GETLEASE", "NOTIFY", [5] = "CANCELLK", "DUPFD_CLOEXEC", + "SETLEASE", "GETLEASE", "NOTIFY", "DUPFD_QUERY", [5] = "CANCELLK", "DUPFD_CLOEXEC", "SETPIPE_SZ", "GETPIPE_SZ", "ADD_SEALS", "GET_SEALS", "GET_RW_HINT", "SET_RW_HINT", "GET_FILE_RW_HINT", "SET_FILE_RW_HINT", }; diff --git a/tools/perf/trace/beauty/arch/x86/include/asm/irq_vectors.h b/tools/perf/trace/beauty/arch/x86/include/asm/irq_vectors.h index d18bfb238f66..13aea8fc3d45 100644 --- a/tools/perf/trace/beauty/arch/x86/include/asm/irq_vectors.h +++ b/tools/perf/trace/beauty/arch/x86/include/asm/irq_vectors.h @@ -97,10 +97,16 @@ #define LOCAL_TIMER_VECTOR 0xec +/* + * Posted interrupt notification vector for all device MSIs delivered to + * the host kernel. + */ +#define POSTED_MSI_NOTIFICATION_VECTOR 0xeb + #define NR_VECTORS 256 #ifdef CONFIG_X86_LOCAL_APIC -#define FIRST_SYSTEM_VECTOR LOCAL_TIMER_VECTOR +#define FIRST_SYSTEM_VECTOR POSTED_MSI_NOTIFICATION_VECTOR #else #define FIRST_SYSTEM_VECTOR NR_VECTORS #endif diff --git a/tools/perf/trace/beauty/include/linux/socket.h b/tools/perf/trace/beauty/include/linux/socket.h index 139c330ccf2c..89d16b90370b 100644 --- a/tools/perf/trace/beauty/include/linux/socket.h +++ b/tools/perf/trace/beauty/include/linux/socket.h @@ -16,6 +16,7 @@ struct cred; struct socket; struct sock; struct sk_buff; +struct proto_accept_arg; #define __sockaddr_check_size(size) \ BUILD_BUG_ON(((size) > sizeof(struct __kernel_sockaddr_storage))) @@ -433,7 +434,7 @@ extern int __sys_recvfrom(int fd, void __user *ubuf, size_t size, extern int __sys_sendto(int fd, void __user *buff, size_t len, unsigned int flags, struct sockaddr __user *addr, int addr_len); -extern struct file *do_accept(struct file *file, unsigned file_flags, +extern struct file *do_accept(struct file *file, struct proto_accept_arg *arg, struct sockaddr __user *upeer_sockaddr, int __user *upeer_addrlen, int flags); extern int __sys_accept4(int fd, struct sockaddr __user *upeer_sockaddr, diff --git a/tools/perf/trace/beauty/include/uapi/linux/fcntl.h b/tools/perf/trace/beauty/include/uapi/linux/fcntl.h index 282e90aeb163..c0bcc185fa48 100644 --- a/tools/perf/trace/beauty/include/uapi/linux/fcntl.h +++ b/tools/perf/trace/beauty/include/uapi/linux/fcntl.h @@ -9,6 +9,14 @@ #define F_GETLEASE (F_LINUX_SPECIFIC_BASE + 1) /* + * Request nofications on a directory. + * See below for events that may be notified. + */ +#define F_NOTIFY (F_LINUX_SPECIFIC_BASE + 2) + +#define F_DUPFD_QUERY (F_LINUX_SPECIFIC_BASE + 3) + +/* * Cancel a blocking posix lock; internal use only until we expose an * asynchronous lock api to userspace: */ @@ -18,12 +26,6 @@ #define F_DUPFD_CLOEXEC (F_LINUX_SPECIFIC_BASE + 6) /* - * Request nofications on a directory. - * See below for events that may be notified. - */ -#define F_NOTIFY (F_LINUX_SPECIFIC_BASE+2) - -/* * Set and get of pipe page size array */ #define F_SETPIPE_SZ (F_LINUX_SPECIFIC_BASE + 7) diff --git a/tools/perf/trace/beauty/include/uapi/linux/prctl.h b/tools/perf/trace/beauty/include/uapi/linux/prctl.h index 370ed14b1ae0..35791791a879 100644 --- a/tools/perf/trace/beauty/include/uapi/linux/prctl.h +++ b/tools/perf/trace/beauty/include/uapi/linux/prctl.h @@ -306,4 +306,26 @@ struct prctl_mm_map { # define PR_RISCV_V_VSTATE_CTRL_NEXT_MASK 0xc # define PR_RISCV_V_VSTATE_CTRL_MASK 0x1f +#define PR_RISCV_SET_ICACHE_FLUSH_CTX 71 +# define PR_RISCV_CTX_SW_FENCEI_ON 0 +# define PR_RISCV_CTX_SW_FENCEI_OFF 1 +# define PR_RISCV_SCOPE_PER_PROCESS 0 +# define PR_RISCV_SCOPE_PER_THREAD 1 + +/* PowerPC Dynamic Execution Control Register (DEXCR) controls */ +#define PR_PPC_GET_DEXCR 72 +#define PR_PPC_SET_DEXCR 73 +/* DEXCR aspect to act on */ +# define PR_PPC_DEXCR_SBHE 0 /* Speculative branch hint enable */ +# define PR_PPC_DEXCR_IBRTPD 1 /* Indirect branch recurrent target prediction disable */ +# define PR_PPC_DEXCR_SRAPD 2 /* Subroutine return address prediction disable */ +# define PR_PPC_DEXCR_NPHIE 3 /* Non-privileged hash instruction enable */ +/* Action to apply / return */ +# define PR_PPC_DEXCR_CTRL_EDITABLE 0x1 /* Aspect can be modified with PR_PPC_SET_DEXCR */ +# define PR_PPC_DEXCR_CTRL_SET 0x2 /* Set the aspect for this process */ +# define PR_PPC_DEXCR_CTRL_CLEAR 0x4 /* Clear the aspect for this process */ +# define PR_PPC_DEXCR_CTRL_SET_ONEXEC 0x8 /* Set the aspect on exec */ +# define PR_PPC_DEXCR_CTRL_CLEAR_ONEXEC 0x10 /* Clear the aspect on exec */ +# define PR_PPC_DEXCR_CTRL_MASK 0x1f + #endif /* _LINUX_PRCTL_H */ diff --git a/tools/perf/trace/beauty/include/uapi/linux/stat.h b/tools/perf/trace/beauty/include/uapi/linux/stat.h index 2f2ee82d5517..67626d535316 100644 --- a/tools/perf/trace/beauty/include/uapi/linux/stat.h +++ b/tools/perf/trace/beauty/include/uapi/linux/stat.h @@ -126,8 +126,9 @@ struct statx { __u64 stx_mnt_id; __u32 stx_dio_mem_align; /* Memory buffer alignment for direct I/O */ __u32 stx_dio_offset_align; /* File offset alignment for direct I/O */ + __u64 stx_subvol; /* Subvolume identifier */ /* 0xa0 */ - __u64 __spare3[12]; /* Spare space for future expansion */ + __u64 __spare3[11]; /* Spare space for future expansion */ /* 0x100 */ }; @@ -155,6 +156,7 @@ struct statx { #define STATX_MNT_ID 0x00001000U /* Got stx_mnt_id */ #define STATX_DIOALIGN 0x00002000U /* Want/got direct I/O alignment info */ #define STATX_MNT_ID_UNIQUE 0x00004000U /* Want/got extended stx_mount_id */ +#define STATX_SUBVOL 0x00008000U /* Want/got stx_subvol */ #define STATX__RESERVED 0x80000000U /* Reserved for future struct statx expansion */ diff --git a/tools/perf/util/comm.c b/tools/perf/util/comm.c index 233f2b6edf52..49b79cf0c5cc 100644 --- a/tools/perf/util/comm.c +++ b/tools/perf/util/comm.c @@ -86,14 +86,6 @@ static struct comm_str *comm_str__new(const char *str) return result; } -static int comm_str__cmp(const void *_lhs, const void *_rhs) -{ - const struct comm_str *lhs = *(const struct comm_str * const *)_lhs; - const struct comm_str *rhs = *(const struct comm_str * const *)_rhs; - - return strcmp(comm_str__str(lhs), comm_str__str(rhs)); -} - static int comm_str__search(const void *_key, const void *_member) { const char *key = _key; @@ -169,9 +161,24 @@ static struct comm_str *comm_strs__findnew(const char *str) } result = comm_str__new(str); if (result) { - comm_strs->strs[comm_strs->num_strs++] = result; - qsort(comm_strs->strs, comm_strs->num_strs, sizeof(struct comm_str *), - comm_str__cmp); + int low = 0, high = comm_strs->num_strs - 1; + int insert = comm_strs->num_strs; /* Default to inserting at the end. */ + + while (low <= high) { + int mid = low + (high - low) / 2; + int cmp = strcmp(comm_str__str(comm_strs->strs[mid]), str); + + if (cmp < 0) { + low = mid + 1; + } else { + high = mid - 1; + insert = mid; + } + } + memmove(&comm_strs->strs[insert + 1], &comm_strs->strs[insert], + (comm_strs->num_strs - insert) * sizeof(struct comm_str *)); + comm_strs->num_strs++; + comm_strs->strs[insert] = result; } } up_write(&comm_strs->lock); diff --git a/tools/perf/util/dsos.c b/tools/perf/util/dsos.c index ab3d0c01dd63..a69a9c661200 100644 --- a/tools/perf/util/dsos.c +++ b/tools/perf/util/dsos.c @@ -203,11 +203,27 @@ int __dsos__add(struct dsos *dsos, struct dso *dso) dsos->dsos = temp; dsos->allocated = to_allocate; } - dsos->dsos[dsos->cnt++] = dso__get(dso); - if (dsos->cnt >= 2 && dsos->sorted) { - dsos->sorted = dsos__cmp_long_name_id_short_name(&dsos->dsos[dsos->cnt - 2], - &dsos->dsos[dsos->cnt - 1]) - <= 0; + if (!dsos->sorted) { + dsos->dsos[dsos->cnt++] = dso__get(dso); + } else { + int low = 0, high = dsos->cnt - 1; + int insert = dsos->cnt; /* Default to inserting at the end. */ + + while (low <= high) { + int mid = low + (high - low) / 2; + int cmp = dsos__cmp_long_name_id_short_name(&dsos->dsos[mid], &dso); + + if (cmp < 0) { + low = mid + 1; + } else { + high = mid - 1; + insert = mid; + } + } + memmove(&dsos->dsos[insert + 1], &dsos->dsos[insert], + (dsos->cnt - insert) * sizeof(struct dso *)); + dsos->cnt++; + dsos->dsos[insert] = dso__get(dso); } dso__set_dsos(dso, dsos); return 0; diff --git a/tools/power/cpupower/Makefile b/tools/power/cpupower/Makefile index b53753dee02f..6c02f401069e 100644 --- a/tools/power/cpupower/Makefile +++ b/tools/power/cpupower/Makefile @@ -67,6 +67,7 @@ LANGUAGES = de fr it cs pt ka bindir ?= /usr/bin sbindir ?= /usr/sbin mandir ?= /usr/man +libdir ?= /usr/lib includedir ?= /usr/include localedir ?= /usr/share/locale docdir ?= /usr/share/doc/packages/cpupower @@ -94,15 +95,6 @@ RANLIB = $(CROSS)ranlib HOSTCC = gcc MKDIR = mkdir -# 64bit library detection -include ../../scripts/Makefile.arch - -ifeq ($(IS_64_BIT), 1) -libdir ?= /usr/lib64 -else -libdir ?= /usr/lib -endif - # Now we set up the build system # @@ -332,4 +324,39 @@ uninstall: rm -f $(DESTDIR)${localedir}/$$HLANG/LC_MESSAGES/cpupower.mo; \ done; -.PHONY: all utils libcpupower update-po create-gmo install-lib install-tools install-man install-gmo install uninstall clean +help: + @echo 'Building targets:' + @echo ' all - Default target. Could be omitted. Put build artifacts' + @echo ' to "O" cmdline option dir (default: current dir)' + @echo ' install - Install previously built project files from the output' + @echo ' dir defined by "O" cmdline option (default: current dir)' + @echo ' to the install dir defined by "DESTDIR" cmdline or' + @echo ' Makefile config block option (default: "")' + @echo ' install-lib - Install previously built library binary from the output' + @echo ' dir defined by "O" cmdline option (default: current dir)' + @echo ' and library headers from "lib/" for userspace to the install' + @echo ' dir defined by "DESTDIR" cmdline (default: "")' + @echo ' install-tools - Install previously built "cpupower" util from the output' + @echo ' dir defined by "O" cmdline option (default: current dir) and' + @echo ' "cpupower-completion.sh" script from the src dir to the' + @echo ' install dir defined by "DESTDIR" cmdline or Makefile' + @echo ' config block option (default: "")' + @echo ' install-man - Install man pages from the "man" src subdir to the' + @echo ' install dir defined by "DESTDIR" cmdline or Makefile' + @echo ' config block option (default: "")' + @echo ' install-gmo - Install previously built language files from the output' + @echo ' dir defined by "O" cmdline option (default: current dir)' + @echo ' to the install dir defined by "DESTDIR" cmdline or Makefile' + @echo ' config block option (default: "")' + @echo ' install-bench - Install previously built "cpufreq-bench" util files from the' + @echo ' output dir defined by "O" cmdline option (default: current dir)' + @echo ' to the install dir defined by "DESTDIR" cmdline or Makefile' + @echo ' config block option (default: "")' + @echo '' + @echo 'Cleaning targets:' + @echo ' clean - Clean build artifacts from the dir defined by "O" cmdline' + @echo ' option (default: current dir)' + @echo ' uninstall - Remove previously installed files from the dir defined by "DESTDIR"' + @echo ' cmdline or Makefile config block option (default: "")' + +.PHONY: all utils libcpupower update-po create-gmo install-lib install-tools install-man install-gmo install uninstall clean help diff --git a/tools/power/cpupower/README b/tools/power/cpupower/README index 1c68f47663b2..2678ed81d311 100644 --- a/tools/power/cpupower/README +++ b/tools/power/cpupower/README @@ -22,16 +22,156 @@ interfaces [depending on configuration, see below]. compilation and installation ---------------------------- -make -su -make install - -should suffice on most systems. It builds libcpupower to put in -/usr/lib; cpupower, cpufreq-bench_plot.sh to put in /usr/bin; and -cpufreq-bench to put in /usr/sbin. If you want to set up the paths -differently and/or want to configure the package to your specific -needs, you need to open "Makefile" with an editor of your choice and -edit the block marked CONFIGURATION. +There are 2 output directories - one for the build output and another for +the installation of the build results, that is the utility, library, +man pages, etc... + +default directory +----------------- + +In the case of default directory, build and install process requires no +additional parameters: + +build +----- + +$ make + +The output directory for the 'make' command is the current directory and +its subdirs in the kernel tree: +tools/power/cpupower + +install +------- + +$ sudo make install + +'make install' command puts targets to default system dirs: + +----------------------------------------------------------------------- +| Installing file | System dir | +----------------------------------------------------------------------- +| libcpupower | /usr/lib | +----------------------------------------------------------------------- +| cpupower | /usr/bin | +----------------------------------------------------------------------- +| cpufreq-bench_plot.sh | /usr/bin | +----------------------------------------------------------------------- +| man pages | /usr/man | +----------------------------------------------------------------------- + +To put it in other words it makes build results available system-wide, +enabling any user to simply start using it without any additional steps + +custom directory +---------------- + +There are 2 make's command-line variables 'O' and 'DESTDIR' that setup +appropriate dirs: +'O' - build directory +'DESTDIR' - installation directory. This variable could also be setup in +the 'CONFIGURATION' block of the "Makefile" + +build +----- + +$ make O=<your_custom_build_catalog> + +Example: +$ make O=/home/hedin/prj/cpupower/build + +install +------- + +$ make O=<your_custom_build_catalog> DESTDIR=<your_custom_install_catalog> + +Example: +$ make O=/home/hedin/prj/cpupower/build DESTDIR=/home/hedin/prj/cpupower \ +> install + +Notice that both variables 'O' and 'DESTDIR' have been provided. The reason +is that the build results are saved in the custom output dir defined by 'O' +variable. So, this dir is the source for the installation step. If only +'DESTDIR' were provided then the 'install' target would assume that the +build directory is the current one, build everything there and install +from the current dir. + +The files will be installed to the following dirs: + +----------------------------------------------------------------------- +| Installing file | System dir | +----------------------------------------------------------------------- +| libcpupower | ${DESTDIR}/usr/lib | +----------------------------------------------------------------------- +| cpupower | ${DESTDIR}/usr/bin | +----------------------------------------------------------------------- +| cpufreq-bench_plot.sh | ${DESTDIR}/usr/bin | +----------------------------------------------------------------------- +| man pages | ${DESTDIR}/usr/man | +----------------------------------------------------------------------- + +If you look at the table for the default 'make' output dirs you will +notice that the only difference with the non-default case is the +${DESTDIR} prefix. So, the structure of the output dirs remains the same +regardles of the root output directory. + + +clean and uninstall +------------------- + +'clean' target is intended for cleanup the build catalog from build results +'uninstall' target is intended for removing installed files from the +installation directory + +default directory +----------------- + +This case is a straightforward one: +$ make clean +$ make uninstall + +custom directory +---------------- + +Use 'O' command line variable to remove previously built files from the +build dir: +$ make O=<your_custom_build_catalog> clean + +Example: +$ make O=/home/hedin/prj/cpupower/build clean + +Use 'DESTDIR' command line variable to uninstall previously installed files +from the given dir: +$ make DESTDIR=<your_custom_install_catalog> + +Example: +make DESTDIR=/home/hedin/prj/cpupower uninstall + + +running the tool +---------------- + +default directory +----------------- + +$ sudo cpupower + +custom directory +---------------- + +When it comes to run the utility from the custom build catalog things +become a little bit complicated as 'just run' approach doesn't work. +Assuming that the current dir is '<your_custom_install_catalog>/usr', +issuing the following command: + +$ sudo ./bin/cpupower +will produce the following error output: +./bin/cpupower: error while loading shared libraries: libcpupower.so.1: +cannot open shared object file: No such file or directory + +The issue is that binary cannot find the 'libcpupower' library. So, we +shall point to the lib dir: +sudo LD_LIBRARY_PATH=lib64/ ./bin/cpupower THANKS diff --git a/tools/power/cpupower/bench/Makefile b/tools/power/cpupower/bench/Makefile index a4b902f9e1c4..34e5894476eb 100644 --- a/tools/power/cpupower/bench/Makefile +++ b/tools/power/cpupower/bench/Makefile @@ -1,4 +1,9 @@ # SPDX-License-Identifier: GPL-2.0 +ifeq ($(MAKELEVEL),0) +$(error This Makefile is not intended to be run standalone, but only as a part \ +of the main one in the parent dir) +endif + OUTPUT := ./ ifeq ("$(origin O)", "command line") ifneq ($(O),) diff --git a/tools/power/cpupower/man/cpupower-monitor.1 b/tools/power/cpupower/man/cpupower-monitor.1 index 8ee737eefa5c..89af019f8dc4 100644 --- a/tools/power/cpupower/man/cpupower-monitor.1 +++ b/tools/power/cpupower/man/cpupower-monitor.1 @@ -81,11 +81,6 @@ Measure idle and frequency characteristics of an arbitrary command/workload. The executable \fBcommand\fP is forked and upon its exit, statistics gathered since it was forked are displayed. .RE -.PP -\-v -.RS 4 -Increase verbosity if the binary was compiled with the DEBUG option set. -.RE .SH MONITOR DESCRIPTIONS .SS "Idle_Stats" @@ -172,9 +167,11 @@ displayed. "BIOS and Kernel Developer’s Guide (BKDG) for AMD Family 14h Processors" https://support.amd.com/us/Processor_TechDocs/43170.pdf -"Intel® Turbo Boost Technology -in Intel® Coreâ„¢ Microarchitecture (Nehalem) Based Processors" -http://download.intel.com/design/processor/applnots/320354.pdf +"What Is Intel® Turbo Boost Technology?" +https://www.intel.com/content/www/us/en/gaming/resources/turbo-boost.html + +"Power Management - Technology Overview" +https://cdrdv2.intel.com/v1/dl/getContent/637748 "Intel® 64 and IA-32 Architectures Software Developer's Manual Volume 3B: System Programming Guide" diff --git a/tools/power/cpupower/utils/helpers/amd.c b/tools/power/cpupower/utils/helpers/amd.c index c519cc89c97f..0a56e22240fc 100644 --- a/tools/power/cpupower/utils/helpers/amd.c +++ b/tools/power/cpupower/utils/helpers/amd.c @@ -41,6 +41,16 @@ union core_pstate { unsigned res1:31; unsigned en:1; } pstatedef; + /* since fam 1Ah: */ + struct { + unsigned fid:12; + unsigned res1:2; + unsigned vid:8; + unsigned iddval:8; + unsigned idddiv:2; + unsigned res2:31; + unsigned en:1; + } pstatedef2; unsigned long long val; }; @@ -48,6 +58,10 @@ static int get_did(union core_pstate pstate) { int t; + /* Fam 1Ah onward do not use did */ + if (cpupower_cpu_info.family >= 0x1A) + return 0; + if (cpupower_cpu_info.caps & CPUPOWER_CAP_AMD_PSTATEDEF) t = pstate.pstatedef.did; else if (cpupower_cpu_info.family == 0x12) @@ -61,12 +75,18 @@ static int get_did(union core_pstate pstate) static int get_cof(union core_pstate pstate) { int t; - int fid, did, cof; + int fid, did, cof = 0; did = get_did(pstate); if (cpupower_cpu_info.caps & CPUPOWER_CAP_AMD_PSTATEDEF) { - fid = pstate.pstatedef.fid; - cof = 200 * fid / did; + if (cpupower_cpu_info.family >= 0x1A) { + fid = pstate.pstatedef2.fid; + if (fid > 0x0f) + cof = (fid * 5); + } else { + fid = pstate.pstatedef.fid; + cof = 200 * fid / did; + } } else { t = 0x10; fid = pstate.pstate.fid; diff --git a/tools/power/cpupower/utils/idle_monitor/cpupower-monitor.c b/tools/power/cpupower/utils/idle_monitor/cpupower-monitor.c index 075e766ff1f3..f746099b5dac 100644 --- a/tools/power/cpupower/utils/idle_monitor/cpupower-monitor.c +++ b/tools/power/cpupower/utils/idle_monitor/cpupower-monitor.c @@ -35,7 +35,7 @@ static unsigned int avail_monitors; static char *progname; enum operation_mode_e { list = 1, show, show_all }; -static int mode; +static enum operation_mode_e mode; static int interval = 1; static char *show_monitors_param; static struct cpupower_topology cpu_top; diff --git a/tools/power/pm-graph/bootgraph.py b/tools/power/pm-graph/bootgraph.py index f96f50e0c336..8a3ef94fe88f 100755 --- a/tools/power/pm-graph/bootgraph.py +++ b/tools/power/pm-graph/bootgraph.py @@ -77,12 +77,12 @@ class SystemValues(aslib.SystemValues): fp.close() self.testdir = datetime.now().strftime('boot-%y%m%d-%H%M%S') def kernelVersion(self, msg): - m = re.match('^[Ll]inux *[Vv]ersion *(?P<v>\S*) .*', msg) + m = re.match(r'^[Ll]inux *[Vv]ersion *(?P<v>\S*) .*', msg) if m: return m.group('v') return 'unknown' def checkFtraceKernelVersion(self): - m = re.match('^(?P<x>[0-9]*)\.(?P<y>[0-9]*)\.(?P<z>[0-9]*).*', self.kernel) + m = re.match(r'^(?P<x>[0-9]*)\.(?P<y>[0-9]*)\.(?P<z>[0-9]*).*', self.kernel) if m: val = tuple(map(int, m.groups())) if val >= (4, 10, 0): @@ -324,7 +324,7 @@ def parseKernelLog(): idx = line.find('[') if idx > 1: line = line[idx:] - m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) + m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) if(not m): continue ktime = float(m.group('ktime')) @@ -332,24 +332,24 @@ def parseKernelLog(): break msg = m.group('msg') data.dmesgtext.append(line) - if(ktime == 0.0 and re.match('^Linux version .*', msg)): + if(ktime == 0.0 and re.match(r'^Linux version .*', msg)): if(not sysvals.stamp['kernel']): sysvals.stamp['kernel'] = sysvals.kernelVersion(msg) continue - m = re.match('.* setting system clock to (?P<d>[0-9\-]*)[ A-Z](?P<t>[0-9:]*) UTC.*', msg) + m = re.match(r'.* setting system clock to (?P<d>[0-9\-]*)[ A-Z](?P<t>[0-9:]*) UTC.*', msg) if(m): bt = datetime.strptime(m.group('d')+' '+m.group('t'), '%Y-%m-%d %H:%M:%S') bt = bt - timedelta(seconds=int(ktime)) data.boottime = bt.strftime('%Y-%m-%d_%H:%M:%S') sysvals.stamp['time'] = bt.strftime('%B %d %Y, %I:%M:%S %p') continue - m = re.match('^calling *(?P<f>.*)\+.* @ (?P<p>[0-9]*)', msg) + m = re.match(r'^calling *(?P<f>.*)\+.* @ (?P<p>[0-9]*)', msg) if(m): func = m.group('f') pid = int(m.group('p')) devtemp[func] = (ktime, pid) continue - m = re.match('^initcall *(?P<f>.*)\+.* returned (?P<r>.*) after (?P<t>.*) usecs', msg) + m = re.match(r'^initcall *(?P<f>.*)\+.* returned (?P<r>.*) after (?P<t>.*) usecs', msg) if(m): data.valid = True data.end = ktime @@ -359,7 +359,7 @@ def parseKernelLog(): data.newAction(phase, f, pid, start, ktime, int(r), int(t)) del devtemp[f] continue - if(re.match('^Freeing unused kernel .*', msg)): + if(re.match(r'^Freeing unused kernel .*', msg)): data.tUserMode = ktime data.dmesg['kernel']['end'] = ktime data.dmesg['user']['start'] = ktime diff --git a/tools/power/pm-graph/sleepgraph.py b/tools/power/pm-graph/sleepgraph.py index 40ad221e8881..ef87e63c05c7 100755 --- a/tools/power/pm-graph/sleepgraph.py +++ b/tools/power/pm-graph/sleepgraph.py @@ -86,7 +86,7 @@ def ascii(text): # store system values and test parameters class SystemValues: title = 'SleepGraph' - version = '5.11' + version = '5.12' ansi = False rs = 0 display = '' @@ -420,11 +420,11 @@ class SystemValues: return value.format(**args) def setOutputFile(self): if self.dmesgfile != '': - m = re.match('(?P<name>.*)_dmesg\.txt.*', self.dmesgfile) + m = re.match(r'(?P<name>.*)_dmesg\.txt.*', self.dmesgfile) if(m): self.htmlfile = m.group('name')+'.html' if self.ftracefile != '': - m = re.match('(?P<name>.*)_ftrace\.txt.*', self.ftracefile) + m = re.match(r'(?P<name>.*)_ftrace\.txt.*', self.ftracefile) if(m): self.htmlfile = m.group('name')+'.html' def systemInfo(self, info): @@ -464,15 +464,15 @@ class SystemValues: if os.path.exists('/proc/cpuinfo'): with open('/proc/cpuinfo', 'r') as fp: for line in fp: - if re.match('^processor[ \t]*:[ \t]*[0-9]*', line): + if re.match(r'^processor[ \t]*:[ \t]*[0-9]*', line): self.cpucount += 1 if os.path.exists('/proc/meminfo'): with open('/proc/meminfo', 'r') as fp: for line in fp: - m = re.match('^MemTotal:[ \t]*(?P<sz>[0-9]*) *kB', line) + m = re.match(r'^MemTotal:[ \t]*(?P<sz>[0-9]*) *kB', line) if m: self.memtotal = int(m.group('sz')) - m = re.match('^MemFree:[ \t]*(?P<sz>[0-9]*) *kB', line) + m = re.match(r'^MemFree:[ \t]*(?P<sz>[0-9]*) *kB', line) if m: self.memfree = int(m.group('sz')) if os.path.exists('/etc/os-release'): @@ -539,7 +539,7 @@ class SystemValues: idx = line.find('[') if idx > 1: line = line[idx:] - m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) + m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) if(m): ktime = m.group('ktime') break @@ -553,7 +553,7 @@ class SystemValues: idx = line.find('[') if idx > 1: line = line[idx:] - m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) + m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) if(not m): continue ktime = float(m.group('ktime')) @@ -636,11 +636,11 @@ class SystemValues: # now process the args for arg in sorted(args): arglist[arg] = '' - m = re.match('.* '+arg+'=(?P<arg>.*) ', data); + m = re.match(r'.* '+arg+'=(?P<arg>.*) ', data); if m: arglist[arg] = m.group('arg') else: - m = re.match('.* '+arg+'=(?P<arg>.*)', data); + m = re.match(r'.* '+arg+'=(?P<arg>.*)', data); if m: arglist[arg] = m.group('arg') out = fmt.format(**arglist) @@ -989,7 +989,7 @@ class SystemValues: m = re.match(tp.ftrace_line_fmt, line) if(not m or 'device_pm_callback_start' not in line): continue - m = re.match('.*: (?P<drv>.*) (?P<d>.*), parent: *(?P<p>.*), .*', m.group('msg')); + m = re.match(r'.*: (?P<drv>.*) (?P<d>.*), parent: *(?P<p>.*), .*', m.group('msg')); if(not m): continue dev = m.group('d') @@ -999,7 +999,7 @@ class SystemValues: # now get the syspath for each target device for dirname, dirnames, filenames in os.walk('/sys/devices'): - if(re.match('.*/power', dirname) and 'async' in filenames): + if(re.match(r'.*/power', dirname) and 'async' in filenames): dev = dirname.split('/')[-2] if dev in props and (not props[dev].syspath or len(dirname) < len(props[dev].syspath)): props[dev].syspath = dirname[:-6] @@ -1143,12 +1143,12 @@ class SystemValues: elif value and os.path.exists(file): fp = open(file, 'r+') if fmt == 'radio': - m = re.match('.*\[(?P<v>.*)\].*', fp.read()) + m = re.match(r'.*\[(?P<v>.*)\].*', fp.read()) if m: self.cfgdef[file] = m.group('v') elif fmt == 'acpi': line = fp.read().strip().split('\n')[-1] - m = re.match('.* (?P<v>[0-9A-Fx]*) .*', line) + m = re.match(r'.* (?P<v>[0-9A-Fx]*) .*', line) if m: self.cfgdef[file] = m.group('v') else: @@ -1173,7 +1173,7 @@ class SystemValues: fp = Popen([cmd, '-v'], stdout=PIPE, stderr=PIPE).stderr out = ascii(fp.read()).strip() fp.close() - if re.match('turbostat version .*', out): + if re.match(r'turbostat version .*', out): self.vprint(out) return True return False @@ -1181,33 +1181,33 @@ class SystemValues: cmd = self.getExec('turbostat') rawout = keyline = valline = '' fullcmd = '%s -q -S echo freeze > %s' % (cmd, self.powerfile) - fp = Popen(['sh', '-c', fullcmd], stdout=PIPE, stderr=PIPE).stderr - for line in fp: + fp = Popen(['sh', '-c', fullcmd], stdout=PIPE, stderr=PIPE) + for line in fp.stderr: line = ascii(line) rawout += line if keyline and valline: continue - if re.match('(?i)Avg_MHz.*', line): + if re.match(r'(?i)Avg_MHz.*', line): keyline = line.strip().split() elif keyline: valline = line.strip().split() - fp.close() + fp.wait() if not keyline or not valline or len(keyline) != len(valline): errmsg = 'unrecognized turbostat output:\n'+rawout.strip() self.vprint(errmsg) if not self.verbose: pprint(errmsg) - return '' + return (fp.returncode, '') if self.verbose: pprint(rawout.strip()) out = [] for key in keyline: idx = keyline.index(key) val = valline[idx] - if key == 'SYS%LPI' and not s0ixready and re.match('^[0\.]*$', val): + if key == 'SYS%LPI' and not s0ixready and re.match(r'^[0\.]*$', val): continue out.append('%s=%s' % (key, val)) - return '|'.join(out) + return (fp.returncode, '|'.join(out)) def netfixon(self, net='both'): cmd = self.getExec('netfix') if not cmd: @@ -1232,7 +1232,7 @@ class SystemValues: except: return '' for line in reversed(w.split('\n')): - m = re.match(' *(?P<dev>.*): (?P<stat>[0-9a-f]*) .*', line) + m = re.match(r' *(?P<dev>.*): (?P<stat>[0-9a-f]*) .*', line) if not m or (dev and dev != m.group('dev')): continue return m.group('dev') @@ -1261,14 +1261,14 @@ class SystemValues: return arr = msg.split() for j in range(len(arr)): - if re.match('^[0-9,\-\.]*$', arr[j]): - arr[j] = '[0-9,\-\.]*' + if re.match(r'^[0-9,\-\.]*$', arr[j]): + arr[j] = r'[0-9,\-\.]*' else: arr[j] = arr[j]\ - .replace('\\', '\\\\').replace(']', '\]').replace('[', '\[')\ - .replace('.', '\.').replace('+', '\+').replace('*', '\*')\ - .replace('(', '\(').replace(')', '\)').replace('}', '\}')\ - .replace('{', '\{') + .replace('\\', r'\\\\').replace(']', r'\]').replace('[', r'\[')\ + .replace('.', r'\.').replace('+', r'\+').replace('*', r'\*')\ + .replace('(', r'\(').replace(')', r'\)').replace('}', r'\}')\ + .replace('{', r'\{') mstr = ' *'.join(arr) entry = { 'line': msg, @@ -1340,7 +1340,7 @@ class SystemValues: fp = Popen(xset.format('q').split(' '), stdout=PIPE).stdout ret = 'unknown' for line in fp: - m = re.match('[\s]*Monitor is (?P<m>.*)', ascii(line)) + m = re.match(r'[\s]*Monitor is (?P<m>.*)', ascii(line)) if(m and len(m.group('m')) >= 2): out = m.group('m').lower() ret = out[3:] if out[0:2] == 'in' else out @@ -1566,7 +1566,7 @@ class Data: i += 1 if tp.stampInfo(line, sysvals): continue - m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) + m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) if not m: continue t = float(m.group('ktime')) @@ -1574,7 +1574,7 @@ class Data: continue dir = 'suspend' if t < self.tSuspended else 'resume' msg = m.group('msg') - if re.match('capability: warning: .*', msg): + if re.match(r'capability: warning: .*', msg): continue for err in self.errlist: if re.match(self.errlist[err], msg): @@ -1679,8 +1679,8 @@ class Data: ubiquitous = False if kprobename in dtf and 'ub' in dtf[kprobename]: ubiquitous = True - mc = re.match('\(.*\) *(?P<args>.*)', cdata) - mr = re.match('\((?P<caller>\S*).* arg1=(?P<ret>.*)', rdata) + mc = re.match(r'\(.*\) *(?P<args>.*)', cdata) + mr = re.match(r'\((?P<caller>\S*).* arg1=(?P<ret>.*)', rdata) if mc and mr: c = mr.group('caller').split('+')[0] a = mc.group('args').strip() @@ -1997,7 +1997,7 @@ class Data: list = self.dmesg[phase]['list'] mydev = '' for devname in sorted(list): - if name == devname or re.match('^%s\[(?P<num>[0-9]*)\]$' % name, devname): + if name == devname or re.match(r'^%s\[(?P<num>[0-9]*)\]$' % name, devname): mydev = devname if mydev: return list[mydev] @@ -2099,7 +2099,7 @@ class Data: for dev in sorted(list): pdev = list[dev]['par'] pid = list[dev]['pid'] - if(pid < 0 or re.match('[0-9]*-[0-9]*\.[0-9]*[\.0-9]*\:[\.0-9]*$', pdev)): + if(pid < 0 or re.match(r'[0-9]*-[0-9]*\.[0-9]*[\.0-9]*\:[\.0-9]*$', pdev)): continue if pdev and pdev not in real and pdev not in rootlist: rootlist.append(pdev) @@ -2190,26 +2190,26 @@ class Data: if 'resume_complete' in dm: dm['resume_complete']['end'] = time def initcall_debug_call(self, line, quick=False): - m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\ - 'PM: *calling .* @ (?P<n>.*), parent: (?P<p>.*)', line) + m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\ + r'PM: *calling .* @ (?P<n>.*), parent: (?P<p>.*)', line) if not m: - m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\ - 'calling .* @ (?P<n>.*), parent: (?P<p>.*)', line) + m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\ + r'calling .* @ (?P<n>.*), parent: (?P<p>.*)', line) if not m: - m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) calling '+\ - '(?P<f>.*)\+ @ (?P<n>.*), parent: (?P<p>.*)', line) + m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) calling '+\ + r'(?P<f>.*)\+ @ (?P<n>.*), parent: (?P<p>.*)', line) if m: return True if quick else m.group('t', 'f', 'n', 'p') return False if quick else ('', '', '', '') def initcall_debug_return(self, line, quick=False): - m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: PM: '+\ - '.* returned (?P<r>[0-9]*) after (?P<dt>[0-9]*) usecs', line) + m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: PM: '+\ + r'.* returned (?P<r>[0-9]*) after (?P<dt>[0-9]*) usecs', line) if not m: - m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\ - '.* returned (?P<r>[0-9]*) after (?P<dt>[0-9]*) usecs', line) + m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\ + r'.* returned (?P<r>[0-9]*) after (?P<dt>[0-9]*) usecs', line) if not m: - m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) call '+\ - '(?P<f>.*)\+ returned .* after (?P<dt>.*) usecs', line) + m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) call '+\ + r'(?P<f>.*)\+ returned .* after (?P<dt>.*) usecs', line) if m: return True if quick else m.group('t', 'f', 'dt') return False if quick else ('', '', '') @@ -2294,28 +2294,28 @@ class FTraceLine: if not m and not d: return # is this a trace event - if(d == 'traceevent' or re.match('^ *\/\* *(?P<msg>.*) \*\/ *$', m)): + if(d == 'traceevent' or re.match(r'^ *\/\* *(?P<msg>.*) \*\/ *$', m)): if(d == 'traceevent'): # nop format trace event msg = m else: # function_graph format trace event - em = re.match('^ *\/\* *(?P<msg>.*) \*\/ *$', m) + em = re.match(r'^ *\/\* *(?P<msg>.*) \*\/ *$', m) msg = em.group('msg') - emm = re.match('^(?P<call>.*?): (?P<msg>.*)', msg) + emm = re.match(r'^(?P<call>.*?): (?P<msg>.*)', msg) if(emm): self.name = emm.group('msg') self.type = emm.group('call') else: self.name = msg - km = re.match('^(?P<n>.*)_cal$', self.type) + km = re.match(r'^(?P<n>.*)_cal$', self.type) if km: self.fcall = True self.fkprobe = True self.type = km.group('n') return - km = re.match('^(?P<n>.*)_ret$', self.type) + km = re.match(r'^(?P<n>.*)_ret$', self.type) if km: self.freturn = True self.fkprobe = True @@ -2327,7 +2327,7 @@ class FTraceLine: if(d): self.length = float(d)/1000000 # the indentation determines the depth - match = re.match('^(?P<d> *)(?P<o>.*)$', m) + match = re.match(r'^(?P<d> *)(?P<o>.*)$', m) if(not match): return self.depth = self.getDepth(match.group('d')) @@ -2337,7 +2337,7 @@ class FTraceLine: self.freturn = True if(len(m) > 1): # includes comment with function name - match = re.match('^} *\/\* *(?P<n>.*) *\*\/$', m) + match = re.match(r'^} *\/\* *(?P<n>.*) *\*\/$', m) if(match): self.name = match.group('n').strip() # function call @@ -2345,13 +2345,13 @@ class FTraceLine: self.fcall = True # function call with children if(m[-1] == '{'): - match = re.match('^(?P<n>.*) *\(.*', m) + match = re.match(r'^(?P<n>.*) *\(.*', m) if(match): self.name = match.group('n').strip() # function call with no children (leaf) elif(m[-1] == ';'): self.freturn = True - match = re.match('^(?P<n>.*) *\(.*', m) + match = re.match(r'^(?P<n>.*) *\(.*', m) if(match): self.name = match.group('n').strip() # something else (possibly a trace marker) @@ -2385,7 +2385,7 @@ class FTraceLine: return False else: if(self.type == 'suspend_resume' and - re.match('suspend_enter\[.*\] begin', self.name)): + re.match(r'suspend_enter\[.*\] begin', self.name)): return True return False def endMarker(self): @@ -2398,7 +2398,7 @@ class FTraceLine: return False else: if(self.type == 'suspend_resume' and - re.match('thaw_processes\[.*\] end', self.name)): + re.match(r'thaw_processes\[.*\] end', self.name)): return True return False @@ -2976,30 +2976,30 @@ class Timeline: # Description: # A list of values describing the properties of these test runs class TestProps: - stampfmt = '# [a-z]*-(?P<m>[0-9]{2})(?P<d>[0-9]{2})(?P<y>[0-9]{2})-'+\ - '(?P<H>[0-9]{2})(?P<M>[0-9]{2})(?P<S>[0-9]{2})'+\ - ' (?P<host>.*) (?P<mode>.*) (?P<kernel>.*)$' - wififmt = '^# wifi *(?P<d>\S*) *(?P<s>\S*) *(?P<t>[0-9\.]+).*' - tstatfmt = '^# turbostat (?P<t>\S*)' - testerrfmt = '^# enter_sleep_error (?P<e>.*)' - sysinfofmt = '^# sysinfo .*' - cmdlinefmt = '^# command \| (?P<cmd>.*)' - kparamsfmt = '^# kparams \| (?P<kp>.*)' - devpropfmt = '# Device Properties: .*' - pinfofmt = '# platform-(?P<val>[a-z,A-Z,0-9,_]*): (?P<info>.*)' - tracertypefmt = '# tracer: (?P<t>.*)' - firmwarefmt = '# fwsuspend (?P<s>[0-9]*) fwresume (?P<r>[0-9]*)$' - procexecfmt = 'ps - (?P<ps>.*)$' - procmultifmt = '@(?P<n>[0-9]*)\|(?P<ps>.*)$' + stampfmt = r'# [a-z]*-(?P<m>[0-9]{2})(?P<d>[0-9]{2})(?P<y>[0-9]{2})-'+\ + r'(?P<H>[0-9]{2})(?P<M>[0-9]{2})(?P<S>[0-9]{2})'+\ + r' (?P<host>.*) (?P<mode>.*) (?P<kernel>.*)$' + wififmt = r'^# wifi *(?P<d>\S*) *(?P<s>\S*) *(?P<t>[0-9\.]+).*' + tstatfmt = r'^# turbostat (?P<t>\S*)' + testerrfmt = r'^# enter_sleep_error (?P<e>.*)' + sysinfofmt = r'^# sysinfo .*' + cmdlinefmt = r'^# command \| (?P<cmd>.*)' + kparamsfmt = r'^# kparams \| (?P<kp>.*)' + devpropfmt = r'# Device Properties: .*' + pinfofmt = r'# platform-(?P<val>[a-z,A-Z,0-9,_]*): (?P<info>.*)' + tracertypefmt = r'# tracer: (?P<t>.*)' + firmwarefmt = r'# fwsuspend (?P<s>[0-9]*) fwresume (?P<r>[0-9]*)$' + procexecfmt = r'ps - (?P<ps>.*)$' + procmultifmt = r'@(?P<n>[0-9]*)\|(?P<ps>.*)$' ftrace_line_fmt_fg = \ - '^ *(?P<time>[0-9\.]*) *\| *(?P<cpu>[0-9]*)\)'+\ - ' *(?P<proc>.*)-(?P<pid>[0-9]*) *\|'+\ - '[ +!#\*@$]*(?P<dur>[0-9\.]*) .*\| (?P<msg>.*)' + r'^ *(?P<time>[0-9\.]*) *\| *(?P<cpu>[0-9]*)\)'+\ + r' *(?P<proc>.*)-(?P<pid>[0-9]*) *\|'+\ + r'[ +!#\*@$]*(?P<dur>[0-9\.]*) .*\| (?P<msg>.*)' ftrace_line_fmt_nop = \ - ' *(?P<proc>.*)-(?P<pid>[0-9]*) *\[(?P<cpu>[0-9]*)\] *'+\ - '(?P<flags>\S*) *(?P<time>[0-9\.]*): *'+\ - '(?P<msg>.*)' - machinesuspend = 'machine_suspend\[.*' + r' *(?P<proc>.*)-(?P<pid>[0-9]*) *\[(?P<cpu>[0-9]*)\] *'+\ + r'(?P<flags>\S*) *(?P<time>[0-9\.]*): *'+\ + r'(?P<msg>.*)' + machinesuspend = r'machine_suspend\[.*' multiproclist = dict() multiproctime = 0.0 multiproccnt = 0 @@ -3081,14 +3081,14 @@ class TestProps: sv.hostname = data.stamp['host'] sv.suspendmode = data.stamp['mode'] if sv.suspendmode == 'freeze': - self.machinesuspend = 'timekeeping_freeze\[.*' + self.machinesuspend = r'timekeeping_freeze\[.*' else: - self.machinesuspend = 'machine_suspend\[.*' + self.machinesuspend = r'machine_suspend\[.*' if sv.suspendmode == 'command' and sv.ftracefile != '': modes = ['on', 'freeze', 'standby', 'mem', 'disk'] fp = sv.openlog(sv.ftracefile, 'r') for line in fp: - m = re.match('.* machine_suspend\[(?P<mode>.*)\]', line) + m = re.match(r'.* machine_suspend\[(?P<mode>.*)\]', line) if m and m.group('mode') in ['1', '2', '3', '4']: sv.suspendmode = modes[int(m.group('mode'))] data.stamp['mode'] = sv.suspendmode @@ -3401,9 +3401,9 @@ def loadTraceLog(): for i in range(len(blk)): if 'SUSPEND START' in blk[i][3]: first.append(i) - elif re.match('.* timekeeping_freeze.*begin', blk[i][3]): + elif re.match(r'.* timekeeping_freeze.*begin', blk[i][3]): last.append(i) - elif re.match('.* timekeeping_freeze.*end', blk[i][3]): + elif re.match(r'.* timekeeping_freeze.*end', blk[i][3]): first.append(i) elif 'RESUME COMPLETE' in blk[i][3]: last.append(i) @@ -3514,28 +3514,28 @@ def parseTraceLog(live=False): if(t.fevent): if(t.type == 'suspend_resume'): # suspend_resume trace events have two types, begin and end - if(re.match('(?P<name>.*) begin$', t.name)): + if(re.match(r'(?P<name>.*) begin$', t.name)): isbegin = True - elif(re.match('(?P<name>.*) end$', t.name)): + elif(re.match(r'(?P<name>.*) end$', t.name)): isbegin = False else: continue if '[' in t.name: - m = re.match('(?P<name>.*)\[.*', t.name) + m = re.match(r'(?P<name>.*)\[.*', t.name) else: - m = re.match('(?P<name>.*) .*', t.name) + m = re.match(r'(?P<name>.*) .*', t.name) name = m.group('name') # ignore these events if(name.split('[')[0] in tracewatch): continue # -- phase changes -- # start of kernel suspend - if(re.match('suspend_enter\[.*', t.name)): + if(re.match(r'suspend_enter\[.*', t.name)): if(isbegin and data.tKernSus == 0): data.tKernSus = t.time continue # suspend_prepare start - elif(re.match('dpm_prepare\[.*', t.name)): + elif(re.match(r'dpm_prepare\[.*', t.name)): if isbegin and data.first_suspend_prepare: data.first_suspend_prepare = False if data.tKernSus == 0: @@ -3544,15 +3544,15 @@ def parseTraceLog(live=False): phase = data.setPhase('suspend_prepare', t.time, isbegin) continue # suspend start - elif(re.match('dpm_suspend\[.*', t.name)): + elif(re.match(r'dpm_suspend\[.*', t.name)): phase = data.setPhase('suspend', t.time, isbegin) continue # suspend_late start - elif(re.match('dpm_suspend_late\[.*', t.name)): + elif(re.match(r'dpm_suspend_late\[.*', t.name)): phase = data.setPhase('suspend_late', t.time, isbegin) continue # suspend_noirq start - elif(re.match('dpm_suspend_noirq\[.*', t.name)): + elif(re.match(r'dpm_suspend_noirq\[.*', t.name)): phase = data.setPhase('suspend_noirq', t.time, isbegin) continue # suspend_machine/resume_machine @@ -3589,19 +3589,19 @@ def parseTraceLog(live=False): data.tResumed = t.time continue # resume_noirq start - elif(re.match('dpm_resume_noirq\[.*', t.name)): + elif(re.match(r'dpm_resume_noirq\[.*', t.name)): phase = data.setPhase('resume_noirq', t.time, isbegin) continue # resume_early start - elif(re.match('dpm_resume_early\[.*', t.name)): + elif(re.match(r'dpm_resume_early\[.*', t.name)): phase = data.setPhase('resume_early', t.time, isbegin) continue # resume start - elif(re.match('dpm_resume\[.*', t.name)): + elif(re.match(r'dpm_resume\[.*', t.name)): phase = data.setPhase('resume', t.time, isbegin) continue # resume complete start - elif(re.match('dpm_complete\[.*', t.name)): + elif(re.match(r'dpm_complete\[.*', t.name)): phase = data.setPhase('resume_complete', t.time, isbegin) continue # skip trace events inside devices calls @@ -3635,7 +3635,7 @@ def parseTraceLog(live=False): elif(t.type == 'device_pm_callback_start'): if phase not in data.dmesg: continue - m = re.match('(?P<drv>.*) (?P<d>.*), parent: *(?P<p>.*), .*',\ + m = re.match(r'(?P<drv>.*) (?P<d>.*), parent: *(?P<p>.*), .*',\ t.name); if(not m): continue @@ -3650,7 +3650,7 @@ def parseTraceLog(live=False): elif(t.type == 'device_pm_callback_end'): if phase not in data.dmesg: continue - m = re.match('(?P<drv>.*) (?P<d>.*), err.*', t.name); + m = re.match(r'(?P<drv>.*) (?P<d>.*), err.*', t.name); if(not m): continue n = m.group('d') @@ -3904,24 +3904,24 @@ def loadKernelLog(): line = line[idx:] if tp.stampInfo(line, sysvals): continue - m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) + m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) if(not m): continue msg = m.group("msg") - if re.match('PM: Syncing filesystems.*', msg) or \ - re.match('PM: suspend entry.*', msg): + if re.match(r'PM: Syncing filesystems.*', msg) or \ + re.match(r'PM: suspend entry.*', msg): if(data): testruns.append(data) data = Data(len(testruns)) tp.parseStamp(data, sysvals) if(not data): continue - m = re.match('.* *(?P<k>[0-9]\.[0-9]{2}\.[0-9]-.*) .*', msg) + m = re.match(r'.* *(?P<k>[0-9]\.[0-9]{2}\.[0-9]-.*) .*', msg) if(m): sysvals.stamp['kernel'] = m.group('k') - m = re.match('PM: Preparing system for (?P<m>.*) sleep', msg) + m = re.match(r'PM: Preparing system for (?P<m>.*) sleep', msg) if not m: - m = re.match('PM: Preparing system for sleep \((?P<m>.*)\)', msg) + m = re.match(r'PM: Preparing system for sleep \((?P<m>.*)\)', msg) if m: sysvals.stamp['mode'] = sysvals.suspendmode = m.group('m') data.dmesgtext.append(line) @@ -3984,7 +3984,7 @@ def parseKernelLog(data): 'resume_machine': ['[PM: ]*Timekeeping suspended for.*', 'ACPI: Low-level resume complete.*', 'ACPI: resume from mwait', - 'Suspended for [0-9\.]* seconds'], + r'Suspended for [0-9\.]* seconds'], 'resume_noirq': ['PM: resume from suspend-to-idle', 'ACPI: Waking up from system sleep state.*'], 'resume_early': ['PM: noirq resume of devices complete after.*', @@ -3993,7 +3993,7 @@ def parseKernelLog(data): 'PM: early restore of devices complete after.*'], 'resume_complete': ['PM: resume of devices complete after.*', 'PM: restore of devices complete after.*'], - 'post_resume': ['.*Restarting tasks \.\.\..*'], + 'post_resume': [r'.*Restarting tasks \.\.\..*'], } # action table (expected events that occur and show up in dmesg) @@ -4021,7 +4021,7 @@ def parseKernelLog(data): actions = dict() for line in data.dmesgtext: # parse each dmesg line into the time and message - m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) + m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) if(m): val = m.group('ktime') try: @@ -4145,26 +4145,26 @@ def parseKernelLog(data): if(a in actions and actions[a][-1]['begin'] == actions[a][-1]['end']): actions[a][-1]['end'] = ktime # now look for CPU on/off events - if(re.match('Disabling non-boot CPUs .*', msg)): + if(re.match(r'Disabling non-boot CPUs .*', msg)): # start of first cpu suspend cpu_start = ktime - elif(re.match('Enabling non-boot CPUs .*', msg)): + elif(re.match(r'Enabling non-boot CPUs .*', msg)): # start of first cpu resume cpu_start = ktime - elif(re.match('smpboot: CPU (?P<cpu>[0-9]*) is now offline', msg) \ - or re.match('psci: CPU(?P<cpu>[0-9]*) killed.*', msg)): + elif(re.match(r'smpboot: CPU (?P<cpu>[0-9]*) is now offline', msg) \ + or re.match(r'psci: CPU(?P<cpu>[0-9]*) killed.*', msg)): # end of a cpu suspend, start of the next - m = re.match('smpboot: CPU (?P<cpu>[0-9]*) is now offline', msg) + m = re.match(r'smpboot: CPU (?P<cpu>[0-9]*) is now offline', msg) if(not m): - m = re.match('psci: CPU(?P<cpu>[0-9]*) killed.*', msg) + m = re.match(r'psci: CPU(?P<cpu>[0-9]*) killed.*', msg) cpu = 'CPU'+m.group('cpu') if(cpu not in actions): actions[cpu] = [] actions[cpu].append({'begin': cpu_start, 'end': ktime}) cpu_start = ktime - elif(re.match('CPU(?P<cpu>[0-9]*) is up', msg)): + elif(re.match(r'CPU(?P<cpu>[0-9]*) is up', msg)): # end of a cpu resume, start of the next - m = re.match('CPU(?P<cpu>[0-9]*) is up', msg) + m = re.match(r'CPU(?P<cpu>[0-9]*) is up', msg) cpu = 'CPU'+m.group('cpu') if(cpu not in actions): actions[cpu] = [] @@ -4343,7 +4343,8 @@ def createHTMLSummarySimple(testruns, htmlfile, title): list[mode]['data'].append([data['host'], data['kernel'], data['time'], tVal[0], tVal[1], data['url'], res, data['issues'], data['sus_worst'], data['sus_worsttime'], - data['res_worst'], data['res_worsttime'], pkgpc10, syslpi, wifi]) + data['res_worst'], data['res_worsttime'], pkgpc10, syslpi, wifi, + (data['fullmode'] if 'fullmode' in data else mode)]) idx = len(list[mode]['data']) - 1 if res.startswith('fail in'): res = 'fail' @@ -4449,7 +4450,7 @@ def createHTMLSummarySimple(testruns, htmlfile, title): elif idx == iMed[i]: tHigh[i] = ' id="%smed" class=medval title="Median"' % tag html += td.format("%d" % (list[mode]['data'].index(d) + 1)) # row - html += td.format(mode) # mode + html += td.format(d[15]) # mode html += td.format(d[0]) # host html += td.format(d[1]) # kernel html += td.format(d[2]) # time @@ -5061,6 +5062,7 @@ def addCSS(hf, sv, testcount=1, kerror=False, extra=''): def addScriptCode(hf, testruns): t0 = testruns[0].start * 1000 tMax = testruns[-1].end * 1000 + hf.write('<script type="text/javascript">\n'); # create an array in javascript memory with the device details detail = ' var devtable = [];\n' for data in testruns: @@ -5068,384 +5070,383 @@ def addScriptCode(hf, testruns): detail += ' devtable[%d] = "%s";\n' % (data.testnumber, topo) detail += ' var bounds = [%f,%f];\n' % (t0, tMax) # add the code which will manipulate the data in the browser - script_code = \ - '<script type="text/javascript">\n'+detail+\ - ' var resolution = -1;\n'\ - ' var dragval = [0, 0];\n'\ - ' function redrawTimescale(t0, tMax, tS) {\n'\ - ' var rline = \'<div class="t" style="left:0;border-left:1px solid black;border-right:0;">\';\n'\ - ' var tTotal = tMax - t0;\n'\ - ' var list = document.getElementsByClassName("tblock");\n'\ - ' for (var i = 0; i < list.length; i++) {\n'\ - ' var timescale = list[i].getElementsByClassName("timescale")[0];\n'\ - ' var m0 = t0 + (tTotal*parseFloat(list[i].style.left)/100);\n'\ - ' var mTotal = tTotal*parseFloat(list[i].style.width)/100;\n'\ - ' var mMax = m0 + mTotal;\n'\ - ' var html = "";\n'\ - ' var divTotal = Math.floor(mTotal/tS) + 1;\n'\ - ' if(divTotal > 1000) continue;\n'\ - ' var divEdge = (mTotal - tS*(divTotal-1))*100/mTotal;\n'\ - ' var pos = 0.0, val = 0.0;\n'\ - ' for (var j = 0; j < divTotal; j++) {\n'\ - ' var htmlline = "";\n'\ - ' var mode = list[i].id[5];\n'\ - ' if(mode == "s") {\n'\ - ' pos = 100 - (((j)*tS*100)/mTotal) - divEdge;\n'\ - ' val = (j-divTotal+1)*tS;\n'\ - ' if(j == divTotal - 1)\n'\ - ' htmlline = \'<div class="t" style="right:\'+pos+\'%"><cS>S→</cS></div>\';\n'\ - ' else\n'\ - ' htmlline = \'<div class="t" style="right:\'+pos+\'%">\'+val+\'ms</div>\';\n'\ - ' } else {\n'\ - ' pos = 100 - (((j)*tS*100)/mTotal);\n'\ - ' val = (j)*tS;\n'\ - ' htmlline = \'<div class="t" style="right:\'+pos+\'%">\'+val+\'ms</div>\';\n'\ - ' if(j == 0)\n'\ - ' if(mode == "r")\n'\ - ' htmlline = rline+"<cS>←R</cS></div>";\n'\ - ' else\n'\ - ' htmlline = rline+"<cS>0ms</div>";\n'\ - ' }\n'\ - ' html += htmlline;\n'\ - ' }\n'\ - ' timescale.innerHTML = html;\n'\ - ' }\n'\ - ' }\n'\ - ' function zoomTimeline() {\n'\ - ' var dmesg = document.getElementById("dmesg");\n'\ - ' var zoombox = document.getElementById("dmesgzoombox");\n'\ - ' var left = zoombox.scrollLeft;\n'\ - ' var val = parseFloat(dmesg.style.width);\n'\ - ' var newval = 100;\n'\ - ' var sh = window.outerWidth / 2;\n'\ - ' if(this.id == "zoomin") {\n'\ - ' newval = val * 1.2;\n'\ - ' if(newval > 910034) newval = 910034;\n'\ - ' dmesg.style.width = newval+"%";\n'\ - ' zoombox.scrollLeft = ((left + sh) * newval / val) - sh;\n'\ - ' } else if (this.id == "zoomout") {\n'\ - ' newval = val / 1.2;\n'\ - ' if(newval < 100) newval = 100;\n'\ - ' dmesg.style.width = newval+"%";\n'\ - ' zoombox.scrollLeft = ((left + sh) * newval / val) - sh;\n'\ - ' } else {\n'\ - ' zoombox.scrollLeft = 0;\n'\ - ' dmesg.style.width = "100%";\n'\ - ' }\n'\ - ' var tS = [10000, 5000, 2000, 1000, 500, 200, 100, 50, 20, 10, 5, 2, 1];\n'\ - ' var t0 = bounds[0];\n'\ - ' var tMax = bounds[1];\n'\ - ' var tTotal = tMax - t0;\n'\ - ' var wTotal = tTotal * 100.0 / newval;\n'\ - ' var idx = 7*window.innerWidth/1100;\n'\ - ' for(var i = 0; (i < tS.length)&&((wTotal / tS[i]) < idx); i++);\n'\ - ' if(i >= tS.length) i = tS.length - 1;\n'\ - ' if(tS[i] == resolution) return;\n'\ - ' resolution = tS[i];\n'\ - ' redrawTimescale(t0, tMax, tS[i]);\n'\ - ' }\n'\ - ' function deviceName(title) {\n'\ - ' var name = title.slice(0, title.indexOf(" ("));\n'\ - ' return name;\n'\ - ' }\n'\ - ' function deviceHover() {\n'\ - ' var name = deviceName(this.title);\n'\ - ' var dmesg = document.getElementById("dmesg");\n'\ - ' var dev = dmesg.getElementsByClassName("thread");\n'\ - ' var cpu = -1;\n'\ - ' if(name.match("CPU_ON\[[0-9]*\]"))\n'\ - ' cpu = parseInt(name.slice(7));\n'\ - ' else if(name.match("CPU_OFF\[[0-9]*\]"))\n'\ - ' cpu = parseInt(name.slice(8));\n'\ - ' for (var i = 0; i < dev.length; i++) {\n'\ - ' dname = deviceName(dev[i].title);\n'\ - ' var cname = dev[i].className.slice(dev[i].className.indexOf("thread"));\n'\ - ' if((cpu >= 0 && dname.match("CPU_O[NF]*\\\[*"+cpu+"\\\]")) ||\n'\ - ' (name == dname))\n'\ - ' {\n'\ - ' dev[i].className = "hover "+cname;\n'\ - ' } else {\n'\ - ' dev[i].className = cname;\n'\ - ' }\n'\ - ' }\n'\ - ' }\n'\ - ' function deviceUnhover() {\n'\ - ' var dmesg = document.getElementById("dmesg");\n'\ - ' var dev = dmesg.getElementsByClassName("thread");\n'\ - ' for (var i = 0; i < dev.length; i++) {\n'\ - ' dev[i].className = dev[i].className.slice(dev[i].className.indexOf("thread"));\n'\ - ' }\n'\ - ' }\n'\ - ' function deviceTitle(title, total, cpu) {\n'\ - ' var prefix = "Total";\n'\ - ' if(total.length > 3) {\n'\ - ' prefix = "Average";\n'\ - ' total[1] = (total[1]+total[3])/2;\n'\ - ' total[2] = (total[2]+total[4])/2;\n'\ - ' }\n'\ - ' var devtitle = document.getElementById("devicedetailtitle");\n'\ - ' var name = deviceName(title);\n'\ - ' if(cpu >= 0) name = "CPU"+cpu;\n'\ - ' var driver = "";\n'\ - ' var tS = "<t2>(</t2>";\n'\ - ' var tR = "<t2>)</t2>";\n'\ - ' if(total[1] > 0)\n'\ - ' tS = "<t2>("+prefix+" Suspend:</t2><t0> "+total[1].toFixed(3)+" ms</t0> ";\n'\ - ' if(total[2] > 0)\n'\ - ' tR = " <t2>"+prefix+" Resume:</t2><t0> "+total[2].toFixed(3)+" ms<t2>)</t2></t0>";\n'\ - ' var s = title.indexOf("{");\n'\ - ' var e = title.indexOf("}");\n'\ - ' if((s >= 0) && (e >= 0))\n'\ - ' driver = title.slice(s+1, e) + " <t1>@</t1> ";\n'\ - ' if(total[1] > 0 && total[2] > 0)\n'\ - ' devtitle.innerHTML = "<t0>"+driver+name+"</t0> "+tS+tR;\n'\ - ' else\n'\ - ' devtitle.innerHTML = "<t0>"+title+"</t0>";\n'\ - ' return name;\n'\ - ' }\n'\ - ' function deviceDetail() {\n'\ - ' var devinfo = document.getElementById("devicedetail");\n'\ - ' devinfo.style.display = "block";\n'\ - ' var name = deviceName(this.title);\n'\ - ' var cpu = -1;\n'\ - ' if(name.match("CPU_ON\[[0-9]*\]"))\n'\ - ' cpu = parseInt(name.slice(7));\n'\ - ' else if(name.match("CPU_OFF\[[0-9]*\]"))\n'\ - ' cpu = parseInt(name.slice(8));\n'\ - ' var dmesg = document.getElementById("dmesg");\n'\ - ' var dev = dmesg.getElementsByClassName("thread");\n'\ - ' var idlist = [];\n'\ - ' var pdata = [[]];\n'\ - ' if(document.getElementById("devicedetail1"))\n'\ - ' pdata = [[], []];\n'\ - ' var pd = pdata[0];\n'\ - ' var total = [0.0, 0.0, 0.0];\n'\ - ' for (var i = 0; i < dev.length; i++) {\n'\ - ' dname = deviceName(dev[i].title);\n'\ - ' if((cpu >= 0 && dname.match("CPU_O[NF]*\\\[*"+cpu+"\\\]")) ||\n'\ - ' (name == dname))\n'\ - ' {\n'\ - ' idlist[idlist.length] = dev[i].id;\n'\ - ' var tidx = 1;\n'\ - ' if(dev[i].id[0] == "a") {\n'\ - ' pd = pdata[0];\n'\ - ' } else {\n'\ - ' if(pdata.length == 1) pdata[1] = [];\n'\ - ' if(total.length == 3) total[3]=total[4]=0.0;\n'\ - ' pd = pdata[1];\n'\ - ' tidx = 3;\n'\ - ' }\n'\ - ' var info = dev[i].title.split(" ");\n'\ - ' var pname = info[info.length-1];\n'\ - ' pd[pname] = parseFloat(info[info.length-3].slice(1));\n'\ - ' total[0] += pd[pname];\n'\ - ' if(pname.indexOf("suspend") >= 0)\n'\ - ' total[tidx] += pd[pname];\n'\ - ' else\n'\ - ' total[tidx+1] += pd[pname];\n'\ - ' }\n'\ - ' }\n'\ - ' var devname = deviceTitle(this.title, total, cpu);\n'\ - ' var left = 0.0;\n'\ - ' for (var t = 0; t < pdata.length; t++) {\n'\ - ' pd = pdata[t];\n'\ - ' devinfo = document.getElementById("devicedetail"+t);\n'\ - ' var phases = devinfo.getElementsByClassName("phaselet");\n'\ - ' for (var i = 0; i < phases.length; i++) {\n'\ - ' if(phases[i].id in pd) {\n'\ - ' var w = 100.0*pd[phases[i].id]/total[0];\n'\ - ' var fs = 32;\n'\ - ' if(w < 8) fs = 4*w | 0;\n'\ - ' var fs2 = fs*3/4;\n'\ - ' phases[i].style.width = w+"%";\n'\ - ' phases[i].style.left = left+"%";\n'\ - ' phases[i].title = phases[i].id+" "+pd[phases[i].id]+" ms";\n'\ - ' left += w;\n'\ - ' var time = "<t4 style=\\"font-size:"+fs+"px\\">"+pd[phases[i].id]+" ms<br></t4>";\n'\ - ' var pname = "<t3 style=\\"font-size:"+fs2+"px\\">"+phases[i].id.replace(new RegExp("_", "g"), " ")+"</t3>";\n'\ - ' phases[i].innerHTML = time+pname;\n'\ - ' } else {\n'\ - ' phases[i].style.width = "0%";\n'\ - ' phases[i].style.left = left+"%";\n'\ - ' }\n'\ - ' }\n'\ - ' }\n'\ - ' if(typeof devstats !== \'undefined\')\n'\ - ' callDetail(this.id, this.title);\n'\ - ' var cglist = document.getElementById("callgraphs");\n'\ - ' if(!cglist) return;\n'\ - ' var cg = cglist.getElementsByClassName("atop");\n'\ - ' if(cg.length < 10) return;\n'\ - ' for (var i = 0; i < cg.length; i++) {\n'\ - ' cgid = cg[i].id.split("x")[0]\n'\ - ' if(idlist.indexOf(cgid) >= 0) {\n'\ - ' cg[i].style.display = "block";\n'\ - ' } else {\n'\ - ' cg[i].style.display = "none";\n'\ - ' }\n'\ - ' }\n'\ - ' }\n'\ - ' function callDetail(devid, devtitle) {\n'\ - ' if(!(devid in devstats) || devstats[devid].length < 1)\n'\ - ' return;\n'\ - ' var list = devstats[devid];\n'\ - ' var tmp = devtitle.split(" ");\n'\ - ' var name = tmp[0], phase = tmp[tmp.length-1];\n'\ - ' var dd = document.getElementById(phase);\n'\ - ' var total = parseFloat(tmp[1].slice(1));\n'\ - ' var mlist = [];\n'\ - ' var maxlen = 0;\n'\ - ' var info = []\n'\ - ' for(var i in list) {\n'\ - ' if(list[i][0] == "@") {\n'\ - ' info = list[i].split("|");\n'\ - ' continue;\n'\ - ' }\n'\ - ' var tmp = list[i].split("|");\n'\ - ' var t = parseFloat(tmp[0]), f = tmp[1], c = parseInt(tmp[2]);\n'\ - ' var p = (t*100.0/total).toFixed(2);\n'\ - ' mlist[mlist.length] = [f, c, t.toFixed(2), p+"%"];\n'\ - ' if(f.length > maxlen)\n'\ - ' maxlen = f.length;\n'\ - ' }\n'\ - ' var pad = 5;\n'\ - ' if(mlist.length == 0) pad = 30;\n'\ - ' var html = \'<div style="padding-top:\'+pad+\'px"><t3> <b>\'+name+\':</b>\';\n'\ - ' if(info.length > 2)\n'\ - ' html += " start=<b>"+info[1]+"</b>, end=<b>"+info[2]+"</b>";\n'\ - ' if(info.length > 3)\n'\ - ' html += ", length<i>(w/o overhead)</i>=<b>"+info[3]+" ms</b>";\n'\ - ' if(info.length > 4)\n'\ - ' html += ", return=<b>"+info[4]+"</b>";\n'\ - ' html += "</t3></div>";\n'\ - ' if(mlist.length > 0) {\n'\ - ' html += \'<table class=fstat style="padding-top:\'+(maxlen*5)+\'px;"><tr><th>Function</th>\';\n'\ - ' for(var i in mlist)\n'\ - ' html += "<td class=vt>"+mlist[i][0]+"</td>";\n'\ - ' html += "</tr><tr><th>Calls</th>";\n'\ - ' for(var i in mlist)\n'\ - ' html += "<td>"+mlist[i][1]+"</td>";\n'\ - ' html += "</tr><tr><th>Time(ms)</th>";\n'\ - ' for(var i in mlist)\n'\ - ' html += "<td>"+mlist[i][2]+"</td>";\n'\ - ' html += "</tr><tr><th>Percent</th>";\n'\ - ' for(var i in mlist)\n'\ - ' html += "<td>"+mlist[i][3]+"</td>";\n'\ - ' html += "</tr></table>";\n'\ - ' }\n'\ - ' dd.innerHTML = html;\n'\ - ' var height = (maxlen*5)+100;\n'\ - ' dd.style.height = height+"px";\n'\ - ' document.getElementById("devicedetail").style.height = height+"px";\n'\ - ' }\n'\ - ' function callSelect() {\n'\ - ' var cglist = document.getElementById("callgraphs");\n'\ - ' if(!cglist) return;\n'\ - ' var cg = cglist.getElementsByClassName("atop");\n'\ - ' for (var i = 0; i < cg.length; i++) {\n'\ - ' if(this.id == cg[i].id) {\n'\ - ' cg[i].style.display = "block";\n'\ - ' } else {\n'\ - ' cg[i].style.display = "none";\n'\ - ' }\n'\ - ' }\n'\ - ' }\n'\ - ' function devListWindow(e) {\n'\ - ' var win = window.open();\n'\ - ' var html = "<title>"+e.target.innerHTML+"</title>"+\n'\ - ' "<style type=\\"text/css\\">"+\n'\ - ' " ul {list-style-type:circle;padding-left:10px;margin-left:10px;}"+\n'\ - ' "</style>"\n'\ - ' var dt = devtable[0];\n'\ - ' if(e.target.id != "devlist1")\n'\ - ' dt = devtable[1];\n'\ - ' win.document.write(html+dt);\n'\ - ' }\n'\ - ' function errWindow() {\n'\ - ' var range = this.id.split("_");\n'\ - ' var idx1 = parseInt(range[0]);\n'\ - ' var idx2 = parseInt(range[1]);\n'\ - ' var win = window.open();\n'\ - ' var log = document.getElementById("dmesglog");\n'\ - ' var title = "<title>dmesg log</title>";\n'\ - ' var text = log.innerHTML.split("\\n");\n'\ - ' var html = "";\n'\ - ' for(var i = 0; i < text.length; i++) {\n'\ - ' if(i == idx1) {\n'\ - ' html += "<e id=target>"+text[i]+"</e>\\n";\n'\ - ' } else if(i > idx1 && i <= idx2) {\n'\ - ' html += "<e>"+text[i]+"</e>\\n";\n'\ - ' } else {\n'\ - ' html += text[i]+"\\n";\n'\ - ' }\n'\ - ' }\n'\ - ' win.document.write("<style>e{color:red}</style>"+title+"<pre>"+html+"</pre>");\n'\ - ' win.location.hash = "#target";\n'\ - ' win.document.close();\n'\ - ' }\n'\ - ' function logWindow(e) {\n'\ - ' var name = e.target.id.slice(4);\n'\ - ' var win = window.open();\n'\ - ' var log = document.getElementById(name+"log");\n'\ - ' var title = "<title>"+document.title.split(" ")[0]+" "+name+" log</title>";\n'\ - ' win.document.write(title+"<pre>"+log.innerHTML+"</pre>");\n'\ - ' win.document.close();\n'\ - ' }\n'\ - ' function onMouseDown(e) {\n'\ - ' dragval[0] = e.clientX;\n'\ - ' dragval[1] = document.getElementById("dmesgzoombox").scrollLeft;\n'\ - ' document.onmousemove = onMouseMove;\n'\ - ' }\n'\ - ' function onMouseMove(e) {\n'\ - ' var zoombox = document.getElementById("dmesgzoombox");\n'\ - ' zoombox.scrollLeft = dragval[1] + dragval[0] - e.clientX;\n'\ - ' }\n'\ - ' function onMouseUp(e) {\n'\ - ' document.onmousemove = null;\n'\ - ' }\n'\ - ' function onKeyPress(e) {\n'\ - ' var c = e.charCode;\n'\ - ' if(c != 42 && c != 43 && c != 45) return;\n'\ - ' var click = document.createEvent("Events");\n'\ - ' click.initEvent("click", true, false);\n'\ - ' if(c == 43) \n'\ - ' document.getElementById("zoomin").dispatchEvent(click);\n'\ - ' else if(c == 45)\n'\ - ' document.getElementById("zoomout").dispatchEvent(click);\n'\ - ' else if(c == 42)\n'\ - ' document.getElementById("zoomdef").dispatchEvent(click);\n'\ - ' }\n'\ - ' window.addEventListener("resize", function () {zoomTimeline();});\n'\ - ' window.addEventListener("load", function () {\n'\ - ' var dmesg = document.getElementById("dmesg");\n'\ - ' dmesg.style.width = "100%"\n'\ - ' dmesg.onmousedown = onMouseDown;\n'\ - ' document.onmouseup = onMouseUp;\n'\ - ' document.onkeypress = onKeyPress;\n'\ - ' document.getElementById("zoomin").onclick = zoomTimeline;\n'\ - ' document.getElementById("zoomout").onclick = zoomTimeline;\n'\ - ' document.getElementById("zoomdef").onclick = zoomTimeline;\n'\ - ' var list = document.getElementsByClassName("err");\n'\ - ' for (var i = 0; i < list.length; i++)\n'\ - ' list[i].onclick = errWindow;\n'\ - ' var list = document.getElementsByClassName("logbtn");\n'\ - ' for (var i = 0; i < list.length; i++)\n'\ - ' list[i].onclick = logWindow;\n'\ - ' list = document.getElementsByClassName("devlist");\n'\ - ' for (var i = 0; i < list.length; i++)\n'\ - ' list[i].onclick = devListWindow;\n'\ - ' var dev = dmesg.getElementsByClassName("thread");\n'\ - ' for (var i = 0; i < dev.length; i++) {\n'\ - ' dev[i].onclick = deviceDetail;\n'\ - ' dev[i].onmouseover = deviceHover;\n'\ - ' dev[i].onmouseout = deviceUnhover;\n'\ - ' }\n'\ - ' var dev = dmesg.getElementsByClassName("srccall");\n'\ - ' for (var i = 0; i < dev.length; i++)\n'\ - ' dev[i].onclick = callSelect;\n'\ - ' zoomTimeline();\n'\ - ' });\n'\ - '</script>\n' + hf.write(detail); + script_code = r""" var resolution = -1; + var dragval = [0, 0]; + function redrawTimescale(t0, tMax, tS) { + var rline = '<div class="t" style="left:0;border-left:1px solid black;border-right:0;">'; + var tTotal = tMax - t0; + var list = document.getElementsByClassName("tblock"); + for (var i = 0; i < list.length; i++) { + var timescale = list[i].getElementsByClassName("timescale")[0]; + var m0 = t0 + (tTotal*parseFloat(list[i].style.left)/100); + var mTotal = tTotal*parseFloat(list[i].style.width)/100; + var mMax = m0 + mTotal; + var html = ""; + var divTotal = Math.floor(mTotal/tS) + 1; + if(divTotal > 1000) continue; + var divEdge = (mTotal - tS*(divTotal-1))*100/mTotal; + var pos = 0.0, val = 0.0; + for (var j = 0; j < divTotal; j++) { + var htmlline = ""; + var mode = list[i].id[5]; + if(mode == "s") { + pos = 100 - (((j)*tS*100)/mTotal) - divEdge; + val = (j-divTotal+1)*tS; + if(j == divTotal - 1) + htmlline = '<div class="t" style="right:'+pos+'%"><cS>S→</cS></div>'; + else + htmlline = '<div class="t" style="right:'+pos+'%">'+val+'ms</div>'; + } else { + pos = 100 - (((j)*tS*100)/mTotal); + val = (j)*tS; + htmlline = '<div class="t" style="right:'+pos+'%">'+val+'ms</div>'; + if(j == 0) + if(mode == "r") + htmlline = rline+"<cS>←R</cS></div>"; + else + htmlline = rline+"<cS>0ms</div>"; + } + html += htmlline; + } + timescale.innerHTML = html; + } + } + function zoomTimeline() { + var dmesg = document.getElementById("dmesg"); + var zoombox = document.getElementById("dmesgzoombox"); + var left = zoombox.scrollLeft; + var val = parseFloat(dmesg.style.width); + var newval = 100; + var sh = window.outerWidth / 2; + if(this.id == "zoomin") { + newval = val * 1.2; + if(newval > 910034) newval = 910034; + dmesg.style.width = newval+"%"; + zoombox.scrollLeft = ((left + sh) * newval / val) - sh; + } else if (this.id == "zoomout") { + newval = val / 1.2; + if(newval < 100) newval = 100; + dmesg.style.width = newval+"%"; + zoombox.scrollLeft = ((left + sh) * newval / val) - sh; + } else { + zoombox.scrollLeft = 0; + dmesg.style.width = "100%"; + } + var tS = [10000, 5000, 2000, 1000, 500, 200, 100, 50, 20, 10, 5, 2, 1]; + var t0 = bounds[0]; + var tMax = bounds[1]; + var tTotal = tMax - t0; + var wTotal = tTotal * 100.0 / newval; + var idx = 7*window.innerWidth/1100; + for(var i = 0; (i < tS.length)&&((wTotal / tS[i]) < idx); i++); + if(i >= tS.length) i = tS.length - 1; + if(tS[i] == resolution) return; + resolution = tS[i]; + redrawTimescale(t0, tMax, tS[i]); + } + function deviceName(title) { + var name = title.slice(0, title.indexOf(" (")); + return name; + } + function deviceHover() { + var name = deviceName(this.title); + var dmesg = document.getElementById("dmesg"); + var dev = dmesg.getElementsByClassName("thread"); + var cpu = -1; + if(name.match("CPU_ON\[[0-9]*\]")) + cpu = parseInt(name.slice(7)); + else if(name.match("CPU_OFF\[[0-9]*\]")) + cpu = parseInt(name.slice(8)); + for (var i = 0; i < dev.length; i++) { + dname = deviceName(dev[i].title); + var cname = dev[i].className.slice(dev[i].className.indexOf("thread")); + if((cpu >= 0 && dname.match("CPU_O[NF]*\\[*"+cpu+"\\]")) || + (name == dname)) + { + dev[i].className = "hover "+cname; + } else { + dev[i].className = cname; + } + } + } + function deviceUnhover() { + var dmesg = document.getElementById("dmesg"); + var dev = dmesg.getElementsByClassName("thread"); + for (var i = 0; i < dev.length; i++) { + dev[i].className = dev[i].className.slice(dev[i].className.indexOf("thread")); + } + } + function deviceTitle(title, total, cpu) { + var prefix = "Total"; + if(total.length > 3) { + prefix = "Average"; + total[1] = (total[1]+total[3])/2; + total[2] = (total[2]+total[4])/2; + } + var devtitle = document.getElementById("devicedetailtitle"); + var name = deviceName(title); + if(cpu >= 0) name = "CPU"+cpu; + var driver = ""; + var tS = "<t2>(</t2>"; + var tR = "<t2>)</t2>"; + if(total[1] > 0) + tS = "<t2>("+prefix+" Suspend:</t2><t0> "+total[1].toFixed(3)+" ms</t0> "; + if(total[2] > 0) + tR = " <t2>"+prefix+" Resume:</t2><t0> "+total[2].toFixed(3)+" ms<t2>)</t2></t0>"; + var s = title.indexOf("{"); + var e = title.indexOf("}"); + if((s >= 0) && (e >= 0)) + driver = title.slice(s+1, e) + " <t1>@</t1> "; + if(total[1] > 0 && total[2] > 0) + devtitle.innerHTML = "<t0>"+driver+name+"</t0> "+tS+tR; + else + devtitle.innerHTML = "<t0>"+title+"</t0>"; + return name; + } + function deviceDetail() { + var devinfo = document.getElementById("devicedetail"); + devinfo.style.display = "block"; + var name = deviceName(this.title); + var cpu = -1; + if(name.match("CPU_ON\[[0-9]*\]")) + cpu = parseInt(name.slice(7)); + else if(name.match("CPU_OFF\[[0-9]*\]")) + cpu = parseInt(name.slice(8)); + var dmesg = document.getElementById("dmesg"); + var dev = dmesg.getElementsByClassName("thread"); + var idlist = []; + var pdata = [[]]; + if(document.getElementById("devicedetail1")) + pdata = [[], []]; + var pd = pdata[0]; + var total = [0.0, 0.0, 0.0]; + for (var i = 0; i < dev.length; i++) { + dname = deviceName(dev[i].title); + if((cpu >= 0 && dname.match("CPU_O[NF]*\\[*"+cpu+"\\]")) || + (name == dname)) + { + idlist[idlist.length] = dev[i].id; + var tidx = 1; + if(dev[i].id[0] == "a") { + pd = pdata[0]; + } else { + if(pdata.length == 1) pdata[1] = []; + if(total.length == 3) total[3]=total[4]=0.0; + pd = pdata[1]; + tidx = 3; + } + var info = dev[i].title.split(" "); + var pname = info[info.length-1]; + pd[pname] = parseFloat(info[info.length-3].slice(1)); + total[0] += pd[pname]; + if(pname.indexOf("suspend") >= 0) + total[tidx] += pd[pname]; + else + total[tidx+1] += pd[pname]; + } + } + var devname = deviceTitle(this.title, total, cpu); + var left = 0.0; + for (var t = 0; t < pdata.length; t++) { + pd = pdata[t]; + devinfo = document.getElementById("devicedetail"+t); + var phases = devinfo.getElementsByClassName("phaselet"); + for (var i = 0; i < phases.length; i++) { + if(phases[i].id in pd) { + var w = 100.0*pd[phases[i].id]/total[0]; + var fs = 32; + if(w < 8) fs = 4*w | 0; + var fs2 = fs*3/4; + phases[i].style.width = w+"%"; + phases[i].style.left = left+"%"; + phases[i].title = phases[i].id+" "+pd[phases[i].id]+" ms"; + left += w; + var time = "<t4 style=\"font-size:"+fs+"px\">"+pd[phases[i].id]+" ms<br></t4>"; + var pname = "<t3 style=\"font-size:"+fs2+"px\">"+phases[i].id.replace(new RegExp("_", "g"), " ")+"</t3>"; + phases[i].innerHTML = time+pname; + } else { + phases[i].style.width = "0%"; + phases[i].style.left = left+"%"; + } + } + } + if(typeof devstats !== 'undefined') + callDetail(this.id, this.title); + var cglist = document.getElementById("callgraphs"); + if(!cglist) return; + var cg = cglist.getElementsByClassName("atop"); + if(cg.length < 10) return; + for (var i = 0; i < cg.length; i++) { + cgid = cg[i].id.split("x")[0] + if(idlist.indexOf(cgid) >= 0) { + cg[i].style.display = "block"; + } else { + cg[i].style.display = "none"; + } + } + } + function callDetail(devid, devtitle) { + if(!(devid in devstats) || devstats[devid].length < 1) + return; + var list = devstats[devid]; + var tmp = devtitle.split(" "); + var name = tmp[0], phase = tmp[tmp.length-1]; + var dd = document.getElementById(phase); + var total = parseFloat(tmp[1].slice(1)); + var mlist = []; + var maxlen = 0; + var info = [] + for(var i in list) { + if(list[i][0] == "@") { + info = list[i].split("|"); + continue; + } + var tmp = list[i].split("|"); + var t = parseFloat(tmp[0]), f = tmp[1], c = parseInt(tmp[2]); + var p = (t*100.0/total).toFixed(2); + mlist[mlist.length] = [f, c, t.toFixed(2), p+"%"]; + if(f.length > maxlen) + maxlen = f.length; + } + var pad = 5; + if(mlist.length == 0) pad = 30; + var html = '<div style="padding-top:'+pad+'px"><t3> <b>'+name+':</b>'; + if(info.length > 2) + html += " start=<b>"+info[1]+"</b>, end=<b>"+info[2]+"</b>"; + if(info.length > 3) + html += ", length<i>(w/o overhead)</i>=<b>"+info[3]+" ms</b>"; + if(info.length > 4) + html += ", return=<b>"+info[4]+"</b>"; + html += "</t3></div>"; + if(mlist.length > 0) { + html += '<table class=fstat style="padding-top:'+(maxlen*5)+'px;"><tr><th>Function</th>'; + for(var i in mlist) + html += "<td class=vt>"+mlist[i][0]+"</td>"; + html += "</tr><tr><th>Calls</th>"; + for(var i in mlist) + html += "<td>"+mlist[i][1]+"</td>"; + html += "</tr><tr><th>Time(ms)</th>"; + for(var i in mlist) + html += "<td>"+mlist[i][2]+"</td>"; + html += "</tr><tr><th>Percent</th>"; + for(var i in mlist) + html += "<td>"+mlist[i][3]+"</td>"; + html += "</tr></table>"; + } + dd.innerHTML = html; + var height = (maxlen*5)+100; + dd.style.height = height+"px"; + document.getElementById("devicedetail").style.height = height+"px"; + } + function callSelect() { + var cglist = document.getElementById("callgraphs"); + if(!cglist) return; + var cg = cglist.getElementsByClassName("atop"); + for (var i = 0; i < cg.length; i++) { + if(this.id == cg[i].id) { + cg[i].style.display = "block"; + } else { + cg[i].style.display = "none"; + } + } + } + function devListWindow(e) { + var win = window.open(); + var html = "<title>"+e.target.innerHTML+"</title>"+ + "<style type=\"text/css\">"+ + " ul {list-style-type:circle;padding-left:10px;margin-left:10px;}"+ + "</style>" + var dt = devtable[0]; + if(e.target.id != "devlist1") + dt = devtable[1]; + win.document.write(html+dt); + } + function errWindow() { + var range = this.id.split("_"); + var idx1 = parseInt(range[0]); + var idx2 = parseInt(range[1]); + var win = window.open(); + var log = document.getElementById("dmesglog"); + var title = "<title>dmesg log</title>"; + var text = log.innerHTML.split("\n"); + var html = ""; + for(var i = 0; i < text.length; i++) { + if(i == idx1) { + html += "<e id=target>"+text[i]+"</e>\n"; + } else if(i > idx1 && i <= idx2) { + html += "<e>"+text[i]+"</e>\n"; + } else { + html += text[i]+"\n"; + } + } + win.document.write("<style>e{color:red}</style>"+title+"<pre>"+html+"</pre>"); + win.location.hash = "#target"; + win.document.close(); + } + function logWindow(e) { + var name = e.target.id.slice(4); + var win = window.open(); + var log = document.getElementById(name+"log"); + var title = "<title>"+document.title.split(" ")[0]+" "+name+" log</title>"; + win.document.write(title+"<pre>"+log.innerHTML+"</pre>"); + win.document.close(); + } + function onMouseDown(e) { + dragval[0] = e.clientX; + dragval[1] = document.getElementById("dmesgzoombox").scrollLeft; + document.onmousemove = onMouseMove; + } + function onMouseMove(e) { + var zoombox = document.getElementById("dmesgzoombox"); + zoombox.scrollLeft = dragval[1] + dragval[0] - e.clientX; + } + function onMouseUp(e) { + document.onmousemove = null; + } + function onKeyPress(e) { + var c = e.charCode; + if(c != 42 && c != 43 && c != 45) return; + var click = document.createEvent("Events"); + click.initEvent("click", true, false); + if(c == 43) + document.getElementById("zoomin").dispatchEvent(click); + else if(c == 45) + document.getElementById("zoomout").dispatchEvent(click); + else if(c == 42) + document.getElementById("zoomdef").dispatchEvent(click); + } + window.addEventListener("resize", function () {zoomTimeline();}); + window.addEventListener("load", function () { + var dmesg = document.getElementById("dmesg"); + dmesg.style.width = "100%" + dmesg.onmousedown = onMouseDown; + document.onmouseup = onMouseUp; + document.onkeypress = onKeyPress; + document.getElementById("zoomin").onclick = zoomTimeline; + document.getElementById("zoomout").onclick = zoomTimeline; + document.getElementById("zoomdef").onclick = zoomTimeline; + var list = document.getElementsByClassName("err"); + for (var i = 0; i < list.length; i++) + list[i].onclick = errWindow; + var list = document.getElementsByClassName("logbtn"); + for (var i = 0; i < list.length; i++) + list[i].onclick = logWindow; + list = document.getElementsByClassName("devlist"); + for (var i = 0; i < list.length; i++) + list[i].onclick = devListWindow; + var dev = dmesg.getElementsByClassName("thread"); + for (var i = 0; i < dev.length; i++) { + dev[i].onclick = deviceDetail; + dev[i].onmouseover = deviceHover; + dev[i].onmouseout = deviceUnhover; + } + var dev = dmesg.getElementsByClassName("srccall"); + for (var i = 0; i < dev.length; i++) + dev[i].onclick = callSelect; + zoomTimeline(); + }); +</script> """ hf.write(script_code); # Function: executeSuspend @@ -5524,7 +5525,9 @@ def executeSuspend(quiet=False): if ((mode == 'freeze') or (sv.memmode == 's2idle')) \ and sv.haveTurbostat(): # execution will pause here - turbo = sv.turbostat(s0ixready) + retval, turbo = sv.turbostat(s0ixready) + if retval != 0: + tdata['error'] ='turbostat returned %d' % retval if turbo: tdata['turbo'] = turbo else: @@ -5532,6 +5535,7 @@ def executeSuspend(quiet=False): pf.write(mode) # execution will pause here try: + pf.flush() pf.close() except Exception as e: tdata['error'] = str(e) @@ -5633,7 +5637,7 @@ def deviceInfo(output=''): tgtval = 'runtime_status' lines = dict() for dirname, dirnames, filenames in os.walk('/sys/devices'): - if(not re.match('.*/power', dirname) or + if(not re.match(r'.*/power', dirname) or 'control' not in filenames or tgtval not in filenames): continue @@ -5702,6 +5706,40 @@ def getModes(): fp.close() return modes +def dmidecode_backup(out, fatal=False): + cpath, spath, info = '/proc/cpuinfo', '/sys/class/dmi/id', { + 'bios-vendor': 'bios_vendor', + 'bios-version': 'bios_version', + 'bios-release-date': 'bios_date', + 'system-manufacturer': 'sys_vendor', + 'system-product-name': 'product_name', + 'system-version': 'product_version', + 'system-serial-number': 'product_serial', + 'baseboard-manufacturer': 'board_vendor', + 'baseboard-product-name': 'board_name', + 'baseboard-version': 'board_version', + 'baseboard-serial-number': 'board_serial', + 'chassis-manufacturer': 'chassis_vendor', + 'chassis-version': 'chassis_version', + 'chassis-serial-number': 'chassis_serial', + } + for key in info: + if key not in out: + val = sysvals.getVal(os.path.join(spath, info[key])).strip() + if val and val.lower() != 'to be filled by o.e.m.': + out[key] = val + if 'processor-version' not in out and os.path.exists(cpath): + with open(cpath, 'r') as fp: + for line in fp: + m = re.match(r'^model\s*name\s*\:\s*(?P<c>.*)', line) + if m: + out['processor-version'] = m.group('c').strip() + break + if fatal and len(out) < 1: + doError('dmidecode failed to get info from %s or %s' % \ + (sysvals.mempath, spath)) + return out + # Function: dmidecode # Description: # Read the bios tables and pull out system info @@ -5712,6 +5750,8 @@ def getModes(): # A dict object with all available key/values def dmidecode(mempath, fatal=False): out = dict() + if(not (os.path.exists(mempath) and os.access(mempath, os.R_OK))): + return dmidecode_backup(out, fatal) # the list of values to retrieve, with hardcoded (type, idx) info = { @@ -5727,24 +5767,14 @@ def dmidecode(mempath, fatal=False): 'baseboard-version': (2, 6), 'baseboard-serial-number': (2, 7), 'chassis-manufacturer': (3, 4), - 'chassis-type': (3, 5), 'chassis-version': (3, 6), 'chassis-serial-number': (3, 7), 'processor-manufacturer': (4, 7), 'processor-version': (4, 16), } - if(not os.path.exists(mempath)): - if(fatal): - doError('file does not exist: %s' % mempath) - return out - if(not os.access(mempath, os.R_OK)): - if(fatal): - doError('file is not readable: %s' % mempath) - return out # by default use legacy scan, but try to use EFI first - memaddr = 0xf0000 - memsize = 0x10000 + memaddr, memsize = 0xf0000, 0x10000 for ep in ['/sys/firmware/efi/systab', '/proc/efi/systab']: if not os.path.exists(ep) or not os.access(ep, os.R_OK): continue @@ -5765,11 +5795,7 @@ def dmidecode(mempath, fatal=False): fp.seek(memaddr) buf = fp.read(memsize) except: - if(fatal): - doError('DMI table is unreachable, sorry') - else: - pprint('WARNING: /dev/mem is not readable, ignoring DMI data') - return out + return dmidecode_backup(out, fatal) fp.close() # search for either an SM table or DMI table @@ -5785,10 +5811,7 @@ def dmidecode(mempath, fatal=False): break i += 16 if base == 0 and length == 0 and num == 0: - if(fatal): - doError('Neither SMBIOS nor DMI were found') - else: - return out + return dmidecode_backup(out, fatal) # read in the SM or DMI table try: @@ -5796,11 +5819,7 @@ def dmidecode(mempath, fatal=False): fp.seek(base) buf = fp.read(length) except: - if(fatal): - doError('DMI table is unreachable, sorry') - else: - pprint('WARNING: /dev/mem is not readable, ignoring DMI data') - return out + return dmidecode_backup(out, fatal) fp.close() # scan the table for the values we want @@ -6272,7 +6291,10 @@ def find_in_html(html, start, end, firstonly=True): return out def data_from_html(file, outpath, issues, fulldetail=False): - html = open(file, 'r').read() + try: + html = open(file, 'r').read() + except: + html = ascii(open(file, 'rb').read()) sysvals.htmlfile = os.path.relpath(file, outpath) # extract general info suspend = find_in_html(html, 'Kernel Suspend', 'ms') @@ -6290,7 +6312,7 @@ def data_from_html(file, outpath, issues, fulldetail=False): tstr = dt.strftime('%Y/%m/%d %H:%M:%S') error = find_in_html(html, '<table class="testfail"><tr><td>', '</td>') if error: - m = re.match('[a-z0-9]* failed in (?P<p>\S*).*', error) + m = re.match(r'[a-z0-9]* failed in (?P<p>\S*).*', error) if m: result = 'fail in %s' % m.group('p') else: @@ -6307,8 +6329,9 @@ def data_from_html(file, outpath, issues, fulldetail=False): d.end = 999999999 d.dmesgtext = log.split('\n') tp = d.extractErrorInfo() - for msg in tp.msglist: - sysvals.errorSummary(issues, msg) + if len(issues) < 100: + for msg in tp.msglist: + sysvals.errorSummary(issues, msg) if stmp[2] == 'freeze': extra = d.turbostatInfo() elist = dict() @@ -6325,6 +6348,11 @@ def data_from_html(file, outpath, issues, fulldetail=False): line = find_in_html(log, '# netfix ', '\n') if line: extra['netfix'] = line + line = find_in_html(log, '# command ', '\n') + if line: + m = re.match(r'.* -m (?P<m>\S*).*', line) + if m: + extra['fullmode'] = m.group('m') low = find_in_html(html, 'freeze time: <b>', ' ms</b>') for lowstr in ['waking', '+']: if not low: @@ -6334,7 +6362,7 @@ def data_from_html(file, outpath, issues, fulldetail=False): if lowstr == '+': issue = 'S2LOOPx%d' % len(low.split('+')) else: - m = re.match('.*waking *(?P<n>[0-9]*) *times.*', low) + m = re.match(r'.*waking *(?P<n>[0-9]*) *times.*', low) issue = 'S2WAKEx%s' % m.group('n') if m else 'S2WAKExNaN' match = [i for i in issues if i['match'] == issue] if len(match) > 0: @@ -6352,10 +6380,10 @@ def data_from_html(file, outpath, issues, fulldetail=False): # extract device info devices = dict() for line in html.split('\n'): - m = re.match(' *<div id=\"[a,0-9]*\" *title=\"(?P<title>.*)\" class=\"thread.*', line) + m = re.match(r' *<div id=\"[a,0-9]*\" *title=\"(?P<title>.*)\" class=\"thread.*', line) if not m or 'thread kth' in line or 'thread sec' in line: continue - m = re.match('(?P<n>.*) \((?P<t>[0-9,\.]*) ms\) (?P<p>.*)', m.group('title')) + m = re.match(r'(?P<n>.*) \((?P<t>[0-9,\.]*) ms\) (?P<p>.*)', m.group('title')) if not m: continue name, time, phase = m.group('n'), m.group('t'), m.group('p') @@ -6416,9 +6444,9 @@ def genHtml(subdir, force=False): for filename in filenames: file = os.path.join(dirname, filename) if sysvals.usable(file): - if(re.match('.*_dmesg.txt', filename)): + if(re.match(r'.*_dmesg.txt', filename)): sysvals.dmesgfile = file - elif(re.match('.*_ftrace.txt', filename)): + elif(re.match(r'.*_ftrace.txt', filename)): sysvals.ftracefile = file sysvals.setOutputFile() if (sysvals.dmesgfile or sysvals.ftracefile) and sysvals.htmlfile and \ @@ -6441,7 +6469,7 @@ def runSummary(subdir, local=True, genhtml=False): desc = {'host':[],'mode':[],'kernel':[]} for dirname, dirnames, filenames in os.walk(subdir): for filename in filenames: - if(not re.match('.*.html', filename)): + if(not re.match(r'.*.html', filename)): continue data = data_from_html(os.path.join(dirname, filename), outpath, issues) if(not data): diff --git a/tools/power/x86/turbostat/Makefile b/tools/power/x86/turbostat/Makefile index 2d6dce2c8f77..b1e6817f1e54 100644 --- a/tools/power/x86/turbostat/Makefile +++ b/tools/power/x86/turbostat/Makefile @@ -14,6 +14,7 @@ turbostat : turbostat.c override CFLAGS += -O2 -Wall -Wextra -I../../../include override CFLAGS += -DMSRHEADER='"../../../../arch/x86/include/asm/msr-index.h"' override CFLAGS += -DINTEL_FAMILY_HEADER='"../../../../arch/x86/include/asm/intel-family.h"' +override CFLAGS += -DBUILD_BUG_HEADER='"../../../../include/linux/build_bug.h"' override CFLAGS += -D_FILE_OFFSET_BITS=64 override CFLAGS += -D_FORTIFY_SOURCE=2 @@ -44,10 +45,13 @@ snapshot: turbostat @echo "#define GENMASK(h, l) (((~0UL) << (l)) & (~0UL >> (sizeof(long) * 8 - 1 - (h))))" >> $(SNAPSHOT)/bits.h @echo "#define GENMASK_ULL(h, l) (((~0ULL) << (l)) & (~0ULL >> (sizeof(long long) * 8 - 1 - (h))))" >> $(SNAPSHOT)/bits.h + @echo '#define BUILD_BUG_ON(cond) do { enum { compile_time_check ## __COUNTER__ = 1/(!(cond)) }; } while (0)' > $(SNAPSHOT)/build_bug.h + @echo PWD=. > $(SNAPSHOT)/Makefile @echo "CFLAGS += -DMSRHEADER='\"msr-index.h\"'" >> $(SNAPSHOT)/Makefile @echo "CFLAGS += -DINTEL_FAMILY_HEADER='\"intel-family.h\"'" >> $(SNAPSHOT)/Makefile - @sed -e's/.*MSRHEADER.*//' -e's/.*INTEL_FAMILY_HEADER.*//' Makefile >> $(SNAPSHOT)/Makefile + @echo "CFLAGS += -DBUILD_BUG_HEADER='\"build_bug.h\"'" >> $(SNAPSHOT)/Makefile + @sed -e's/.*MSRHEADER.*//' -e's/.*INTEL_FAMILY_HEADER.*//' -e's/.*BUILD_BUG_HEADER.*//' Makefile >> $(SNAPSHOT)/Makefile @rm -f $(SNAPSHOT).tar.gz tar cvzf $(SNAPSHOT).tar.gz $(SNAPSHOT) diff --git a/tools/power/x86/turbostat/turbostat.c b/tools/power/x86/turbostat/turbostat.c index 8cdf41906e98..9f5d053d4bc6 100644 --- a/tools/power/x86/turbostat/turbostat.c +++ b/tools/power/x86/turbostat/turbostat.c @@ -10,6 +10,7 @@ #define _GNU_SOURCE #include MSRHEADER #include INTEL_FAMILY_HEADER +#include BUILD_BUG_HEADER #include <stdarg.h> #include <stdio.h> #include <err.h> @@ -38,7 +39,6 @@ #include <stdbool.h> #include <assert.h> #include <linux/kernel.h> -#include <linux/build_bug.h> #define UNUSED(x) (void)(x) @@ -5695,9 +5695,6 @@ static void probe_intel_uncore_frequency_cluster(void) if (access("/sys/devices/system/cpu/intel_uncore_frequency/uncore00/current_freq_khz", R_OK)) return; - if (quiet) - return; - for (uncore_max_id = 0;; ++uncore_max_id) { sprintf(path_base, "/sys/devices/system/cpu/intel_uncore_frequency/uncore%02d", uncore_max_id); @@ -5727,6 +5724,14 @@ static void probe_intel_uncore_frequency_cluster(void) sprintf(path, "%s/fabric_cluster_id", path_base); cluster_id = read_sysfs_int(path); + sprintf(path, "%s/current_freq_khz", path_base); + sprintf(name_buf, "UMHz%d.%d", domain_id, cluster_id); + + add_counter(0, path, name_buf, 0, SCOPE_PACKAGE, COUNTER_K2M, FORMAT_AVERAGE, 0, package_id); + + if (quiet) + continue; + sprintf(path, "%s/min_freq_khz", path_base); k = read_sysfs_int(path); sprintf(path, "%s/max_freq_khz", path_base); @@ -5743,11 +5748,6 @@ static void probe_intel_uncore_frequency_cluster(void) sprintf(path, "%s/current_freq_khz", path_base); k = read_sysfs_int(path); fprintf(outf, " %d MHz\n", k / 1000); - - sprintf(path, "%s/current_freq_khz", path_base); - sprintf(name_buf, "UMHz%d.%d", domain_id, cluster_id); - - add_counter(0, path, name_buf, 0, SCOPE_PACKAGE, COUNTER_K2M, FORMAT_AVERAGE, 0, package_id); } } @@ -8424,7 +8424,7 @@ void cmdline(int argc, char **argv) * Parse some options early, because they may make other options invalid, * like adding the MSR counter with --add and at the same time using --no-msr. */ - while ((opt = getopt_long_only(argc, argv, "MP", long_options, &option_index)) != -1) { + while ((opt = getopt_long_only(argc, argv, "MPn:", long_options, &option_index)) != -1) { switch (opt) { case 'M': no_msr = 1; diff --git a/tools/rcu/rcu-updaters.sh b/tools/rcu/rcu-updaters.sh new file mode 100755 index 000000000000..4ef1397927bb --- /dev/null +++ b/tools/rcu/rcu-updaters.sh @@ -0,0 +1,52 @@ +#!/bin/sh +# SPDX-License-Identifier: GPL-2.0+ +# +# Run bpftrace to obtain a histogram of the types of primitives used to +# initiate RCU grace periods. The count associated with rcu_gp_init() +# is the number of normal (non-expedited) grace periods. +# +# Usage: rcu-updaters.sh [ duration-in-seconds ] +# +# Note that not all kernel builds have all of these functions. In those +# that do not, this script will issue a diagnostic for each that is not +# found, but continue normally for the rest of the functions. + +duration=${1} +if test -n "${duration}" +then + exitclause='interval:s:'"${duration}"' { exit(); }' +else + echo 'Hit control-C to end sample and print results.' +fi +bpftrace -e 'kprobe:kvfree_call_rcu, + kprobe:call_rcu, + kprobe:call_rcu_tasks, + kprobe:call_rcu_tasks_rude, + kprobe:call_rcu_tasks_trace, + kprobe:call_srcu, + kprobe:rcu_barrier, + kprobe:rcu_barrier_tasks, + kprobe:rcu_barrier_tasks_rude, + kprobe:rcu_barrier_tasks_trace, + kprobe:srcu_barrier, + kprobe:synchronize_rcu, + kprobe:synchronize_rcu_expedited, + kprobe:synchronize_rcu_tasks, + kprobe:synchronize_rcu_tasks_rude, + kprobe:synchronize_rcu_tasks_trace, + kprobe:synchronize_srcu, + kprobe:synchronize_srcu_expedited, + kprobe:get_state_synchronize_rcu, + kprobe:get_state_synchronize_rcu_full, + kprobe:start_poll_synchronize_rcu, + kprobe:start_poll_synchronize_rcu_expedited, + kprobe:start_poll_synchronize_rcu_full, + kprobe:start_poll_synchronize_rcu_expedited_full, + kprobe:poll_state_synchronize_rcu, + kprobe:poll_state_synchronize_rcu_full, + kprobe:cond_synchronize_rcu, + kprobe:cond_synchronize_rcu_full, + kprobe:start_poll_synchronize_srcu, + kprobe:poll_state_synchronize_srcu, + kprobe:rcu_gp_init + { @counts[func] = count(); } '"${exitclause}" diff --git a/tools/testing/cxl/test/cxl.c b/tools/testing/cxl/test/cxl.c index 3482248aa344..90d5afd52dd0 100644 --- a/tools/testing/cxl/test/cxl.c +++ b/tools/testing/cxl/test/cxl.c @@ -630,11 +630,15 @@ static struct cxl_hdm *mock_cxl_setup_hdm(struct cxl_port *port, struct cxl_endpoint_dvsec_info *info) { struct cxl_hdm *cxlhdm = devm_kzalloc(&port->dev, sizeof(*cxlhdm), GFP_KERNEL); + struct device *dev = &port->dev; if (!cxlhdm) return ERR_PTR(-ENOMEM); cxlhdm->port = port; + cxlhdm->interleave_mask = ~0U; + cxlhdm->iw_cap_mask = ~0UL; + dev_set_drvdata(dev, cxlhdm); return cxlhdm; } diff --git a/tools/testing/cxl/test/mem.c b/tools/testing/cxl/test/mem.c index 6584443144de..eaf091a3d331 100644 --- a/tools/testing/cxl/test/mem.c +++ b/tools/testing/cxl/test/mem.c @@ -3,6 +3,7 @@ #include <linux/platform_device.h> #include <linux/mod_devicetable.h> +#include <linux/vmalloc.h> #include <linux/module.h> #include <linux/delay.h> #include <linux/sizes.h> diff --git a/tools/testing/selftests/alsa/Makefile b/tools/testing/selftests/alsa/Makefile index 5af9ba8a4645..c1ce39874e2b 100644 --- a/tools/testing/selftests/alsa/Makefile +++ b/tools/testing/selftests/alsa/Makefile @@ -1,7 +1,7 @@ # SPDX-License-Identifier: GPL-2.0 # -CFLAGS += $(shell pkg-config --cflags alsa) +CFLAGS += $(shell pkg-config --cflags alsa) $(KHDR_INCLUDES) LDLIBS += $(shell pkg-config --libs alsa) ifeq ($(LDLIBS),) LDLIBS += -lasound diff --git a/tools/testing/selftests/arm64/abi/ptrace.c b/tools/testing/selftests/arm64/abi/ptrace.c index abe4d58d731d..4c941270d8de 100644 --- a/tools/testing/selftests/arm64/abi/ptrace.c +++ b/tools/testing/selftests/arm64/abi/ptrace.c @@ -47,7 +47,7 @@ static void test_tpidr(pid_t child) /* ...write a new value.. */ write_iov.iov_len = sizeof(uint64_t); - write_val[0] = read_val[0]++; + write_val[0] = read_val[0] + 1; ret = ptrace(PTRACE_SETREGSET, child, NT_ARM_TLS, &write_iov); ksft_test_result(ret == 0, "write_tpidr_one\n"); diff --git a/tools/testing/selftests/arm64/fp/.gitignore b/tools/testing/selftests/arm64/fp/.gitignore index 00e52c966281..8362e7ec35ad 100644 --- a/tools/testing/selftests/arm64/fp/.gitignore +++ b/tools/testing/selftests/arm64/fp/.gitignore @@ -2,6 +2,7 @@ fp-pidbench fp-ptrace fp-stress fpsimd-test +kernel-test rdvl-sme rdvl-sve sve-probe-vls diff --git a/tools/testing/selftests/arm64/fp/Makefile b/tools/testing/selftests/arm64/fp/Makefile index 55d4f00d9e8e..d171021e4cdd 100644 --- a/tools/testing/selftests/arm64/fp/Makefile +++ b/tools/testing/selftests/arm64/fp/Makefile @@ -12,6 +12,7 @@ TEST_GEN_PROGS := \ vec-syscfg \ za-fork za-ptrace TEST_GEN_PROGS_EXTENDED := fp-pidbench fpsimd-test \ + kernel-test \ rdvl-sme rdvl-sve \ sve-test \ ssve-test \ diff --git a/tools/testing/selftests/arm64/fp/fp-stress.c b/tools/testing/selftests/arm64/fp/fp-stress.c index dd31647b00a2..faac24bdefeb 100644 --- a/tools/testing/selftests/arm64/fp/fp-stress.c +++ b/tools/testing/selftests/arm64/fp/fp-stress.c @@ -319,6 +319,19 @@ static void start_fpsimd(struct child_data *child, int cpu, int copy) ksft_print_msg("Started %s\n", child->name); } +static void start_kernel(struct child_data *child, int cpu, int copy) +{ + int ret; + + ret = asprintf(&child->name, "KERNEL-%d-%d", cpu, copy); + if (ret == -1) + ksft_exit_fail_msg("asprintf() failed\n"); + + child_start(child, "./kernel-test"); + + ksft_print_msg("Started %s\n", child->name); +} + static void start_sve(struct child_data *child, int vl, int cpu) { int ret; @@ -438,7 +451,7 @@ int main(int argc, char **argv) int ret; int timeout = 10; int cpus, i, j, c; - int sve_vl_count, sme_vl_count, fpsimd_per_cpu; + int sve_vl_count, sme_vl_count; bool all_children_started = false; int seen_children; int sve_vls[MAX_VLS], sme_vls[MAX_VLS]; @@ -482,12 +495,7 @@ int main(int argc, char **argv) have_sme2 = false; } - /* Force context switching if we only have FPSIMD */ - if (!sve_vl_count && !sme_vl_count) - fpsimd_per_cpu = 2; - else - fpsimd_per_cpu = 1; - tests += cpus * fpsimd_per_cpu; + tests += cpus * 2; ksft_print_header(); ksft_set_plan(tests); @@ -542,8 +550,8 @@ int main(int argc, char **argv) tests); for (i = 0; i < cpus; i++) { - for (j = 0; j < fpsimd_per_cpu; j++) - start_fpsimd(&children[num_children++], i, j); + start_fpsimd(&children[num_children++], i, 0); + start_kernel(&children[num_children++], i, 0); for (j = 0; j < sve_vl_count; j++) start_sve(&children[num_children++], sve_vls[j], i); diff --git a/tools/testing/selftests/arm64/fp/kernel-test.c b/tools/testing/selftests/arm64/fp/kernel-test.c new file mode 100644 index 000000000000..e8da3b4cbd23 --- /dev/null +++ b/tools/testing/selftests/arm64/fp/kernel-test.c @@ -0,0 +1,324 @@ +// SPDX-License-Identifier: GPL-2.0-only +/* + * Copyright (C) 2024 ARM Limited. + */ + +#define _GNU_SOURCE + +#include <stdio.h> +#include <stdlib.h> +#include <stdbool.h> +#include <errno.h> +#include <fcntl.h> +#include <signal.h> +#include <string.h> +#include <unistd.h> + +#include <sys/socket.h> + +#include <linux/kernel.h> +#include <linux/if_alg.h> + +#define DATA_SIZE (16 * 4096) + +static int base, sock; + +static int digest_len; +static char *ref; +static char *digest; +static char *alg_name; + +static struct iovec data_iov; +static int zerocopy[2]; +static int sigs; +static int iter; + +static void handle_exit_signal(int sig, siginfo_t *info, void *context) +{ + printf("Terminated by signal %d, iterations=%d, signals=%d\n", + sig, iter, sigs); + exit(0); +} + +static void handle_kick_signal(int sig, siginfo_t *info, void *context) +{ + sigs++; +} + +static char *drivers[] = { + "crct10dif-arm64-ce", + /* "crct10dif-arm64-neon", - Same priority as generic */ + "sha1-ce", + "sha224-arm64", + "sha224-arm64-neon", + "sha224-ce", + "sha256-arm64", + "sha256-arm64-neon", + "sha256-ce", + "sha384-ce", + "sha512-ce", + "sha3-224-ce", + "sha3-256-ce", + "sha3-384-ce", + "sha3-512-ce", + "sm3-ce", + "sm3-neon", +}; + +static bool create_socket(void) +{ + FILE *proc; + struct sockaddr_alg addr; + char buf[1024]; + char *c, *driver_name; + bool is_shash, match; + int ret, i; + + ret = socket(AF_ALG, SOCK_SEQPACKET, 0); + if (ret < 0) { + if (errno == EAFNOSUPPORT) { + printf("AF_ALG not supported\n"); + return false; + } + + printf("Failed to create AF_ALG socket: %s (%d)\n", + strerror(errno), errno); + return false; + } + base = ret; + + memset(&addr, 0, sizeof(addr)); + addr.salg_family = AF_ALG; + strncpy((char *)addr.salg_type, "hash", sizeof(addr.salg_type)); + + proc = fopen("/proc/crypto", "r"); + if (!proc) { + printf("Unable to open /proc/crypto\n"); + return false; + } + + driver_name = NULL; + is_shash = false; + match = false; + + /* Look through /proc/crypto for a driver with kernel mode FP usage */ + while (!match) { + c = fgets(buf, sizeof(buf), proc); + if (!c) { + if (feof(proc)) { + printf("Nothing found in /proc/crypto\n"); + return false; + } + continue; + } + + /* Algorithm descriptions are separated by a blank line */ + if (*c == '\n') { + if (is_shash && driver_name) { + for (i = 0; i < ARRAY_SIZE(drivers); i++) { + if (strcmp(drivers[i], + driver_name) == 0) { + match = true; + } + } + } + + if (!match) { + digest_len = 0; + + free(driver_name); + driver_name = NULL; + + free(alg_name); + alg_name = NULL; + + is_shash = false; + } + continue; + } + + /* Remove trailing newline */ + c = strchr(buf, '\n'); + if (c) + *c = '\0'; + + /* Find the field/value separator and start of the value */ + c = strchr(buf, ':'); + if (!c) + continue; + c += 2; + + if (strncmp(buf, "digestsize", strlen("digestsize")) == 0) + sscanf(c, "%d", &digest_len); + + if (strncmp(buf, "name", strlen("name")) == 0) + alg_name = strdup(c); + + if (strncmp(buf, "driver", strlen("driver")) == 0) + driver_name = strdup(c); + + if (strncmp(buf, "type", strlen("type")) == 0) + if (strncmp(c, "shash", strlen("shash")) == 0) + is_shash = true; + } + + strncpy((char *)addr.salg_name, alg_name, + sizeof(addr.salg_name) - 1); + + ret = bind(base, (struct sockaddr *)&addr, sizeof(addr)); + if (ret < 0) { + printf("Failed to bind %s: %s (%d)\n", + addr.salg_name, strerror(errno), errno); + return false; + } + + ret = accept(base, NULL, 0); + if (ret < 0) { + printf("Failed to accept %s: %s (%d)\n", + addr.salg_name, strerror(errno), errno); + return false; + } + + sock = ret; + + ret = pipe(zerocopy); + if (ret != 0) { + printf("Failed to create zerocopy pipe: %s (%d)\n", + strerror(errno), errno); + return false; + } + + ref = malloc(digest_len); + if (!ref) { + printf("Failed to allocated %d byte reference\n", digest_len); + return false; + } + + digest = malloc(digest_len); + if (!digest) { + printf("Failed to allocated %d byte digest\n", digest_len); + return false; + } + + return true; +} + +static bool compute_digest(void *buf) +{ + struct iovec iov; + int ret, wrote; + + iov = data_iov; + while (iov.iov_len) { + ret = vmsplice(zerocopy[1], &iov, 1, SPLICE_F_GIFT); + if (ret < 0) { + printf("Failed to send buffer: %s (%d)\n", + strerror(errno), errno); + return false; + } + + wrote = ret; + ret = splice(zerocopy[0], NULL, sock, NULL, wrote, 0); + if (ret < 0) { + printf("Failed to splice buffer: %s (%d)\n", + strerror(errno), errno); + } else if (ret != wrote) { + printf("Short splice: %d < %d\n", ret, wrote); + } + + iov.iov_len -= wrote; + iov.iov_base += wrote; + } + +reread: + ret = recv(sock, buf, digest_len, 0); + if (ret == 0) { + printf("No digest returned\n"); + return false; + } + if (ret != digest_len) { + if (errno == -EAGAIN) + goto reread; + printf("Failed to get digest: %s (%d)\n", + strerror(errno), errno); + return false; + } + + return true; +} + +int main(void) +{ + char *data; + struct sigaction sa; + int ret; + + /* Ensure we have unbuffered output */ + setvbuf(stdout, NULL, _IOLBF, 0); + + /* The parent will communicate with us via signals */ + memset(&sa, 0, sizeof(sa)); + sa.sa_sigaction = handle_exit_signal; + sa.sa_flags = SA_RESTART | SA_SIGINFO; + sigemptyset(&sa.sa_mask); + ret = sigaction(SIGTERM, &sa, NULL); + if (ret < 0) + printf("Failed to install SIGTERM handler: %s (%d)\n", + strerror(errno), errno); + + sa.sa_sigaction = handle_kick_signal; + ret = sigaction(SIGUSR2, &sa, NULL); + if (ret < 0) + printf("Failed to install SIGUSR2 handler: %s (%d)\n", + strerror(errno), errno); + + data = malloc(DATA_SIZE); + if (!data) { + printf("Failed to allocate data buffer\n"); + return EXIT_FAILURE; + } + memset(data, 0, DATA_SIZE); + + data_iov.iov_base = data; + data_iov.iov_len = DATA_SIZE; + + /* + * If we can't create a socket assume it's a lack of system + * support and fall back to a basic FPSIMD test for the + * benefit of fp-stress. + */ + if (!create_socket()) { + execl("./fpsimd-test", "./fpsimd-test", NULL); + printf("Failed to fall back to fspimd-test: %d (%s)\n", + errno, strerror(errno)); + return EXIT_FAILURE; + } + + /* + * Compute a reference digest we hope is repeatable, we do + * this at runtime partly to make it easier to play with + * parameters. + */ + if (!compute_digest(ref)) { + printf("Failed to compute reference digest\n"); + return EXIT_FAILURE; + } + + printf("AF_ALG using %s\n", alg_name); + + while (true) { + if (!compute_digest(digest)) { + printf("Failed to compute digest, iter=%d\n", iter); + return EXIT_FAILURE; + } + + if (memcmp(ref, digest, digest_len) != 0) { + printf("Digest mismatch, iter=%d\n", iter); + return EXIT_FAILURE; + } + + iter++; + } + + return EXIT_FAILURE; +} diff --git a/tools/testing/selftests/arm64/tags/Makefile b/tools/testing/selftests/arm64/tags/Makefile index 6d29cfde43a2..0a77f35295fb 100644 --- a/tools/testing/selftests/arm64/tags/Makefile +++ b/tools/testing/selftests/arm64/tags/Makefile @@ -2,6 +2,5 @@ CFLAGS += $(KHDR_INCLUDES) TEST_GEN_PROGS := tags_test -TEST_PROGS := run_tags_test.sh include ../../lib.mk diff --git a/tools/testing/selftests/arm64/tags/run_tags_test.sh b/tools/testing/selftests/arm64/tags/run_tags_test.sh deleted file mode 100755 index 745f11379930..000000000000 --- a/tools/testing/selftests/arm64/tags/run_tags_test.sh +++ /dev/null @@ -1,12 +0,0 @@ -#!/bin/sh -# SPDX-License-Identifier: GPL-2.0 - -echo "--------------------" -echo "running tags test" -echo "--------------------" -./tags_test -if [ $? -ne 0 ]; then - echo "[FAIL]" -else - echo "[PASS]" -fi diff --git a/tools/testing/selftests/arm64/tags/tags_test.c b/tools/testing/selftests/arm64/tags/tags_test.c index 955f87c1170d..8ae26e496c89 100644 --- a/tools/testing/selftests/arm64/tags/tags_test.c +++ b/tools/testing/selftests/arm64/tags/tags_test.c @@ -17,19 +17,21 @@ int main(void) static int tbi_enabled = 0; unsigned long tag = 0; struct utsname *ptr; - int err; + + ksft_print_header(); + ksft_set_plan(1); if (prctl(PR_SET_TAGGED_ADDR_CTRL, PR_TAGGED_ADDR_ENABLE, 0, 0, 0) == 0) tbi_enabled = 1; ptr = (struct utsname *)malloc(sizeof(*ptr)); if (!ptr) - ksft_exit_fail_msg("Failed to allocate utsname buffer\n"); + ksft_exit_fail_perror("Failed to allocate utsname buffer"); if (tbi_enabled) tag = 0x42; ptr = (struct utsname *)SET_TAG(ptr, tag); - err = uname(ptr); + ksft_test_result(!uname(ptr), "Syscall successful with tagged address\n"); free(ptr); - return err; + ksft_finished(); } diff --git a/tools/testing/selftests/bpf/Makefile b/tools/testing/selftests/bpf/Makefile index e0b3887b3d2d..dd49c1d23a60 100644 --- a/tools/testing/selftests/bpf/Makefile +++ b/tools/testing/selftests/bpf/Makefile @@ -457,7 +457,7 @@ LINKED_SKELS := test_static_linked.skel.h linked_funcs.skel.h \ LSKELS := fentry_test.c fexit_test.c fexit_sleep.c atomics.c \ trace_printk.c trace_vprintk.c map_ptr_kern.c \ core_kern.c core_kern_overflow.c test_ringbuf.c \ - test_ringbuf_n.c test_ringbuf_map_key.c + test_ringbuf_n.c test_ringbuf_map_key.c test_ringbuf_write.c # Generate both light skeleton and libbpf skeleton for these LSKELS_EXTRA := test_ksyms_module.c test_ksyms_weak.c kfunc_call_test.c \ diff --git a/tools/testing/selftests/bpf/config b/tools/testing/selftests/bpf/config index eeabd798bc3a..98b6b6a886ce 100644 --- a/tools/testing/selftests/bpf/config +++ b/tools/testing/selftests/bpf/config @@ -58,9 +58,12 @@ CONFIG_MPLS=y CONFIG_MPLS_IPTUNNEL=y CONFIG_MPLS_ROUTING=y CONFIG_MPTCP=y +CONFIG_NET_ACT_SKBMOD=y +CONFIG_NET_CLS=y CONFIG_NET_CLS_ACT=y CONFIG_NET_CLS_BPF=y CONFIG_NET_CLS_FLOWER=y +CONFIG_NET_CLS_MATCHALL=y CONFIG_NET_FOU=y CONFIG_NET_FOU_IP_TUNNELS=y CONFIG_NET_IPGRE=y diff --git a/tools/testing/selftests/bpf/prog_tests/ringbuf.c b/tools/testing/selftests/bpf/prog_tests/ringbuf.c index 4c6f42dae409..da430df45aa4 100644 --- a/tools/testing/selftests/bpf/prog_tests/ringbuf.c +++ b/tools/testing/selftests/bpf/prog_tests/ringbuf.c @@ -12,9 +12,11 @@ #include <sys/sysinfo.h> #include <linux/perf_event.h> #include <linux/ring_buffer.h> + #include "test_ringbuf.lskel.h" #include "test_ringbuf_n.lskel.h" #include "test_ringbuf_map_key.lskel.h" +#include "test_ringbuf_write.lskel.h" #define EDONE 7777 @@ -84,6 +86,58 @@ static void *poll_thread(void *input) return (void *)(long)ring_buffer__poll(ringbuf, timeout); } +static void ringbuf_write_subtest(void) +{ + struct test_ringbuf_write_lskel *skel; + int page_size = getpagesize(); + size_t *mmap_ptr; + int err, rb_fd; + + skel = test_ringbuf_write_lskel__open(); + if (!ASSERT_OK_PTR(skel, "skel_open")) + return; + + skel->maps.ringbuf.max_entries = 0x4000; + + err = test_ringbuf_write_lskel__load(skel); + if (!ASSERT_OK(err, "skel_load")) + goto cleanup; + + rb_fd = skel->maps.ringbuf.map_fd; + + mmap_ptr = mmap(NULL, page_size, PROT_READ | PROT_WRITE, MAP_SHARED, rb_fd, 0); + if (!ASSERT_OK_PTR(mmap_ptr, "rw_cons_pos")) + goto cleanup; + *mmap_ptr = 0x3000; + ASSERT_OK(munmap(mmap_ptr, page_size), "unmap_rw"); + + skel->bss->pid = getpid(); + + ringbuf = ring_buffer__new(rb_fd, process_sample, NULL, NULL); + if (!ASSERT_OK_PTR(ringbuf, "ringbuf_new")) + goto cleanup; + + err = test_ringbuf_write_lskel__attach(skel); + if (!ASSERT_OK(err, "skel_attach")) + goto cleanup_ringbuf; + + skel->bss->discarded = 0; + skel->bss->passed = 0; + + /* trigger exactly two samples */ + syscall(__NR_getpgid); + syscall(__NR_getpgid); + + ASSERT_EQ(skel->bss->discarded, 2, "discarded"); + ASSERT_EQ(skel->bss->passed, 0, "passed"); + + test_ringbuf_write_lskel__detach(skel); +cleanup_ringbuf: + ring_buffer__free(ringbuf); +cleanup: + test_ringbuf_write_lskel__destroy(skel); +} + static void ringbuf_subtest(void) { const size_t rec_sz = BPF_RINGBUF_HDR_SZ + sizeof(struct sample); @@ -451,4 +505,6 @@ void test_ringbuf(void) ringbuf_n_subtest(); if (test__start_subtest("ringbuf_map_key")) ringbuf_map_key_subtest(); + if (test__start_subtest("ringbuf_write")) + ringbuf_write_subtest(); } diff --git a/tools/testing/selftests/bpf/prog_tests/tc_links.c b/tools/testing/selftests/bpf/prog_tests/tc_links.c index bc9841144685..1af9ec1149aa 100644 --- a/tools/testing/selftests/bpf/prog_tests/tc_links.c +++ b/tools/testing/selftests/bpf/prog_tests/tc_links.c @@ -9,6 +9,8 @@ #define ping_cmd "ping -q -c1 -w1 127.0.0.1 > /dev/null" #include "test_tc_link.skel.h" + +#include "netlink_helpers.h" #include "tc_helpers.h" void serial_test_tc_links_basic(void) @@ -1787,6 +1789,65 @@ void serial_test_tc_links_ingress(void) test_tc_links_ingress(BPF_TCX_INGRESS, false, false); } +struct qdisc_req { + struct nlmsghdr n; + struct tcmsg t; + char buf[1024]; +}; + +static int qdisc_replace(int ifindex, const char *kind, bool block) +{ + struct rtnl_handle rth = { .fd = -1 }; + struct qdisc_req req; + int err; + + err = rtnl_open(&rth, 0); + if (!ASSERT_OK(err, "open_rtnetlink")) + return err; + + memset(&req, 0, sizeof(req)); + req.n.nlmsg_len = NLMSG_LENGTH(sizeof(struct tcmsg)); + req.n.nlmsg_flags = NLM_F_CREATE | NLM_F_REPLACE | NLM_F_REQUEST; + req.n.nlmsg_type = RTM_NEWQDISC; + req.t.tcm_family = AF_UNSPEC; + req.t.tcm_ifindex = ifindex; + req.t.tcm_parent = 0xfffffff1; + + addattr_l(&req.n, sizeof(req), TCA_KIND, kind, strlen(kind) + 1); + if (block) + addattr32(&req.n, sizeof(req), TCA_INGRESS_BLOCK, 1); + + err = rtnl_talk(&rth, &req.n, NULL); + ASSERT_OK(err, "talk_rtnetlink"); + rtnl_close(&rth); + return err; +} + +void serial_test_tc_links_dev_chain0(void) +{ + int err, ifindex; + + ASSERT_OK(system("ip link add dev foo type veth peer name bar"), "add veth"); + ifindex = if_nametoindex("foo"); + ASSERT_NEQ(ifindex, 0, "non_zero_ifindex"); + err = qdisc_replace(ifindex, "ingress", true); + if (!ASSERT_OK(err, "attaching ingress")) + goto cleanup; + ASSERT_OK(system("tc filter add block 1 matchall action skbmod swap mac"), "add block"); + err = qdisc_replace(ifindex, "clsact", false); + if (!ASSERT_OK(err, "attaching clsact")) + goto cleanup; + /* Heuristic: kern_sync_rcu() alone does not work; a wait-time of ~5s + * triggered the issue without the fix reliably 100% of the time. + */ + sleep(5); + ASSERT_OK(system("tc filter add dev foo ingress matchall action skbmod swap mac"), "add filter"); +cleanup: + ASSERT_OK(system("ip link del dev foo"), "del veth"); + ASSERT_EQ(if_nametoindex("foo"), 0, "foo removed"); + ASSERT_EQ(if_nametoindex("bar"), 0, "bar removed"); +} + static void test_tc_links_dev_mixed(int target) { LIBBPF_OPTS(bpf_tc_opts, tc_opts, .handle = 1, .priority = 1); diff --git a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c index 15ee7b2fc410..b9135720024c 100644 --- a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c +++ b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c @@ -73,6 +73,16 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex, "up primary"); ASSERT_OK(system("ip addr add dev " netkit_name " 10.0.0.1/24"), "addr primary"); + + if (mode == NETKIT_L3) { + ASSERT_EQ(system("ip link set dev " netkit_name + " addr ee:ff:bb:cc:aa:dd 2> /dev/null"), 512, + "set hwaddress"); + } else { + ASSERT_OK(system("ip link set dev " netkit_name + " addr ee:ff:bb:cc:aa:dd"), + "set hwaddress"); + } if (same_netns) { ASSERT_OK(system("ip link set dev " netkit_peer " up"), "up peer"); @@ -89,6 +99,16 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex, return err; } +static void move_netkit(void) +{ + ASSERT_OK(system("ip link set " netkit_peer " netns foo"), + "move peer"); + ASSERT_OK(system("ip netns exec foo ip link set dev " + netkit_peer " up"), "up peer"); + ASSERT_OK(system("ip netns exec foo ip addr add dev " + netkit_peer " 10.0.0.2/24"), "addr peer"); +} + static void destroy_netkit(void) { ASSERT_OK(system("ip link del dev " netkit_name), "del primary"); @@ -685,3 +705,77 @@ void serial_test_tc_netkit_neigh_links(void) serial_test_tc_netkit_neigh_links_target(NETKIT_L2, BPF_NETKIT_PRIMARY); serial_test_tc_netkit_neigh_links_target(NETKIT_L3, BPF_NETKIT_PRIMARY); } + +static void serial_test_tc_netkit_pkt_type_mode(int mode) +{ + LIBBPF_OPTS(bpf_netkit_opts, optl_nk); + LIBBPF_OPTS(bpf_tcx_opts, optl_tcx); + int err, ifindex, ifindex2; + struct test_tc_link *skel; + struct bpf_link *link; + + err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS, + &ifindex, true); + if (err) + return; + + ifindex2 = if_nametoindex(netkit_peer); + ASSERT_NEQ(ifindex, ifindex2, "ifindex_1_2"); + + skel = test_tc_link__open(); + if (!ASSERT_OK_PTR(skel, "skel_open")) + goto cleanup; + + ASSERT_EQ(bpf_program__set_expected_attach_type(skel->progs.tc1, + BPF_NETKIT_PRIMARY), 0, "tc1_attach_type"); + ASSERT_EQ(bpf_program__set_expected_attach_type(skel->progs.tc7, + BPF_TCX_INGRESS), 0, "tc7_attach_type"); + + err = test_tc_link__load(skel); + if (!ASSERT_OK(err, "skel_load")) + goto cleanup; + + assert_mprog_count_ifindex(ifindex, BPF_NETKIT_PRIMARY, 0); + assert_mprog_count_ifindex(ifindex2, BPF_TCX_INGRESS, 0); + + link = bpf_program__attach_netkit(skel->progs.tc1, ifindex, &optl_nk); + if (!ASSERT_OK_PTR(link, "link_attach")) + goto cleanup; + + skel->links.tc1 = link; + + assert_mprog_count_ifindex(ifindex, BPF_NETKIT_PRIMARY, 1); + assert_mprog_count_ifindex(ifindex2, BPF_TCX_INGRESS, 0); + + link = bpf_program__attach_tcx(skel->progs.tc7, ifindex2, &optl_tcx); + if (!ASSERT_OK_PTR(link, "link_attach")) + goto cleanup; + + skel->links.tc7 = link; + + assert_mprog_count_ifindex(ifindex, BPF_NETKIT_PRIMARY, 1); + assert_mprog_count_ifindex(ifindex2, BPF_TCX_INGRESS, 1); + + move_netkit(); + + tc_skel_reset_all_seen(skel); + skel->bss->set_type = true; + ASSERT_EQ(send_icmp(), 0, "icmp_pkt"); + + ASSERT_EQ(skel->bss->seen_tc1, true, "seen_tc1"); + ASSERT_EQ(skel->bss->seen_tc7, true, "seen_tc7"); + + ASSERT_EQ(skel->bss->seen_host, true, "seen_host"); + ASSERT_EQ(skel->bss->seen_mcast, true, "seen_mcast"); +cleanup: + test_tc_link__destroy(skel); + + assert_mprog_count_ifindex(ifindex, BPF_NETKIT_PRIMARY, 0); + destroy_netkit(); +} + +void serial_test_tc_netkit_pkt_type(void) +{ + serial_test_tc_netkit_pkt_type_mode(NETKIT_L2); + serial_test_tc_netkit_pkt_type_mode(NETKIT_L3); +} diff --git a/tools/testing/selftests/bpf/prog_tests/timer_lockup.c b/tools/testing/selftests/bpf/prog_tests/timer_lockup.c new file mode 100644 index 000000000000..871d16cb95cf --- /dev/null +++ b/tools/testing/selftests/bpf/prog_tests/timer_lockup.c @@ -0,0 +1,91 @@ +// SPDX-License-Identifier: GPL-2.0 + +#define _GNU_SOURCE +#include <sched.h> +#include <test_progs.h> +#include <pthread.h> +#include <network_helpers.h> + +#include "timer_lockup.skel.h" + +static long cpu; +static int *timer1_err; +static int *timer2_err; +static bool skip; + +volatile int k = 0; + +static void *timer_lockup_thread(void *arg) +{ + LIBBPF_OPTS(bpf_test_run_opts, opts, + .data_in = &pkt_v4, + .data_size_in = sizeof(pkt_v4), + .repeat = 1000, + ); + int i, prog_fd = *(int *)arg; + cpu_set_t cpuset; + + CPU_ZERO(&cpuset); + CPU_SET(__sync_fetch_and_add(&cpu, 1), &cpuset); + ASSERT_OK(pthread_setaffinity_np(pthread_self(), sizeof(cpuset), + &cpuset), + "cpu affinity"); + + for (i = 0; !READ_ONCE(*timer1_err) && !READ_ONCE(*timer2_err); i++) { + bpf_prog_test_run_opts(prog_fd, &opts); + /* Skip the test if we can't reproduce the race in a reasonable + * amount of time. + */ + if (i > 50) { + WRITE_ONCE(skip, true); + break; + } + } + + return NULL; +} + +void test_timer_lockup(void) +{ + int timer1_prog, timer2_prog; + struct timer_lockup *skel; + pthread_t thrds[2]; + void *ret; + + skel = timer_lockup__open_and_load(); + if (!ASSERT_OK_PTR(skel, "timer_lockup__open_and_load")) + return; + + timer1_prog = bpf_program__fd(skel->progs.timer1_prog); + timer2_prog = bpf_program__fd(skel->progs.timer2_prog); + + timer1_err = &skel->bss->timer1_err; + timer2_err = &skel->bss->timer2_err; + + if (!ASSERT_OK(pthread_create(&thrds[0], NULL, timer_lockup_thread, + &timer1_prog), + "pthread_create thread1")) + goto out; + if (!ASSERT_OK(pthread_create(&thrds[1], NULL, timer_lockup_thread, + &timer2_prog), + "pthread_create thread2")) { + pthread_exit(&thrds[0]); + goto out; + } + + pthread_join(thrds[1], &ret); + pthread_join(thrds[0], &ret); + + if (skip) { + test__skip(); + goto out; + } + + if (*timer1_err != -EDEADLK && *timer1_err != 0) + ASSERT_FAIL("timer1_err bad value"); + if (*timer2_err != -EDEADLK && *timer2_err != 0) + ASSERT_FAIL("timer2_err bad value"); +out: + timer_lockup__destroy(skel); + return; +} diff --git a/tools/testing/selftests/bpf/prog_tests/uprobe_multi_test.c b/tools/testing/selftests/bpf/prog_tests/uprobe_multi_test.c index 8269cdee33ae..bf6ca8e3eb13 100644 --- a/tools/testing/selftests/bpf/prog_tests/uprobe_multi_test.c +++ b/tools/testing/selftests/bpf/prog_tests/uprobe_multi_test.c @@ -1,12 +1,14 @@ // SPDX-License-Identifier: GPL-2.0 #include <unistd.h> +#include <pthread.h> #include <test_progs.h> #include "uprobe_multi.skel.h" #include "uprobe_multi_bench.skel.h" #include "uprobe_multi_usdt.skel.h" #include "bpf/libbpf_internal.h" #include "testing_helpers.h" +#include "../sdt.h" static char test_data[] = "test_data"; @@ -25,9 +27,17 @@ noinline void uprobe_multi_func_3(void) asm volatile (""); } +noinline void usdt_trigger(void) +{ + STAP_PROBE(test, pid_filter_usdt); +} + struct child { int go[2]; + int c2p[2]; /* child -> parent channel */ int pid; + int tid; + pthread_t thread; }; static void release_child(struct child *child) @@ -38,6 +48,10 @@ static void release_child(struct child *child) return; close(child->go[1]); close(child->go[0]); + if (child->thread) + pthread_join(child->thread, NULL); + close(child->c2p[0]); + close(child->c2p[1]); if (child->pid > 0) waitpid(child->pid, &child_status, 0); } @@ -63,7 +77,7 @@ static struct child *spawn_child(void) if (pipe(child.go)) return NULL; - child.pid = fork(); + child.pid = child.tid = fork(); if (child.pid < 0) { release_child(&child); errno = EINVAL; @@ -82,6 +96,7 @@ static struct child *spawn_child(void) uprobe_multi_func_1(); uprobe_multi_func_2(); uprobe_multi_func_3(); + usdt_trigger(); exit(errno); } @@ -89,6 +104,67 @@ static struct child *spawn_child(void) return &child; } +static void *child_thread(void *ctx) +{ + struct child *child = ctx; + int c = 0, err; + + child->tid = syscall(SYS_gettid); + + /* let parent know we are ready */ + err = write(child->c2p[1], &c, 1); + if (err != 1) + pthread_exit(&err); + + /* wait for parent's kick */ + err = read(child->go[0], &c, 1); + if (err != 1) + pthread_exit(&err); + + uprobe_multi_func_1(); + uprobe_multi_func_2(); + uprobe_multi_func_3(); + usdt_trigger(); + + err = 0; + pthread_exit(&err); +} + +static struct child *spawn_thread(void) +{ + static struct child child; + int c, err; + + /* pipe to notify child to execute the trigger functions */ + if (pipe(child.go)) + return NULL; + /* pipe to notify parent that child thread is ready */ + if (pipe(child.c2p)) { + close(child.go[0]); + close(child.go[1]); + return NULL; + } + + child.pid = getpid(); + + err = pthread_create(&child.thread, NULL, child_thread, &child); + if (err) { + err = -errno; + close(child.go[0]); + close(child.go[1]); + close(child.c2p[0]); + close(child.c2p[1]); + errno = -err; + return NULL; + } + + err = read(child.c2p[0], &c, 1); + if (!ASSERT_EQ(err, 1, "child_thread_ready")) + return NULL; + + return &child; +} + static void uprobe_multi_test_run(struct uprobe_multi *skel, struct child *child) { skel->bss->uprobe_multi_func_1_addr = (__u64) uprobe_multi_func_1; @@ -103,15 +179,23 @@ static void uprobe_multi_test_run(struct uprobe_multi *skel, struct child *child * passed at the probe attach. */ skel->bss->pid = child ? 0 : getpid(); + skel->bss->expect_pid = child ? child->pid : 0; + + /* trigger all probes, if we are testing child *process*, just to make + * sure that PID filtering doesn't let through activations from wrong + * PIDs; when we test child *thread*, we don't want to do this to + * avoid double counting number of triggering events + */ + if (!child || !child->thread) { + uprobe_multi_func_1(); + uprobe_multi_func_2(); + uprobe_multi_func_3(); + usdt_trigger(); + } if (child) kick_child(child); - /* trigger all probes */ - uprobe_multi_func_1(); - uprobe_multi_func_2(); - uprobe_multi_func_3(); - /* * There are 2 entry and 2 exit probe called for each uprobe_multi_func_[123] * function and each slepable probe (6) increments uprobe_multi_sleep_result. @@ -126,8 +210,12 @@ static void uprobe_multi_test_run(struct uprobe_multi *skel, struct child *child ASSERT_EQ(skel->bss->uprobe_multi_sleep_result, 6, "uprobe_multi_sleep_result"); - if (child) + ASSERT_FALSE(skel->bss->bad_pid_seen, "bad_pid_seen"); + + if (child) { ASSERT_EQ(skel->bss->child_pid, child->pid, "uprobe_multi_child_pid"); + ASSERT_EQ(skel->bss->child_tid, child->tid, "uprobe_multi_child_tid"); + } } static void test_skel_api(void) @@ -190,8 +278,24 @@ __test_attach_api(const char *binary, const char *pattern, struct bpf_uprobe_mul if (!ASSERT_OK_PTR(skel->links.uprobe_extra, "bpf_program__attach_uprobe_multi")) goto cleanup; + /* Attach (uprobe-backed) USDTs */ + skel->links.usdt_pid = bpf_program__attach_usdt(skel->progs.usdt_pid, pid, binary, + "test", "pid_filter_usdt", NULL); + if (!ASSERT_OK_PTR(skel->links.usdt_pid, "attach_usdt_pid")) + goto cleanup; + + skel->links.usdt_extra = bpf_program__attach_usdt(skel->progs.usdt_extra, -1, binary, + "test", "pid_filter_usdt", NULL); + if (!ASSERT_OK_PTR(skel->links.usdt_extra, "attach_usdt_extra")) + goto cleanup; + uprobe_multi_test_run(skel, child); + ASSERT_FALSE(skel->bss->bad_pid_seen_usdt, "bad_pid_seen_usdt"); + if (child) { + ASSERT_EQ(skel->bss->child_pid_usdt, child->pid, "usdt_multi_child_pid"); + ASSERT_EQ(skel->bss->child_tid_usdt, child->tid, "usdt_multi_child_tid"); + } cleanup: uprobe_multi__destroy(skel); } @@ -210,6 +314,13 @@ test_attach_api(const char *binary, const char *pattern, struct bpf_uprobe_multi return; __test_attach_api(binary, pattern, opts, child); + + /* pid filter (thread) */ + child = spawn_thread(); + if (!ASSERT_OK_PTR(child, "spawn_thread")) + return; + + __test_attach_api(binary, pattern, opts, child); } static void test_attach_api_pattern(void) @@ -397,7 +508,7 @@ static void test_attach_api_fails(void) link_fd = bpf_link_create(prog_fd, 0, BPF_TRACE_UPROBE_MULTI, &opts); if (!ASSERT_ERR(link_fd, "link_fd")) goto cleanup; - ASSERT_EQ(link_fd, -ESRCH, "pid_is_wrong"); + ASSERT_EQ(link_fd, -EINVAL, "pid_is_wrong"); cleanup: if (link_fd >= 0) @@ -495,6 +606,13 @@ static void test_link_api(void) return; __test_link_api(child); + + /* pid filter (thread) */ + child = spawn_thread(); + if (!ASSERT_OK_PTR(child, "spawn_thread")) + return; + + __test_link_api(child); } static void test_bench_attach_uprobe(void) diff --git a/tools/testing/selftests/bpf/prog_tests/verifier.c b/tools/testing/selftests/bpf/prog_tests/verifier.c index c60db8beeb73..98ef39efa77e 100644 --- a/tools/testing/selftests/bpf/prog_tests/verifier.c +++ b/tools/testing/selftests/bpf/prog_tests/verifier.c @@ -53,6 +53,7 @@ #include "verifier_movsx.skel.h" #include "verifier_netfilter_ctx.skel.h" #include "verifier_netfilter_retcode.skel.h" +#include "verifier_or_jmp32_k.skel.h" #include "verifier_precision.skel.h" #include "verifier_prevent_map_lookup.skel.h" #include "verifier_raw_stack.skel.h" @@ -67,6 +68,7 @@ #include "verifier_search_pruning.skel.h" #include "verifier_sock.skel.h" #include "verifier_sock_addr.skel.h" +#include "verifier_sockmap_mutate.skel.h" #include "verifier_spill_fill.skel.h" #include "verifier_spin_lock.skel.h" #include "verifier_stack_ptr.skel.h" @@ -169,6 +171,7 @@ void test_verifier_meta_access(void) { RUN(verifier_meta_access); } void test_verifier_movsx(void) { RUN(verifier_movsx); } void test_verifier_netfilter_ctx(void) { RUN(verifier_netfilter_ctx); } void test_verifier_netfilter_retcode(void) { RUN(verifier_netfilter_retcode); } +void test_verifier_or_jmp32_k(void) { RUN(verifier_or_jmp32_k); } void test_verifier_precision(void) { RUN(verifier_precision); } void test_verifier_prevent_map_lookup(void) { RUN(verifier_prevent_map_lookup); } void test_verifier_raw_stack(void) { RUN(verifier_raw_stack); } @@ -183,6 +186,7 @@ void test_verifier_sdiv(void) { RUN(verifier_sdiv); } void test_verifier_search_pruning(void) { RUN(verifier_search_pruning); } void test_verifier_sock(void) { RUN(verifier_sock); } void test_verifier_sock_addr(void) { RUN(verifier_sock_addr); } +void test_verifier_sockmap_mutate(void) { RUN(verifier_sockmap_mutate); } void test_verifier_spill_fill(void) { RUN(verifier_spill_fill); } void test_verifier_spin_lock(void) { RUN(verifier_spin_lock); } void test_verifier_stack_ptr(void) { RUN(verifier_stack_ptr); } diff --git a/tools/testing/selftests/bpf/progs/test_ringbuf_write.c b/tools/testing/selftests/bpf/progs/test_ringbuf_write.c new file mode 100644 index 000000000000..350513c0e4c9 --- /dev/null +++ b/tools/testing/selftests/bpf/progs/test_ringbuf_write.c @@ -0,0 +1,46 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> +#include "bpf_misc.h" + +char _license[] SEC("license") = "GPL"; + +struct { + __uint(type, BPF_MAP_TYPE_RINGBUF); +} ringbuf SEC(".maps"); + +/* inputs */ +int pid = 0; + +/* outputs */ +long passed = 0; +long discarded = 0; + +SEC("fentry/" SYS_PREFIX "sys_getpgid") +int test_ringbuf_write(void *ctx) +{ + int *foo, cur_pid = bpf_get_current_pid_tgid() >> 32; + void *sample1, *sample2; + + if (cur_pid != pid) + return 0; + + sample1 = bpf_ringbuf_reserve(&ringbuf, 0x3000, 0); + if (!sample1) + return 0; + /* first one can pass */ + sample2 = bpf_ringbuf_reserve(&ringbuf, 0x3000, 0); + if (!sample2) { + bpf_ringbuf_discard(sample1, 0); + __sync_fetch_and_add(&discarded, 1); + return 0; + } + /* second one must not */ + __sync_fetch_and_add(&passed, 1); + foo = sample2 + 4084; + *foo = 256; + bpf_ringbuf_discard(sample1, 0); + bpf_ringbuf_discard(sample2, 0); + return 0; +} diff --git a/tools/testing/selftests/bpf/progs/test_sk_storage_tracing.c b/tools/testing/selftests/bpf/progs/test_sk_storage_tracing.c index 02e718f06e0f..40531e56776e 100644 --- a/tools/testing/selftests/bpf/progs/test_sk_storage_tracing.c +++ b/tools/testing/selftests/bpf/progs/test_sk_storage_tracing.c @@ -84,7 +84,7 @@ int BPF_PROG(trace_tcp_connect, struct sock *sk) } SEC("fexit/inet_csk_accept") -int BPF_PROG(inet_csk_accept, struct sock *sk, int flags, int *err, bool kern, +int BPF_PROG(inet_csk_accept, struct sock *sk, struct proto_accept_arg *arg, struct sock *accepted_sk) { set_task_info(accepted_sk); diff --git a/tools/testing/selftests/bpf/progs/test_tc_link.c b/tools/testing/selftests/bpf/progs/test_tc_link.c index 992400acb957..ab3eae3d6af8 100644 --- a/tools/testing/selftests/bpf/progs/test_tc_link.c +++ b/tools/testing/selftests/bpf/progs/test_tc_link.c @@ -4,7 +4,8 @@ #include <linux/bpf.h> #include <linux/if_ether.h> - +#include <linux/stddef.h> +#include <linux/if_packet.h> #include <bpf/bpf_endian.h> #include <bpf/bpf_helpers.h> @@ -16,7 +17,13 @@ bool seen_tc3; bool seen_tc4; bool seen_tc5; bool seen_tc6; +bool seen_tc7; + +bool set_type; + bool seen_eth; +bool seen_host; +bool seen_mcast; SEC("tc/ingress") int tc1(struct __sk_buff *skb) @@ -28,8 +35,16 @@ int tc1(struct __sk_buff *skb) if (bpf_skb_load_bytes(skb, 0, ð, sizeof(eth))) goto out; seen_eth = eth.h_proto == bpf_htons(ETH_P_IP); + seen_host = skb->pkt_type == PACKET_HOST; + if (seen_host && set_type) { + eth.h_dest[0] = 4; + if (bpf_skb_store_bytes(skb, 0, ð, sizeof(eth), 0)) + goto fail; + bpf_skb_change_type(skb, PACKET_MULTICAST); + } out: seen_tc1 = true; +fail: return TCX_NEXT; } @@ -67,3 +82,21 @@ int tc6(struct __sk_buff *skb) seen_tc6 = true; return TCX_PASS; } + +SEC("tc/ingress") +int tc7(struct __sk_buff *skb) +{ + struct ethhdr eth = {}; + + if (skb->protocol != __bpf_constant_htons(ETH_P_IP)) + goto out; + if (bpf_skb_load_bytes(skb, 0, ð, sizeof(eth))) + goto out; + if (eth.h_dest[0] == 4 && set_type) { + seen_mcast = skb->pkt_type == PACKET_MULTICAST; + bpf_skb_change_type(skb, PACKET_HOST); + } +out: + seen_tc7 = true; + return TCX_PASS; +} diff --git a/tools/testing/selftests/bpf/progs/timer_lockup.c b/tools/testing/selftests/bpf/progs/timer_lockup.c new file mode 100644 index 000000000000..3e520133281e --- /dev/null +++ b/tools/testing/selftests/bpf/progs/timer_lockup.c @@ -0,0 +1,87 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include <linux/bpf.h> +#include <time.h> +#include <errno.h> +#include <bpf/bpf_helpers.h> +#include <bpf/bpf_tracing.h> +#include "bpf_misc.h" + +char _license[] SEC("license") = "GPL"; + +struct elem { + struct bpf_timer t; +}; + +struct { + __uint(type, BPF_MAP_TYPE_ARRAY); + __uint(max_entries, 1); + __type(key, int); + __type(value, struct elem); +} timer1_map SEC(".maps"); + +struct { + __uint(type, BPF_MAP_TYPE_ARRAY); + __uint(max_entries, 1); + __type(key, int); + __type(value, struct elem); +} timer2_map SEC(".maps"); + +int timer1_err; +int timer2_err; + +static int timer_cb1(void *map, int *k, struct elem *v) +{ + struct bpf_timer *timer; + int key = 0; + + timer = bpf_map_lookup_elem(&timer2_map, &key); + if (timer) + timer2_err = bpf_timer_cancel(timer); + + return 0; +} + +static int timer_cb2(void *map, int *k, struct elem *v) +{ + struct bpf_timer *timer; + int key = 0; + + timer = bpf_map_lookup_elem(&timer1_map, &key); + if (timer) + timer1_err = bpf_timer_cancel(timer); + + return 0; +} + +SEC("tc") +int timer1_prog(void *ctx) +{ + struct bpf_timer *timer; + int key = 0; + + timer = bpf_map_lookup_elem(&timer1_map, &key); + if (timer) { + bpf_timer_init(timer, &timer1_map, CLOCK_BOOTTIME); + bpf_timer_set_callback(timer, timer_cb1); + bpf_timer_start(timer, 1, BPF_F_TIMER_CPU_PIN); + } + + return 0; +} + +SEC("tc") +int timer2_prog(void *ctx) +{ + struct bpf_timer *timer; + int key = 0; + + timer = bpf_map_lookup_elem(&timer2_map, &key); + if (timer) { + bpf_timer_init(timer, &timer2_map, CLOCK_BOOTTIME); + bpf_timer_set_callback(timer, timer_cb2); + bpf_timer_start(timer, 1, BPF_F_TIMER_CPU_PIN); + } + + return 0; +} diff --git a/tools/testing/selftests/bpf/progs/uprobe_multi.c b/tools/testing/selftests/bpf/progs/uprobe_multi.c index 419d9aa28fce..44190efcdba2 100644 --- a/tools/testing/selftests/bpf/progs/uprobe_multi.c +++ b/tools/testing/selftests/bpf/progs/uprobe_multi.c @@ -1,8 +1,8 @@ // SPDX-License-Identifier: GPL-2.0 -#include <linux/bpf.h> +#include "vmlinux.h" #include <bpf/bpf_helpers.h> #include <bpf/bpf_tracing.h> -#include <stdbool.h> +#include <bpf/usdt.bpf.h> char _license[] SEC("license") = "GPL"; @@ -22,6 +22,13 @@ __u64 uprobe_multi_sleep_result = 0; int pid = 0; int child_pid = 0; +int child_tid = 0; +int child_pid_usdt = 0; +int child_tid_usdt = 0; + +int expect_pid = 0; +bool bad_pid_seen = false; +bool bad_pid_seen_usdt = false; bool test_cookie = false; void *user_ptr = 0; @@ -36,11 +43,19 @@ static __always_inline bool verify_sleepable_user_copy(void) static void uprobe_multi_check(void *ctx, bool is_return, bool is_sleep) { - child_pid = bpf_get_current_pid_tgid() >> 32; + __u64 cur_pid_tgid = bpf_get_current_pid_tgid(); + __u32 cur_pid; - if (pid && child_pid != pid) + cur_pid = cur_pid_tgid >> 32; + if (pid && cur_pid != pid) return; + if (expect_pid && cur_pid != expect_pid) + bad_pid_seen = true; + + child_pid = cur_pid_tgid >> 32; + child_tid = (__u32)cur_pid_tgid; + __u64 cookie = test_cookie ? bpf_get_attach_cookie(ctx) : 0; __u64 addr = bpf_get_func_ip(ctx); @@ -97,5 +112,32 @@ int uretprobe_sleep(struct pt_regs *ctx) SEC("uprobe.multi//proc/self/exe:uprobe_multi_func_*") int uprobe_extra(struct pt_regs *ctx) { + /* we need this one just to mix PID-filtered and global uprobes */ + return 0; +} + +SEC("usdt") +int usdt_pid(struct pt_regs *ctx) +{ + __u64 cur_pid_tgid = bpf_get_current_pid_tgid(); + __u32 cur_pid; + + cur_pid = cur_pid_tgid >> 32; + if (pid && cur_pid != pid) + return 0; + + if (expect_pid && cur_pid != expect_pid) + bad_pid_seen_usdt = true; + + child_pid_usdt = cur_pid_tgid >> 32; + child_tid_usdt = (__u32)cur_pid_tgid; + + return 0; +} + +SEC("usdt") +int usdt_extra(struct pt_regs *ctx) +{ + /* we need this one just to mix PID-filtered and global USDT probes */ return 0; } diff --git a/tools/testing/selftests/bpf/progs/verifier_iterating_callbacks.c b/tools/testing/selftests/bpf/progs/verifier_iterating_callbacks.c index bd676d7e615f..80c737b6d340 100644 --- a/tools/testing/selftests/bpf/progs/verifier_iterating_callbacks.c +++ b/tools/testing/selftests/bpf/progs/verifier_iterating_callbacks.c @@ -274,6 +274,58 @@ static __naked void iter_limit_bug_cb(void) ); } +int tmp_var; +SEC("socket") +__failure __msg("infinite loop detected at insn 2") +__naked void jgt_imm64_and_may_goto(void) +{ + asm volatile (" \ + r0 = %[tmp_var] ll; \ +l0_%=: .byte 0xe5; /* may_goto */ \ + .byte 0; /* regs */ \ + .short -3; /* off -3 */ \ + .long 0; /* imm */ \ + if r0 > 10 goto l0_%=; \ + r0 = 0; \ + exit; \ +" :: __imm_addr(tmp_var) + : __clobber_all); +} + +SEC("socket") +__failure __msg("infinite loop detected at insn 1") +__naked void may_goto_self(void) +{ + asm volatile (" \ + r0 = *(u32 *)(r10 - 4); \ +l0_%=: .byte 0xe5; /* may_goto */ \ + .byte 0; /* regs */ \ + .short -1; /* off -1 */ \ + .long 0; /* imm */ \ + if r0 > 10 goto l0_%=; \ + r0 = 0; \ + exit; \ +" ::: __clobber_all); +} + +SEC("socket") +__success __retval(0) +__naked void may_goto_neg_off(void) +{ + asm volatile (" \ + r0 = *(u32 *)(r10 - 4); \ + goto l0_%=; \ + goto l1_%=; \ +l0_%=: .byte 0xe5; /* may_goto */ \ + .byte 0; /* regs */ \ + .short -2; /* off -2 */ \ + .long 0; /* imm */ \ + if r0 > 10 goto l0_%=; \ +l1_%=: r0 = 0; \ + exit; \ +" ::: __clobber_all); +} + SEC("tc") __failure __flag(BPF_F_TEST_STATE_FREQ) @@ -307,6 +359,100 @@ int iter_limit_bug(struct __sk_buff *skb) return 0; } +SEC("socket") +__success __retval(0) +__naked void ja_and_may_goto(void) +{ + asm volatile (" \ +l0_%=: .byte 0xe5; /* may_goto */ \ + .byte 0; /* regs */ \ + .short 1; /* off 1 */ \ + .long 0; /* imm */ \ + goto l0_%=; \ + r0 = 0; \ + exit; \ +" ::: __clobber_common); +} + +SEC("socket") +__success __retval(0) +__naked void ja_and_may_goto2(void) +{ + asm volatile (" \ +l0_%=: r0 = 0; \ + .byte 0xe5; /* may_goto */ \ + .byte 0; /* regs */ \ + .short 1; /* off 1 */ \ + .long 0; /* imm */ \ + goto l0_%=; \ + r0 = 0; \ + exit; \ +" ::: __clobber_common); +} + +SEC("socket") +__success __retval(0) +__naked void jlt_and_may_goto(void) +{ + asm volatile (" \ +l0_%=: call %[bpf_jiffies64]; \ + .byte 0xe5; /* may_goto */ \ + .byte 0; /* regs */ \ + .short 1; /* off 1 */ \ + .long 0; /* imm */ \ + if r0 < 10 goto l0_%=; \ + r0 = 0; \ + exit; \ +" :: __imm(bpf_jiffies64) + : __clobber_all); +} + +#if (defined(__TARGET_ARCH_arm64) || defined(__TARGET_ARCH_x86) || \ + (defined(__TARGET_ARCH_riscv) && __riscv_xlen == 64) || \ + defined(__TARGET_ARCH_arm) || defined(__TARGET_ARCH_s390) || \ + defined(__TARGET_ARCH_loongarch)) && \ + __clang_major__ >= 18 +SEC("socket") +__success __retval(0) +__naked void gotol_and_may_goto(void) +{ + asm volatile (" \ +l0_%=: r0 = 0; \ + .byte 0xe5; /* may_goto */ \ + .byte 0; /* regs */ \ + .short 1; /* off 1 */ \ + .long 0; /* imm */ \ + gotol l0_%=; \ + r0 = 0; \ + exit; \ +" ::: __clobber_common); +} +#endif + +SEC("socket") +__success __retval(0) +__naked void ja_and_may_goto_subprog(void) +{ + asm volatile (" \ + call subprog_with_may_goto; \ + exit; \ +" ::: __clobber_all); +} + +static __naked __noinline __used +void subprog_with_may_goto(void) +{ + asm volatile (" \ +l0_%=: .byte 0xe5; /* may_goto */ \ + .byte 0; /* regs */ \ + .short 1; /* off 1 */ \ + .long 0; /* imm */ \ + goto l0_%=; \ + r0 = 0; \ + exit; \ +" ::: __clobber_all); +} + #define ARR_SZ 1000000 int zero; char arr[ARR_SZ]; diff --git a/tools/testing/selftests/bpf/progs/verifier_movsx.c b/tools/testing/selftests/bpf/progs/verifier_movsx.c index cbb9d6714f53..028ec855587b 100644 --- a/tools/testing/selftests/bpf/progs/verifier_movsx.c +++ b/tools/testing/selftests/bpf/progs/verifier_movsx.c @@ -224,6 +224,69 @@ l0_%=: \ : __clobber_all); } +SEC("socket") +__description("MOV32SX, S8, var_off u32_max") +__failure __msg("infinite loop detected") +__failure_unpriv __msg_unpriv("back-edge from insn 2 to 0") +__naked void mov64sx_s32_varoff_1(void) +{ + asm volatile (" \ +l0_%=: \ + r3 = *(u8 *)(r10 -387); \ + w7 = (s8)w3; \ + if w7 >= 0x2533823b goto l0_%=; \ + w0 = 0; \ + exit; \ +" : + : + : __clobber_all); +} + +SEC("socket") +__description("MOV32SX, S8, var_off not u32_max, positive after s8 extension") +__success __retval(0) +__failure_unpriv __msg_unpriv("frame pointer is read only") +__naked void mov64sx_s32_varoff_2(void) +{ + asm volatile (" \ + call %[bpf_get_prandom_u32]; \ + r3 = r0; \ + r3 &= 0xf; \ + w7 = (s8)w3; \ + if w7 s>= 16 goto l0_%=; \ + w0 = 0; \ + exit; \ +l0_%=: \ + r10 = 1; \ + exit; \ +" : + : __imm(bpf_get_prandom_u32) + : __clobber_all); +} + +SEC("socket") +__description("MOV32SX, S8, var_off not u32_max, negative after s8 extension") +__success __retval(0) +__failure_unpriv __msg_unpriv("frame pointer is read only") +__naked void mov64sx_s32_varoff_3(void) +{ + asm volatile (" \ + call %[bpf_get_prandom_u32]; \ + r3 = r0; \ + r3 &= 0xf; \ + r3 |= 0x80; \ + w7 = (s8)w3; \ + if w7 s>= -5 goto l0_%=; \ + w0 = 0; \ + exit; \ +l0_%=: \ + r10 = 1; \ + exit; \ +" : + : __imm(bpf_get_prandom_u32) + : __clobber_all); +} + #else SEC("socket") diff --git a/tools/testing/selftests/bpf/progs/verifier_or_jmp32_k.c b/tools/testing/selftests/bpf/progs/verifier_or_jmp32_k.c new file mode 100644 index 000000000000..f37713a265ac --- /dev/null +++ b/tools/testing/selftests/bpf/progs/verifier_or_jmp32_k.c @@ -0,0 +1,41 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> +#include "bpf_misc.h" + +SEC("socket") +__description("or_jmp32_k: bit ops + branch on unknown value") +__failure +__msg("R0 invalid mem access 'scalar'") +__naked void or_jmp32_k(void) +{ + asm volatile (" \ + r0 = 0xffffffff; \ + r0 /= 1; \ + r1 = 0; \ + w1 = -1; \ + w1 >>= 1; \ + w0 &= w1; \ + w0 |= 2; \ + if w0 != 0x7ffffffd goto l1; \ + r0 = 1; \ + exit; \ +l3: \ + r0 = 5; \ + *(u64*)(r0 - 8) = r0; \ + exit; \ +l2: \ + w0 -= 0xe; \ + if w0 == 1 goto l3; \ + r0 = 4; \ + exit; \ +l1: \ + w0 -= 0x7ffffff0; \ + if w0 s>= 0xe goto l2; \ + r0 = 3; \ + exit; \ +" ::: __clobber_all); +} + +char _license[] SEC("license") = "GPL"; diff --git a/tools/testing/selftests/bpf/progs/verifier_sockmap_mutate.c b/tools/testing/selftests/bpf/progs/verifier_sockmap_mutate.c new file mode 100644 index 000000000000..fe4b123187b8 --- /dev/null +++ b/tools/testing/selftests/bpf/progs/verifier_sockmap_mutate.c @@ -0,0 +1,187 @@ +// SPDX-License-Identifier: GPL-2.0 + +#include <linux/bpf.h> +#include <bpf/bpf_helpers.h> +#include <bpf/bpf_tracing.h> + +#include "bpf_misc.h" + +#define __always_unused __attribute__((unused)) + +char _license[] SEC("license") = "GPL"; + +struct sock { +} __attribute__((preserve_access_index)); + +struct bpf_iter__sockmap { + union { + struct sock *sk; + }; +} __attribute__((preserve_access_index)); + +struct { + __uint(type, BPF_MAP_TYPE_SOCKHASH); + __uint(max_entries, 1); + __type(key, int); + __type(value, int); +} sockhash SEC(".maps"); + +struct { + __uint(type, BPF_MAP_TYPE_SOCKMAP); + __uint(max_entries, 1); + __type(key, int); + __type(value, int); +} sockmap SEC(".maps"); + +enum { CG_OK = 1 }; + +int zero = 0; + +static __always_inline void test_sockmap_delete(void) +{ + bpf_map_delete_elem(&sockmap, &zero); + bpf_map_delete_elem(&sockhash, &zero); +} + +static __always_inline void test_sockmap_update(void *sk) +{ + if (sk) { + bpf_map_update_elem(&sockmap, &zero, sk, BPF_ANY); + bpf_map_update_elem(&sockhash, &zero, sk, BPF_ANY); + } +} + +static __always_inline void test_sockmap_lookup_and_update(void) +{ + struct bpf_sock *sk = bpf_map_lookup_elem(&sockmap, &zero); + + if (sk) { + test_sockmap_update(sk); + bpf_sk_release(sk); + } +} + +static __always_inline void test_sockmap_mutate(void *sk) +{ + test_sockmap_delete(); + test_sockmap_update(sk); +} + +static __always_inline void test_sockmap_lookup_and_mutate(void) +{ + test_sockmap_delete(); + test_sockmap_lookup_and_update(); +} + +SEC("action") +__success +int test_sched_act(struct __sk_buff *skb) +{ + test_sockmap_mutate(skb->sk); + return 0; +} + +SEC("classifier") +__success +int test_sched_cls(struct __sk_buff *skb) +{ + test_sockmap_mutate(skb->sk); + return 0; +} + +SEC("flow_dissector") +__success +int test_flow_dissector_delete(struct __sk_buff *skb __always_unused) +{ + test_sockmap_delete(); + return 0; +} + +SEC("flow_dissector") +__failure __msg("program of this type cannot use helper bpf_sk_release") +int test_flow_dissector_update(struct __sk_buff *skb __always_unused) +{ + test_sockmap_lookup_and_update(); /* no access to skb->sk */ + return 0; +} + +SEC("iter/sockmap") +__success +int test_trace_iter(struct bpf_iter__sockmap *ctx) +{ + test_sockmap_mutate(ctx->sk); + return 0; +} + +SEC("raw_tp/kfree") +__failure __msg("cannot update sockmap in this context") +int test_raw_tp_delete(const void *ctx __always_unused) +{ + test_sockmap_delete(); + return 0; +} + +SEC("raw_tp/kfree") +__failure __msg("cannot update sockmap in this context") +int test_raw_tp_update(const void *ctx __always_unused) +{ + test_sockmap_lookup_and_update(); + return 0; +} + +SEC("sk_lookup") +__success +int test_sk_lookup(struct bpf_sk_lookup *ctx) +{ + test_sockmap_mutate(ctx->sk); + return 0; +} + +SEC("sk_reuseport") +__success +int test_sk_reuseport(struct sk_reuseport_md *ctx) +{ + test_sockmap_mutate(ctx->sk); + return 0; +} + +SEC("socket") +__success +int test_socket_filter(struct __sk_buff *skb) +{ + test_sockmap_mutate(skb->sk); + return 0; +} + +SEC("sockops") +__success +int test_sockops_delete(struct bpf_sock_ops *ctx __always_unused) +{ + test_sockmap_delete(); + return CG_OK; +} + +SEC("sockops") +__failure __msg("cannot update sockmap in this context") +int test_sockops_update(struct bpf_sock_ops *ctx) +{ + test_sockmap_update(ctx->sk); + return CG_OK; +} + +SEC("sockops") +__success +int test_sockops_update_dedicated(struct bpf_sock_ops *ctx) +{ + bpf_sock_map_update(ctx, &sockmap, &zero, BPF_ANY); + bpf_sock_hash_update(ctx, &sockhash, &zero, BPF_ANY); + return CG_OK; +} + +SEC("xdp") +__success +int test_xdp(struct xdp_md *ctx __always_unused) +{ + test_sockmap_lookup_and_mutate(); + return XDP_PASS; +} diff --git a/tools/testing/selftests/cachestat/test_cachestat.c b/tools/testing/selftests/cachestat/test_cachestat.c index b171fd53b004..632ab44737ec 100644 --- a/tools/testing/selftests/cachestat/test_cachestat.c +++ b/tools/testing/selftests/cachestat/test_cachestat.c @@ -1,5 +1,6 @@ // SPDX-License-Identifier: GPL-2.0 #define _GNU_SOURCE +#define __SANE_USERSPACE_TYPES__ // Use ll64 #include <stdio.h> #include <stdbool.h> diff --git a/tools/testing/selftests/cgroup/.gitignore b/tools/testing/selftests/cgroup/.gitignore index 2732e0b29271..952e4448bf07 100644 --- a/tools/testing/selftests/cgroup/.gitignore +++ b/tools/testing/selftests/cgroup/.gitignore @@ -1,11 +1,12 @@ # SPDX-License-Identifier: GPL-2.0-only -test_memcontrol test_core -test_freezer -test_kmem -test_kill test_cpu test_cpuset -test_zswap +test_freezer test_hugetlb_memcg +test_kill +test_kmem +test_memcontrol +test_pids +test_zswap wait_inotify diff --git a/tools/testing/selftests/cgroup/Makefile b/tools/testing/selftests/cgroup/Makefile index 16461dc0ffdf..1b897152bab6 100644 --- a/tools/testing/selftests/cgroup/Makefile +++ b/tools/testing/selftests/cgroup/Makefile @@ -6,26 +6,29 @@ all: ${HELPER_PROGS} TEST_FILES := with_stress.sh TEST_PROGS := test_stress.sh test_cpuset_prs.sh test_cpuset_v1_hp.sh TEST_GEN_FILES := wait_inotify -TEST_GEN_PROGS = test_memcontrol -TEST_GEN_PROGS += test_kmem -TEST_GEN_PROGS += test_core -TEST_GEN_PROGS += test_freezer -TEST_GEN_PROGS += test_kill +# Keep the lists lexicographically sorted +TEST_GEN_PROGS = test_core TEST_GEN_PROGS += test_cpu TEST_GEN_PROGS += test_cpuset -TEST_GEN_PROGS += test_zswap +TEST_GEN_PROGS += test_freezer TEST_GEN_PROGS += test_hugetlb_memcg +TEST_GEN_PROGS += test_kill +TEST_GEN_PROGS += test_kmem +TEST_GEN_PROGS += test_memcontrol +TEST_GEN_PROGS += test_pids +TEST_GEN_PROGS += test_zswap LOCAL_HDRS += $(selfdir)/clone3/clone3_selftests.h $(selfdir)/pidfd/pidfd.h include ../lib.mk -$(OUTPUT)/test_memcontrol: cgroup_util.c -$(OUTPUT)/test_kmem: cgroup_util.c $(OUTPUT)/test_core: cgroup_util.c -$(OUTPUT)/test_freezer: cgroup_util.c -$(OUTPUT)/test_kill: cgroup_util.c $(OUTPUT)/test_cpu: cgroup_util.c $(OUTPUT)/test_cpuset: cgroup_util.c -$(OUTPUT)/test_zswap: cgroup_util.c +$(OUTPUT)/test_freezer: cgroup_util.c $(OUTPUT)/test_hugetlb_memcg: cgroup_util.c +$(OUTPUT)/test_kill: cgroup_util.c +$(OUTPUT)/test_kmem: cgroup_util.c +$(OUTPUT)/test_memcontrol: cgroup_util.c +$(OUTPUT)/test_pids: cgroup_util.c +$(OUTPUT)/test_zswap: cgroup_util.c diff --git a/tools/testing/selftests/cgroup/test_cpuset_prs.sh b/tools/testing/selftests/cgroup/test_cpuset_prs.sh index b5eb1be2248c..7c08cc153367 100755 --- a/tools/testing/selftests/cgroup/test_cpuset_prs.sh +++ b/tools/testing/selftests/cgroup/test_cpuset_prs.sh @@ -28,6 +28,14 @@ CPULIST=$(cat $CGROUP2/cpuset.cpus.effective) NR_CPUS=$(lscpu | grep "^CPU(s):" | sed -e "s/.*:[[:space:]]*//") [[ $NR_CPUS -lt 8 ]] && skip_test "Test needs at least 8 cpus available!" +# Check to see if /dev/console exists and is writable +if [[ -c /dev/console && -w /dev/console ]] +then + CONSOLE=/dev/console +else + CONSOLE=/dev/null +fi + # Set verbose flag and delay factor PROG=$1 VERBOSE=0 @@ -103,8 +111,8 @@ console_msg() { MSG=$1 echo "$MSG" - echo "" > /dev/console - echo "$MSG" > /dev/console + echo "" > $CONSOLE + echo "$MSG" > $CONSOLE pause 0.01 } @@ -161,6 +169,14 @@ test_add_proc() # T = put a task into cgroup # O<c>=<v> = Write <v> to CPU online file of <c> # +# ECPUs - effective CPUs of cpusets +# Pstate - partition root state +# ISOLCPUS - isolated CPUs (<icpus>[,<icpus2>]) +# +# Note that if there are 2 fields in ISOLCPUS, the first one is for +# sched-debug matching which includes offline CPUs and single-CPU partitions +# while the second one is for matching cpuset.cpus.isolated. +# SETUP_A123_PARTITIONS="C1-3:P1:S+ C2-3:P1:S+ C3:P1" TEST_MATRIX=( # old-A1 old-A2 old-A3 old-B1 new-A1 new-A2 new-A3 new-B1 fail ECPUs Pstate ISOLCPUS @@ -220,23 +236,29 @@ TEST_MATRIX=( " C0-3:S+ C1-3:S+ C2-3 . X2-3 X2-3:P2 . . 0 A1:0-1,A2:2-3,A3:2-3 A1:P0,A2:P2 2-3" " C0-3:S+ C1-3:S+ C2-3 . X2-3 X3:P2 . . 0 A1:0-2,A2:3,A3:3 A1:P0,A2:P2 3" " C0-3:S+ C1-3:S+ C2-3 . X2-3 X2-3 X2-3:P2 . 0 A1:0-1,A2:1,A3:2-3 A1:P0,A3:P2 2-3" - " C0-3:S+ C1-3:S+ C2-3 . X2-3 X2-3 X2-3:P2:C3 . 0 A1:0-2,A2:1-2,A3:3 A1:P0,A3:P2 3" + " C0-3:S+ C1-3:S+ C2-3 . X2-3 X2-3 X2-3:P2:C3 . 0 A1:0-1,A2:1,A3:2-3 A1:P0,A3:P2 2-3" " C0-3:S+ C1-3:S+ C2-3 C2-3 . . . P2 0 A1:0-3,A2:1-3,A3:2-3,B1:2-3 A1:P0,A3:P0,B1:P-2" " C0-3:S+ C1-3:S+ C2-3 C4-5 . . . P2 0 B1:4-5 B1:P2 4-5" " C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3 X2-3:P2 P2 0 A3:2-3,B1:4 A3:P2,B1:P2 2-4" " C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3 X2-3:P2:C1-3 P2 0 A3:2-3,B1:4 A3:P2,B1:P2 2-4" " C0-3:S+ C1-3:S+ C2-3 C4 X1-3 X1-3:P2 P2 . 0 A2:1,A3:2-3 A2:P2,A3:P2 1-3" " C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3 X2-3:P2 P2:C4-5 0 A3:2-3,B1:4-5 A3:P2,B1:P2 2-5" + " C4:X0-3:S+ X1-3:S+ X2-3 . . P2 . . 0 A1:4,A2:1-3,A3:1-3 A2:P2 1-3" + " C4:X0-3:S+ X1-3:S+ X2-3 . . . P2 . 0 A1:4,A2:4,A3:2-3 A3:P2 2-3" # Nested remote/local partition tests " C0-3:S+ C1-3:S+ C2-3 C4-5 X2-3 X2-3:P1 P2 P1 0 A1:0-1,A2:,A3:2-3,B1:4-5 \ A1:P0,A2:P1,A3:P2,B1:P1 2-3" " C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3:P1 P2 P1 0 A1:0-1,A2:,A3:2-3,B1:4 \ A1:P0,A2:P1,A3:P2,B1:P1 2-4,2-3" + " C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3:P1 . P1 0 A1:0-1,A2:2-3,A3:2-3,B1:4 \ + A1:P0,A2:P1,A3:P0,B1:P1" " C0-3:S+ C1-3:S+ C3 C4 X2-3 X2-3:P1 P2 P1 0 A1:0-1,A2:2,A3:3,B1:4 \ A1:P0,A2:P1,A3:P2,B1:P1 2-4,3" " C0-4:S+ C1-4:S+ C2-4 . X2-4 X2-4:P2 X4:P1 . 0 A1:0-1,A2:2-3,A3:4 \ A1:P0,A2:P2,A3:P1 2-4,2-3" + " C0-4:S+ C1-4:S+ C2-4 . X2-4 X2-4:P2 X3-4:P1 . 0 A1:0-1,A2:2,A3:3-4 \ + A1:P0,A2:P2,A3:P1 2" " C0-4:X2-4:S+ C1-4:X2-4:S+:P2 C2-4:X4:P1 \ . . X5 . . 0 A1:0-4,A2:1-4,A3:2-4 \ A1:P0,A2:P-2,A3:P-1" @@ -262,8 +284,8 @@ TEST_MATRIX=( . . X2-3 P2 . . 0 A1:0-2,A2:3,XA2:3 A2:P2 3" # Invalid to valid local partition direct transition tests - " C1-3:S+:P2 C2-3:X1:P2 . . . . . . 0 A1:1-3,XA1:1-3,A2:2-3:XA2: A1:P2,A2:P-2 1-3" - " C1-3:S+:P2 C2-3:X1:P2 . . . X3:P2 . . 0 A1:1-2,XA1:1-3,A2:3:XA2:3 A1:P2,A2:P2 1-3" + " C1-3:S+:P2 X4:P2 . . . . . . 0 A1:1-3,XA1:1-3,A2:1-3:XA2: A1:P2,A2:P-2 1-3" + " C1-3:S+:P2 X4:P2 . . . X3:P2 . . 0 A1:1-2,XA1:1-3,A2:3:XA2:3 A1:P2,A2:P2 1-3" " C0-3:P2 . . C4-6 C0-4 . . . 0 A1:0-4,B1:4-6 A1:P-2,B1:P0" " C0-3:P2 . . C4-6 C0-4:C0-3 . . . 0 A1:0-3,B1:4-6 A1:P2,B1:P0 0-3" " C0-3:P2 . . C3-5:C4-5 . . . . 0 A1:0-3,B1:4-5 A1:P2,B1:P0 0-3" @@ -274,32 +296,26 @@ TEST_MATRIX=( " C0-3:X1-3:S+:P2 C1-3:X2-3:S+:P2 C2-3:X3:P2 \ . . X4 . . 0 A1:1-3,A2:1-3,A3:2-3,XA2:,XA3: A1:P2,A2:P-2,A3:P-2 1-3" " C0-3:X1-3:S+:P2 C1-3:X2-3:S+:P2 C2-3:X3:P2 \ - . . C4 . . 0 A1:1-3,A2:1-3,A3:2-3,XA2:,XA3: A1:P2,A2:P-2,A3:P-2 1-3" + . . C4:X . . 0 A1:1-3,A2:1-3,A3:2-3,XA2:,XA3: A1:P2,A2:P-2,A3:P-2 1-3" # Local partition CPU change tests " C0-5:S+:P2 C4-5:S+:P1 . . . C3-5 . . 0 A1:0-2,A2:3-5 A1:P2,A2:P1 0-2" " C0-5:S+:P2 C4-5:S+:P1 . . C1-5 . . . 0 A1:1-3,A2:4-5 A1:P2,A2:P1 1-3" # cpus_allowed/exclusive_cpus update tests " C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3 \ - . C4 . P2 . 0 A1:4,A2:4,XA2:,XA3:,A3:4 \ + . X:C4 . P2 . 0 A1:4,A2:4,XA2:,XA3:,A3:4 \ A1:P0,A3:P-2" " C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3 \ . X1 . P2 . 0 A1:0-3,A2:1-3,XA1:1,XA2:,XA3:,A3:2-3 \ A1:P0,A3:P-2" " C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3 \ - . . C3 P2 . 0 A1:0-2,A2:0-2,XA2:3,XA3:3,A3:3 \ - A1:P0,A3:P2 3" - " C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3 \ . . X3 P2 . 0 A1:0-2,A2:1-2,XA2:3,XA3:3,A3:3 \ A1:P0,A3:P2 3" " C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3:P2 \ . . X3 . . 0 A1:0-3,A2:1-3,XA2:3,XA3:3,A3:2-3 \ A1:P0,A3:P-2" " C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3:P2 \ - . . C3 . . 0 A1:0-3,A2:3,XA2:3,XA3:3,A3:3 \ - A1:P0,A3:P-2" - " C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3:P2 \ - . C4 . . . 0 A1:4,A2:4,A3:4,XA1:,XA2:,XA3 \ + . X4 . . . 0 A1:0-3,A2:1-3,A3:2-3,XA1:4,XA2:,XA3 \ A1:P0,A3:P-2" # old-A1 old-A2 old-A3 old-B1 new-A1 new-A2 new-A3 new-B1 fail ECPUs Pstate ISOLCPUS @@ -346,6 +362,9 @@ TEST_MATRIX=( " C0-1:P1 . . P1:C2-3 C0-2 . . . 0 A1:0-2,B1:2-3 A1:P-1,B1:P-1" " C0-1 . . P1:C2-3 C0-2 . . . 0 A1:0-2,B1:2-3 A1:P0,B1:P-1" + # cpuset.cpus can overlap with sibling cpuset.cpus.exclusive but not subsumed by it + " C0-3 . . C4-5 X5 . . . 0 A1:0-3,B1:4-5" + # old-A1 old-A2 old-A3 old-B1 new-A1 new-A2 new-A3 new-B1 fail ECPUs Pstate ISOLCPUS # ------ ------ ------ ------ ------ ------ ------ ------ ---- ----- ------ -------- # Failure cases: @@ -355,6 +374,9 @@ TEST_MATRIX=( # Changes to cpuset.cpus.exclusive that violate exclusivity rule is rejected " C0-3 . . C4-5 X0-3 . . X3-5 1 A1:0-3,B1:4-5" + + # cpuset.cpus cannot be a subset of sibling cpuset.cpus.exclusive + " C0-3 . . C4-5 X3-5 . . . 1 A1:0-3,B1:4-5" ) # @@ -556,14 +578,15 @@ check_cgroup_states() do set -- $(echo $CHK | sed -e "s/:/ /g") CGRP=$1 + CGRP_DIR=$CGRP STATE=$2 FILE= EVAL=$(expr substr $STATE 2 2) - [[ $CGRP = A2 ]] && CGRP=A1/A2 - [[ $CGRP = A3 ]] && CGRP=A1/A2/A3 + [[ $CGRP = A2 ]] && CGRP_DIR=A1/A2 + [[ $CGRP = A3 ]] && CGRP_DIR=A1/A2/A3 case $STATE in - P*) FILE=$CGRP/cpuset.cpus.partition + P*) FILE=$CGRP_DIR/cpuset.cpus.partition ;; *) echo "Unknown state: $STATE!" exit 1 @@ -587,6 +610,16 @@ check_cgroup_states() ;; esac [[ $EVAL != $VAL ]] && return 1 + + # + # For root partition, dump sched-domains info to console if + # verbose mode set for manual comparison with sched debug info. + # + [[ $VAL -eq 1 && $VERBOSE -gt 0 ]] && { + DOMS=$(cat $CGRP_DIR/cpuset.cpus.effective) + [[ -n "$DOMS" ]] && + echo " [$CGRP] sched-domain: $DOMS" > $CONSOLE + } done return 0 } @@ -694,9 +727,9 @@ null_isolcpus_check() [[ $VERBOSE -gt 0 ]] || return 0 # Retry a few times before printing error RETRY=0 - while [[ $RETRY -lt 5 ]] + while [[ $RETRY -lt 8 ]] do - pause 0.01 + pause 0.02 check_isolcpus "." [[ $? -eq 0 ]] && return 0 ((RETRY++)) @@ -726,7 +759,7 @@ run_state_test() while [[ $I -lt $CNT ]] do - echo "Running test $I ..." > /dev/console + echo "Running test $I ..." > $CONSOLE [[ $VERBOSE -gt 1 ]] && { echo "" eval echo \${$TEST[$I]} @@ -783,7 +816,7 @@ run_state_test() while [[ $NEWLIST != $CPULIST && $RETRY -lt 8 ]] do # Wait a bit longer & recheck a few times - pause 0.01 + pause 0.02 ((RETRY++)) NEWLIST=$(cat cpuset.cpus.effective) done diff --git a/tools/testing/selftests/cgroup/test_pids.c b/tools/testing/selftests/cgroup/test_pids.c new file mode 100644 index 000000000000..9ecb83c6cc5c --- /dev/null +++ b/tools/testing/selftests/cgroup/test_pids.c @@ -0,0 +1,178 @@ +// SPDX-License-Identifier: GPL-2.0 +#define _GNU_SOURCE + +#include <errno.h> +#include <linux/limits.h> +#include <signal.h> +#include <string.h> +#include <sys/stat.h> +#include <sys/types.h> +#include <unistd.h> + +#include "../kselftest.h" +#include "cgroup_util.h" + +static int run_success(const char *cgroup, void *arg) +{ + return 0; +} + +static int run_pause(const char *cgroup, void *arg) +{ + return pause(); +} + +/* + * This test checks that pids.max prevents forking new children above the + * specified limit in the cgroup. + */ +static int test_pids_max(const char *root) +{ + int ret = KSFT_FAIL; + char *cg_pids; + int pid; + + cg_pids = cg_name(root, "pids_test"); + if (!cg_pids) + goto cleanup; + + if (cg_create(cg_pids)) + goto cleanup; + + if (cg_read_strcmp(cg_pids, "pids.max", "max\n")) + goto cleanup; + + if (cg_write(cg_pids, "pids.max", "2")) + goto cleanup; + + if (cg_enter_current(cg_pids)) + goto cleanup; + + pid = cg_run_nowait(cg_pids, run_pause, NULL); + if (pid < 0) + goto cleanup; + + if (cg_run_nowait(cg_pids, run_success, NULL) != -1 || errno != EAGAIN) + goto cleanup; + + if (kill(pid, SIGINT)) + goto cleanup; + + ret = KSFT_PASS; + +cleanup: + cg_enter_current(root); + cg_destroy(cg_pids); + free(cg_pids); + + return ret; +} + +/* + * This test checks that pids.events are counted in cgroup associated with pids.max + */ +static int test_pids_events(const char *root) +{ + int ret = KSFT_FAIL; + char *cg_parent = NULL, *cg_child = NULL; + int pid; + + cg_parent = cg_name(root, "pids_parent"); + cg_child = cg_name(cg_parent, "pids_child"); + if (!cg_parent || !cg_child) + goto cleanup; + + if (cg_create(cg_parent)) + goto cleanup; + if (cg_write(cg_parent, "cgroup.subtree_control", "+pids")) + goto cleanup; + if (cg_create(cg_child)) + goto cleanup; + + if (cg_write(cg_parent, "pids.max", "2")) + goto cleanup; + + if (cg_read_strcmp(cg_child, "pids.max", "max\n")) + goto cleanup; + + if (cg_enter_current(cg_child)) + goto cleanup; + + pid = cg_run_nowait(cg_child, run_pause, NULL); + if (pid < 0) + goto cleanup; + + if (cg_run_nowait(cg_child, run_success, NULL) != -1 || errno != EAGAIN) + goto cleanup; + + if (kill(pid, SIGINT)) + goto cleanup; + + if (cg_read_key_long(cg_child, "pids.events", "max ") != 0) + goto cleanup; + if (cg_read_key_long(cg_parent, "pids.events", "max ") != 1) + goto cleanup; + + + ret = KSFT_PASS; + +cleanup: + cg_enter_current(root); + if (cg_child) + cg_destroy(cg_child); + if (cg_parent) + cg_destroy(cg_parent); + free(cg_child); + free(cg_parent); + + return ret; +} + + + +#define T(x) { x, #x } +struct pids_test { + int (*fn)(const char *root); + const char *name; +} tests[] = { + T(test_pids_max), + T(test_pids_events), +}; +#undef T + +int main(int argc, char **argv) +{ + char root[PATH_MAX]; + + ksft_print_header(); + ksft_set_plan(ARRAY_SIZE(tests)); + if (cg_find_unified_root(root, sizeof(root), NULL)) + ksft_exit_skip("cgroup v2 isn't mounted\n"); + + /* + * Check that pids controller is available: + * pids is listed in cgroup.controllers + */ + if (cg_read_strstr(root, "cgroup.controllers", "pids")) + ksft_exit_skip("pids controller isn't available\n"); + + if (cg_read_strstr(root, "cgroup.subtree_control", "pids")) + if (cg_write(root, "cgroup.subtree_control", "+pids")) + ksft_exit_skip("Failed to set pids controller\n"); + + for (int i = 0; i < ARRAY_SIZE(tests); i++) { + switch (tests[i].fn(root)) { + case KSFT_PASS: + ksft_test_result_pass("%s\n", tests[i].name); + break; + case KSFT_SKIP: + ksft_test_result_skip("%s\n", tests[i].name); + break; + default: + ksft_test_result_fail("%s\n", tests[i].name); + break; + } + } + + ksft_finished(); +} diff --git a/tools/testing/selftests/drivers/net/virtio_net/config b/tools/testing/selftests/drivers/net/virtio_net/config index f35de0542b60..bcf7555eaffe 100644 --- a/tools/testing/selftests/drivers/net/virtio_net/config +++ b/tools/testing/selftests/drivers/net/virtio_net/config @@ -1,2 +1,8 @@ -CONFIG_VIRTIO_NET=y +CONFIG_BPF_SYSCALL=y +CONFIG_CGROUP_BPF=y +CONFIG_IPV6=y +CONFIG_IPV6_MULTIPLE_TABLES=y +CONFIG_NET_L3_MASTER_DEV=y +CONFIG_NET_VRF=m CONFIG_VIRTIO_DEBUG=y +CONFIG_VIRTIO_NET=y diff --git a/tools/testing/selftests/exec/Makefile b/tools/testing/selftests/exec/Makefile index fb4472ddffd8..ab67d58cfab7 100644 --- a/tools/testing/selftests/exec/Makefile +++ b/tools/testing/selftests/exec/Makefile @@ -3,8 +3,13 @@ CFLAGS = -Wall CFLAGS += -Wno-nonnull CFLAGS += -D_GNU_SOURCE +ALIGNS := 0x1000 0x200000 0x1000000 +ALIGN_PIES := $(patsubst %,load_address.%,$(ALIGNS)) +ALIGN_STATIC_PIES := $(patsubst %,load_address.static.%,$(ALIGNS)) +ALIGNMENT_TESTS := $(ALIGN_PIES) $(ALIGN_STATIC_PIES) + TEST_PROGS := binfmt_script.py -TEST_GEN_PROGS := execveat load_address_4096 load_address_2097152 load_address_16777216 non-regular +TEST_GEN_PROGS := execveat non-regular $(ALIGNMENT_TESTS) TEST_GEN_FILES := execveat.symlink execveat.denatured script subdir # Makefile is a run-time dependency, since it's accessed by the execveat test TEST_FILES := Makefile @@ -28,9 +33,9 @@ $(OUTPUT)/execveat.symlink: $(OUTPUT)/execveat $(OUTPUT)/execveat.denatured: $(OUTPUT)/execveat cp $< $@ chmod -x $@ -$(OUTPUT)/load_address_4096: load_address.c - $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=0x1000 -pie -static $< -o $@ -$(OUTPUT)/load_address_2097152: load_address.c - $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=0x200000 -pie -static $< -o $@ -$(OUTPUT)/load_address_16777216: load_address.c - $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=0x1000000 -pie -static $< -o $@ +$(OUTPUT)/load_address.0x%: load_address.c + $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=$(lastword $(subst ., ,$@)) \ + -fPIE -pie $< -o $@ +$(OUTPUT)/load_address.static.0x%: load_address.c + $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=$(lastword $(subst ., ,$@)) \ + -fPIE -static-pie $< -o $@ diff --git a/tools/testing/selftests/exec/load_address.c b/tools/testing/selftests/exec/load_address.c index 17e3207d34ae..8257fddba8c8 100644 --- a/tools/testing/selftests/exec/load_address.c +++ b/tools/testing/selftests/exec/load_address.c @@ -5,11 +5,13 @@ #include <link.h> #include <stdio.h> #include <stdlib.h> +#include <stdbool.h> #include "../kselftest.h" struct Statistics { unsigned long long load_address; unsigned long long alignment; + bool interp; }; int ExtractStatistics(struct dl_phdr_info *info, size_t size, void *data) @@ -26,11 +28,20 @@ int ExtractStatistics(struct dl_phdr_info *info, size_t size, void *data) stats->alignment = 0; for (i = 0; i < info->dlpi_phnum; i++) { + unsigned long long align; + + if (info->dlpi_phdr[i].p_type == PT_INTERP) { + stats->interp = true; + continue; + } + if (info->dlpi_phdr[i].p_type != PT_LOAD) continue; - if (info->dlpi_phdr[i].p_align > stats->alignment) - stats->alignment = info->dlpi_phdr[i].p_align; + align = info->dlpi_phdr[i].p_align; + + if (align > stats->alignment) + stats->alignment = align; } return 1; // Terminate dl_iterate_phdr. @@ -38,27 +49,57 @@ int ExtractStatistics(struct dl_phdr_info *info, size_t size, void *data) int main(int argc, char **argv) { - struct Statistics extracted; - unsigned long long misalign; + struct Statistics extracted = { }; + unsigned long long misalign, pow2; + bool interp_needed; + char buf[1024]; + FILE *maps; int ret; ksft_print_header(); - ksft_set_plan(1); + ksft_set_plan(4); + + /* Dump maps file for debugging reference. */ + maps = fopen("/proc/self/maps", "r"); + if (!maps) + ksft_exit_fail_msg("FAILED: /proc/self/maps: %s\n", strerror(errno)); + while (fgets(buf, sizeof(buf), maps)) { + ksft_print_msg("%s", buf); + } + fclose(maps); + /* Walk the program headers. */ ret = dl_iterate_phdr(ExtractStatistics, &extracted); if (ret != 1) ksft_exit_fail_msg("FAILED: dl_iterate_phdr\n"); - if (extracted.alignment == 0) - ksft_exit_fail_msg("FAILED: No alignment found\n"); - else if (extracted.alignment & (extracted.alignment - 1)) - ksft_exit_fail_msg("FAILED: Alignment is not a power of 2\n"); + /* Report our findings. */ + ksft_print_msg("load_address=%#llx alignment=%#llx\n", + extracted.load_address, extracted.alignment); + + /* If we're named with ".static." we expect no INTERP. */ + interp_needed = strstr(argv[0], ".static.") == NULL; + + /* Were we built as expected? */ + ksft_test_result(interp_needed == extracted.interp, + "%s INTERP program header %s\n", + interp_needed ? "Wanted" : "Unwanted", + extracted.interp ? "seen" : "missing"); + + /* Did we find an alignment? */ + ksft_test_result(extracted.alignment != 0, + "Alignment%s found\n", extracted.alignment ? "" : " NOT"); + + /* Is the alignment sane? */ + pow2 = extracted.alignment & (extracted.alignment - 1); + ksft_test_result(pow2 == 0, + "Alignment is%s a power of 2: %#llx\n", + pow2 == 0 ? "" : " NOT", extracted.alignment); + /* Is the load address aligned? */ misalign = extracted.load_address & (extracted.alignment - 1); - if (misalign) - ksft_exit_fail_msg("FAILED: alignment = %llu, load_address = %llu\n", - extracted.alignment, extracted.load_address); + ksft_test_result(misalign == 0, "Load Address is %saligned (%#llx)\n", + misalign ? "MIS" : "", misalign); - ksft_test_result_pass("Completed\n"); ksft_finished(); } diff --git a/tools/testing/selftests/fchmodat2/Makefile b/tools/testing/selftests/fchmodat2/Makefile index 71ec34bf1501..4373cea79b79 100644 --- a/tools/testing/selftests/fchmodat2/Makefile +++ b/tools/testing/selftests/fchmodat2/Makefile @@ -1,6 +1,15 @@ # SPDX-License-Identifier: GPL-2.0-or-later -CFLAGS += -Wall -O2 -g -fsanitize=address -fsanitize=undefined -static-libasan $(KHDR_INCLUDES) +CFLAGS += -Wall -O2 -g -fsanitize=address -fsanitize=undefined $(KHDR_INCLUDES) + +# gcc requires -static-libasan in order to ensure that Address Sanitizer's +# library is the first one loaded. However, clang already statically links the +# Address Sanitizer if -fsanitize is specified. Therefore, simply omit +# -static-libasan for clang builds. +ifeq ($(LLVM),) + CFLAGS += -static-libasan +endif + TEST_GEN_PROGS := fchmodat2_test include ../lib.mk diff --git a/tools/testing/selftests/filesystems/overlayfs/dev_in_maps.c b/tools/testing/selftests/filesystems/overlayfs/dev_in_maps.c index 759f86e7d263..2862aae58b79 100644 --- a/tools/testing/selftests/filesystems/overlayfs/dev_in_maps.c +++ b/tools/testing/selftests/filesystems/overlayfs/dev_in_maps.c @@ -1,5 +1,6 @@ // SPDX-License-Identifier: GPL-2.0 #define _GNU_SOURCE +#define __SANE_USERSPACE_TYPES__ // Use ll64 #include <inttypes.h> #include <unistd.h> diff --git a/tools/testing/selftests/filesystems/statmount/Makefile b/tools/testing/selftests/filesystems/statmount/Makefile index 07a0d5b545ca..3af3136e35a4 100644 --- a/tools/testing/selftests/filesystems/statmount/Makefile +++ b/tools/testing/selftests/filesystems/statmount/Makefile @@ -1,6 +1,6 @@ # SPDX-License-Identifier: GPL-2.0-or-later CFLAGS += -Wall -O2 -g $(KHDR_INCLUDES) -TEST_GEN_PROGS := statmount_test +TEST_GEN_PROGS := statmount_test statmount_test_ns include ../../lib.mk diff --git a/tools/testing/selftests/filesystems/statmount/statmount.h b/tools/testing/selftests/filesystems/statmount/statmount.h new file mode 100644 index 000000000000..f4294bab9d73 --- /dev/null +++ b/tools/testing/selftests/filesystems/statmount/statmount.h @@ -0,0 +1,46 @@ +/* SPDX-License-Identifier: GPL-2.0 */ + +#ifndef __STATMOUNT_H +#define __STATMOUNT_H + +#include <stdint.h> +#include <linux/mount.h> +#include <asm/unistd.h> + +static inline int statmount(uint64_t mnt_id, uint64_t mnt_ns_id, uint64_t mask, + struct statmount *buf, size_t bufsize, + unsigned int flags) +{ + struct mnt_id_req req = { + .size = MNT_ID_REQ_SIZE_VER0, + .mnt_id = mnt_id, + .param = mask, + }; + + if (mnt_ns_id) { + req.size = MNT_ID_REQ_SIZE_VER1; + req.mnt_ns_id = mnt_ns_id; + } + + return syscall(__NR_statmount, &req, buf, bufsize, flags); +} + +static ssize_t listmount(uint64_t mnt_id, uint64_t mnt_ns_id, + uint64_t last_mnt_id, uint64_t list[], size_t num, + unsigned int flags) +{ + struct mnt_id_req req = { + .size = MNT_ID_REQ_SIZE_VER0, + .mnt_id = mnt_id, + .param = last_mnt_id, + }; + + if (mnt_ns_id) { + req.size = MNT_ID_REQ_SIZE_VER1; + req.mnt_ns_id = mnt_ns_id; + } + + return syscall(__NR_listmount, &req, list, num, flags); +} + +#endif /* __STATMOUNT_H */ diff --git a/tools/testing/selftests/filesystems/statmount/statmount_test.c b/tools/testing/selftests/filesystems/statmount/statmount_test.c index e6d7c4f1c85b..c773334bbcc9 100644 --- a/tools/testing/selftests/filesystems/statmount/statmount_test.c +++ b/tools/testing/selftests/filesystems/statmount/statmount_test.c @@ -4,17 +4,15 @@ #include <assert.h> #include <stddef.h> -#include <stdint.h> #include <sched.h> #include <fcntl.h> #include <sys/param.h> #include <sys/mount.h> #include <sys/stat.h> #include <sys/statfs.h> -#include <linux/mount.h> #include <linux/stat.h> -#include <asm/unistd.h> +#include "statmount.h" #include "../../kselftest.h" static const char *const known_fs[] = { @@ -36,18 +34,6 @@ static const char *const known_fs[] = { "ufs", "v7", "vboxsf", "vfat", "virtiofs", "vxfs", "xenfs", "xfs", "zonefs", NULL }; -static int statmount(uint64_t mnt_id, uint64_t mask, struct statmount *buf, - size_t bufsize, unsigned int flags) -{ - struct mnt_id_req req = { - .size = MNT_ID_REQ_SIZE_VER0, - .mnt_id = mnt_id, - .param = mask, - }; - - return syscall(__NR_statmount, &req, buf, bufsize, flags); -} - static struct statmount *statmount_alloc(uint64_t mnt_id, uint64_t mask, unsigned int flags) { size_t bufsize = 1 << 15; @@ -56,7 +42,7 @@ static struct statmount *statmount_alloc(uint64_t mnt_id, uint64_t mask, unsigne int ret; for (;;) { - ret = statmount(mnt_id, mask, tmp, bufsize, flags); + ret = statmount(mnt_id, 0, mask, tmp, bufsize, flags); if (ret != -1) break; if (tofree) @@ -121,12 +107,20 @@ static char root_mntpoint[] = "/tmp/statmount_test_root.XXXXXX"; static int orig_root; static uint64_t root_id, parent_id; static uint32_t old_root_id, old_parent_id; - +static FILE *f_mountinfo; static void cleanup_namespace(void) { - fchdir(orig_root); - chroot("."); + int ret; + + ret = fchdir(orig_root); + if (ret == -1) + ksft_perror("fchdir to original root"); + + ret = chroot("."); + if (ret == -1) + ksft_perror("chroot to original root"); + umount2(root_mntpoint, MNT_DETACH); rmdir(root_mntpoint); } @@ -138,7 +132,7 @@ static void setup_namespace(void) uid_t uid = getuid(); gid_t gid = getgid(); - ret = unshare(CLONE_NEWNS|CLONE_NEWUSER); + ret = unshare(CLONE_NEWNS|CLONE_NEWUSER|CLONE_NEWPID); if (ret == -1) ksft_exit_fail_msg("unsharing mountns and userns: %s\n", strerror(errno)); @@ -149,6 +143,11 @@ static void setup_namespace(void) sprintf(buf, "0 %d 1", gid); write_file("/proc/self/gid_map", buf); + f_mountinfo = fopen("/proc/self/mountinfo", "re"); + if (!f_mountinfo) + ksft_exit_fail_msg("failed to open mountinfo: %s\n", + strerror(errno)); + ret = mount("", "/", NULL, MS_REC|MS_PRIVATE, NULL); if (ret == -1) ksft_exit_fail_msg("making mount tree private: %s\n", @@ -208,25 +207,13 @@ static int setup_mount_tree(int log2_num) return 0; } -static ssize_t listmount(uint64_t mnt_id, uint64_t last_mnt_id, - uint64_t list[], size_t num, unsigned int flags) -{ - struct mnt_id_req req = { - .size = MNT_ID_REQ_SIZE_VER0, - .mnt_id = mnt_id, - .param = last_mnt_id, - }; - - return syscall(__NR_listmount, &req, list, num, flags); -} - static void test_listmount_empty_root(void) { ssize_t res; const unsigned int size = 32; uint64_t list[size]; - res = listmount(LSMT_ROOT, 0, list, size, 0); + res = listmount(LSMT_ROOT, 0, 0, list, size, 0); if (res == -1) { ksft_test_result_fail("listmount: %s\n", strerror(errno)); return; @@ -251,7 +238,7 @@ static void test_statmount_zero_mask(void) struct statmount sm; int ret; - ret = statmount(root_id, 0, &sm, sizeof(sm), 0); + ret = statmount(root_id, 0, 0, &sm, sizeof(sm), 0); if (ret == -1) { ksft_test_result_fail("statmount zero mask: %s\n", strerror(errno)); @@ -277,7 +264,7 @@ static void test_statmount_mnt_basic(void) int ret; uint64_t mask = STATMOUNT_MNT_BASIC; - ret = statmount(root_id, mask, &sm, sizeof(sm), 0); + ret = statmount(root_id, 0, mask, &sm, sizeof(sm), 0); if (ret == -1) { ksft_test_result_fail("statmount mnt basic: %s\n", strerror(errno)); @@ -337,7 +324,7 @@ static void test_statmount_sb_basic(void) struct statx sx; struct statfs sf; - ret = statmount(root_id, mask, &sm, sizeof(sm), 0); + ret = statmount(root_id, 0, mask, &sm, sizeof(sm), 0); if (ret == -1) { ksft_test_result_fail("statmount sb basic: %s\n", strerror(errno)); @@ -462,6 +449,88 @@ static void test_statmount_fs_type(void) free(sm); } +static void test_statmount_mnt_opts(void) +{ + struct statmount *sm; + const char *statmount_opts; + char *line = NULL; + size_t len = 0; + + sm = statmount_alloc(root_id, STATMOUNT_MNT_BASIC | STATMOUNT_MNT_OPTS, + 0); + if (!sm) { + ksft_test_result_fail("statmount mnt opts: %s\n", + strerror(errno)); + return; + } + + while (getline(&line, &len, f_mountinfo) != -1) { + int i; + char *p, *p2; + unsigned int old_mnt_id; + + old_mnt_id = atoi(line); + if (old_mnt_id != sm->mnt_id_old) + continue; + + for (p = line, i = 0; p && i < 5; i++) + p = strchr(p + 1, ' '); + if (!p) + continue; + + p2 = strchr(p + 1, ' '); + if (!p2) + continue; + *p2 = '\0'; + p = strchr(p2 + 1, '-'); + if (!p) + continue; + for (p++, i = 0; p && i < 2; i++) + p = strchr(p + 1, ' '); + if (!p) + continue; + p++; + + /* skip generic superblock options */ + if (strncmp(p, "ro", 2) == 0) + p += 2; + else if (strncmp(p, "rw", 2) == 0) + p += 2; + if (*p == ',') + p++; + if (strncmp(p, "sync", 4) == 0) + p += 4; + if (*p == ',') + p++; + if (strncmp(p, "dirsync", 7) == 0) + p += 7; + if (*p == ',') + p++; + if (strncmp(p, "lazytime", 8) == 0) + p += 8; + if (*p == ',') + p++; + p2 = strrchr(p, '\n'); + if (p2) + *p2 = '\0'; + + statmount_opts = sm->str + sm->mnt_opts; + if (strcmp(statmount_opts, p) != 0) + ksft_test_result_fail( + "unexpected mount options: '%s' != '%s'\n", + statmount_opts, p); + else + ksft_test_result_pass("statmount mount options\n"); + free(sm); + free(line); + return; + } + + ksft_test_result_fail("didnt't find mount entry\n"); + free(sm); + free(line); +} + static void test_statmount_string(uint64_t mask, size_t off, const char *name) { struct statmount *sm; @@ -498,14 +567,14 @@ static void test_statmount_string(uint64_t mask, size_t off, const char *name) exactsize = sm->size; shortsize = sizeof(*sm) + i; - ret = statmount(root_id, mask, sm, exactsize, 0); + ret = statmount(root_id, 0, mask, sm, exactsize, 0); if (ret == -1) { ksft_test_result_fail("statmount exact size: %s\n", strerror(errno)); goto out; } errno = 0; - ret = statmount(root_id, mask, sm, shortsize, 0); + ret = statmount(root_id, 0, mask, sm, shortsize, 0); if (ret != -1 || errno != EOVERFLOW) { ksft_test_result_fail("should have failed with EOVERFLOW: %s\n", strerror(errno)); @@ -533,7 +602,7 @@ static void test_listmount_tree(void) if (res == -1) return; - num = res = listmount(LSMT_ROOT, 0, list, size, 0); + num = res = listmount(LSMT_ROOT, 0, 0, list, size, 0); if (res == -1) { ksft_test_result_fail("listmount: %s\n", strerror(errno)); return; @@ -545,7 +614,7 @@ static void test_listmount_tree(void) } for (i = 0; i < size - step;) { - res = listmount(LSMT_ROOT, i ? list2[i - 1] : 0, list2 + i, step, 0); + res = listmount(LSMT_ROOT, 0, i ? list2[i - 1] : 0, list2 + i, step, 0); if (res == -1) ksft_test_result_fail("short listmount: %s\n", strerror(errno)); @@ -577,18 +646,18 @@ int main(void) int ret; uint64_t all_mask = STATMOUNT_SB_BASIC | STATMOUNT_MNT_BASIC | STATMOUNT_PROPAGATE_FROM | STATMOUNT_MNT_ROOT | - STATMOUNT_MNT_POINT | STATMOUNT_FS_TYPE; + STATMOUNT_MNT_POINT | STATMOUNT_FS_TYPE | STATMOUNT_MNT_NS_ID; ksft_print_header(); - ret = statmount(0, 0, NULL, 0, 0); + ret = statmount(0, 0, 0, NULL, 0, 0); assert(ret == -1); if (errno == ENOSYS) ksft_exit_skip("statmount() syscall not supported\n"); setup_namespace(); - ksft_set_plan(14); + ksft_set_plan(15); test_listmount_empty_root(); test_statmount_zero_mask(); test_statmount_mnt_basic(); @@ -596,6 +665,7 @@ int main(void) test_statmount_mnt_root(); test_statmount_mnt_point(); test_statmount_fs_type(); + test_statmount_mnt_opts(); test_statmount_string(STATMOUNT_MNT_ROOT, str_off(mnt_root), "mount root"); test_statmount_string(STATMOUNT_MNT_POINT, str_off(mnt_point), "mount point"); test_statmount_string(STATMOUNT_FS_TYPE, str_off(fs_type), "fs type"); diff --git a/tools/testing/selftests/filesystems/statmount/statmount_test_ns.c b/tools/testing/selftests/filesystems/statmount/statmount_test_ns.c new file mode 100644 index 000000000000..e044f5fc57fd --- /dev/null +++ b/tools/testing/selftests/filesystems/statmount/statmount_test_ns.c @@ -0,0 +1,364 @@ +// SPDX-License-Identifier: GPL-2.0-or-later + +#define _GNU_SOURCE + +#include <assert.h> +#include <fcntl.h> +#include <limits.h> +#include <sched.h> +#include <stdlib.h> +#include <sys/mount.h> +#include <sys/stat.h> +#include <sys/wait.h> +#include <linux/nsfs.h> +#include <linux/stat.h> + +#include "statmount.h" +#include "../../kselftest.h" + +#define NSID_PASS 0 +#define NSID_FAIL 1 +#define NSID_SKIP 2 +#define NSID_ERROR 3 + +static void handle_result(int ret, const char *testname) +{ + if (ret == NSID_PASS) + ksft_test_result_pass("%s\n", testname); + else if (ret == NSID_FAIL) + ksft_test_result_fail("%s\n", testname); + else if (ret == NSID_ERROR) + ksft_exit_fail_msg("%s\n", testname); + else + ksft_test_result_skip("%s\n", testname); +} + +static inline int wait_for_pid(pid_t pid) +{ + int status, ret; + +again: + ret = waitpid(pid, &status, 0); + if (ret == -1) { + if (errno == EINTR) + goto again; + + ksft_print_msg("waitpid returned -1, errno=%d\n", errno); + return -1; + } + + if (!WIFEXITED(status)) { + ksft_print_msg( + "waitpid !WIFEXITED, WIFSIGNALED=%d, WTERMSIG=%d\n", + WIFSIGNALED(status), WTERMSIG(status)); + return -1; + } + + ret = WEXITSTATUS(status); + return ret; +} + +static int get_mnt_ns_id(const char *mnt_ns, uint64_t *mnt_ns_id) +{ + int fd = open(mnt_ns, O_RDONLY); + + if (fd < 0) { + ksft_print_msg("failed to open for ns %s: %s\n", + mnt_ns, strerror(errno)); + sleep(60); + return NSID_ERROR; + } + + if (ioctl(fd, NS_GET_MNTNS_ID, mnt_ns_id) < 0) { + ksft_print_msg("failed to get the nsid for ns %s: %s\n", + mnt_ns, strerror(errno)); + return NSID_ERROR; + } + close(fd); + return NSID_PASS; +} + +static int get_mnt_id(const char *path, uint64_t *mnt_id) +{ + struct statx sx; + int ret; + + ret = statx(AT_FDCWD, path, 0, STATX_MNT_ID_UNIQUE, &sx); + if (ret == -1) { + ksft_print_msg("retrieving unique mount ID for %s: %s\n", path, + strerror(errno)); + return NSID_ERROR; + } + + if (!(sx.stx_mask & STATX_MNT_ID_UNIQUE)) { + ksft_print_msg("no unique mount ID available for %s\n", path); + return NSID_ERROR; + } + + *mnt_id = sx.stx_mnt_id; + return NSID_PASS; +} + +static int write_file(const char *path, const char *val) +{ + int fd = open(path, O_WRONLY); + size_t len = strlen(val); + int ret; + + if (fd == -1) { + ksft_print_msg("opening %s for write: %s\n", path, strerror(errno)); + return NSID_ERROR; + } + + ret = write(fd, val, len); + if (ret == -1) { + ksft_print_msg("writing to %s: %s\n", path, strerror(errno)); + return NSID_ERROR; + } + if (ret != len) { + ksft_print_msg("short write to %s\n", path); + return NSID_ERROR; + } + + ret = close(fd); + if (ret == -1) { + ksft_print_msg("closing %s\n", path); + return NSID_ERROR; + } + + return NSID_PASS; +} + +static int setup_namespace(void) +{ + int ret; + char buf[32]; + uid_t uid = getuid(); + gid_t gid = getgid(); + + ret = unshare(CLONE_NEWNS|CLONE_NEWUSER|CLONE_NEWPID); + if (ret == -1) + ksft_exit_fail_msg("unsharing mountns and userns: %s\n", + strerror(errno)); + + sprintf(buf, "0 %d 1", uid); + ret = write_file("/proc/self/uid_map", buf); + if (ret != NSID_PASS) + return ret; + ret = write_file("/proc/self/setgroups", "deny"); + if (ret != NSID_PASS) + return ret; + sprintf(buf, "0 %d 1", gid); + ret = write_file("/proc/self/gid_map", buf); + if (ret != NSID_PASS) + return ret; + + ret = mount("", "/", NULL, MS_REC|MS_PRIVATE, NULL); + if (ret == -1) { + ksft_print_msg("making mount tree private: %s\n", + strerror(errno)); + return NSID_ERROR; + } + + return NSID_PASS; +} + +static int _test_statmount_mnt_ns_id(void) +{ + struct statmount sm; + uint64_t mnt_ns_id; + uint64_t root_id; + int ret; + + ret = get_mnt_ns_id("/proc/self/ns/mnt", &mnt_ns_id); + if (ret != NSID_PASS) + return ret; + + ret = get_mnt_id("/", &root_id); + if (ret != NSID_PASS) + return ret; + + ret = statmount(root_id, 0, STATMOUNT_MNT_NS_ID, &sm, sizeof(sm), 0); + if (ret == -1) { + ksft_print_msg("statmount mnt ns id: %s\n", strerror(errno)); + return NSID_ERROR; + } + + if (sm.size != sizeof(sm)) { + ksft_print_msg("unexpected size: %u != %u\n", sm.size, + (uint32_t)sizeof(sm)); + return NSID_FAIL; + } + if (sm.mask != STATMOUNT_MNT_NS_ID) { + ksft_print_msg("statmount mnt ns id unavailable\n"); + return NSID_SKIP; + } + + if (sm.mnt_ns_id != mnt_ns_id) { + ksft_print_msg("unexpected mnt ns ID: 0x%llx != 0x%llx\n", + (unsigned long long)sm.mnt_ns_id, + (unsigned long long)mnt_ns_id); + return NSID_FAIL; + } + + return NSID_PASS; +} + +static void test_statmount_mnt_ns_id(void) +{ + pid_t pid; + int ret; + + pid = fork(); + if (pid < 0) + ksft_exit_fail_msg("failed to fork: %s\n", strerror(errno)); + + /* We're the original pid, wait for the result. */ + if (pid != 0) { + ret = wait_for_pid(pid); + handle_result(ret, "test statmount ns id"); + return; + } + + ret = setup_namespace(); + if (ret != NSID_PASS) + exit(ret); + ret = _test_statmount_mnt_ns_id(); + exit(ret); +} + +static int validate_external_listmount(pid_t pid, uint64_t child_nr_mounts) +{ + uint64_t list[256]; + uint64_t mnt_ns_id; + uint64_t nr_mounts; + char buf[256]; + int ret; + + /* Get the mount ns id for our child. */ + snprintf(buf, sizeof(buf), "/proc/%lu/ns/mnt", (unsigned long)pid); + ret = get_mnt_ns_id(buf, &mnt_ns_id); + + nr_mounts = listmount(LSMT_ROOT, mnt_ns_id, 0, list, 256, 0); + if (nr_mounts == (uint64_t)-1) { + ksft_print_msg("listmount: %s\n", strerror(errno)); + return NSID_ERROR; + } + + if (nr_mounts != child_nr_mounts) { + ksft_print_msg("listmount results is %zi != %zi\n", nr_mounts, + child_nr_mounts); + return NSID_FAIL; + } + + /* Validate that all of our entries match our mnt_ns_id. */ + for (int i = 0; i < nr_mounts; i++) { + struct statmount sm; + + ret = statmount(list[i], mnt_ns_id, STATMOUNT_MNT_NS_ID, &sm, + sizeof(sm), 0); + if (ret < 0) { + ksft_print_msg("statmount mnt ns id: %s\n", strerror(errno)); + return NSID_ERROR; + } + + if (sm.mask != STATMOUNT_MNT_NS_ID) { + ksft_print_msg("statmount mnt ns id unavailable\n"); + return NSID_SKIP; + } + + if (sm.mnt_ns_id != mnt_ns_id) { + ksft_print_msg("listmount gave us the wrong ns id: 0x%llx != 0x%llx\n", + (unsigned long long)sm.mnt_ns_id, + (unsigned long long)mnt_ns_id); + return NSID_FAIL; + } + } + + return NSID_PASS; +} + +static void test_listmount_ns(void) +{ + uint64_t nr_mounts; + char pval; + int child_ready_pipe[2]; + int parent_ready_pipe[2]; + pid_t pid; + int ret, child_ret; + + if (pipe(child_ready_pipe) < 0) + ksft_exit_fail_msg("failed to create the child pipe: %s\n", + strerror(errno)); + if (pipe(parent_ready_pipe) < 0) + ksft_exit_fail_msg("failed to create the parent pipe: %s\n", + strerror(errno)); + + pid = fork(); + if (pid < 0) + ksft_exit_fail_msg("failed to fork: %s\n", strerror(errno)); + + if (pid == 0) { + char cval; + uint64_t list[256]; + + close(child_ready_pipe[0]); + close(parent_ready_pipe[1]); + + ret = setup_namespace(); + if (ret != NSID_PASS) + exit(ret); + + nr_mounts = listmount(LSMT_ROOT, 0, 0, list, 256, 0); + if (nr_mounts == (uint64_t)-1) { + ksft_print_msg("listmount: %s\n", strerror(errno)); + exit(NSID_FAIL); + } + + /* + * Tell our parent how many mounts we have, and then wait for it + * to tell us we're done. + */ + write(child_ready_pipe[1], &nr_mounts, sizeof(nr_mounts)); + read(parent_ready_pipe[0], &cval, sizeof(cval)); + exit(NSID_PASS); + } + + close(child_ready_pipe[1]); + close(parent_ready_pipe[0]); + + /* Wait until the child has created everything. */ + if (read(child_ready_pipe[0], &nr_mounts, sizeof(nr_mounts)) != + sizeof(nr_mounts)) + ret = NSID_ERROR; + + ret = validate_external_listmount(pid, nr_mounts); + + if (write(parent_ready_pipe[1], &pval, sizeof(pval)) != sizeof(pval)) + ret = NSID_ERROR; + + child_ret = wait_for_pid(pid); + if (child_ret != NSID_PASS) + ret = child_ret; + handle_result(ret, "test listmount ns id"); +} + +int main(void) +{ + int ret; + + ksft_print_header(); + ret = statmount(0, 0, 0, NULL, 0, 0); + assert(ret == -1); + if (errno == ENOSYS) + ksft_exit_skip("statmount() syscall not supported\n"); + + ksft_set_plan(2); + test_statmount_mnt_ns_id(); + test_listmount_ns(); + + if (ksft_get_fail_cnt() + ksft_get_error_cnt() > 0) + ksft_exit_fail(); + else + ksft_exit_pass(); +} diff --git a/tools/testing/selftests/ftrace/config b/tools/testing/selftests/ftrace/config index e59d985eeff0..048a312abf40 100644 --- a/tools/testing/selftests/ftrace/config +++ b/tools/testing/selftests/ftrace/config @@ -1,16 +1,28 @@ -CONFIG_KPROBES=y +CONFIG_BPF_SYSCALL=y +CONFIG_DEBUG_INFO_BTF=y +CONFIG_DEBUG_INFO_DWARF4=y +CONFIG_EPROBE_EVENTS=y +CONFIG_FPROBE=y +CONFIG_FPROBE_EVENTS=y CONFIG_FTRACE=y +CONFIG_FTRACE_SYSCALLS=y +CONFIG_FUNCTION_GRAPH_RETVAL=y CONFIG_FUNCTION_PROFILER=y -CONFIG_TRACER_SNAPSHOT=y -CONFIG_STACK_TRACER=y CONFIG_HIST_TRIGGERS=y -CONFIG_SCHED_TRACER=y -CONFIG_PREEMPT_TRACER=y CONFIG_IRQSOFF_TRACER=y -CONFIG_PREEMPTIRQ_DELAY_TEST=m +CONFIG_KALLSYMS_ALL=y +CONFIG_KPROBES=y +CONFIG_KPROBE_EVENTS=y CONFIG_MODULES=y CONFIG_MODULE_UNLOAD=y +CONFIG_PREEMPTIRQ_DELAY_TEST=m +CONFIG_PREEMPT_TRACER=y +CONFIG_PROBE_EVENTS_BTF_ARGS=y CONFIG_SAMPLES=y CONFIG_SAMPLE_FTRACE_DIRECT=m CONFIG_SAMPLE_TRACE_PRINTK=m -CONFIG_KALLSYMS_ALL=y +CONFIG_SCHED_TRACER=y +CONFIG_STACK_TRACER=y +CONFIG_TRACER_SNAPSHOT=y +CONFIG_UPROBES=y +CONFIG_UPROBE_EVENTS=y diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/test_duplicates.tc b/tools/testing/selftests/ftrace/test.d/dynevent/test_duplicates.tc index d3a79da215c8..5f72abe6fa79 100644 --- a/tools/testing/selftests/ftrace/test.d/dynevent/test_duplicates.tc +++ b/tools/testing/selftests/ftrace/test.d/dynevent/test_duplicates.tc @@ -1,7 +1,7 @@ #!/bin/sh # SPDX-License-Identifier: GPL-2.0 # description: Generic dynamic event - check if duplicate events are caught -# requires: dynamic_events "e[:[<group>/][<event>]] <attached-group>.<attached-event> [<args>]":README +# requires: dynamic_events "e[:[<group>/][<event>]] <attached-group>.<attached-event> [<args>]":README events/syscalls/sys_enter_openat echo 0 > events/enable diff --git a/tools/testing/selftests/ftrace/test.d/filter/event-filter-function.tc b/tools/testing/selftests/ftrace/test.d/filter/event-filter-function.tc index 3f74c09c56b6..118247b8dd84 100644 --- a/tools/testing/selftests/ftrace/test.d/filter/event-filter-function.tc +++ b/tools/testing/selftests/ftrace/test.d/filter/event-filter-function.tc @@ -10,7 +10,6 @@ fail() { #msg } sample_events() { - echo > trace echo 1 > events/kmem/kmem_cache_free/enable echo 1 > tracing_on ls > /dev/null @@ -22,6 +21,7 @@ echo 0 > tracing_on echo 0 > events/enable echo "Get the most frequently calling function" +echo > trace sample_events target_func=`cat trace | grep -o 'call_site=\([^+]*\)' | sed 's/call_site=//' | sort | uniq -c | sort | tail -n 1 | sed 's/^[ 0-9]*//'` @@ -32,7 +32,16 @@ echo > trace echo "Test event filter function name" echo "call_site.function == $target_func" > events/kmem/kmem_cache_free/filter + +sample_events +max_retry=10 +while [ `grep kmem_cache_free trace| wc -l` -eq 0 ]; do sample_events +max_retry=$((max_retry - 1)) +if [ $max_retry -eq 0 ]; then + exit_fail +fi +done hitcnt=`grep kmem_cache_free trace| grep $target_func | wc -l` misscnt=`grep kmem_cache_free trace| grep -v $target_func | wc -l` @@ -49,7 +58,16 @@ address=`grep " ${target_func}\$" /proc/kallsyms | cut -d' ' -f1` echo "Test event filter function address" echo "call_site.function == 0x$address" > events/kmem/kmem_cache_free/filter +echo > trace +sample_events +max_retry=10 +while [ `grep kmem_cache_free trace| wc -l` -eq 0 ]; do sample_events +max_retry=$((max_retry - 1)) +if [ $max_retry -eq 0 ]; then + exit_fail +fi +done hitcnt=`grep kmem_cache_free trace| grep $target_func | wc -l` misscnt=`grep kmem_cache_free trace| grep -v $target_func | wc -l` diff --git a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_eventname.tc b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_eventname.tc index 1f6981ef7afa..ba19b81cef39 100644 --- a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_eventname.tc +++ b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_eventname.tc @@ -30,7 +30,8 @@ find_dot_func() { fi grep " [tT] .*\.isra\..*" /proc/kallsyms | cut -f 3 -d " " | while read f; do - if grep -s $f available_filter_functions; then + cnt=`grep -s $f available_filter_functions | wc -l`; + if [ $cnt -eq 1 ]; then echo $f break fi diff --git a/tools/testing/selftests/futex/Makefile b/tools/testing/selftests/futex/Makefile index 11e157d7533b..78ab2cd111f6 100644 --- a/tools/testing/selftests/futex/Makefile +++ b/tools/testing/selftests/futex/Makefile @@ -3,8 +3,6 @@ SUBDIRS := functional TEST_PROGS := run.sh -.PHONY: all clean - include ../lib.mk all: diff --git a/tools/testing/selftests/futex/functional/Makefile b/tools/testing/selftests/futex/functional/Makefile index a392d0917b4e..994fa3468f17 100644 --- a/tools/testing/selftests/futex/functional/Makefile +++ b/tools/testing/selftests/futex/functional/Makefile @@ -1,6 +1,6 @@ # SPDX-License-Identifier: GPL-2.0 INCLUDES := -I../include -I../../ $(KHDR_INCLUDES) -CFLAGS := $(CFLAGS) -g -O2 -Wall -D_GNU_SOURCE -pthread $(INCLUDES) $(KHDR_INCLUDES) +CFLAGS := $(CFLAGS) -g -O2 -Wall -D_GNU_SOURCE= -pthread $(INCLUDES) $(KHDR_INCLUDES) LDLIBS := -lpthread -lrt LOCAL_HDRS := \ diff --git a/tools/testing/selftests/futex/functional/futex_requeue_pi.c b/tools/testing/selftests/futex/functional/futex_requeue_pi.c index 7f3ca5c78df1..215c6cb539b4 100644 --- a/tools/testing/selftests/futex/functional/futex_requeue_pi.c +++ b/tools/testing/selftests/futex/functional/futex_requeue_pi.c @@ -360,7 +360,7 @@ out: int main(int argc, char *argv[]) { - const char *test_name; + char *test_name; int c, ret; while ((c = getopt(argc, argv, "bchlot:v:")) != -1) { diff --git a/tools/testing/selftests/kselftest.h b/tools/testing/selftests/kselftest.h index 76c2a6945d3e..b8967b6e29d5 100644 --- a/tools/testing/selftests/kselftest.h +++ b/tools/testing/selftests/kselftest.h @@ -168,15 +168,7 @@ static inline __printf(1, 2) void ksft_print_msg(const char *msg, ...) static inline void ksft_perror(const char *msg) { -#ifndef NOLIBC ksft_print_msg("%s: %s (%d)\n", msg, strerror(errno), errno); -#else - /* - * nolibc doesn't provide strerror() and it seems - * inappropriate to add one, just print the errno. - */ - ksft_print_msg("%s: %d)\n", msg, errno); -#endif } static inline __printf(1, 2) void ksft_test_result_pass(const char *msg, ...) diff --git a/tools/testing/selftests/kselftest_harness.h b/tools/testing/selftests/kselftest_harness.h index b634969cbb6f..40723a6a083f 100644 --- a/tools/testing/selftests/kselftest_harness.h +++ b/tools/testing/selftests/kselftest_harness.h @@ -66,8 +66,6 @@ #include <sys/wait.h> #include <unistd.h> #include <setjmp.h> -#include <syscall.h> -#include <linux/sched.h> #include "kselftest.h" @@ -82,17 +80,6 @@ # define TH_LOG_ENABLED 1 #endif -/* Wait for the child process to end but without sharing memory mapping. */ -static inline pid_t clone3_vfork(void) -{ - struct clone_args args = { - .flags = CLONE_VFORK, - .exit_signal = SIGCHLD, - }; - - return syscall(__NR_clone3, &args, sizeof(args)); -} - /** * TH_LOG() * @@ -437,7 +424,7 @@ static inline pid_t clone3_vfork(void) } \ if (setjmp(_metadata->env) == 0) { \ /* _metadata and potentially self are shared with all forks. */ \ - child = clone3_vfork(); \ + child = fork(); \ if (child == 0) { \ fixture_name##_setup(_metadata, self, variant->data); \ /* Let setup failure terminate early. */ \ @@ -1016,7 +1003,14 @@ void __wait_for_test(struct __test_metadata *t) .sa_flags = SA_SIGINFO, }; struct sigaction saved_action; - int status; + /* + * Sets status so that WIFEXITED(status) returns true and + * WEXITSTATUS(status) returns KSFT_FAIL. This safe default value + * should never be evaluated because of the waitpid(2) check and + * SIGALRM handling. + */ + int status = KSFT_FAIL << 8; + int child; if (sigaction(SIGALRM, &action, &saved_action)) { t->exit_code = KSFT_FAIL; @@ -1028,7 +1022,15 @@ void __wait_for_test(struct __test_metadata *t) __active_test = t; t->timed_out = false; alarm(t->timeout); - waitpid(t->pid, &status, 0); + child = waitpid(t->pid, &status, 0); + if (child == -1 && errno != EINTR) { + t->exit_code = KSFT_FAIL; + fprintf(TH_LOG_STREAM, + "# %s: Failed to wait for PID %d (errno: %d)\n", + t->name, t->pid, errno); + return; + } + alarm(0); if (sigaction(SIGALRM, &saved_action, NULL)) { t->exit_code = KSFT_FAIL; @@ -1083,6 +1085,7 @@ void __wait_for_test(struct __test_metadata *t) WTERMSIG(status)); } } else { + t->exit_code = KSFT_FAIL; fprintf(TH_LOG_STREAM, "# %s: Test ended in some other way [%u]\n", t->name, @@ -1218,6 +1221,7 @@ void __run_test(struct __fixture_metadata *f, struct __test_xfail *xfail; char test_name[1024]; const char *diagnostic; + int child; /* reset test struct */ t->exit_code = KSFT_PASS; @@ -1236,15 +1240,16 @@ void __run_test(struct __fixture_metadata *f, fflush(stdout); fflush(stderr); - t->pid = clone3_vfork(); - if (t->pid < 0) { + child = fork(); + if (child < 0) { ksft_print_msg("ERROR SPAWNING TEST CHILD\n"); t->exit_code = KSFT_FAIL; - } else if (t->pid == 0) { + } else if (child == 0) { setpgrp(); t->fn(t, variant); _exit(t->exit_code); } else { + t->pid = child; __wait_for_test(t); } ksft_print_msg(" %4s %s\n", diff --git a/tools/testing/selftests/kvm/Makefile b/tools/testing/selftests/kvm/Makefile index ce8ff8e8ce3a..ac280dcba996 100644 --- a/tools/testing/selftests/kvm/Makefile +++ b/tools/testing/selftests/kvm/Makefile @@ -183,6 +183,7 @@ TEST_GEN_PROGS_s390x += s390x/sync_regs_test TEST_GEN_PROGS_s390x += s390x/tprot TEST_GEN_PROGS_s390x += s390x/cmma_test TEST_GEN_PROGS_s390x += s390x/debug_test +TEST_GEN_PROGS_s390x += s390x/shared_zeropage_test TEST_GEN_PROGS_s390x += demand_paging_test TEST_GEN_PROGS_s390x += dirty_log_test TEST_GEN_PROGS_s390x += guest_print_test diff --git a/tools/testing/selftests/kvm/include/x86_64/processor.h b/tools/testing/selftests/kvm/include/x86_64/processor.h index 8eb57de0b587..c0c7c1fe93f9 100644 --- a/tools/testing/selftests/kvm/include/x86_64/processor.h +++ b/tools/testing/selftests/kvm/include/x86_64/processor.h @@ -277,6 +277,7 @@ struct kvm_x86_cpu_property { #define X86_PROPERTY_MAX_EXT_LEAF KVM_X86_CPU_PROPERTY(0x80000000, 0, EAX, 0, 31) #define X86_PROPERTY_MAX_PHY_ADDR KVM_X86_CPU_PROPERTY(0x80000008, 0, EAX, 0, 7) #define X86_PROPERTY_MAX_VIRT_ADDR KVM_X86_CPU_PROPERTY(0x80000008, 0, EAX, 8, 15) +#define X86_PROPERTY_GUEST_MAX_PHY_ADDR KVM_X86_CPU_PROPERTY(0x80000008, 0, EAX, 16, 23) #define X86_PROPERTY_SEV_C_BIT KVM_X86_CPU_PROPERTY(0x8000001F, 0, EBX, 0, 5) #define X86_PROPERTY_PHYS_ADDR_REDUCTION KVM_X86_CPU_PROPERTY(0x8000001F, 0, EBX, 6, 11) diff --git a/tools/testing/selftests/kvm/lib/riscv/ucall.c b/tools/testing/selftests/kvm/lib/riscv/ucall.c index 14ee17151a59..b5035c63d516 100644 --- a/tools/testing/selftests/kvm/lib/riscv/ucall.c +++ b/tools/testing/selftests/kvm/lib/riscv/ucall.c @@ -9,6 +9,7 @@ #include "kvm_util.h" #include "processor.h" +#include "sbi.h" void *ucall_arch_get_ucall(struct kvm_vcpu *vcpu) { diff --git a/tools/testing/selftests/kvm/lib/x86_64/processor.c b/tools/testing/selftests/kvm/lib/x86_64/processor.c index c664e446136b..594b061aef52 100644 --- a/tools/testing/selftests/kvm/lib/x86_64/processor.c +++ b/tools/testing/selftests/kvm/lib/x86_64/processor.c @@ -1247,9 +1247,20 @@ unsigned long vm_compute_max_gfn(struct kvm_vm *vm) { const unsigned long num_ht_pages = 12 << (30 - vm->page_shift); /* 12 GiB */ unsigned long ht_gfn, max_gfn, max_pfn; - uint8_t maxphyaddr; + uint8_t maxphyaddr, guest_maxphyaddr; - max_gfn = (1ULL << (vm->pa_bits - vm->page_shift)) - 1; + /* + * Use "guest MAXPHYADDR" from KVM if it's available. Guest MAXPHYADDR + * enumerates the max _mappable_ GPA, which can be less than the raw + * MAXPHYADDR, e.g. if MAXPHYADDR=52, KVM is using TDP, and the CPU + * doesn't support 5-level TDP. + */ + guest_maxphyaddr = kvm_cpu_property(X86_PROPERTY_GUEST_MAX_PHY_ADDR); + guest_maxphyaddr = guest_maxphyaddr ?: vm->pa_bits; + TEST_ASSERT(guest_maxphyaddr <= vm->pa_bits, + "Guest MAXPHYADDR should never be greater than raw MAXPHYADDR"); + + max_gfn = (1ULL << (guest_maxphyaddr - vm->page_shift)) - 1; /* Avoid reserved HyperTransport region on AMD processors. */ if (!host_cpu_is_amd) diff --git a/tools/testing/selftests/kvm/riscv/ebreak_test.c b/tools/testing/selftests/kvm/riscv/ebreak_test.c index 823c132069b4..0e0712854953 100644 --- a/tools/testing/selftests/kvm/riscv/ebreak_test.c +++ b/tools/testing/selftests/kvm/riscv/ebreak_test.c @@ -6,6 +6,7 @@ * */ #include "kvm_util.h" +#include "ucall_common.h" #define LABEL_ADDRESS(v) ((uint64_t)&(v)) diff --git a/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c b/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c index 69bb94e6b227..f299cbfd23ca 100644 --- a/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c +++ b/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c @@ -15,6 +15,7 @@ #include "processor.h" #include "sbi.h" #include "arch_timer.h" +#include "ucall_common.h" /* Maximum counters(firmware + hardware) */ #define RISCV_MAX_PMU_COUNTERS 64 diff --git a/tools/testing/selftests/kvm/s390x/shared_zeropage_test.c b/tools/testing/selftests/kvm/s390x/shared_zeropage_test.c new file mode 100644 index 000000000000..bba0d9a6dcc8 --- /dev/null +++ b/tools/testing/selftests/kvm/s390x/shared_zeropage_test.c @@ -0,0 +1,111 @@ +// SPDX-License-Identifier: GPL-2.0-or-later +/* + * Test shared zeropage handling (with/without storage keys) + * + * Copyright (C) 2024, Red Hat, Inc. + */ +#include <sys/mman.h> + +#include <linux/fs.h> + +#include "test_util.h" +#include "kvm_util.h" +#include "kselftest.h" +#include "ucall_common.h" + +static void set_storage_key(void *addr, uint8_t skey) +{ + asm volatile("sske %0,%1" : : "d" (skey), "a" (addr)); +} + +static void guest_code(void) +{ + /* Issue some storage key instruction. */ + set_storage_key((void *)0, 0x98); + GUEST_DONE(); +} + +/* + * Returns 1 if the shared zeropage is mapped, 0 if something else is mapped. + * Returns < 0 on error or if nothing is mapped. + */ +static int maps_shared_zeropage(int pagemap_fd, void *addr) +{ + struct page_region region; + struct pm_scan_arg arg = { + .start = (uintptr_t)addr, + .end = (uintptr_t)addr + 4096, + .vec = (uintptr_t)®ion, + .vec_len = 1, + .size = sizeof(struct pm_scan_arg), + .category_mask = PAGE_IS_PFNZERO, + .category_anyof_mask = PAGE_IS_PRESENT, + .return_mask = PAGE_IS_PFNZERO, + }; + return ioctl(pagemap_fd, PAGEMAP_SCAN, &arg); +} + +int main(int argc, char *argv[]) +{ + char *mem, *page0, *page1, *page2, tmp; + const size_t pagesize = getpagesize(); + struct kvm_vcpu *vcpu; + struct kvm_vm *vm; + struct ucall uc; + int pagemap_fd; + + ksft_print_header(); + ksft_set_plan(3); + + /* + * We'll use memory that is not mapped into the VM for simplicity. + * Shared zeropages are enabled/disabled per-process. + */ + mem = mmap(0, 3 * pagesize, PROT_READ, MAP_PRIVATE | MAP_ANON, -1, 0); + TEST_ASSERT(mem != MAP_FAILED, "mmap() failed"); + + /* Disable THP. Ignore errors on older kernels. */ + madvise(mem, 3 * pagesize, MADV_NOHUGEPAGE); + + page0 = mem; + page1 = page0 + pagesize; + page2 = page1 + pagesize; + + /* Can we even detect shared zeropages? */ + pagemap_fd = open("/proc/self/pagemap", O_RDONLY); + TEST_REQUIRE(pagemap_fd >= 0); + + tmp = *page0; + asm volatile("" : "+r" (tmp)); + TEST_REQUIRE(maps_shared_zeropage(pagemap_fd, page0) == 1); + + vm = vm_create_with_one_vcpu(&vcpu, guest_code); + + /* Verify that we get the shared zeropage after VM creation. */ + tmp = *page1; + asm volatile("" : "+r" (tmp)); + ksft_test_result(maps_shared_zeropage(pagemap_fd, page1) == 1, + "Shared zeropages should be enabled\n"); + + /* + * Let our VM execute a storage key instruction that should + * unshare all shared zeropages. + */ + vcpu_run(vcpu); + get_ucall(vcpu, &uc); + TEST_ASSERT_EQ(uc.cmd, UCALL_DONE); + + /* Verify that we don't have a shared zeropage anymore. */ + ksft_test_result(!maps_shared_zeropage(pagemap_fd, page1), + "Shared zeropage should be gone\n"); + + /* Verify that we don't get any new shared zeropages. */ + tmp = *page2; + asm volatile("" : "+r" (tmp)); + ksft_test_result(!maps_shared_zeropage(pagemap_fd, page2), + "Shared zeropages should be disabled\n"); + + kvm_vm_free(vm); + + ksft_finished(); +} diff --git a/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c b/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c index 7a4a61be119b..3fb967f40c6a 100644 --- a/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c +++ b/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c @@ -105,11 +105,11 @@ void test_features(uint32_t vm_type, uint64_t supported_features) int i; for (i = 0; i < 64; i++) { - if (!(supported_features & (1u << i))) + if (!(supported_features & BIT_ULL(i))) test_init2_invalid(vm_type, &(struct kvm_sev_init){ .vmsa_features = BIT_ULL(i) }, "unknown feature"); - else if (KNOWN_FEATURES & (1u << i)) + else if (KNOWN_FEATURES & BIT_ULL(i)) test_init2(vm_type, &(struct kvm_sev_init){ .vmsa_features = BIT_ULL(i) }); } diff --git a/tools/testing/selftests/landlock/fs_test.c b/tools/testing/selftests/landlock/fs_test.c index 6b5a9ff88c3d..7d063c652be1 100644 --- a/tools/testing/selftests/landlock/fs_test.c +++ b/tools/testing/selftests/landlock/fs_test.c @@ -35,6 +35,7 @@ * See https://sourceware.org/glibc/wiki/Synchronizing_Headers. */ #include <linux/fs.h> +#include <linux/mount.h> #include "common.h" @@ -47,6 +48,13 @@ int renameat2(int olddirfd, const char *oldpath, int newdirfd, } #endif +#ifndef open_tree +int open_tree(int dfd, const char *filename, unsigned int flags) +{ + return syscall(__NR_open_tree, dfd, filename, flags); +} +#endif + #ifndef RENAME_EXCHANGE #define RENAME_EXCHANGE (1 << 1) #endif @@ -2400,6 +2408,43 @@ TEST_F_FORK(layout1, refer_denied_by_default4) layer_dir_s1d1_refer); } +/* + * Tests walking through a denied root mount. + */ +TEST_F_FORK(layout1, refer_mount_root_deny) +{ + const struct landlock_ruleset_attr ruleset_attr = { + .handled_access_fs = LANDLOCK_ACCESS_FS_MAKE_DIR, + }; + int root_fd, ruleset_fd; + + /* Creates a mount object from a non-mount point. */ + set_cap(_metadata, CAP_SYS_ADMIN); + root_fd = + open_tree(AT_FDCWD, dir_s1d1, + AT_EMPTY_PATH | OPEN_TREE_CLONE | OPEN_TREE_CLOEXEC); + clear_cap(_metadata, CAP_SYS_ADMIN); + ASSERT_LE(0, root_fd); + + ruleset_fd = + landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0); + ASSERT_LE(0, ruleset_fd); + + ASSERT_EQ(0, prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0)); + ASSERT_EQ(0, landlock_restrict_self(ruleset_fd, 0)); + EXPECT_EQ(0, close(ruleset_fd)); + + /* Link denied by Landlock: EACCES. */ + EXPECT_EQ(-1, linkat(root_fd, ".", root_fd, "does_not_exist", 0)); + EXPECT_EQ(EACCES, errno); + + /* renameat2() always returns EBUSY. */ + EXPECT_EQ(-1, renameat2(root_fd, ".", root_fd, "does_not_exist", 0)); + EXPECT_EQ(EBUSY, errno); + + EXPECT_EQ(0, close(root_fd)); +} + TEST_F_FORK(layout1, reparent_link) { const struct rule layer1[] = { diff --git a/tools/testing/selftests/lkdtm/tests.txt b/tools/testing/selftests/lkdtm/tests.txt index 368973f05250..cff124c1eddd 100644 --- a/tools/testing/selftests/lkdtm/tests.txt +++ b/tools/testing/selftests/lkdtm/tests.txt @@ -31,6 +31,7 @@ SLAB_FREE_CROSS SLAB_FREE_PAGE #SOFTLOCKUP Hangs the system #HARDLOCKUP Hangs the system +#SMP_CALL_LOCKUP Hangs the system #SPINLOCKUP Hangs the system #HUNG_TASK Hangs the system EXEC_DATA diff --git a/tools/testing/selftests/mm/ksm_functional_tests.c b/tools/testing/selftests/mm/ksm_functional_tests.c index 37de82da9be7..b61803e36d1c 100644 --- a/tools/testing/selftests/mm/ksm_functional_tests.c +++ b/tools/testing/selftests/mm/ksm_functional_tests.c @@ -656,12 +656,33 @@ unmap: munmap(map, size); } +static void init_global_file_handles(void) +{ + mem_fd = open("/proc/self/mem", O_RDWR); + if (mem_fd < 0) + ksft_exit_fail_msg("opening /proc/self/mem failed\n"); + ksm_fd = open("/sys/kernel/mm/ksm/run", O_RDWR); + if (ksm_fd < 0) + ksft_exit_skip("open(\"/sys/kernel/mm/ksm/run\") failed\n"); + ksm_full_scans_fd = open("/sys/kernel/mm/ksm/full_scans", O_RDONLY); + if (ksm_full_scans_fd < 0) + ksft_exit_skip("open(\"/sys/kernel/mm/ksm/full_scans\") failed\n"); + pagemap_fd = open("/proc/self/pagemap", O_RDONLY); + if (pagemap_fd < 0) + ksft_exit_skip("open(\"/proc/self/pagemap\") failed\n"); + proc_self_ksm_stat_fd = open("/proc/self/ksm_stat", O_RDONLY); + proc_self_ksm_merging_pages_fd = open("/proc/self/ksm_merging_pages", + O_RDONLY); + ksm_use_zero_pages_fd = open("/sys/kernel/mm/ksm/use_zero_pages", O_RDWR); +} + int main(int argc, char **argv) { unsigned int tests = 8; int err; if (argc > 1 && !strcmp(argv[1], FORK_EXEC_CHILD_PRG_NAME)) { + init_global_file_handles(); exit(test_child_ksm()); } @@ -674,22 +695,7 @@ int main(int argc, char **argv) pagesize = getpagesize(); - mem_fd = open("/proc/self/mem", O_RDWR); - if (mem_fd < 0) - ksft_exit_fail_msg("opening /proc/self/mem failed\n"); - ksm_fd = open("/sys/kernel/mm/ksm/run", O_RDWR); - if (ksm_fd < 0) - ksft_exit_skip("open(\"/sys/kernel/mm/ksm/run\") failed\n"); - ksm_full_scans_fd = open("/sys/kernel/mm/ksm/full_scans", O_RDONLY); - if (ksm_full_scans_fd < 0) - ksft_exit_skip("open(\"/sys/kernel/mm/ksm/full_scans\") failed\n"); - pagemap_fd = open("/proc/self/pagemap", O_RDONLY); - if (pagemap_fd < 0) - ksft_exit_skip("open(\"/proc/self/pagemap\") failed\n"); - proc_self_ksm_stat_fd = open("/proc/self/ksm_stat", O_RDONLY); - proc_self_ksm_merging_pages_fd = open("/proc/self/ksm_merging_pages", - O_RDONLY); - ksm_use_zero_pages_fd = open("/sys/kernel/mm/ksm/use_zero_pages", O_RDWR); + init_global_file_handles(); test_unmerge(); test_unmerge_zero_pages(); diff --git a/tools/testing/selftests/mm/map_fixed_noreplace.c b/tools/testing/selftests/mm/map_fixed_noreplace.c index b74813fdc951..d53de2486080 100644 --- a/tools/testing/selftests/mm/map_fixed_noreplace.c +++ b/tools/testing/selftests/mm/map_fixed_noreplace.c @@ -67,7 +67,8 @@ int main(void) dump_maps(); ksft_exit_fail_msg("Error: munmap failed!?\n"); } - ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_test_result_pass("mmap() 5*PAGE_SIZE at base\n"); addr = base_addr + page_size; size = 3 * page_size; @@ -76,7 +77,8 @@ int main(void) dump_maps(); ksft_exit_fail_msg("Error: first mmap() failed unexpectedly\n"); } - ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_test_result_pass("mmap() 3*PAGE_SIZE at base+PAGE_SIZE\n"); /* * Exact same mapping again: @@ -93,7 +95,8 @@ int main(void) dump_maps(); ksft_exit_fail_msg("Error:1: mmap() succeeded when it shouldn't have\n"); } - ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_test_result_pass("mmap() 5*PAGE_SIZE at base\n"); /* * Second mapping contained within first: @@ -111,7 +114,8 @@ int main(void) dump_maps(); ksft_exit_fail_msg("Error:2: mmap() succeeded when it shouldn't have\n"); } - ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_test_result_pass("mmap() 2*PAGE_SIZE at base+PAGE_SIZE\n"); /* * Overlap end of existing mapping: @@ -128,7 +132,8 @@ int main(void) dump_maps(); ksft_exit_fail_msg("Error:3: mmap() succeeded when it shouldn't have\n"); } - ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_test_result_pass("mmap() 2*PAGE_SIZE at base+(3*PAGE_SIZE)\n"); /* * Overlap start of existing mapping: @@ -145,7 +150,8 @@ int main(void) dump_maps(); ksft_exit_fail_msg("Error:4: mmap() succeeded when it shouldn't have\n"); } - ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_test_result_pass("mmap() 2*PAGE_SIZE bytes at base\n"); /* * Adjacent to start of existing mapping: @@ -162,7 +168,8 @@ int main(void) dump_maps(); ksft_exit_fail_msg("Error:5: mmap() failed when it shouldn't have\n"); } - ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_test_result_pass("mmap() PAGE_SIZE at base\n"); /* * Adjacent to end of existing mapping: @@ -179,7 +186,8 @@ int main(void) dump_maps(); ksft_exit_fail_msg("Error:6: mmap() failed when it shouldn't have\n"); } - ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p); + ksft_test_result_pass("mmap() PAGE_SIZE at base+(4*PAGE_SIZE)\n"); addr = base_addr; size = 5 * page_size; diff --git a/tools/testing/selftests/net/.gitignore b/tools/testing/selftests/net/.gitignore index 49a56eb5d036..666ab7d9390b 100644 --- a/tools/testing/selftests/net/.gitignore +++ b/tools/testing/selftests/net/.gitignore @@ -43,7 +43,6 @@ tap tcp_fastopen_backup_key tcp_inq tcp_mmap -test_unix_oob timestamping tls toeplitz diff --git a/tools/testing/selftests/net/Makefile b/tools/testing/selftests/net/Makefile index bd01e4a0be2c..d9393569d03a 100644 --- a/tools/testing/selftests/net/Makefile +++ b/tools/testing/selftests/net/Makefile @@ -43,6 +43,8 @@ TEST_PROGS += srv6_hl2encap_red_l2vpn_test.sh TEST_PROGS += srv6_end_next_csid_l3vpn_test.sh TEST_PROGS += srv6_end_x_next_csid_l3vpn_test.sh TEST_PROGS += srv6_end_flavors_test.sh +TEST_PROGS += srv6_end_dx4_netfilter_test.sh +TEST_PROGS += srv6_end_dx6_netfilter_test.sh TEST_PROGS += vrf_strict_mode_test.sh TEST_PROGS += arp_ndisc_evict_nocarrier.sh TEST_PROGS += ndisc_unsolicited_na_test.sh diff --git a/tools/testing/selftests/net/af_unix/Makefile b/tools/testing/selftests/net/af_unix/Makefile index 3b83c797650d..50584479540b 100644 --- a/tools/testing/selftests/net/af_unix/Makefile +++ b/tools/testing/selftests/net/af_unix/Makefile @@ -1,4 +1,4 @@ CFLAGS += $(KHDR_INCLUDES) -TEST_GEN_PROGS := diag_uid test_unix_oob unix_connect scm_pidfd scm_rights +TEST_GEN_PROGS := diag_uid msg_oob scm_pidfd scm_rights unix_connect include ../../lib.mk diff --git a/tools/testing/selftests/net/af_unix/config b/tools/testing/selftests/net/af_unix/config new file mode 100644 index 000000000000..37368567768c --- /dev/null +++ b/tools/testing/selftests/net/af_unix/config @@ -0,0 +1,3 @@ +CONFIG_UNIX=y +CONFIG_AF_UNIX_OOB=y +CONFIG_UNIX_DIAG=m diff --git a/tools/testing/selftests/net/af_unix/msg_oob.c b/tools/testing/selftests/net/af_unix/msg_oob.c new file mode 100644 index 000000000000..16d0c172eaeb --- /dev/null +++ b/tools/testing/selftests/net/af_unix/msg_oob.c @@ -0,0 +1,734 @@ +// SPDX-License-Identifier: GPL-2.0 +/* Copyright Amazon.com Inc. or its affiliates. */ + +#include <fcntl.h> +#include <string.h> +#include <unistd.h> + +#include <netinet/in.h> +#include <sys/epoll.h> +#include <sys/ioctl.h> +#include <sys/signalfd.h> +#include <sys/socket.h> + +#include "../../kselftest_harness.h" + +#define BUF_SZ 32 + +FIXTURE(msg_oob) +{ + int fd[4]; /* 0: AF_UNIX sender + * 1: AF_UNIX receiver + * 2: TCP sender + * 3: TCP receiver + */ + int signal_fd; + int epoll_fd[2]; /* 0: AF_UNIX receiver + * 1: TCP receiver + */ + bool tcp_compliant; +}; + +FIXTURE_VARIANT(msg_oob) +{ + bool peek; +}; + +FIXTURE_VARIANT_ADD(msg_oob, no_peek) +{ + .peek = false, +}; + +FIXTURE_VARIANT_ADD(msg_oob, peek) +{ + .peek = true +}; + +static void create_unix_socketpair(struct __test_metadata *_metadata, + FIXTURE_DATA(msg_oob) *self) +{ + int ret; + + ret = socketpair(AF_UNIX, SOCK_STREAM | SOCK_NONBLOCK, 0, self->fd); + ASSERT_EQ(ret, 0); +} + +static void create_tcp_socketpair(struct __test_metadata *_metadata, + FIXTURE_DATA(msg_oob) *self) +{ + struct sockaddr_in addr; + socklen_t addrlen; + int listen_fd; + int ret; + + listen_fd = socket(AF_INET, SOCK_STREAM, 0); + ASSERT_GE(listen_fd, 0); + + ret = listen(listen_fd, -1); + ASSERT_EQ(ret, 0); + + addrlen = sizeof(addr); + ret = getsockname(listen_fd, (struct sockaddr *)&addr, &addrlen); + ASSERT_EQ(ret, 0); + + self->fd[2] = socket(AF_INET, SOCK_STREAM, 0); + ASSERT_GE(self->fd[2], 0); + + ret = connect(self->fd[2], (struct sockaddr *)&addr, addrlen); + ASSERT_EQ(ret, 0); + + self->fd[3] = accept(listen_fd, (struct sockaddr *)&addr, &addrlen); + ASSERT_GE(self->fd[3], 0); + + ret = fcntl(self->fd[3], F_SETFL, O_NONBLOCK); + ASSERT_EQ(ret, 0); +} + +static void setup_sigurg(struct __test_metadata *_metadata, + FIXTURE_DATA(msg_oob) *self) +{ + struct signalfd_siginfo siginfo; + int pid = getpid(); + sigset_t mask; + int i, ret; + + for (i = 0; i < 2; i++) { + ret = ioctl(self->fd[i * 2 + 1], FIOSETOWN, &pid); + ASSERT_EQ(ret, 0); + } + + ret = sigemptyset(&mask); + ASSERT_EQ(ret, 0); + + ret = sigaddset(&mask, SIGURG); + ASSERT_EQ(ret, 0); + + ret = sigprocmask(SIG_BLOCK, &mask, NULL); + ASSERT_EQ(ret, 0); + + self->signal_fd = signalfd(-1, &mask, SFD_NONBLOCK); + ASSERT_GE(self->signal_fd, 0); + + ret = read(self->signal_fd, &siginfo, sizeof(siginfo)); + ASSERT_EQ(ret, -1); +} + +static void setup_epollpri(struct __test_metadata *_metadata, + FIXTURE_DATA(msg_oob) *self) +{ + struct epoll_event event = { + .events = EPOLLPRI, + }; + int i; + + for (i = 0; i < 2; i++) { + int ret; + + self->epoll_fd[i] = epoll_create1(0); + ASSERT_GE(self->epoll_fd[i], 0); + + ret = epoll_ctl(self->epoll_fd[i], EPOLL_CTL_ADD, self->fd[i * 2 + 1], &event); + ASSERT_EQ(ret, 0); + } +} + +static void close_sockets(FIXTURE_DATA(msg_oob) *self) +{ + int i; + + for (i = 0; i < 4; i++) + close(self->fd[i]); +} + +FIXTURE_SETUP(msg_oob) +{ + create_unix_socketpair(_metadata, self); + create_tcp_socketpair(_metadata, self); + + setup_sigurg(_metadata, self); + setup_epollpri(_metadata, self); + + self->tcp_compliant = true; +} + +FIXTURE_TEARDOWN(msg_oob) +{ + close_sockets(self); +} + +static void __epollpair(struct __test_metadata *_metadata, + FIXTURE_DATA(msg_oob) *self, + bool oob_remaining) +{ + struct epoll_event event[2] = {}; + int i, ret[2]; + + for (i = 0; i < 2; i++) + ret[i] = epoll_wait(self->epoll_fd[i], &event[i], 1, 0); + + ASSERT_EQ(ret[0], oob_remaining); + + if (self->tcp_compliant) + ASSERT_EQ(ret[0], ret[1]); + + if (oob_remaining) { + ASSERT_EQ(event[0].events, EPOLLPRI); + + if (self->tcp_compliant) + ASSERT_EQ(event[0].events, event[1].events); + } +} + +static void __sendpair(struct __test_metadata *_metadata, + FIXTURE_DATA(msg_oob) *self, + const void *buf, size_t len, int flags) +{ + int i, ret[2]; + + for (i = 0; i < 2; i++) { + struct signalfd_siginfo siginfo = {}; + int bytes; + + ret[i] = send(self->fd[i * 2], buf, len, flags); + + bytes = read(self->signal_fd, &siginfo, sizeof(siginfo)); + + if (flags & MSG_OOB) { + ASSERT_EQ(bytes, sizeof(siginfo)); + ASSERT_EQ(siginfo.ssi_signo, SIGURG); + + bytes = read(self->signal_fd, &siginfo, sizeof(siginfo)); + } + + ASSERT_EQ(bytes, -1); + } + + ASSERT_EQ(ret[0], len); + ASSERT_EQ(ret[0], ret[1]); +} + +static void __recvpair(struct __test_metadata *_metadata, + FIXTURE_DATA(msg_oob) *self, + const void *expected_buf, int expected_len, + int buf_len, int flags) +{ + int i, ret[2], recv_errno[2], expected_errno = 0; + char recv_buf[2][BUF_SZ] = {}; + bool printed = false; + + ASSERT_GE(BUF_SZ, buf_len); + + errno = 0; + + for (i = 0; i < 2; i++) { + ret[i] = recv(self->fd[i * 2 + 1], recv_buf[i], buf_len, flags); + recv_errno[i] = errno; + } + + if (expected_len < 0) { + expected_errno = -expected_len; + expected_len = -1; + } + + if (ret[0] != expected_len || recv_errno[0] != expected_errno) { + TH_LOG("AF_UNIX :%s", ret[0] < 0 ? strerror(recv_errno[0]) : recv_buf[0]); + TH_LOG("Expected:%s", expected_errno ? strerror(expected_errno) : expected_buf); + + ASSERT_EQ(ret[0], expected_len); + ASSERT_EQ(recv_errno[0], expected_errno); + } + + if (ret[0] != ret[1] || recv_errno[0] != recv_errno[1]) { + TH_LOG("AF_UNIX :%s", ret[0] < 0 ? strerror(recv_errno[0]) : recv_buf[0]); + TH_LOG("TCP :%s", ret[1] < 0 ? strerror(recv_errno[1]) : recv_buf[1]); + + printed = true; + + if (self->tcp_compliant) { + ASSERT_EQ(ret[0], ret[1]); + ASSERT_EQ(recv_errno[0], recv_errno[1]); + } + } + + if (expected_len >= 0) { + int cmp; + + cmp = strncmp(expected_buf, recv_buf[0], expected_len); + if (cmp) { + TH_LOG("AF_UNIX :%s", ret[0] < 0 ? strerror(recv_errno[0]) : recv_buf[0]); + TH_LOG("Expected:%s", expected_errno ? strerror(expected_errno) : expected_buf); + + ASSERT_EQ(cmp, 0); + } + + cmp = strncmp(recv_buf[0], recv_buf[1], expected_len); + if (cmp) { + if (!printed) { + TH_LOG("AF_UNIX :%s", ret[0] < 0 ? strerror(recv_errno[0]) : recv_buf[0]); + TH_LOG("TCP :%s", ret[1] < 0 ? strerror(recv_errno[1]) : recv_buf[1]); + } + + if (self->tcp_compliant) + ASSERT_EQ(cmp, 0); + } + } +} + +static void __setinlinepair(struct __test_metadata *_metadata, + FIXTURE_DATA(msg_oob) *self) +{ + int i, oob_inline = 1; + + for (i = 0; i < 2; i++) { + int ret; + + ret = setsockopt(self->fd[i * 2 + 1], SOL_SOCKET, SO_OOBINLINE, + &oob_inline, sizeof(oob_inline)); + ASSERT_EQ(ret, 0); + } +} + +static void __siocatmarkpair(struct __test_metadata *_metadata, + FIXTURE_DATA(msg_oob) *self, + bool oob_head) +{ + int answ[2] = {}; + int i; + + for (i = 0; i < 2; i++) { + int ret; + + ret = ioctl(self->fd[i * 2 + 1], SIOCATMARK, &answ[i]); + ASSERT_EQ(ret, 0); + } + + ASSERT_EQ(answ[0], oob_head); + + if (self->tcp_compliant) + ASSERT_EQ(answ[0], answ[1]); +} + +#define sendpair(buf, len, flags) \ + __sendpair(_metadata, self, buf, len, flags) + +#define recvpair(expected_buf, expected_len, buf_len, flags) \ + do { \ + if (variant->peek) \ + __recvpair(_metadata, self, \ + expected_buf, expected_len, \ + buf_len, (flags) | MSG_PEEK); \ + __recvpair(_metadata, self, \ + expected_buf, expected_len, buf_len, flags); \ + } while (0) + +#define epollpair(oob_remaining) \ + __epollpair(_metadata, self, oob_remaining) + +#define siocatmarkpair(oob_head) \ + __siocatmarkpair(_metadata, self, oob_head) + +#define setinlinepair() \ + __setinlinepair(_metadata, self) + +#define tcp_incompliant \ + for (self->tcp_compliant = false; \ + self->tcp_compliant == false; \ + self->tcp_compliant = true) + +TEST_F(msg_oob, non_oob) +{ + sendpair("x", 1, 0); + epollpair(false); + siocatmarkpair(false); + + recvpair("", -EINVAL, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, oob) +{ + sendpair("x", 1, MSG_OOB); + epollpair(true); + siocatmarkpair(true); + + recvpair("x", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(true); +} + +TEST_F(msg_oob, oob_drop) +{ + sendpair("x", 1, MSG_OOB); + epollpair(true); + siocatmarkpair(true); + + recvpair("", -EAGAIN, 1, 0); /* Drop OOB. */ + epollpair(false); + siocatmarkpair(false); + + recvpair("", -EINVAL, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, oob_ahead) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + recvpair("o", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(false); + + recvpair("hell", 4, 4, 0); + epollpair(false); + siocatmarkpair(true); +} + +TEST_F(msg_oob, oob_break) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + recvpair("hell", 4, 5, 0); /* Break at OOB even with enough buffer. */ + epollpair(true); + siocatmarkpair(true); + + recvpair("o", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(true); + + recvpair("", -EAGAIN, 1, 0); + siocatmarkpair(false); +} + +TEST_F(msg_oob, oob_ahead_break) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + sendpair("world", 5, 0); + epollpair(true); + siocatmarkpair(false); + + recvpair("o", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(false); + + recvpair("hell", 4, 9, 0); /* Break at OOB even after it's recv()ed. */ + epollpair(false); + siocatmarkpair(true); + + recvpair("world", 5, 5, 0); + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, oob_break_drop) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + sendpair("world", 5, 0); + epollpair(true); + siocatmarkpair(false); + + recvpair("hell", 4, 10, 0); /* Break at OOB even with enough buffer. */ + epollpair(true); + siocatmarkpair(true); + + recvpair("world", 5, 10, 0); /* Drop OOB and recv() the next skb. */ + epollpair(false); + siocatmarkpair(false); + + recvpair("", -EINVAL, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, ex_oob_break) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + sendpair("wor", 3, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + sendpair("ld", 2, 0); + epollpair(true); + siocatmarkpair(false); + + recvpair("hellowo", 7, 10, 0); /* Break at OOB but not at ex-OOB. */ + epollpair(true); + siocatmarkpair(true); + + recvpair("r", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(true); + + recvpair("ld", 2, 2, 0); + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, ex_oob_drop) +{ + sendpair("x", 1, MSG_OOB); + epollpair(true); + siocatmarkpair(true); + + sendpair("y", 1, MSG_OOB); /* TCP drops "x" at this moment. */ + epollpair(true); + + tcp_incompliant { + siocatmarkpair(false); + + recvpair("x", 1, 1, 0); /* TCP drops "y" by passing through it. */ + epollpair(true); + siocatmarkpair(true); + + recvpair("y", 1, 1, MSG_OOB); /* TCP returns -EINVAL. */ + epollpair(false); + siocatmarkpair(true); + } +} + +TEST_F(msg_oob, ex_oob_drop_2) +{ + sendpair("x", 1, MSG_OOB); + epollpair(true); + siocatmarkpair(true); + + sendpair("y", 1, MSG_OOB); /* TCP drops "x" at this moment. */ + epollpair(true); + + tcp_incompliant { + siocatmarkpair(false); + } + + recvpair("y", 1, 1, MSG_OOB); + epollpair(false); + + tcp_incompliant { + siocatmarkpair(false); + + recvpair("x", 1, 1, 0); /* TCP returns -EAGAIN. */ + epollpair(false); + siocatmarkpair(true); + } +} + +TEST_F(msg_oob, ex_oob_ahead_break) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + sendpair("wor", 3, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + recvpair("r", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(false); + + sendpair("ld", 2, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + tcp_incompliant { + recvpair("hellowol", 8, 10, 0); /* TCP recv()s "helloworl", why "r" ?? */ + } + + epollpair(true); + siocatmarkpair(true); + + recvpair("d", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(true); +} + +TEST_F(msg_oob, ex_oob_siocatmark) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + recvpair("o", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(false); + + sendpair("world", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + recvpair("hell", 4, 4, 0); /* Intentionally stop at ex-OOB. */ + epollpair(true); + siocatmarkpair(false); +} + +TEST_F(msg_oob, inline_oob) +{ + setinlinepair(); + + sendpair("x", 1, MSG_OOB); + epollpair(true); + siocatmarkpair(true); + + recvpair("", -EINVAL, 1, MSG_OOB); + epollpair(true); + siocatmarkpair(true); + + recvpair("x", 1, 1, 0); + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, inline_oob_break) +{ + setinlinepair(); + + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + recvpair("", -EINVAL, 1, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + recvpair("hell", 4, 5, 0); /* Break at OOB but not at ex-OOB. */ + epollpair(true); + siocatmarkpair(true); + + recvpair("o", 1, 1, 0); + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, inline_oob_ahead_break) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + sendpair("world", 5, 0); + epollpair(true); + siocatmarkpair(false); + + recvpair("o", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(false); + + setinlinepair(); + + recvpair("hell", 4, 9, 0); /* Break at OOB even with enough buffer. */ + epollpair(false); + siocatmarkpair(true); + + tcp_incompliant { + recvpair("world", 5, 6, 0); /* TCP recv()s "oworld", ... "o" ??? */ + } + + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, inline_ex_oob_break) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + sendpair("wor", 3, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + sendpair("ld", 2, 0); + epollpair(true); + siocatmarkpair(false); + + setinlinepair(); + + recvpair("hellowo", 7, 10, 0); /* Break at OOB but not at ex-OOB. */ + epollpair(true); + siocatmarkpair(true); + + recvpair("rld", 3, 3, 0); + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, inline_ex_oob_no_drop) +{ + sendpair("x", 1, MSG_OOB); + epollpair(true); + siocatmarkpair(true); + + setinlinepair(); + + sendpair("y", 1, MSG_OOB); /* TCP does NOT drops "x" at this moment. */ + epollpair(true); + siocatmarkpair(false); + + recvpair("x", 1, 1, 0); + epollpair(true); + siocatmarkpair(true); + + recvpair("y", 1, 1, 0); + epollpair(false); + siocatmarkpair(false); +} + +TEST_F(msg_oob, inline_ex_oob_drop) +{ + sendpair("x", 1, MSG_OOB); + epollpair(true); + siocatmarkpair(true); + + sendpair("y", 1, MSG_OOB); /* TCP drops "x" at this moment. */ + epollpair(true); + + setinlinepair(); + + tcp_incompliant { + siocatmarkpair(false); + + recvpair("x", 1, 1, 0); /* TCP recv()s "y". */ + epollpair(true); + siocatmarkpair(true); + + recvpair("y", 1, 1, 0); /* TCP returns -EAGAIN. */ + epollpair(false); + siocatmarkpair(false); + } +} + +TEST_F(msg_oob, inline_ex_oob_siocatmark) +{ + sendpair("hello", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + recvpair("o", 1, 1, MSG_OOB); + epollpair(false); + siocatmarkpair(false); + + setinlinepair(); + + sendpair("world", 5, MSG_OOB); + epollpair(true); + siocatmarkpair(false); + + recvpair("hell", 4, 4, 0); /* Intentionally stop at ex-OOB. */ + epollpair(true); + siocatmarkpair(false); +} + +TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/net/af_unix/scm_rights.c b/tools/testing/selftests/net/af_unix/scm_rights.c index 2bfed46e0b19..d66336256580 100644 --- a/tools/testing/selftests/net/af_unix/scm_rights.c +++ b/tools/testing/selftests/net/af_unix/scm_rights.c @@ -14,12 +14,12 @@ FIXTURE(scm_rights) { - int fd[16]; + int fd[32]; }; FIXTURE_VARIANT(scm_rights) { - char name[16]; + char name[32]; int type; int flags; bool test_listener; @@ -172,6 +172,8 @@ static void __create_sockets(struct __test_metadata *_metadata, const FIXTURE_VARIANT(scm_rights) *variant, int n) { + ASSERT_LE(n * 2, sizeof(self->fd) / sizeof(self->fd[0])); + if (variant->test_listener) create_listeners(_metadata, self, n); else @@ -283,4 +285,23 @@ TEST_F(scm_rights, cross_edge) close_sockets(8); } +TEST_F(scm_rights, backtrack_from_scc) +{ + create_sockets(10); + + send_fd(0, 1); + send_fd(0, 4); + send_fd(1, 2); + send_fd(2, 3); + send_fd(3, 1); + + send_fd(5, 6); + send_fd(5, 9); + send_fd(6, 7); + send_fd(7, 8); + send_fd(8, 6); + + close_sockets(10); +} + TEST_HARNESS_MAIN diff --git a/tools/testing/selftests/net/af_unix/test_unix_oob.c b/tools/testing/selftests/net/af_unix/test_unix_oob.c deleted file mode 100644 index a7c51889acd5..000000000000 --- a/tools/testing/selftests/net/af_unix/test_unix_oob.c +++ /dev/null @@ -1,436 +0,0 @@ -// SPDX-License-Identifier: GPL-2.0-or-later -#include <stdio.h> -#include <stdlib.h> -#include <sys/socket.h> -#include <arpa/inet.h> -#include <unistd.h> -#include <string.h> -#include <fcntl.h> -#include <sys/ioctl.h> -#include <errno.h> -#include <netinet/tcp.h> -#include <sys/un.h> -#include <sys/signal.h> -#include <sys/poll.h> - -static int pipefd[2]; -static int signal_recvd; -static pid_t producer_id; -static char sock_name[32]; - -static void sig_hand(int sn, siginfo_t *si, void *p) -{ - signal_recvd = sn; -} - -static int set_sig_handler(int signal) -{ - struct sigaction sa; - - sa.sa_sigaction = sig_hand; - sigemptyset(&sa.sa_mask); - sa.sa_flags = SA_SIGINFO | SA_RESTART; - - return sigaction(signal, &sa, NULL); -} - -static void set_filemode(int fd, int set) -{ - int flags = fcntl(fd, F_GETFL, 0); - - if (set) - flags &= ~O_NONBLOCK; - else - flags |= O_NONBLOCK; - fcntl(fd, F_SETFL, flags); -} - -static void signal_producer(int fd) -{ - char cmd; - - cmd = 'S'; - write(fd, &cmd, sizeof(cmd)); -} - -static void wait_for_signal(int fd) -{ - char buf[5]; - - read(fd, buf, 5); -} - -static void die(int status) -{ - fflush(NULL); - unlink(sock_name); - kill(producer_id, SIGTERM); - exit(status); -} - -int is_sioctatmark(int fd) -{ - int ans = -1; - - if (ioctl(fd, SIOCATMARK, &ans, sizeof(ans)) < 0) { -#ifdef DEBUG - perror("SIOCATMARK Failed"); -#endif - } - return ans; -} - -void read_oob(int fd, char *c) -{ - - *c = ' '; - if (recv(fd, c, sizeof(*c), MSG_OOB) < 0) { -#ifdef DEBUG - perror("Reading MSG_OOB Failed"); -#endif - } -} - -int read_data(int pfd, char *buf, int size) -{ - int len = 0; - - memset(buf, size, '0'); - len = read(pfd, buf, size); -#ifdef DEBUG - if (len < 0) - perror("read failed"); -#endif - return len; -} - -static void wait_for_data(int pfd, int event) -{ - struct pollfd pfds[1]; - - pfds[0].fd = pfd; - pfds[0].events = event; - poll(pfds, 1, -1); -} - -void producer(struct sockaddr_un *consumer_addr) -{ - int cfd; - char buf[64]; - int i; - - memset(buf, 'x', sizeof(buf)); - cfd = socket(AF_UNIX, SOCK_STREAM, 0); - - wait_for_signal(pipefd[0]); - if (connect(cfd, (struct sockaddr *)consumer_addr, - sizeof(*consumer_addr)) != 0) { - perror("Connect failed"); - kill(0, SIGTERM); - exit(1); - } - - for (i = 0; i < 2; i++) { - /* Test 1: Test for SIGURG and OOB */ - wait_for_signal(pipefd[0]); - memset(buf, 'x', sizeof(buf)); - buf[63] = '@'; - send(cfd, buf, sizeof(buf), MSG_OOB); - - wait_for_signal(pipefd[0]); - - /* Test 2: Test for OOB being overwitten */ - memset(buf, 'x', sizeof(buf)); - buf[63] = '%'; - send(cfd, buf, sizeof(buf), MSG_OOB); - - memset(buf, 'x', sizeof(buf)); - buf[63] = '#'; - send(cfd, buf, sizeof(buf), MSG_OOB); - - wait_for_signal(pipefd[0]); - - /* Test 3: Test for SIOCATMARK */ - memset(buf, 'x', sizeof(buf)); - buf[63] = '@'; - send(cfd, buf, sizeof(buf), MSG_OOB); - - memset(buf, 'x', sizeof(buf)); - buf[63] = '%'; - send(cfd, buf, sizeof(buf), MSG_OOB); - - memset(buf, 'x', sizeof(buf)); - send(cfd, buf, sizeof(buf), 0); - - wait_for_signal(pipefd[0]); - - /* Test 4: Test for 1byte OOB msg */ - memset(buf, 'x', sizeof(buf)); - buf[0] = '@'; - send(cfd, buf, 1, MSG_OOB); - } -} - -int -main(int argc, char **argv) -{ - int lfd, pfd; - struct sockaddr_un consumer_addr, paddr; - socklen_t len = sizeof(consumer_addr); - char buf[1024]; - int on = 0; - char oob; - int atmark; - - lfd = socket(AF_UNIX, SOCK_STREAM, 0); - memset(&consumer_addr, 0, sizeof(consumer_addr)); - consumer_addr.sun_family = AF_UNIX; - sprintf(sock_name, "unix_oob_%d", getpid()); - unlink(sock_name); - strcpy(consumer_addr.sun_path, sock_name); - - if ((bind(lfd, (struct sockaddr *)&consumer_addr, - sizeof(consumer_addr))) != 0) { - perror("socket bind failed"); - exit(1); - } - - pipe(pipefd); - - listen(lfd, 1); - - producer_id = fork(); - if (producer_id == 0) { - producer(&consumer_addr); - exit(0); - } - - set_sig_handler(SIGURG); - signal_producer(pipefd[1]); - - pfd = accept(lfd, (struct sockaddr *) &paddr, &len); - fcntl(pfd, F_SETOWN, getpid()); - - signal_recvd = 0; - signal_producer(pipefd[1]); - - /* Test 1: - * veriyf that SIGURG is - * delivered, 63 bytes are - * read, oob is '@', and POLLPRI works. - */ - wait_for_data(pfd, POLLPRI); - read_oob(pfd, &oob); - len = read_data(pfd, buf, 1024); - if (!signal_recvd || len != 63 || oob != '@') { - fprintf(stderr, "Test 1 failed sigurg %d len %d %c\n", - signal_recvd, len, oob); - die(1); - } - - signal_recvd = 0; - signal_producer(pipefd[1]); - - /* Test 2: - * Verify that the first OOB is over written by - * the 2nd one and the first OOB is returned as - * part of the read, and sigurg is received. - */ - wait_for_data(pfd, POLLIN | POLLPRI); - len = 0; - while (len < 70) - len = recv(pfd, buf, 1024, MSG_PEEK); - len = read_data(pfd, buf, 1024); - read_oob(pfd, &oob); - if (!signal_recvd || len != 127 || oob != '#') { - fprintf(stderr, "Test 2 failed, sigurg %d len %d OOB %c\n", - signal_recvd, len, oob); - die(1); - } - - signal_recvd = 0; - signal_producer(pipefd[1]); - - /* Test 3: - * verify that 2nd oob over writes - * the first one and read breaks at - * oob boundary returning 127 bytes - * and sigurg is received and atmark - * is set. - * oob is '%' and second read returns - * 64 bytes. - */ - len = 0; - wait_for_data(pfd, POLLIN | POLLPRI); - while (len < 150) - len = recv(pfd, buf, 1024, MSG_PEEK); - len = read_data(pfd, buf, 1024); - atmark = is_sioctatmark(pfd); - read_oob(pfd, &oob); - - if (!signal_recvd || len != 127 || oob != '%' || atmark != 1) { - fprintf(stderr, - "Test 3 failed, sigurg %d len %d OOB %c atmark %d\n", - signal_recvd, len, oob, atmark); - die(1); - } - - signal_recvd = 0; - - len = read_data(pfd, buf, 1024); - if (len != 64) { - fprintf(stderr, "Test 3.1 failed, sigurg %d len %d OOB %c\n", - signal_recvd, len, oob); - die(1); - } - - signal_recvd = 0; - signal_producer(pipefd[1]); - - /* Test 4: - * verify that a single byte - * oob message is delivered. - * set non blocking mode and - * check proper error is - * returned and sigurg is - * received and correct - * oob is read. - */ - - set_filemode(pfd, 0); - - wait_for_data(pfd, POLLIN | POLLPRI); - len = read_data(pfd, buf, 1024); - if ((len == -1) && (errno == 11)) - len = 0; - - read_oob(pfd, &oob); - - if (!signal_recvd || len != 0 || oob != '@') { - fprintf(stderr, "Test 4 failed, sigurg %d len %d OOB %c\n", - signal_recvd, len, oob); - die(1); - } - - set_filemode(pfd, 1); - - /* Inline Testing */ - - on = 1; - if (setsockopt(pfd, SOL_SOCKET, SO_OOBINLINE, &on, sizeof(on))) { - perror("SO_OOBINLINE"); - die(1); - } - - signal_recvd = 0; - signal_producer(pipefd[1]); - - /* Test 1 -- Inline: - * Check that SIGURG is - * delivered and 63 bytes are - * read and oob is '@' - */ - - wait_for_data(pfd, POLLIN | POLLPRI); - len = read_data(pfd, buf, 1024); - - if (!signal_recvd || len != 63) { - fprintf(stderr, "Test 1 Inline failed, sigurg %d len %d\n", - signal_recvd, len); - die(1); - } - - len = read_data(pfd, buf, 1024); - - if (len != 1) { - fprintf(stderr, - "Test 1.1 Inline failed, sigurg %d len %d oob %c\n", - signal_recvd, len, oob); - die(1); - } - - signal_recvd = 0; - signal_producer(pipefd[1]); - - /* Test 2 -- Inline: - * Verify that the first OOB is over written by - * the 2nd one and read breaks correctly on - * 2nd OOB boundary with the first OOB returned as - * part of the read, and sigurg is delivered and - * siocatmark returns true. - * next read returns one byte, the oob byte - * and siocatmark returns false. - */ - len = 0; - wait_for_data(pfd, POLLIN | POLLPRI); - while (len < 70) - len = recv(pfd, buf, 1024, MSG_PEEK); - len = read_data(pfd, buf, 1024); - atmark = is_sioctatmark(pfd); - if (len != 127 || atmark != 1 || !signal_recvd) { - fprintf(stderr, "Test 2 Inline failed, len %d atmark %d\n", - len, atmark); - die(1); - } - - len = read_data(pfd, buf, 1024); - atmark = is_sioctatmark(pfd); - if (len != 1 || buf[0] != '#' || atmark == 1) { - fprintf(stderr, "Test 2.1 Inline failed, len %d data %c atmark %d\n", - len, buf[0], atmark); - die(1); - } - - signal_recvd = 0; - signal_producer(pipefd[1]); - - /* Test 3 -- Inline: - * verify that 2nd oob over writes - * the first one and read breaks at - * oob boundary returning 127 bytes - * and sigurg is received and siocatmark - * is true after the read. - * subsequent read returns 65 bytes - * because of oob which should be '%'. - */ - len = 0; - wait_for_data(pfd, POLLIN | POLLPRI); - while (len < 126) - len = recv(pfd, buf, 1024, MSG_PEEK); - len = read_data(pfd, buf, 1024); - atmark = is_sioctatmark(pfd); - if (!signal_recvd || len != 127 || !atmark) { - fprintf(stderr, - "Test 3 Inline failed, sigurg %d len %d data %c\n", - signal_recvd, len, buf[0]); - die(1); - } - - len = read_data(pfd, buf, 1024); - atmark = is_sioctatmark(pfd); - if (len != 65 || buf[0] != '%' || atmark != 0) { - fprintf(stderr, - "Test 3.1 Inline failed, len %d oob %c atmark %d\n", - len, buf[0], atmark); - die(1); - } - - signal_recvd = 0; - signal_producer(pipefd[1]); - - /* Test 4 -- Inline: - * verify that a single - * byte oob message is delivered - * and read returns one byte, the oob - * byte and sigurg is received - */ - wait_for_data(pfd, POLLIN | POLLPRI); - len = read_data(pfd, buf, 1024); - if (!signal_recvd || len != 1 || buf[0] != '@') { - fprintf(stderr, - "Test 4 Inline failed, signal %d len %d data %c\n", - signal_recvd, len, buf[0]); - die(1); - } - die(0); -} diff --git a/tools/testing/selftests/net/config b/tools/testing/selftests/net/config index 04de7a6ba6f3..d4891f7a2bfa 100644 --- a/tools/testing/selftests/net/config +++ b/tools/testing/selftests/net/config @@ -101,3 +101,5 @@ CONFIG_NETFILTER_XT_MATCH_POLICY=m CONFIG_CRYPTO_ARIA=y CONFIG_XFRM_INTERFACE=m CONFIG_XFRM_USER=m +CONFIG_IP_NF_MATCH_RPFILTER=m +CONFIG_IP6_NF_MATCH_RPFILTER=m diff --git a/tools/testing/selftests/net/hsr/config b/tools/testing/selftests/net/hsr/config index 22061204fb69..241542441c51 100644 --- a/tools/testing/selftests/net/hsr/config +++ b/tools/testing/selftests/net/hsr/config @@ -2,3 +2,4 @@ CONFIG_IPV6=y CONFIG_NET_SCH_NETEM=m CONFIG_HSR=y CONFIG_VETH=y +CONFIG_BRIDGE=y diff --git a/tools/testing/selftests/net/hsr/hsr_ping.sh b/tools/testing/selftests/net/hsr/hsr_ping.sh index 790294c8af83..3684b813b0f6 100755 --- a/tools/testing/selftests/net/hsr/hsr_ping.sh +++ b/tools/testing/selftests/net/hsr/hsr_ping.sh @@ -174,6 +174,8 @@ trap cleanup_all_ns EXIT setup_hsr_interfaces 0 do_complete_ping_test +setup_ns ns1 ns2 ns3 + setup_hsr_interfaces 1 do_complete_ping_test diff --git a/tools/testing/selftests/net/lib.sh b/tools/testing/selftests/net/lib.sh index edc030e81a46..9155c914c064 100644 --- a/tools/testing/selftests/net/lib.sh +++ b/tools/testing/selftests/net/lib.sh @@ -15,7 +15,7 @@ ksft_xfail=2 ksft_skip=4 # namespace list created by setup_ns -NS_LIST="" +NS_LIST=() ############################################################################## # Helpers @@ -27,6 +27,7 @@ __ksft_status_merge() local -A weights local weight=0 + local i for i in "$@"; do weights[$i]=$((weight++)) done @@ -67,9 +68,7 @@ loopy_wait() while true do local out - out=$("$@") - local ret=$? - if ((!ret)); then + if out=$("$@"); then echo -n "$out" return 0 fi @@ -139,6 +138,7 @@ cleanup_ns() fi for ns in "$@"; do + [ -z "${ns}" ] && continue ip netns delete "${ns}" &> /dev/null if ! busywait $BUSYWAIT_TIMEOUT ip netns list \| grep -vq "^$ns$" &> /dev/null; then echo "Warn: Failed to remove namespace $ns" @@ -152,7 +152,7 @@ cleanup_ns() cleanup_all_ns() { - cleanup_ns $NS_LIST + cleanup_ns "${NS_LIST[@]}" } # setup netns with given names as prefix. e.g @@ -161,7 +161,7 @@ setup_ns() { local ns="" local ns_name="" - local ns_list="" + local ns_list=() local ns_exist= for ns_name in "$@"; do # Some test may setup/remove same netns multi times @@ -177,13 +177,13 @@ setup_ns() if ! ip netns add "$ns"; then echo "Failed to create namespace $ns_name" - cleanup_ns "$ns_list" + cleanup_ns "${ns_list[@]}" return $ksft_skip fi ip -n "$ns" link set lo up - ! $ns_exist && ns_list="$ns_list $ns" + ! $ns_exist && ns_list+=("$ns") done - NS_LIST="$NS_LIST $ns_list" + NS_LIST+=("${ns_list[@]}") } tc_rule_stats_get() diff --git a/tools/testing/selftests/net/mptcp/mptcp_join.sh b/tools/testing/selftests/net/mptcp/mptcp_join.sh index fefa9173bdaa..108aeeb84ef1 100755 --- a/tools/testing/selftests/net/mptcp/mptcp_join.sh +++ b/tools/testing/selftests/net/mptcp/mptcp_join.sh @@ -261,6 +261,8 @@ reset() TEST_NAME="${1}" + MPTCP_LIB_SUBTEST_FLAKY=0 # reset if modified + if skip_test; then MPTCP_LIB_TEST_COUNTER=$((MPTCP_LIB_TEST_COUNTER+1)) last_test_ignored=1 @@ -448,7 +450,9 @@ reset_with_tcp_filter() # $1: err msg fail_test() { - ret=${KSFT_FAIL} + if ! mptcp_lib_subtest_is_flaky; then + ret=${KSFT_FAIL} + fi if [ ${#} -gt 0 ]; then print_fail "${@}" @@ -2245,9 +2249,10 @@ remove_tests() if reset "remove invalid addresses"; then pm_nl_set_limits $ns1 3 3 pm_nl_add_endpoint $ns1 10.0.12.1 flags signal + # broadcast IP: no packet for this address will be received on ns1 + pm_nl_add_endpoint $ns1 224.0.0.1 flags signal pm_nl_add_endpoint $ns1 10.0.3.1 flags signal - pm_nl_add_endpoint $ns1 10.0.14.1 flags signal - pm_nl_set_limits $ns2 3 3 + pm_nl_set_limits $ns2 2 2 addr_nr_ns1=-3 speed=10 \ run_tests $ns1 $ns2 10.0.1.1 chk_join_nr 1 1 1 @@ -3069,6 +3074,7 @@ fullmesh_tests() fastclose_tests() { if reset_check_counter "fastclose test" "MPTcpExtMPFastcloseTx"; then + MPTCP_LIB_SUBTEST_FLAKY=1 test_linkfail=1024 fastclose=client \ run_tests $ns1 $ns2 10.0.1.1 chk_join_nr 0 0 0 @@ -3077,6 +3083,7 @@ fastclose_tests() fi if reset_check_counter "fastclose server test" "MPTcpExtMPFastcloseRx"; then + MPTCP_LIB_SUBTEST_FLAKY=1 test_linkfail=1024 fastclose=server \ run_tests $ns1 $ns2 10.0.1.1 chk_join_nr 0 0 0 0 0 0 1 @@ -3095,6 +3102,7 @@ fail_tests() { # single subflow if reset_with_fail "Infinite map" 1; then + MPTCP_LIB_SUBTEST_FLAKY=1 test_linkfail=128 \ run_tests $ns1 $ns2 10.0.1.1 chk_join_nr 0 0 0 +1 +0 1 0 1 "$(pedit_action_pkts)" @@ -3103,6 +3111,7 @@ fail_tests() # multiple subflows if reset_with_fail "MP_FAIL MP_RST" 2; then + MPTCP_LIB_SUBTEST_FLAKY=1 tc -n $ns2 qdisc add dev ns2eth1 root netem rate 1mbit delay 5ms pm_nl_set_limits $ns1 0 1 pm_nl_set_limits $ns2 0 1 diff --git a/tools/testing/selftests/net/mptcp/mptcp_lib.sh b/tools/testing/selftests/net/mptcp/mptcp_lib.sh index ad2ebda5cb64..6ffa9b7a3260 100644 --- a/tools/testing/selftests/net/mptcp/mptcp_lib.sh +++ b/tools/testing/selftests/net/mptcp/mptcp_lib.sh @@ -21,6 +21,7 @@ declare -rx MPTCP_LIB_AF_INET6=10 MPTCP_LIB_SUBTESTS=() MPTCP_LIB_SUBTESTS_DUPLICATED=0 +MPTCP_LIB_SUBTEST_FLAKY=0 MPTCP_LIB_TEST_COUNTER=0 MPTCP_LIB_TEST_FORMAT="%02u %-50s" MPTCP_LIB_IP_MPTCP=0 @@ -41,6 +42,16 @@ else readonly MPTCP_LIB_COLOR_RESET= fi +# SELFTESTS_MPTCP_LIB_OVERRIDE_FLAKY env var can be set not to ignore errors +# from subtests marked as flaky +mptcp_lib_override_flaky() { + [ "${SELFTESTS_MPTCP_LIB_OVERRIDE_FLAKY:-}" = 1 ] +} + +mptcp_lib_subtest_is_flaky() { + [ "${MPTCP_LIB_SUBTEST_FLAKY}" = 1 ] && ! mptcp_lib_override_flaky +} + # $1: color, $2: text mptcp_lib_print_color() { echo -e "${MPTCP_LIB_START_PRINT:-}${*}${MPTCP_LIB_COLOR_RESET}" @@ -72,7 +83,16 @@ mptcp_lib_pr_skip() { } mptcp_lib_pr_fail() { - mptcp_lib_print_err "[FAIL]${1:+ ${*}}" + local title cmt + + if mptcp_lib_subtest_is_flaky; then + title="IGNO" + cmt=" (flaky)" + else + title="FAIL" + fi + + mptcp_lib_print_err "[${title}]${cmt}${1:+ ${*}}" } mptcp_lib_pr_info() { @@ -208,7 +228,13 @@ mptcp_lib_result_pass() { # $1: test name mptcp_lib_result_fail() { - __mptcp_lib_result_add "not ok" "${1}" + if mptcp_lib_subtest_is_flaky; then + # It might sound better to use 'not ok # TODO' or 'ok # SKIP', + # but some CIs don't understand 'TODO' and treat SKIP as errors. + __mptcp_lib_result_add "ok" "${1} # IGNORE Flaky" + else + __mptcp_lib_result_add "not ok" "${1}" + fi } # $1: test name diff --git a/tools/testing/selftests/net/mptcp/simult_flows.sh b/tools/testing/selftests/net/mptcp/simult_flows.sh index 4b14b4412166..f74e1c3c126d 100755 --- a/tools/testing/selftests/net/mptcp/simult_flows.sh +++ b/tools/testing/selftests/net/mptcp/simult_flows.sh @@ -244,7 +244,7 @@ run_test() do_transfer $small $large $time lret=$? mptcp_lib_result_code "${lret}" "${msg}" - if [ $lret -ne 0 ]; then + if [ $lret -ne 0 ] && ! mptcp_lib_subtest_is_flaky; then ret=$lret [ $bail -eq 0 ] || exit $ret fi @@ -254,7 +254,7 @@ run_test() do_transfer $large $small $time lret=$? mptcp_lib_result_code "${lret}" "${msg}" - if [ $lret -ne 0 ]; then + if [ $lret -ne 0 ] && ! mptcp_lib_subtest_is_flaky; then ret=$lret [ $bail -eq 0 ] || exit $ret fi @@ -290,7 +290,7 @@ run_test 10 10 0 0 "balanced bwidth" run_test 10 10 1 25 "balanced bwidth with unbalanced delay" # we still need some additional infrastructure to pass the following test-cases -run_test 10 3 0 0 "unbalanced bwidth" +MPTCP_LIB_SUBTEST_FLAKY=1 run_test 10 3 0 0 "unbalanced bwidth" run_test 10 3 1 25 "unbalanced bwidth with unbalanced delay" run_test 10 3 25 1 "unbalanced bwidth with opposed, unbalanced delay" diff --git a/tools/testing/selftests/net/mptcp/userspace_pm.sh b/tools/testing/selftests/net/mptcp/userspace_pm.sh index 9e2981f2d7f5..9cb05978269d 100755 --- a/tools/testing/selftests/net/mptcp/userspace_pm.sh +++ b/tools/testing/selftests/net/mptcp/userspace_pm.sh @@ -160,10 +160,12 @@ make_connection() local is_v6=$1 local app_port=$app4_port local connect_addr="10.0.1.1" + local client_addr="10.0.1.2" local listen_addr="0.0.0.0" if [ "$is_v6" = "v6" ] then connect_addr="dead:beef:1::1" + client_addr="dead:beef:1::2" listen_addr="::" app_port=$app6_port else @@ -206,6 +208,7 @@ make_connection() [ "$server_serverside" = 1 ] then test_pass + print_title "Connection info: ${client_addr}:${client_port} -> ${connect_addr}:${app_port}" else test_fail "Expected tokens (c:${client_token} - s:${server_token}) and server (c:${client_serverside} - s:${server_serverside})" mptcp_lib_result_print_all_tap @@ -297,7 +300,7 @@ test_announce() ip netns exec "$ns2"\ ./pm_nl_ctl ann 10.0.2.2 token "$client4_token" id $client_addr_id dev\ ns2eth1 - print_test "ADD_ADDR id:${client_addr_id} 10.0.2.2 (ns2) => ns1, reuse port" + print_test "ADD_ADDR id:client 10.0.2.2 (ns2) => ns1, reuse port" sleep 0.5 verify_announce_event $server_evts $ANNOUNCED $server4_token "10.0.2.2" $client_addr_id \ "$client4_port" @@ -306,7 +309,7 @@ test_announce() :>"$server_evts" ip netns exec "$ns2" ./pm_nl_ctl ann\ dead:beef:2::2 token "$client6_token" id $client_addr_id dev ns2eth1 - print_test "ADD_ADDR6 id:${client_addr_id} dead:beef:2::2 (ns2) => ns1, reuse port" + print_test "ADD_ADDR6 id:client dead:beef:2::2 (ns2) => ns1, reuse port" sleep 0.5 verify_announce_event "$server_evts" "$ANNOUNCED" "$server6_token" "dead:beef:2::2"\ "$client_addr_id" "$client6_port" "v6" @@ -316,7 +319,7 @@ test_announce() client_addr_id=$((client_addr_id+1)) ip netns exec "$ns2" ./pm_nl_ctl ann 10.0.2.2 token "$client4_token" id\ $client_addr_id dev ns2eth1 port $new4_port - print_test "ADD_ADDR id:${client_addr_id} 10.0.2.2 (ns2) => ns1, new port" + print_test "ADD_ADDR id:client+1 10.0.2.2 (ns2) => ns1, new port" sleep 0.5 verify_announce_event "$server_evts" "$ANNOUNCED" "$server4_token" "10.0.2.2"\ "$client_addr_id" "$new4_port" @@ -327,7 +330,7 @@ test_announce() # ADD_ADDR from the server to client machine reusing the subflow port ip netns exec "$ns1" ./pm_nl_ctl ann 10.0.2.1 token "$server4_token" id\ $server_addr_id dev ns1eth2 - print_test "ADD_ADDR id:${server_addr_id} 10.0.2.1 (ns1) => ns2, reuse port" + print_test "ADD_ADDR id:server 10.0.2.1 (ns1) => ns2, reuse port" sleep 0.5 verify_announce_event "$client_evts" "$ANNOUNCED" "$client4_token" "10.0.2.1"\ "$server_addr_id" "$app4_port" @@ -336,7 +339,7 @@ test_announce() :>"$client_evts" ip netns exec "$ns1" ./pm_nl_ctl ann dead:beef:2::1 token "$server6_token" id\ $server_addr_id dev ns1eth2 - print_test "ADD_ADDR6 id:${server_addr_id} dead:beef:2::1 (ns1) => ns2, reuse port" + print_test "ADD_ADDR6 id:server dead:beef:2::1 (ns1) => ns2, reuse port" sleep 0.5 verify_announce_event "$client_evts" "$ANNOUNCED" "$client6_token" "dead:beef:2::1"\ "$server_addr_id" "$app6_port" "v6" @@ -346,7 +349,7 @@ test_announce() server_addr_id=$((server_addr_id+1)) ip netns exec "$ns1" ./pm_nl_ctl ann 10.0.2.1 token "$server4_token" id\ $server_addr_id dev ns1eth2 port $new4_port - print_test "ADD_ADDR id:${server_addr_id} 10.0.2.1 (ns1) => ns2, new port" + print_test "ADD_ADDR id:server+1 10.0.2.1 (ns1) => ns2, new port" sleep 0.5 verify_announce_event "$client_evts" "$ANNOUNCED" "$client4_token" "10.0.2.1"\ "$server_addr_id" "$new4_port" @@ -380,7 +383,7 @@ test_remove() local invalid_token=$(( client4_token - 1 )) ip netns exec "$ns2" ./pm_nl_ctl rem token $invalid_token id\ $client_addr_id > /dev/null 2>&1 - print_test "RM_ADDR id:${client_addr_id} ns2 => ns1, invalid token" + print_test "RM_ADDR id:client ns2 => ns1, invalid token" local type type=$(mptcp_lib_evts_get_info type "$server_evts") if [ "$type" = "" ] @@ -394,7 +397,7 @@ test_remove() local invalid_id=$(( client_addr_id + 1 )) ip netns exec "$ns2" ./pm_nl_ctl rem token "$client4_token" id\ $invalid_id > /dev/null 2>&1 - print_test "RM_ADDR id:${invalid_id} ns2 => ns1, invalid id" + print_test "RM_ADDR id:client+1 ns2 => ns1, invalid id" type=$(mptcp_lib_evts_get_info type "$server_evts") if [ "$type" = "" ] then @@ -407,7 +410,7 @@ test_remove() :>"$server_evts" ip netns exec "$ns2" ./pm_nl_ctl rem token "$client4_token" id\ $client_addr_id - print_test "RM_ADDR id:${client_addr_id} ns2 => ns1" + print_test "RM_ADDR id:client ns2 => ns1" sleep 0.5 verify_remove_event "$server_evts" "$REMOVED" "$server4_token" "$client_addr_id" @@ -416,7 +419,7 @@ test_remove() client_addr_id=$(( client_addr_id - 1 )) ip netns exec "$ns2" ./pm_nl_ctl rem token "$client4_token" id\ $client_addr_id - print_test "RM_ADDR id:${client_addr_id} ns2 => ns1" + print_test "RM_ADDR id:client-1 ns2 => ns1" sleep 0.5 verify_remove_event "$server_evts" "$REMOVED" "$server4_token" "$client_addr_id" @@ -424,7 +427,7 @@ test_remove() :>"$server_evts" ip netns exec "$ns2" ./pm_nl_ctl rem token "$client6_token" id\ $client_addr_id - print_test "RM_ADDR6 id:${client_addr_id} ns2 => ns1" + print_test "RM_ADDR6 id:client-1 ns2 => ns1" sleep 0.5 verify_remove_event "$server_evts" "$REMOVED" "$server6_token" "$client_addr_id" @@ -434,7 +437,7 @@ test_remove() # RM_ADDR from the server to client machine ip netns exec "$ns1" ./pm_nl_ctl rem token "$server4_token" id\ $server_addr_id - print_test "RM_ADDR id:${server_addr_id} ns1 => ns2" + print_test "RM_ADDR id:server ns1 => ns2" sleep 0.5 verify_remove_event "$client_evts" "$REMOVED" "$client4_token" "$server_addr_id" @@ -443,7 +446,7 @@ test_remove() server_addr_id=$(( server_addr_id - 1 )) ip netns exec "$ns1" ./pm_nl_ctl rem token "$server4_token" id\ $server_addr_id - print_test "RM_ADDR id:${server_addr_id} ns1 => ns2" + print_test "RM_ADDR id:server-1 ns1 => ns2" sleep 0.5 verify_remove_event "$client_evts" "$REMOVED" "$client4_token" "$server_addr_id" @@ -451,7 +454,7 @@ test_remove() :>"$client_evts" ip netns exec "$ns1" ./pm_nl_ctl rem token "$server6_token" id\ $server_addr_id - print_test "RM_ADDR6 id:${server_addr_id} ns1 => ns2" + print_test "RM_ADDR6 id:server-1 ns1 => ns2" sleep 0.5 verify_remove_event "$client_evts" "$REMOVED" "$client6_token" "$server_addr_id" } @@ -479,8 +482,14 @@ verify_subflow_events() local locid local remid local info + local e_dport_txt - info="${e_saddr} (${e_from}) => ${e_daddr}:${e_dport} (${e_to})" + # only display the fixed ports + if [ "${e_dport}" -ge "${app4_port}" ] && [ "${e_dport}" -le "${app6_port}" ]; then + e_dport_txt=":${e_dport}" + fi + + info="${e_saddr} (${e_from}) => ${e_daddr}${e_dport_txt} (${e_to})" if [ "$e_type" = "$SUB_ESTABLISHED" ] then @@ -766,7 +775,7 @@ test_subflows_v4_v6_mix() :>"$client_evts" ip netns exec "$ns1" ./pm_nl_ctl ann 10.0.2.1 token "$server6_token" id\ $server_addr_id dev ns1eth2 - print_test "ADD_ADDR4 id:${server_addr_id} 10.0.2.1 (ns1) => ns2, reuse port" + print_test "ADD_ADDR4 id:server 10.0.2.1 (ns1) => ns2, reuse port" sleep 0.5 verify_announce_event "$client_evts" "$ANNOUNCED" "$client6_token" "10.0.2.1"\ "$server_addr_id" "$app6_port" @@ -861,7 +870,7 @@ test_listener() local listener_pid=$! sleep 0.5 - print_test "CREATE_LISTENER 10.0.2.2:$client4_port" + print_test "CREATE_LISTENER 10.0.2.2 (client port)" verify_listener_events $client_evts $LISTENER_CREATED $AF_INET 10.0.2.2 $client4_port # ADD_ADDR from client to server machine reusing the subflow port @@ -878,13 +887,14 @@ test_listener() mptcp_lib_kill_wait $listener_pid sleep 0.5 - print_test "CLOSE_LISTENER 10.0.2.2:$client4_port" + print_test "CLOSE_LISTENER 10.0.2.2 (client port)" verify_listener_events $client_evts $LISTENER_CLOSED $AF_INET 10.0.2.2 $client4_port } print_title "Make connections" make_connection make_connection "v6" +print_title "Will be using address IDs ${client_addr_id} (client) and ${server_addr_id} (server)" test_announce test_remove diff --git a/tools/testing/selftests/net/msg_zerocopy.c b/tools/testing/selftests/net/msg_zerocopy.c index bdc03a2097e8..7ea5fb28c93d 100644 --- a/tools/testing/selftests/net/msg_zerocopy.c +++ b/tools/testing/selftests/net/msg_zerocopy.c @@ -85,6 +85,7 @@ static bool cfg_rx; static int cfg_runtime_ms = 4200; static int cfg_verbose; static int cfg_waittime_ms = 500; +static int cfg_notification_limit = 32; static bool cfg_zerocopy; static socklen_t cfg_alen; @@ -95,6 +96,7 @@ static char payload[IP_MAXPACKET]; static long packets, bytes, completions, expected_completions; static int zerocopied = -1; static uint32_t next_completion; +static uint32_t sends_since_notify; static unsigned long gettimeofday_ms(void) { @@ -208,6 +210,7 @@ static bool do_sendmsg(int fd, struct msghdr *msg, bool do_zerocopy, int domain) error(1, errno, "send"); if (cfg_verbose && ret != len) fprintf(stderr, "send: ret=%u != %u\n", ret, len); + sends_since_notify++; if (len) { packets++; @@ -435,7 +438,7 @@ static bool do_recv_completion(int fd, int domain) /* Detect notification gaps. These should not happen often, if at all. * Gaps can occur due to drops, reordering and retransmissions. */ - if (lo != next_completion) + if (cfg_verbose && lo != next_completion) fprintf(stderr, "gap: %u..%u does not append to %u\n", lo, hi, next_completion); next_completion = hi + 1; @@ -460,6 +463,7 @@ static bool do_recv_completion(int fd, int domain) static void do_recv_completions(int fd, int domain) { while (do_recv_completion(fd, domain)) {} + sends_since_notify = 0; } /* Wait for all remaining completions on the errqueue */ @@ -549,6 +553,9 @@ static void do_tx(int domain, int type, int protocol) else do_sendmsg(fd, &msg, cfg_zerocopy, domain); + if (cfg_zerocopy && sends_since_notify >= cfg_notification_limit) + do_recv_completions(fd, domain); + while (!do_poll(fd, POLLOUT)) { if (cfg_zerocopy) do_recv_completions(fd, domain); @@ -708,7 +715,7 @@ static void parse_opts(int argc, char **argv) cfg_payload_len = max_payload_len; - while ((c = getopt(argc, argv, "46c:C:D:i:mp:rs:S:t:vz")) != -1) { + while ((c = getopt(argc, argv, "46c:C:D:i:l:mp:rs:S:t:vz")) != -1) { switch (c) { case '4': if (cfg_family != PF_UNSPEC) @@ -736,6 +743,9 @@ static void parse_opts(int argc, char **argv) if (cfg_ifindex == 0) error(1, errno, "invalid iface: %s", optarg); break; + case 'l': + cfg_notification_limit = strtoul(optarg, NULL, 0); + break; case 'm': cfg_cork_mixed = true; break; diff --git a/tools/testing/selftests/net/openvswitch/openvswitch.sh b/tools/testing/selftests/net/openvswitch/openvswitch.sh index 5cae53543849..15bca0708717 100755 --- a/tools/testing/selftests/net/openvswitch/openvswitch.sh +++ b/tools/testing/selftests/net/openvswitch/openvswitch.sh @@ -1,4 +1,4 @@ -#!/bin/sh +#!/bin/bash # SPDX-License-Identifier: GPL-2.0 # # OVS kernel module self tests diff --git a/tools/testing/selftests/net/openvswitch/ovs-dpctl.py b/tools/testing/selftests/net/openvswitch/ovs-dpctl.py index 1dd057afd3fb..9f8dec2f6539 100644 --- a/tools/testing/selftests/net/openvswitch/ovs-dpctl.py +++ b/tools/testing/selftests/net/openvswitch/ovs-dpctl.py @@ -531,7 +531,7 @@ class ovsactions(nla): for flat_act in parse_flat_map: if parse_starts_block(actstr, flat_act[0], False): actstr = actstr[len(flat_act[0]):] - self["attrs"].append([flat_act[1]]) + self["attrs"].append([flat_act[1], True]) actstr = actstr[strspn(actstr, ", ") :] parsed = True diff --git a/tools/testing/selftests/net/srv6_end_dx4_netfilter_test.sh b/tools/testing/selftests/net/srv6_end_dx4_netfilter_test.sh new file mode 100755 index 000000000000..e23210aa547f --- /dev/null +++ b/tools/testing/selftests/net/srv6_end_dx4_netfilter_test.sh @@ -0,0 +1,335 @@ +#!/bin/bash +# SPDX-License-Identifier: GPL-2.0 +# +# author: Jianguo Wu <wujianguo@chinatelecom.cn> +# +# Mostly copied from tools/testing/selftests/net/srv6_end_dt4_l3vpn_test.sh. +# +# This script is designed for testing the support of netfilter hooks for +# SRv6 End.DX4 behavior. +# +# Hereafter a network diagram is shown, where one tenants (named 100) offer +# IPv4 L3 VPN services allowing hosts to communicate with each other across +# an IPv6 network. +# +# Routers rt-1 and rt-2 implement IPv4 L3 VPN services leveraging the SRv6 +# architecture. The key components for such VPNs are: a) SRv6 Encap behavior, +# b) SRv6 End.DX4 behavior. +# +# To explain how an IPv4 L3 VPN based on SRv6 works, let us briefly consider an +# example where, within the same domain of tenant 100, the host hs-1 pings +# the host hs-2. +# +# First of all, L2 reachability of the host hs-2 is taken into account by +# the router rt-1 which acts as an arp proxy. +# +# When the host hs-1 sends an IPv4 packet destined to hs-2, the router rt-1 +# receives the packet on the internal veth-t100 interface, rt-1 contains the +# SRv6 Encap route for encapsulating the IPv4 packet in a IPv6 plus the Segment +# Routing Header (SRH) packet. This packet is sent through the (IPv6) core +# network up to the router rt-2 that receives it on veth0 interface. +# +# The rt-2 router uses the 'localsid' routing table to process incoming +# IPv6+SRH packets which belong to the VPN of the tenant 100. For each of these +# packets, the SRv6 End.DX4 behavior removes the outer IPv6+SRH headers and +# routs the packet to the specified nexthop. Afterwards, the packet is sent to +# the host hs-2 through the veth-t100 interface. +# +# The ping response follows the same processing but this time the role of rt-1 +# and rt-2 are swapped. +# +# And when net.netfilter.nf_hooks_lwtunnel is set to 1 in rt-1 or rt-2, and a +# rpfilter iptables rule is added, SRv6 packets will go through netfilter PREROUTING +# hooks. +# +# +# +-------------------+ +-------------------+ +# | | | | +# | hs-1 netns | | hs-2 netns | +# | | | | +# | +-------------+ | | +-------------+ | +# | | veth0 | | | | veth0 | | +# | | 10.0.0.1/24 | | | | 10.0.0.2/24 | | +# | +-------------+ | | +-------------+ | +# | . | | . | +# +-------------------+ +-------------------+ +# . . +# . . +# . . +# +-----------------------------------+ +-----------------------------------+ +# | . | | . | +# | +---------------+ | | +---------------- | +# | | veth-t100 | | | | veth-t100 | | +# | | 10.0.0.11/24 | +----------+ | | +----------+ | 10.0.0.22/24 | | +# | +-------+-------+ | route | | | | route | +-------+-------- | +# | | table | | | | table | | +# | +----------+ | | +----------+ | +# | +--------------+ | | +--------------+ | +# | | veth0 | | | | veth0 | | +# | | 2001:11::1/64 |.|...|.| 2001:11::2/64 | | +# | +--------------+ | | +--------------+ | +# | | | | +# | rt-1 netns | | rt-2 netns | +# | | | | +# +-----------------------------------+ +-----------------------------------+ +# +# ~~~~~~~~~~~~~~~~~~~~~~~~~ +# | Network configuration | +# ~~~~~~~~~~~~~~~~~~~~~~~~~ +# +# rt-1: localsid table +# +----------------------------------------------------------------+ +# |SID |Action | +# +----------------------------------------------------------------+ +# |fc00:21:100::6004|apply SRv6 End.DX4 nh4 10.0.0.1 dev veth-t100 | +# +----------------------------------------------------------------+ +# +# rt-1: route table +# +---------------------------------------------------+ +# |host |Action | +# +---------------------------------------------------+ +# |10.0.0.2 |apply seg6 encap segs fc00:12:100::6004| +# +---------------------------------------------------+ +# |10.0.0.0/24|forward to dev veth_t100 | +# +---------------------------------------------------+ +# +# +# rt-2: localsid table +# +---------------------------------------------------------------+ +# |SID |Action | +# +---------------------------------------------------------------+ +# |fc00:12:100::6004|apply SRv6 End.DX4 nh4 10.0.0.2 dev veth-t100| +# +---------------------------------------------------------------+ +# +# rt-2: route table +# +---------------------------------------------------+ +# |host |Action | +# +---------------------------------------------------+ +# |10.0.0.1 |apply seg6 encap segs fc00:21:100::6004| +# +---------------------------------------------------+ +# |10.0.0.0/24|forward to dev veth_t100 | +# +---------------------------------------------------+ +# + +# Kselftest framework requirement - SKIP code is 4. +ksft_skip=4 + +readonly IPv6_RT_NETWORK=2001:11 +readonly IPv4_HS_NETWORK=10.0.0 +readonly SID_LOCATOR=fc00 + +PING_TIMEOUT_SEC=4 + +ret=0 + +PAUSE_ON_FAIL=${PAUSE_ON_FAIL:=no} + +log_test() +{ + local rc=$1 + local expected=$2 + local msg="$3" + + if [ ${rc} -eq ${expected} ]; then + nsuccess=$((nsuccess+1)) + printf "\n TEST: %-60s [ OK ]\n" "${msg}" + else + ret=1 + nfail=$((nfail+1)) + printf "\n TEST: %-60s [FAIL]\n" "${msg}" + if [ "${PAUSE_ON_FAIL}" = "yes" ]; then + echo + echo "hit enter to continue, 'q' to quit" + read a + [ "$a" = "q" ] && exit 1 + fi + fi +} + +print_log_test_results() +{ + if [ "$TESTS" != "none" ]; then + printf "\nTests passed: %3d\n" ${nsuccess} + printf "Tests failed: %3d\n" ${nfail} + fi +} + +log_section() +{ + echo + echo "################################################################################" + echo "TEST SECTION: $*" + echo "################################################################################" +} + +cleanup() +{ + ip link del veth-rt-1 2>/dev/null || true + ip link del veth-rt-2 2>/dev/null || true + + # destroy routers rt-* and hosts hs-* + for ns in $(ip netns show | grep -E 'rt-*|hs-*'); do + ip netns del ${ns} || true + done +} + +# Setup the basic networking for the routers +setup_rt_networking() +{ + local rt=$1 + local nsname=rt-${rt} + + ip netns add ${nsname} + + ip netns exec ${nsname} sysctl -wq net.ipv6.conf.all.accept_dad=0 + ip netns exec ${nsname} sysctl -wq net.ipv6.conf.default.accept_dad=0 + + ip link set veth-rt-${rt} netns ${nsname} + ip -netns ${nsname} link set veth-rt-${rt} name veth0 + + ip -netns ${nsname} addr add ${IPv6_RT_NETWORK}::${rt}/64 dev veth0 nodad + ip -netns ${nsname} link set veth0 up + ip -netns ${nsname} link set lo up + + ip netns exec ${nsname} sysctl -wq net.ipv4.ip_forward=1 + ip netns exec ${nsname} sysctl -wq net.ipv6.conf.all.forwarding=1 +} + +setup_rt_netfilter() +{ + local rt=$1 + local nsname=rt-${rt} + + ip netns exec ${nsname} sysctl -wq net.netfilter.nf_hooks_lwtunnel=1 + ip netns exec ${nsname} iptables -t raw -A PREROUTING -m rpfilter --invert -j DROP +} + +setup_hs() +{ + local hs=$1 + local rt=$2 + local tid=$3 + local hsname=hs-${hs} + local rtname=rt-${rt} + local rtveth=veth-t${tid} + + # set the networking for the host + ip netns add ${hsname} + + ip -netns ${hsname} link add veth0 type veth peer name ${rtveth} + ip -netns ${hsname} link set ${rtveth} netns ${rtname} + ip -netns ${hsname} addr add ${IPv4_HS_NETWORK}.${hs}/24 dev veth0 + ip -netns ${hsname} link set veth0 up + ip -netns ${hsname} link set lo up + + ip -netns ${rtname} addr add ${IPv4_HS_NETWORK}.${rt}${hs}/24 dev ${rtveth} + ip -netns ${rtname} link set ${rtveth} up + + ip netns exec ${rtname} sysctl -wq net.ipv4.conf.${rtveth}.proxy_arp=1 +} + +setup_vpn_config() +{ + local hssrc=$1 + local rtsrc=$2 + local hsdst=$3 + local rtdst=$4 + local tid=$5 + + local hssrc_name=hs-t${tid}-${hssrc} + local hsdst_name=hs-t${tid}-${hsdst} + local rtsrc_name=rt-${rtsrc} + local rtdst_name=rt-${rtdst} + local vpn_sid=${SID_LOCATOR}:${hssrc}${hsdst}:${tid}::6004 + + # set the encap route for encapsulating packets which arrive from the + # host hssrc and destined to the access router rtsrc. + ip -netns ${rtsrc_name} -4 route add ${IPv4_HS_NETWORK}.${hsdst}/32 \ + encap seg6 mode encap segs ${vpn_sid} dev veth0 + ip -netns ${rtsrc_name} -6 route add ${vpn_sid}/128 \ + via 2001:11::${rtdst} dev veth0 + + # set the decap route for decapsulating packets which arrive from + # the rtdst router and destined to the hsdst host. + ip -netns ${rtdst_name} -6 route add ${vpn_sid}/128 \ + encap seg6local action End.DX4 nh4 ${IPv4_HS_NETWORK}.${hsdst} dev veth-t${tid} +} + +setup() +{ + ip link add veth-rt-1 type veth peer name veth-rt-2 + # setup the networking for router rt-1 and router rt-2 + setup_rt_networking 1 + setup_rt_networking 2 + + # setup two hosts for the tenant 100. + # - host hs-1 is directly connected to the router rt-1; + # - host hs-2 is directly connected to the router rt-2. + setup_hs 1 1 100 + setup_hs 2 2 100 + + # setup the IPv4 L3 VPN which connects the host hs-1 and host hs-2. + setup_vpn_config 1 1 2 2 100 #args: src_host src_router dst_host dst_router tenant + setup_vpn_config 2 2 1 1 100 +} + +check_hs_connectivity() +{ + local hssrc=$1 + local hsdst=$2 + local tid=$3 + + ip netns exec hs-${hssrc} ping -c 1 -W ${PING_TIMEOUT_SEC} \ + ${IPv4_HS_NETWORK}.${hsdst} >/dev/null 2>&1 +} + +check_and_log_hs_connectivity() +{ + local hssrc=$1 + local hsdst=$2 + local tid=$3 + + check_hs_connectivity ${hssrc} ${hsdst} ${tid} + log_test $? 0 "Hosts connectivity: hs-${hssrc} -> hs-${hsdst} (tenant ${tid})" +} + +host_tests() +{ + log_section "SRv6 VPN connectivity test among hosts in the same tenant" + + check_and_log_hs_connectivity 1 2 100 + check_and_log_hs_connectivity 2 1 100 +} + +router_netfilter_tests() +{ + log_section "SRv6 VPN connectivity test with netfilter enabled in routers" + setup_rt_netfilter 1 + setup_rt_netfilter 2 + + check_and_log_hs_connectivity 1 2 100 + check_and_log_hs_connectivity 2 1 100 +} + +if [ "$(id -u)" -ne 0 ];then + echo "SKIP: Need root privileges" + exit $ksft_skip +fi + +if [ ! -x "$(command -v ip)" ]; then + echo "SKIP: Could not run test without ip tool" + exit $ksft_skip +fi + +cleanup &>/dev/null + +setup + +host_tests +router_netfilter_tests + +print_log_test_results + +cleanup &>/dev/null + +exit ${ret} diff --git a/tools/testing/selftests/net/srv6_end_dx6_netfilter_test.sh b/tools/testing/selftests/net/srv6_end_dx6_netfilter_test.sh new file mode 100755 index 000000000000..9e69a2ed5bc3 --- /dev/null +++ b/tools/testing/selftests/net/srv6_end_dx6_netfilter_test.sh @@ -0,0 +1,340 @@ +#!/bin/bash +# SPDX-License-Identifier: GPL-2.0 +# +# author: Jianguo Wu <wujianguo@chinatelecom.cn> +# +# Mostly copied from tools/testing/selftests/net/srv6_end_dt6_l3vpn_test.sh. +# +# This script is designed for testing the support of netfilter hooks for +# SRv6 End.DX4 behavior. +# +# Hereafter a network diagram is shown, where one tenants (named 100) offer +# IPv6 L3 VPN services allowing hosts to communicate with each other across +# an IPv6 network. +# +# Routers rt-1 and rt-2 implement IPv6 L3 VPN services leveraging the SRv6 +# architecture. The key components for such VPNs are: a) SRv6 Encap behavior, +# b) SRv6 End.DX4 behavior. +# +# To explain how an IPv6 L3 VPN based on SRv6 works, let us briefly consider an +# example where, within the same domain of tenant 100, the host hs-1 pings +# the host hs-2. +# +# First of all, L2 reachability of the host hs-2 is taken into account by +# the router rt-1 which acts as an arp proxy. +# +# When the host hs-1 sends an IPv6 packet destined to hs-2, the router rt-1 +# receives the packet on the internal veth-t100 interface, rt-1 contains the +# SRv6 Encap route for encapsulating the IPv6 packet in a IPv6 plus the Segment +# Routing Header (SRH) packet. This packet is sent through the (IPv6) core +# network up to the router rt-2 that receives it on veth0 interface. +# +# The rt-2 router uses the 'localsid' routing table to process incoming +# IPv6+SRH packets which belong to the VPN of the tenant 100. For each of these +# packets, the SRv6 End.DX4 behavior removes the outer IPv6+SRH headers and +# routs the packet to the specified nexthop. Afterwards, the packet is sent to +# the host hs-2 through the veth-t100 interface. +# +# The ping response follows the same processing but this time the role of rt-1 +# and rt-2 are swapped. +# +# And when net.netfilter.nf_hooks_lwtunnel is set to 1 in rt-1 or rt-2, and a +# rpfilter iptables rule is added, SRv6 packets will go through netfilter PREROUTING +# hooks. +# +# +# +-------------------+ +-------------------+ +# | | | | +# | hs-1 netns | | hs-2 netns | +# | | | | +# | +-------------+ | | +-------------+ | +# | | veth0 | | | | veth0 | | +# | | cafe::1/64 | | | | cafe::2/64 | | +# | +-------------+ | | +-------------+ | +# | . | | . | +# +-------------------+ +-------------------+ +# . . +# . . +# . . +# +-----------------------------------+ +-----------------------------------+ +# | . | | . | +# | +---------------+ | | +---------------- | +# | | veth-t100 | | | | veth-t100 | | +# | | cafe::11/64 | +----------+ | | +----------+ | cafe::22/64 | | +# | +-------+-------+ | route | | | | route | +-------+-------- | +# | | table | | | | table | | +# | +----------+ | | +----------+ | +# | +--------------+ | | +--------------+ | +# | | veth0 | | | | veth0 | | +# | | 2001:11::1/64 |.|...|.| 2001:11::2/64 | | +# | +--------------+ | | +--------------+ | +# | | | | +# | rt-1 netns | | rt-2 netns | +# | | | | +# +-----------------------------------+ +-----------------------------------+ +# +# ~~~~~~~~~~~~~~~~~~~~~~~~~ +# | Network configuration | +# ~~~~~~~~~~~~~~~~~~~~~~~~~ +# +# rt-1: localsid table +# +----------------------------------------------------------------+ +# |SID |Action | +# +----------------------------------------------------------------+ +# |fc00:21:100::6004|apply SRv6 End.DX6 nh6 cafe::1 dev veth-t100 | +# +----------------------------------------------------------------+ +# +# rt-1: route table +# +---------------------------------------------------+ +# |host |Action | +# +---------------------------------------------------+ +# |cafe::2 |apply seg6 encap segs fc00:12:100::6004| +# +---------------------------------------------------+ +# |cafe::/64 |forward to dev veth_t100 | +# +---------------------------------------------------+ +# +# +# rt-2: localsid table +# +---------------------------------------------------------------+ +# |SID |Action | +# +---------------------------------------------------------------+ +# |fc00:12:100::6004|apply SRv6 End.DX6 nh6 cafe::2 dev veth-t100 | +# +---------------------------------------------------------------+ +# +# rt-2: route table +# +---------------------------------------------------+ +# |host |Action | +# +---------------------------------------------------+ +# |cafe::1 |apply seg6 encap segs fc00:21:100::6004| +# +---------------------------------------------------+ +# |cafe::/64 |forward to dev veth_t100 | +# +---------------------------------------------------+ +# + +# Kselftest framework requirement - SKIP code is 4. +ksft_skip=4 + +readonly IPv6_RT_NETWORK=2001:11 +readonly IPv6_HS_NETWORK=cafe +readonly SID_LOCATOR=fc00 + +PING_TIMEOUT_SEC=4 + +ret=0 + +PAUSE_ON_FAIL=${PAUSE_ON_FAIL:=no} + +log_test() +{ + local rc=$1 + local expected=$2 + local msg="$3" + + if [ ${rc} -eq ${expected} ]; then + nsuccess=$((nsuccess+1)) + printf "\n TEST: %-60s [ OK ]\n" "${msg}" + else + ret=1 + nfail=$((nfail+1)) + printf "\n TEST: %-60s [FAIL]\n" "${msg}" + if [ "${PAUSE_ON_FAIL}" = "yes" ]; then + echo + echo "hit enter to continue, 'q' to quit" + read a + [ "$a" = "q" ] && exit 1 + fi + fi +} + +print_log_test_results() +{ + if [ "$TESTS" != "none" ]; then + printf "\nTests passed: %3d\n" ${nsuccess} + printf "Tests failed: %3d\n" ${nfail} + fi +} + +log_section() +{ + echo + echo "################################################################################" + echo "TEST SECTION: $*" + echo "################################################################################" +} + +cleanup() +{ + ip link del veth-rt-1 2>/dev/null || true + ip link del veth-rt-2 2>/dev/null || true + + # destroy routers rt-* and hosts hs-* + for ns in $(ip netns show | grep -E 'rt-*|hs-*'); do + ip netns del ${ns} || true + done +} + +# Setup the basic networking for the routers +setup_rt_networking() +{ + local rt=$1 + local nsname=rt-${rt} + + ip netns add ${nsname} + + ip netns exec ${nsname} sysctl -wq net.ipv6.conf.all.accept_dad=0 + ip netns exec ${nsname} sysctl -wq net.ipv6.conf.default.accept_dad=0 + + ip link set veth-rt-${rt} netns ${nsname} + ip -netns ${nsname} link set veth-rt-${rt} name veth0 + + ip -netns ${nsname} addr add ${IPv6_RT_NETWORK}::${rt}/64 dev veth0 nodad + ip -netns ${nsname} link set veth0 up + ip -netns ${nsname} link set lo up + + ip netns exec ${nsname} sysctl -wq net.ipv6.conf.all.forwarding=1 +} + +setup_rt_netfilter() +{ + local rt=$1 + local nsname=rt-${rt} + + ip netns exec ${nsname} sysctl -wq net.netfilter.nf_hooks_lwtunnel=1 + ip netns exec ${nsname} ip6tables -t raw -A PREROUTING -m rpfilter --invert -j DROP +} + +setup_hs() +{ + local hs=$1 + local rt=$2 + local tid=$3 + local hsname=hs-${hs} + local rtname=rt-${rt} + local rtveth=veth-t${tid} + + # set the networking for the host + ip netns add ${hsname} + + ip -netns ${hsname} link add veth0 type veth peer name ${rtveth} + ip -netns ${hsname} link set ${rtveth} netns ${rtname} + ip -netns ${hsname} addr add ${IPv6_HS_NETWORK}::${hs}/64 dev veth0 nodad + ip -netns ${hsname} link set veth0 up + ip -netns ${hsname} link set lo up + + ip -netns ${rtname} addr add ${IPv6_HS_NETWORK}::${rt}${hs}/64 dev ${rtveth} + ip -netns ${rtname} link set ${rtveth} up + + ip netns exec ${rtname} sysctl -wq net.ipv6.conf.all.accept_dad=0 + ip netns exec ${rtname} sysctl -wq net.ipv6.conf.default.accept_dad=0 + + ip netns exec ${rtname} sysctl -wq net.ipv6.conf.${rtveth}.proxy_ndp=1 +} + +setup_vpn_config() +{ + local hssrc=$1 + local rtsrc=$2 + local hsdst=$3 + local rtdst=$4 + local tid=$5 + + local hssrc_name=hs-t${tid}-${hssrc} + local hsdst_name=hs-t${tid}-${hsdst} + local rtsrc_name=rt-${rtsrc} + local rtdst_name=rt-${rtdst} + local rtveth=veth-t${tid} + local vpn_sid=${SID_LOCATOR}:${hssrc}${hsdst}:${tid}::6004 + + ip -netns ${rtsrc_name} -6 neigh add proxy ${IPv6_HS_NETWORK}::${hsdst} dev ${rtveth} + + # set the encap route for encapsulating packets which arrive from the + # host hssrc and destined to the access router rtsrc. + ip -netns ${rtsrc_name} -6 route add ${IPv6_HS_NETWORK}::${hsdst}/128 \ + encap seg6 mode encap segs ${vpn_sid} dev veth0 + ip -netns ${rtsrc_name} -6 route add ${vpn_sid}/128 \ + via 2001:11::${rtdst} dev veth0 + + # set the decap route for decapsulating packets which arrive from + # the rtdst router and destined to the hsdst host. + ip -netns ${rtdst_name} -6 route add ${vpn_sid}/128 \ + encap seg6local action End.DX6 nh6 ${IPv6_HS_NETWORK}::${hsdst} dev veth-t${tid} +} + +setup() +{ + ip link add veth-rt-1 type veth peer name veth-rt-2 + # setup the networking for router rt-1 and router rt-2 + setup_rt_networking 1 + setup_rt_networking 2 + + # setup two hosts for the tenant 100. + # - host hs-1 is directly connected to the router rt-1; + # - host hs-2 is directly connected to the router rt-2. + setup_hs 1 1 100 + setup_hs 2 2 100 + + # setup the IPv4 L3 VPN which connects the host hs-1 and host hs-2. + setup_vpn_config 1 1 2 2 100 #args: src_host src_router dst_host dst_router tenant + setup_vpn_config 2 2 1 1 100 +} + +check_hs_connectivity() +{ + local hssrc=$1 + local hsdst=$2 + local tid=$3 + + ip netns exec hs-${hssrc} ping -6 -c 1 -W ${PING_TIMEOUT_SEC} \ + ${IPv6_HS_NETWORK}::${hsdst} >/dev/null 2>&1 +} + +check_and_log_hs_connectivity() +{ + local hssrc=$1 + local hsdst=$2 + local tid=$3 + + check_hs_connectivity ${hssrc} ${hsdst} ${tid} + log_test $? 0 "Hosts connectivity: hs-${hssrc} -> hs-${hsdst} (tenant ${tid})" +} + +host_tests() +{ + log_section "SRv6 VPN connectivity test among hosts in the same tenant" + + check_and_log_hs_connectivity 1 2 100 + check_and_log_hs_connectivity 2 1 100 +} + +router_netfilter_tests() +{ + log_section "SRv6 VPN connectivity test with netfilter enabled in routers" + setup_rt_netfilter 1 + setup_rt_netfilter 2 + + check_and_log_hs_connectivity 1 2 100 + check_and_log_hs_connectivity 2 1 100 +} + +if [ "$(id -u)" -ne 0 ];then + echo "SKIP: Need root privileges" + exit $ksft_skip +fi + +if [ ! -x "$(command -v ip)" ]; then + echo "SKIP: Could not run test without ip tool" + exit $ksft_skip +fi + +cleanup &>/dev/null + +setup + +host_tests +router_netfilter_tests + +print_log_test_results + +cleanup &>/dev/null + +exit ${ret} diff --git a/tools/testing/selftests/nolibc/Makefile b/tools/testing/selftests/nolibc/Makefile index 40dd95228051..3fbabab46958 100644 --- a/tools/testing/selftests/nolibc/Makefile +++ b/tools/testing/selftests/nolibc/Makefile @@ -152,7 +152,7 @@ CFLAGS_mips32be = -EB -mabi=32 CFLAGS_STACKPROTECTOR ?= $(call cc-option,-mstack-protector-guard=global $(call cc-option,-fstack-protector-all)) CFLAGS ?= -Os -fno-ident -fno-asynchronous-unwind-tables -std=c89 -W -Wall -Wextra \ $(call cc-option,-fno-stack-protector) \ - $(CFLAGS_$(XARCH)) $(CFLAGS_STACKPROTECTOR) + $(CFLAGS_$(XARCH)) $(CFLAGS_STACKPROTECTOR) $(CFLAGS_EXTRA) LDFLAGS := REPORT ?= awk '/\[OK\][\r]*$$/{p++} /\[FAIL\][\r]*$$/{if (!f) printf("\n"); f++; print;} /\[SKIPPED\][\r]*$$/{s++} \ diff --git a/tools/testing/selftests/nolibc/nolibc-test.c b/tools/testing/selftests/nolibc/nolibc-test.c index 94bb6e11c16f..093d0512f4c5 100644 --- a/tools/testing/selftests/nolibc/nolibc-test.c +++ b/tools/testing/selftests/nolibc/nolibc-test.c @@ -64,6 +64,14 @@ static const char *argv0; /* will be used by constructor tests */ static int constructor_test_value; +static const int is_nolibc = +#ifdef NOLIBC + 1 +#else + 0 +#endif +; + /* definition of a series of tests */ struct test { const char *name; /* test name */ @@ -607,7 +615,7 @@ int expect_strne(const char *expr, int llen, const char *cmp) static __attribute__((unused)) int expect_str_buf_eq(size_t expr, const char *buf, size_t val, int llen, const char *cmp) { - llen += printf(" = %lu <%s> ", expr, buf); + llen += printf(" = %lu <%s> ", (unsigned long)expr, buf); if (strcmp(buf, cmp) != 0) { result(llen, FAIL); return 1; @@ -621,6 +629,51 @@ int expect_str_buf_eq(size_t expr, const char *buf, size_t val, int llen, const return 0; } +#define EXPECT_STRTOX(cond, func, input, base, expected, chars, expected_errno) \ + do { if (!(cond)) result(llen, SKIPPED); else ret += expect_strtox(llen, func, input, base, expected, chars, expected_errno); } while (0) + +static __attribute__((unused)) +int expect_strtox(int llen, void *func, const char *input, int base, intmax_t expected, int expected_chars, int expected_errno) +{ + char *endptr; + int actual_errno, actual_chars; + intmax_t r; + + errno = 0; + if (func == strtol) { + r = strtol(input, &endptr, base); + } else if (func == strtoul) { + r = strtoul(input, &endptr, base); + } else { + result(llen, FAIL); + return 1; + } + actual_errno = errno; + actual_chars = endptr - input; + + llen += printf(" %lld = %lld", (long long)expected, (long long)r); + if (r != expected) { + result(llen, FAIL); + return 1; + } + if (expected_chars == -1) { + if (*endptr != '\0') { + result(llen, FAIL); + return 1; + } + } else if (expected_chars != actual_chars) { + result(llen, FAIL); + return 1; + } + if (actual_errno != expected_errno) { + result(llen, FAIL); + return 1; + } + + result(llen, OK); + return 0; +} + /* declare tests based on line numbers. There must be exactly one test per line. */ #define CASE_TEST(name) \ case __LINE__: llen += printf("%d %s", test, #name); @@ -942,6 +995,7 @@ int run_syscall(int min, int max) int ret = 0; void *p1, *p2; int has_gettid = 1; + int has_brk; /* <proc> indicates whether or not /proc is mounted */ proc = stat("/proc", &stat_buf) == 0; @@ -954,6 +1008,9 @@ int run_syscall(int min, int max) has_gettid = __GLIBC__ > 2 || (__GLIBC__ == 2 && __GLIBC_MINOR__ >= 30); #endif + /* on musl setting brk()/sbrk() always fails */ + has_brk = brk(0) == 0; + for (test = min; test >= 0 && test <= max; test++) { int llen = 0; /* line length */ @@ -969,9 +1026,9 @@ int run_syscall(int min, int max) CASE_TEST(kill_0); EXPECT_SYSZR(1, kill(getpid(), 0)); break; CASE_TEST(kill_CONT); EXPECT_SYSZR(1, kill(getpid(), 0)); break; CASE_TEST(kill_BADPID); EXPECT_SYSER(1, kill(INT_MAX, 0), -1, ESRCH); break; - CASE_TEST(sbrk_0); EXPECT_PTRNE(1, sbrk(0), (void *)-1); break; - CASE_TEST(sbrk); if ((p1 = p2 = sbrk(4096)) != (void *)-1) p2 = sbrk(-4096); EXPECT_SYSZR(1, (p2 == (void *)-1) || p2 == p1); break; - CASE_TEST(brk); EXPECT_SYSZR(1, brk(sbrk(0))); break; + CASE_TEST(sbrk_0); EXPECT_PTRNE(has_brk, sbrk(0), (void *)-1); break; + CASE_TEST(sbrk); if ((p1 = p2 = sbrk(4096)) != (void *)-1) p2 = sbrk(-4096); EXPECT_SYSZR(has_brk, (p2 == (void *)-1) || p2 == p1); break; + CASE_TEST(brk); EXPECT_SYSZR(has_brk, brk(sbrk(0))); break; CASE_TEST(chdir_root); EXPECT_SYSZR(1, chdir("/")); chdir(getenv("PWD")); break; CASE_TEST(chdir_dot); EXPECT_SYSZR(1, chdir(".")); break; CASE_TEST(chdir_blah); EXPECT_SYSER(1, chdir("/blah"), -1, ENOENT); break; @@ -1076,19 +1133,17 @@ int run_stdlib(int min, int max) CASE_TEST(strchr_foobar_z); EXPECT_STRZR(1, strchr("foobar", 'z')); break; CASE_TEST(strrchr_foobar_o); EXPECT_STREQ(1, strrchr("foobar", 'o'), "obar"); break; CASE_TEST(strrchr_foobar_z); EXPECT_STRZR(1, strrchr("foobar", 'z')); break; -#ifdef NOLIBC - CASE_TEST(strlcat_0); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 0), buf, 3, "test"); break; - CASE_TEST(strlcat_1); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 1), buf, 4, "test"); break; - CASE_TEST(strlcat_5); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 5), buf, 7, "test"); break; - CASE_TEST(strlcat_6); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 6), buf, 7, "testb"); break; - CASE_TEST(strlcat_7); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 7), buf, 7, "testba"); break; - CASE_TEST(strlcat_8); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 8), buf, 7, "testbar"); break; - CASE_TEST(strlcpy_0); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 0), buf, 3, "test"); break; - CASE_TEST(strlcpy_1); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 1), buf, 3, ""); break; - CASE_TEST(strlcpy_2); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 2), buf, 3, "b"); break; - CASE_TEST(strlcpy_3); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 3), buf, 3, "ba"); break; - CASE_TEST(strlcpy_4); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 4), buf, 3, "bar"); break; -#endif + CASE_TEST(strlcat_0); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 0), buf, 3, "test"); break; + CASE_TEST(strlcat_1); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 1), buf, 4, "test"); break; + CASE_TEST(strlcat_5); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 5), buf, 7, "test"); break; + CASE_TEST(strlcat_6); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 6), buf, 7, "testb"); break; + CASE_TEST(strlcat_7); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 7), buf, 7, "testba"); break; + CASE_TEST(strlcat_8); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 8), buf, 7, "testbar"); break; + CASE_TEST(strlcpy_0); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 0), buf, 3, "test"); break; + CASE_TEST(strlcpy_1); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 1), buf, 3, ""); break; + CASE_TEST(strlcpy_2); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 2), buf, 3, "b"); break; + CASE_TEST(strlcpy_3); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 3), buf, 3, "ba"); break; + CASE_TEST(strlcpy_4); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 4), buf, 3, "bar"); break; CASE_TEST(memcmp_20_20); EXPECT_EQ(1, memcmp("aaa\x20", "aaa\x20", 4), 0); break; CASE_TEST(memcmp_20_60); EXPECT_LT(1, memcmp("aaa\x20", "aaa\x60", 4), 0); break; CASE_TEST(memcmp_60_20); EXPECT_GT(1, memcmp("aaa\x60", "aaa\x20", 4), 0); break; @@ -1139,6 +1194,26 @@ int run_stdlib(int min, int max) CASE_TEST(limit_ptrdiff_min); EXPECT_EQ(1, PTRDIFF_MIN, sizeof(long) == 8 ? (ptrdiff_t) 0x8000000000000000LL : (ptrdiff_t) 0x80000000); break; CASE_TEST(limit_ptrdiff_max); EXPECT_EQ(1, PTRDIFF_MAX, sizeof(long) == 8 ? (ptrdiff_t) 0x7fffffffffffffffLL : (ptrdiff_t) 0x7fffffff); break; CASE_TEST(limit_size_max); EXPECT_EQ(1, SIZE_MAX, sizeof(long) == 8 ? (size_t) 0xffffffffffffffffULL : (size_t) 0xffffffffU); break; + CASE_TEST(strtol_simple); EXPECT_STRTOX(1, strtol, "35", 10, 35, -1, 0); break; + CASE_TEST(strtol_positive); EXPECT_STRTOX(1, strtol, "+35", 10, 35, -1, 0); break; + CASE_TEST(strtol_negative); EXPECT_STRTOX(1, strtol, "-35", 10, -35, -1, 0); break; + CASE_TEST(strtol_hex_auto); EXPECT_STRTOX(1, strtol, "0xFF", 0, 255, -1, 0); break; + CASE_TEST(strtol_base36); EXPECT_STRTOX(1, strtol, "12yZ", 36, 50507, -1, 0); break; + CASE_TEST(strtol_cutoff); EXPECT_STRTOX(1, strtol, "1234567890", 8, 342391, 7, 0); break; + CASE_TEST(strtol_octal_auto); EXPECT_STRTOX(1, strtol, "011", 0, 9, -1, 0); break; + CASE_TEST(strtol_hex_00); EXPECT_STRTOX(1, strtol, "0x00", 16, 0, -1, 0); break; + CASE_TEST(strtol_hex_FF); EXPECT_STRTOX(1, strtol, "FF", 16, 255, -1, 0); break; + CASE_TEST(strtol_hex_ff); EXPECT_STRTOX(1, strtol, "ff", 16, 255, -1, 0); break; + CASE_TEST(strtol_hex_prefix); EXPECT_STRTOX(1, strtol, "0xFF", 16, 255, -1, 0); break; + CASE_TEST(strtol_trailer); EXPECT_STRTOX(1, strtol, "35foo", 10, 35, 2, 0); break; + CASE_TEST(strtol_overflow); EXPECT_STRTOX(1, strtol, "0x8000000000000000", 16, LONG_MAX, -1, ERANGE); break; + CASE_TEST(strtol_underflow); EXPECT_STRTOX(1, strtol, "-0x8000000000000001", 16, LONG_MIN, -1, ERANGE); break; + CASE_TEST(strtoul_negative); EXPECT_STRTOX(1, strtoul, "-0x1", 16, ULONG_MAX, 4, 0); break; + CASE_TEST(strtoul_overflow); EXPECT_STRTOX(1, strtoul, "0x10000000000000000", 16, ULONG_MAX, -1, ERANGE); break; + CASE_TEST(strerror_success); EXPECT_STREQ(is_nolibc, strerror(0), "errno=0"); break; + CASE_TEST(strerror_EINVAL); EXPECT_STREQ(is_nolibc, strerror(EINVAL), "errno=22"); break; + CASE_TEST(strerror_int_max); EXPECT_STREQ(is_nolibc, strerror(INT_MAX), "errno=2147483647"); break; + CASE_TEST(strerror_int_min); EXPECT_STREQ(is_nolibc, strerror(INT_MIN), "errno=-2147483648"); break; case __LINE__: return ret; /* must be last */ diff --git a/tools/testing/selftests/nolibc/run-tests.sh b/tools/testing/selftests/nolibc/run-tests.sh index c0a5a7cea9fa..0446e6326a40 100755 --- a/tools/testing/selftests/nolibc/run-tests.sh +++ b/tools/testing/selftests/nolibc/run-tests.sh @@ -15,9 +15,10 @@ download_location="${cache_dir}/crosstools/" build_location="$(realpath "${cache_dir}"/nolibc-tests/)" perform_download=0 test_mode=system +CFLAGS_EXTRA="-Werror" archs="i386 x86_64 arm64 arm mips32le mips32be ppc ppc64 ppc64le riscv s390 loongarch" -TEMP=$(getopt -o 'j:d:c:b:a:m:ph' -n "$0" -- "$@") +TEMP=$(getopt -o 'j:d:c:b:a:m:peh' -n "$0" -- "$@") eval set -- "$TEMP" unset TEMP @@ -40,6 +41,7 @@ Options: -a [ARCH] Host architecture of toolchains to use (default: ${hostarch}) -b [DIR] Build location (default: ${build_location}) -m [MODE] Test mode user/system (default: ${test_mode}) + -e Disable -Werror EOF } @@ -66,6 +68,9 @@ while true; do '-m') test_mode="$2" shift 2; continue ;; + '-e') + CFLAGS_EXTRA="" + shift; continue ;; '-h') print_usage exit 0 @@ -153,7 +158,7 @@ test_arch() { exit 1 esac printf '%-15s' "$arch:" - swallow_output "${MAKE[@]}" "$test_target" V=1 + swallow_output "${MAKE[@]}" CFLAGS_EXTRA="$CFLAGS_EXTRA" "$test_target" V=1 cp run.out run.out."${arch}" "${MAKE[@]}" report | grep passed } diff --git a/tools/testing/selftests/openat2/Makefile b/tools/testing/selftests/openat2/Makefile index 254d676a2689..185dc76ebb5f 100644 --- a/tools/testing/selftests/openat2/Makefile +++ b/tools/testing/selftests/openat2/Makefile @@ -1,8 +1,18 @@ # SPDX-License-Identifier: GPL-2.0-or-later -CFLAGS += -Wall -O2 -g -fsanitize=address -fsanitize=undefined -static-libasan +CFLAGS += -Wall -O2 -g -fsanitize=address -fsanitize=undefined TEST_GEN_PROGS := openat2_test resolve_test rename_attack_test +# gcc requires -static-libasan in order to ensure that Address Sanitizer's +# library is the first one loaded. However, clang already statically links the +# Address Sanitizer if -fsanitize is specified. Therefore, simply omit +# -static-libasan for clang builds. +ifeq ($(LLVM),) + CFLAGS += -static-libasan +endif + +LOCAL_HDRS += helpers.h + include ../lib.mk -$(TEST_GEN_PROGS): helpers.c helpers.h +$(TEST_GEN_PROGS): helpers.c diff --git a/tools/testing/selftests/openat2/openat2_test.c b/tools/testing/selftests/openat2/openat2_test.c index 9024754530b2..5790ab446527 100644 --- a/tools/testing/selftests/openat2/openat2_test.c +++ b/tools/testing/selftests/openat2/openat2_test.c @@ -5,6 +5,7 @@ */ #define _GNU_SOURCE +#define __SANE_USERSPACE_TYPES__ // Use ll64 #include <fcntl.h> #include <sched.h> #include <sys/stat.h> diff --git a/tools/testing/selftests/powerpc/flags.mk b/tools/testing/selftests/powerpc/flags.mk index b909bee3cb2a..abb9e58d95c4 100644 --- a/tools/testing/selftests/powerpc/flags.mk +++ b/tools/testing/selftests/powerpc/flags.mk @@ -5,8 +5,5 @@ GIT_VERSION := $(shell git describe --always --long --dirty || echo "unknown") export GIT_VERSION endif -ifeq ($(CFLAGS),) -CFLAGS := -std=gnu99 -O2 -Wall -Werror -DGIT_VERSION='"$(GIT_VERSION)"' -I$(selfdir)/powerpc/include $(CFLAGS) +CFLAGS := -std=gnu99 -O2 -Wall -Werror -DGIT_VERSION='"$(GIT_VERSION)"' -I$(selfdir)/powerpc/include $(USERCFLAGS) export CFLAGS -endif - diff --git a/tools/testing/selftests/resctrl/cat_test.c b/tools/testing/selftests/resctrl/cat_test.c index c7686fb6641a..55315ed695f4 100644 --- a/tools/testing/selftests/resctrl/cat_test.c +++ b/tools/testing/selftests/resctrl/cat_test.c @@ -291,11 +291,30 @@ static int cat_run_test(const struct resctrl_test *test, const struct user_param return ret; } +static bool arch_supports_noncont_cat(const struct resctrl_test *test) +{ + unsigned int eax, ebx, ecx, edx; + + /* AMD always supports non-contiguous CBM. */ + if (get_vendor() == ARCH_AMD) + return true; + + /* Intel support for non-contiguous CBM needs to be discovered. */ + if (!strcmp(test->resource, "L3")) + __cpuid_count(0x10, 1, eax, ebx, ecx, edx); + else if (!strcmp(test->resource, "L2")) + __cpuid_count(0x10, 2, eax, ebx, ecx, edx); + else + return false; + + return ((ecx >> 3) & 1); +} + static int noncont_cat_run_test(const struct resctrl_test *test, const struct user_params *uparams) { unsigned long full_cache_mask, cont_mask, noncont_mask; - unsigned int eax, ebx, ecx, edx, sparse_masks; + unsigned int sparse_masks; int bit_center, ret; char schemata[64]; @@ -304,15 +323,8 @@ static int noncont_cat_run_test(const struct resctrl_test *test, if (ret) return ret; - if (!strcmp(test->resource, "L3")) - __cpuid_count(0x10, 1, eax, ebx, ecx, edx); - else if (!strcmp(test->resource, "L2")) - __cpuid_count(0x10, 2, eax, ebx, ecx, edx); - else - return -EINVAL; - - if (sparse_masks != ((ecx >> 3) & 1)) { - ksft_print_msg("CPUID output doesn't match 'sparse_masks' file content!\n"); + if (arch_supports_noncont_cat(test) != sparse_masks) { + ksft_print_msg("Hardware and kernel differ on non-contiguous CBM support!\n"); return 1; } diff --git a/tools/testing/selftests/riscv/sigreturn/sigreturn.c b/tools/testing/selftests/riscv/sigreturn/sigreturn.c index 62397d5934f1..ed351a1cb917 100644 --- a/tools/testing/selftests/riscv/sigreturn/sigreturn.c +++ b/tools/testing/selftests/riscv/sigreturn/sigreturn.c @@ -51,7 +51,7 @@ static int vector_sigreturn(int data, void (*handler)(int, siginfo_t *, void *)) asm(".option push \n\ .option arch, +v \n\ - vsetivli x0, 1, e32, ta, ma \n\ + vsetivli x0, 1, e32, m1, ta, ma \n\ vmv.s.x v0, %1 \n\ # Generate SIGSEGV \n\ lw a0, 0(x0) \n\ diff --git a/tools/testing/selftests/seccomp/seccomp_benchmark.c b/tools/testing/selftests/seccomp/seccomp_benchmark.c index b83099160fbc..94886c82ae60 100644 --- a/tools/testing/selftests/seccomp/seccomp_benchmark.c +++ b/tools/testing/selftests/seccomp/seccomp_benchmark.c @@ -194,14 +194,14 @@ int main(int argc, char *argv[]) ksft_set_plan(7); ksft_print_msg("Running on:\n"); - ksft_print_msg(""); + ksft_print_msg("%s", ""); system("uname -a"); ksft_print_msg("Current BPF sysctl settings:\n"); /* Avoid using "sysctl" which may not be installed. */ - ksft_print_msg(""); + ksft_print_msg("%s", ""); system("grep -H . /proc/sys/net/core/bpf_jit_enable"); - ksft_print_msg(""); + ksft_print_msg("%s", ""); system("grep -H . /proc/sys/net/core/bpf_jit_harden"); affinity(); diff --git a/tools/testing/selftests/seccomp/seccomp_bpf.c b/tools/testing/selftests/seccomp/seccomp_bpf.c index 783ebce8c4de..e3f97f90d8db 100644 --- a/tools/testing/selftests/seccomp/seccomp_bpf.c +++ b/tools/testing/selftests/seccomp/seccomp_bpf.c @@ -3954,6 +3954,60 @@ TEST(user_notification_filter_empty) EXPECT_GT((pollfd.revents & POLLHUP) ?: 0, 0); } +TEST(user_ioctl_notification_filter_empty) +{ + pid_t pid; + long ret; + int status, p[2]; + struct __clone_args args = { + .flags = CLONE_FILES, + .exit_signal = SIGCHLD, + }; + struct seccomp_notif req = {}; + + ret = prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0); + ASSERT_EQ(0, ret) { + TH_LOG("Kernel does not support PR_SET_NO_NEW_PRIVS!"); + } + + if (__NR_clone3 < 0) + SKIP(return, "Test not built with clone3 support"); + + ASSERT_EQ(0, pipe(p)); + + pid = sys_clone3(&args, sizeof(args)); + ASSERT_GE(pid, 0); + + if (pid == 0) { + int listener; + + listener = user_notif_syscall(__NR_mknodat, SECCOMP_FILTER_FLAG_NEW_LISTENER); + if (listener < 0) + _exit(EXIT_FAILURE); + + if (dup2(listener, 200) != 200) + _exit(EXIT_FAILURE); + close(p[1]); + close(listener); + sleep(1); + + _exit(EXIT_SUCCESS); + } + if (read(p[0], &status, 1) != 0) + _exit(EXIT_SUCCESS); + close(p[0]); + /* + * The seccomp filter has become unused so we should be notified once + * the kernel gets around to cleaning up task struct. + */ + EXPECT_EQ(ioctl(200, SECCOMP_IOCTL_NOTIF_RECV, &req), -1); + EXPECT_EQ(errno, ENOENT); + + EXPECT_EQ(waitpid(pid, &status, 0), pid); + EXPECT_EQ(true, WIFEXITED(status)); + EXPECT_EQ(0, WEXITSTATUS(status)); +} + static void *do_thread(void *data) { return NULL; @@ -4755,6 +4809,83 @@ TEST(user_notification_wait_killable_fatal) EXPECT_EQ(SIGTERM, WTERMSIG(status)); } +struct tsync_vs_thread_leader_args { + pthread_t leader; +}; + +static void *tsync_vs_dead_thread_leader_sibling(void *_args) +{ + struct sock_filter allow_filter[] = { + BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_ALLOW), + }; + struct sock_fprog allow_prog = { + .len = (unsigned short)ARRAY_SIZE(allow_filter), + .filter = allow_filter, + }; + struct tsync_vs_thread_leader_args *args = _args; + void *retval; + long ret; + + ret = pthread_join(args->leader, &retval); + if (ret) + exit(1); + if (retval != _args) + exit(2); + ret = seccomp(SECCOMP_SET_MODE_FILTER, SECCOMP_FILTER_FLAG_TSYNC, &allow_prog); + if (ret) + exit(3); + + exit(0); +} + +/* + * Ensure that a dead thread leader doesn't prevent installing new filters with + * SECCOMP_FILTER_FLAG_TSYNC from other threads. + */ +TEST(tsync_vs_dead_thread_leader) +{ + int status; + pid_t pid; + long ret; + + ret = prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0); + ASSERT_EQ(0, ret) { + TH_LOG("Kernel does not support PR_SET_NO_NEW_PRIVS!"); + } + + pid = fork(); + ASSERT_GE(pid, 0); + + if (pid == 0) { + struct sock_filter allow_filter[] = { + BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_ALLOW), + }; + struct sock_fprog allow_prog = { + .len = (unsigned short)ARRAY_SIZE(allow_filter), + .filter = allow_filter, + }; + struct tsync_vs_thread_leader_args *args; + pthread_t sibling; + + args = malloc(sizeof(*args)); + ASSERT_NE(NULL, args); + args->leader = pthread_self(); + + ret = pthread_create(&sibling, NULL, + tsync_vs_dead_thread_leader_sibling, args); + ASSERT_EQ(0, ret); + + /* Install a new filter just to the leader thread. */ + ret = seccomp(SECCOMP_SET_MODE_FILTER, 0, &allow_prog); + ASSERT_EQ(0, ret); + pthread_exit(args); + exit(1); + } + + EXPECT_EQ(pid, waitpid(pid, &status, 0)); + EXPECT_EQ(0, status); +} + /* * TODO: * - expand NNP testing diff --git a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/taprio.json b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/taprio.json index 12da0a939e3e..557fb074acf0 100644 --- a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/taprio.json +++ b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/taprio.json @@ -133,6 +133,50 @@ ] }, { + "id": "6f62", + "name": "Add taprio Qdisc with too short interval", + "category": [ + "qdisc", + "taprio" + ], + "plugins": { + "requires": "nsPlugin" + }, + "setup": [ + "echo \"1 1 8\" > /sys/bus/netdevsim/new_device" + ], + "cmdUnderTest": "$TC qdisc add dev $ETH root handle 1: taprio num_tc 2 queues 1@0 1@1 sched-entry S 01 300 sched-entry S 02 1700 clockid CLOCK_TAI", + "expExitCode": "2", + "verifyCmd": "$TC qdisc show dev $ETH", + "matchPattern": "qdisc taprio 1: root refcnt", + "matchCount": "0", + "teardown": [ + "echo \"1\" > /sys/bus/netdevsim/del_device" + ] + }, + { + "id": "831f", + "name": "Add taprio Qdisc with too short cycle-time", + "category": [ + "qdisc", + "taprio" + ], + "plugins": { + "requires": "nsPlugin" + }, + "setup": [ + "echo \"1 1 8\" > /sys/bus/netdevsim/new_device" + ], + "cmdUnderTest": "$TC qdisc add dev $ETH root handle 1: taprio num_tc 2 queues 1@0 1@1 sched-entry S 01 200000 sched-entry S 02 200000 cycle-time 100 clockid CLOCK_TAI", + "expExitCode": "2", + "verifyCmd": "$TC qdisc show dev $ETH", + "matchPattern": "qdisc taprio 1: root refcnt", + "matchCount": "0", + "teardown": [ + "echo \"1\" > /sys/bus/netdevsim/del_device" + ] + }, + { "id": "3e1e", "name": "Add taprio Qdisc with an invalid cycle-time", "category": [ diff --git a/tools/testing/selftests/timens/exec.c b/tools/testing/selftests/timens/exec.c index e40dc5be2f66..d12ff955de0d 100644 --- a/tools/testing/selftests/timens/exec.c +++ b/tools/testing/selftests/timens/exec.c @@ -30,7 +30,7 @@ int main(int argc, char *argv[]) for (i = 0; i < 2; i++) { _gettime(CLOCK_MONOTONIC, &tst, i); - if (abs(tst.tv_sec - now.tv_sec) > 5) + if (labs(tst.tv_sec - now.tv_sec) > 5) return pr_fail("%ld %ld\n", now.tv_sec, tst.tv_sec); } return 0; @@ -50,7 +50,7 @@ int main(int argc, char *argv[]) for (i = 0; i < 2; i++) { _gettime(CLOCK_MONOTONIC, &tst, i); - if (abs(tst.tv_sec - now.tv_sec) > 5) + if (labs(tst.tv_sec - now.tv_sec) > 5) return pr_fail("%ld %ld\n", now.tv_sec, tst.tv_sec); } @@ -70,7 +70,7 @@ int main(int argc, char *argv[]) /* Check that a child process is in the new timens. */ for (i = 0; i < 2; i++) { _gettime(CLOCK_MONOTONIC, &tst, i); - if (abs(tst.tv_sec - now.tv_sec - OFFSET) > 5) + if (labs(tst.tv_sec - now.tv_sec - OFFSET) > 5) return pr_fail("%ld %ld\n", now.tv_sec + OFFSET, tst.tv_sec); } diff --git a/tools/testing/selftests/timens/timer.c b/tools/testing/selftests/timens/timer.c index 5e7f0051bd7b..5b939f59dfa4 100644 --- a/tools/testing/selftests/timens/timer.c +++ b/tools/testing/selftests/timens/timer.c @@ -56,7 +56,7 @@ int run_test(int clockid, struct timespec now) return pr_perror("timerfd_gettime"); elapsed = new_value.it_value.tv_sec; - if (abs(elapsed - 3600) > 60) { + if (llabs(elapsed - 3600) > 60) { ksft_test_result_fail("clockid: %d elapsed: %lld\n", clockid, elapsed); return 1; diff --git a/tools/testing/selftests/timens/timerfd.c b/tools/testing/selftests/timens/timerfd.c index 9edd43d6b2c1..a4196bbd6e33 100644 --- a/tools/testing/selftests/timens/timerfd.c +++ b/tools/testing/selftests/timens/timerfd.c @@ -61,7 +61,7 @@ int run_test(int clockid, struct timespec now) return pr_perror("timerfd_gettime(%d)", clockid); elapsed = new_value.it_value.tv_sec; - if (abs(elapsed - 3600) > 60) { + if (llabs(elapsed - 3600) > 60) { ksft_test_result_fail("clockid: %d elapsed: %lld\n", clockid, elapsed); return 1; diff --git a/tools/testing/selftests/timens/vfork_exec.c b/tools/testing/selftests/timens/vfork_exec.c index beb7614941fb..5b8907bf451d 100644 --- a/tools/testing/selftests/timens/vfork_exec.c +++ b/tools/testing/selftests/timens/vfork_exec.c @@ -32,7 +32,7 @@ static void *tcheck(void *_args) for (i = 0; i < 2; i++) { _gettime(CLOCK_MONOTONIC, &tst, i); - if (abs(tst.tv_sec - now->tv_sec) > 5) { + if (labs(tst.tv_sec - now->tv_sec) > 5) { pr_fail("%s: in-thread: unexpected value: %ld (%ld)\n", args->tst_name, tst.tv_sec, now->tv_sec); return (void *)1UL; @@ -64,7 +64,7 @@ static int check(char *tst_name, struct timespec *now) for (i = 0; i < 2; i++) { _gettime(CLOCK_MONOTONIC, &tst, i); - if (abs(tst.tv_sec - now->tv_sec) > 5) + if (labs(tst.tv_sec - now->tv_sec) > 5) return pr_fail("%s: unexpected value: %ld (%ld)\n", tst_name, tst.tv_sec, now->tv_sec); } diff --git a/tools/testing/selftests/vDSO/Makefile b/tools/testing/selftests/vDSO/Makefile index d53a4d8008f9..98d8ba2afa00 100644 --- a/tools/testing/selftests/vDSO/Makefile +++ b/tools/testing/selftests/vDSO/Makefile @@ -1,35 +1,30 @@ # SPDX-License-Identifier: GPL-2.0 -include ../lib.mk - uname_M := $(shell uname -m 2>/dev/null || echo not) ARCH ?= $(shell echo $(uname_M) | sed -e s/i.86/x86/ -e s/x86_64/x86/) -TEST_GEN_PROGS := $(OUTPUT)/vdso_test_gettimeofday $(OUTPUT)/vdso_test_getcpu -TEST_GEN_PROGS += $(OUTPUT)/vdso_test_abi -TEST_GEN_PROGS += $(OUTPUT)/vdso_test_clock_getres +TEST_GEN_PROGS := vdso_test_gettimeofday +TEST_GEN_PROGS += vdso_test_getcpu +TEST_GEN_PROGS += vdso_test_abi +TEST_GEN_PROGS += vdso_test_clock_getres ifeq ($(ARCH),$(filter $(ARCH),x86 x86_64)) -TEST_GEN_PROGS += $(OUTPUT)/vdso_standalone_test_x86 +TEST_GEN_PROGS += vdso_standalone_test_x86 endif -TEST_GEN_PROGS += $(OUTPUT)/vdso_test_correctness +TEST_GEN_PROGS += vdso_test_correctness CFLAGS := -std=gnu99 -CFLAGS_vdso_standalone_test_x86 := -nostdlib -fno-asynchronous-unwind-tables -fno-stack-protector -LDFLAGS_vdso_test_correctness := -ldl + ifeq ($(CONFIG_X86_32),y) LDLIBS += -lgcc_s endif -all: $(TEST_GEN_PROGS) +include ../lib.mk $(OUTPUT)/vdso_test_gettimeofday: parse_vdso.c vdso_test_gettimeofday.c $(OUTPUT)/vdso_test_getcpu: parse_vdso.c vdso_test_getcpu.c $(OUTPUT)/vdso_test_abi: parse_vdso.c vdso_test_abi.c $(OUTPUT)/vdso_test_clock_getres: vdso_test_clock_getres.c + $(OUTPUT)/vdso_standalone_test_x86: vdso_standalone_test_x86.c parse_vdso.c - $(CC) $(CFLAGS) $(CFLAGS_vdso_standalone_test_x86) \ - vdso_standalone_test_x86.c parse_vdso.c \ - -o $@ +$(OUTPUT)/vdso_standalone_test_x86: CFLAGS +=-nostdlib -fno-asynchronous-unwind-tables -fno-stack-protector + $(OUTPUT)/vdso_test_correctness: vdso_test_correctness.c - $(CC) $(CFLAGS) \ - vdso_test_correctness.c \ - -o $@ \ - $(LDFLAGS_vdso_test_correctness) +$(OUTPUT)/vdso_test_correctness: LDFLAGS += -ldl diff --git a/tools/testing/selftests/vDSO/parse_vdso.c b/tools/testing/selftests/vDSO/parse_vdso.c index 413f75620a35..4ae417372e9e 100644 --- a/tools/testing/selftests/vDSO/parse_vdso.c +++ b/tools/testing/selftests/vDSO/parse_vdso.c @@ -55,14 +55,20 @@ static struct vdso_info ELF(Verdef) *verdef; } vdso_info; -/* Straight from the ELF specification. */ -static unsigned long elf_hash(const unsigned char *name) +/* + * Straight from the ELF specification...and then tweaked slightly, in order to + * avoid a few clang warnings. + */ +static unsigned long elf_hash(const char *name) { unsigned long h = 0, g; - while (*name) + const unsigned char *uch_name = (const unsigned char *)name; + + while (*uch_name) { - h = (h << 4) + *name++; - if (g = h & 0xf0000000) + h = (h << 4) + *uch_name++; + g = h & 0xf0000000; + if (g) h ^= g >> 24; h &= ~g; } diff --git a/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c b/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c index 8a44ff973ee1..27f6fdf11969 100644 --- a/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c +++ b/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c @@ -18,7 +18,7 @@ #include "parse_vdso.h" -/* We need a libc functions... */ +/* We need some libc functions... */ int strcmp(const char *a, const char *b) { /* This implementation is buggy: it never returns -1. */ @@ -34,6 +34,20 @@ int strcmp(const char *a, const char *b) return 0; } +/* + * The clang build needs this, although gcc does not. + * Stolen from lib/string.c. + */ +void *memcpy(void *dest, const void *src, size_t count) +{ + char *tmp = dest; + const char *s = src; + + while (count--) + *tmp++ = *s++; + return dest; +} + /* ...and two syscalls. This is x86-specific. */ static inline long x86_syscall3(long nr, long a0, long a1, long a2) { @@ -70,7 +84,7 @@ void to_base10(char *lastdig, time_t n) } } -__attribute__((externally_visible)) void c_main(void **stack) +void c_main(void **stack) { /* Parse the stack */ long argc = (long)*stack; diff --git a/tools/testing/selftests/wireguard/qemu/Makefile b/tools/testing/selftests/wireguard/qemu/Makefile index e95bd56b332f..35856b11c143 100644 --- a/tools/testing/selftests/wireguard/qemu/Makefile +++ b/tools/testing/selftests/wireguard/qemu/Makefile @@ -109,9 +109,9 @@ KERNEL_ARCH := x86_64 KERNEL_BZIMAGE := $(KERNEL_BUILD_PATH)/arch/x86/boot/bzImage QEMU_VPORT_RESULT := virtio-serial-device ifeq ($(HOST_ARCH),$(ARCH)) -QEMU_MACHINE := -cpu host -machine microvm,accel=kvm,pit=off,pic=off,rtc=off -no-acpi +QEMU_MACHINE := -cpu host -machine microvm,accel=kvm,pit=off,pic=off,rtc=off,acpi=off else -QEMU_MACHINE := -cpu max -machine microvm -no-acpi +QEMU_MACHINE := -cpu max -machine microvm,acpi=off endif else ifeq ($(ARCH),i686) CHOST := i686-linux-musl @@ -120,9 +120,9 @@ KERNEL_ARCH := x86 KERNEL_BZIMAGE := $(KERNEL_BUILD_PATH)/arch/x86/boot/bzImage QEMU_VPORT_RESULT := virtio-serial-device ifeq ($(subst x86_64,i686,$(HOST_ARCH)),$(ARCH)) -QEMU_MACHINE := -cpu host -machine microvm,accel=kvm,pit=off,pic=off,rtc=off -no-acpi +QEMU_MACHINE := -cpu host -machine microvm,accel=kvm,pit=off,pic=off,rtc=off,acpi=off else -QEMU_MACHINE := -cpu coreduo -machine microvm -no-acpi +QEMU_MACHINE := -cpu coreduo -machine microvm,acpi=off endif else ifeq ($(ARCH),mips64) CHOST := mips64-linux-musl |